Answer:
hello the molecules are missing from your question below are the Generic molecules : [tex]ABE_{3}[/tex] and [tex]AB_{3} E[/tex]
answer : It can be determined that both generic molecules are polar
It can be determined that both generic molecules have similar molecular shape
They have different Geometry
They differ in bond angles as well
Explanation:
The two generic molecules : [tex]ABE_{3}[/tex] and [tex]AB_{3} E[/tex]
comparing(similarities) these two generic molecules
It can be determined that both generic molecules are polar
It can be determined that both generic molecules have similar molecular shape
differences between the generic molecules
They have different Geometry
They differ in bond angles as well
Calculate the moles of Iron (Fe) in 3.8 x 10^{21} atoms of Iron. Please show your work
Answer: 6.31×10⁻³ moles Fe
Explanation:
To calculate moles when given atoms, we need to use Avogadro's number.
Avogadro's number: 6.022×10²³ atoms/mol
[tex](3.8*10^2^1 atoms)*\frac{mol}{6.022*10^2^3 atoms} =6.31*10^-^3 mols[/tex]
The atoms cancel out, and we are left with moles. There are 6.31×10⁻³ moles Fe.
When titrating a strong acid with a strong base, after the equivalence point is reached, the pH will be determined exclusively by: Select the correct answer below:
A) hydronium concentration
B) hydroxide concentration
C) conjugate base concentration
D) conjugate acid concentration
Answer:
B) hydroxide concentration
Explanation:
Hello,
In this case, since we are talking about strong both base and acid, since the base is the titrant and the acid the analyte, once the equivalence point has been reached, some additional base could be added before the experimenter realizes about it, therefore, since the titrant is a strong base, it completely dissociates in hydroxide ions and metallic ions which allows us to compute the pOH of the solution by known the hydroxide ions concentration.
After that, due to the fact that the pH is related with the pOH as shown below:
pH=14-pOH
We can directly compute the pH.
Best regards.
A sailor on a trans-Pacific solo voyage notices one day that if he puts 735.mL of fresh water into a plastic cup weighing 25.0g, the cup floats in the seawater around his boat with the fresh water inside the cup at exactly the same level as the seawater outside the cup (see sketch at right).
Calculate the amount of salt dissolved in each liter of seawater. Be sure your answer has a unit symbol, if needed, and round it to 2 significant digits.
You'll need to know that the density of fresh water at the temperature of the sea around the sailor is 0.999/gcm3. You'll also want to remember Archimedes' Principle, that objects float when they displace a mass of water equal to their own mass.
Answer:
Amount of salt in 1 L seawater = 34 g
Explanation:
According to Archimedes' principle, mass of freshwater and cup = mass of equal volume of seawater
mass of freshwater = density * volume
1 cm³ = 1 mL
mass of freshwater = 0.999 g/cm³ * 735 cm³ = 734.265 g
mass of freshwater + cup = 734.265 + 25 = 759.265 g
Therefore, mass of equal volume of seawater = 759.265 g
Volume of seawater displaced = 735 mL = 0.735 L (assuming the cup volume is negligible)
1 liter = 1000 cm³ = 1000 mL;
Density of seawater = mass / volume
Density of seawater = 759.265 g / 0.735 L = 1033.01 g/L
Density of freshwater in g/L = 0.999 g/ (1/1000) L = 999 g/L
mass of 1 Liter seawater = 1033.01 g
mass of 1 Liter freshwater = 999 g
mass of salt dissolved in 1 L of seawater = 1033.01 g - 999 g = 34.01 g
Therefore, amount of salt in 1 L seawater = 34 g
When the following molecular equation is balanced using the smallest possible integer coefficients, the values of these coefficients are: potassium hydrogen sulfate (aq) potassium hydroxide (aq) potassium sulfate (aq) water (l)\
Answer:
Explanation:
Answer:
1, 1, 1, 1
Explanation:
potassium hydrogen sulfate + potassium hydroxide ⟶ potassium sulfate + water(l)
KHSO₄ + KOH ⟶ K₂SO₄ + H₂O
1. Put a 1 in front of the most complicated-looking formula (K₂SO₄?):
KHSO₄ + KOH ⟶ 1K₂SO₄ + H₂O
2. Balance S:
We have fixed 1 S on the right. We need 1 S on the left. Put a 1 in front of KHSO₄ to fix it.
1KHSO₄ + KOH ⟶ 1K₂SO₄ + H₂O
3. Balance K:
We have fixed 2 K on the right and 1 K on the left. We need 1 more K on the left. Put a 1 in front of KOH.
1KHSO₄ + 1KOH ⟶ 1K₂SO₄ + H₂O
4. Balance O
We have fixed 4 O on the right and 5 O on the left. We need 1 more O on the right. Put a 1 in front of H₂O.
1KHSO₄ + 1KOH ⟶ 1K₂SO₄ + 1H₂O
Every formula has a coefficient. The equation should be balanced.
5. Check that atoms balance:
[tex]\begin{array}{ccc}\textbf{Atom} & \textbf{On the left} & \textbf{On the right}\\\text{K} & 2 &2\\\text{H} & 2 & 2\\\text{S} & 1 & 1\\\text{O}&5&5\\\end{array}[/tex]
It checks.
The coefficients are 1, 1, 1, 1.
If the heat of combustion for a specific compound is −1320.0 kJ/mol and its molar mass is 30.55 g/mol, how many grams of this compound must you burn to release 617.30 kJ of heat?
Answer:
14.297 g
Explanation:
From the question;
1 mo of the compound requires 1320.0 kJ
From the molar mass;
1 ml of the compound weighs 30.55g
How many grams requires 617.30kJ?
1 ml = 1320
x mol = 617.30
x = 617.30 / 1320
x = 0.468 mol
But 1 mol = 30.55
0.468 mol = x
x = 14.297 g
16. The concentration of a solution of potassium hydroxide is determined by titration with nitric
acid. A 30.0 mL sample of KOH is neutralized by 42.7 mL of 0.498 M HNO3. What is the
concentration of the potassium hydroxide solution?
Answer:
[tex]M_{base}=0.709M[/tex]
Explanation:
Hello,
In this case, since the reaction between potassium hydroxide and nitric acid is:
[tex]KOH+HNO_3\rightarrow KNO_3+H_2O[/tex]
We can see a 1:1 mole ratio between the acid and base, therefore, for the titration analysis, we find the following equality at the equivalence point:
[tex]n_{acid}=n_{base}[/tex]
That in terms of molarities and volumes is:
[tex]M_{acid}V_{acid}=M_{base}V_{base}[/tex]
Thus, solving the molarity of the base (KOH), we obtain:
[tex]M_{base}=\frac{M_{acid}V_{acid}}{V_{base}} =\frac{0.498M*42.7mL}{30.0mL}\\ \\M_{base}=0.709M[/tex]
Regards.
Hey. what is the difference between a boulder and a rock? ]
And bonus: what did the duck say when she bought lipstick?
Answer:
The difference between a rock and a boulder can be explained in terms of size and detachment. A rock is defined by geologists as an aggregate of minerals. A boulder is a type of rock, specifically a large detached one. All boulders are rocks, but not all rocks are boulders.
If 75.4 J of energy is absorbed by 0.25 mol of CCl4 at constant pressure, what is the change in temperature? The specific heat of CCl4 is 0.861 J/g·°C.
Answer:
ΔT = 2.28°C
Explanation:
Heat, H = 75.4J
Number of moles = 0.25 mol
Specific heat capacity, c = 0.861 J/g·°C
Change in temperature, ΔT = ?
These quantities are related by the following equation;
H = mc ΔT
Mass, m = Number of moles * Molar mass
m = 0.25mol * 153.82 g/mol
m = 38.455g
S back to the equation;
H = mc ΔT
Substituting the values;
75.4 = 38.455 * 0.861 * ΔT
ΔT = 75.4 / 33.11
ΔT = 2.28°C
The change in temperature is 2.28 °C
First, we will determine the mass of CCl₄ absorbed
From the given information,
Number of moles of CCl₄ absorbed = 0.25 mol
Using the formula
Mass = Number of moles × Molar mass
Molar mass of CCl₄ = 153.82 g/mol
∴ Mass of CCl₄ absorbed = 0.25 × 153.82
Mass of CCl₄ absorbed = 38.455 g
Now, using the formula
Q = mcΔT
Where Q is the quantity of heat
m is the mass
c is the specific heat of substance
and ΔT is the change in temperature
From the given information
Q = 75.4 J
c = 0.861 J/g.°C
Putting the parameters into the formula, we get
75.4 = 38.455 × 0.861 ×ΔT
75.4 = 33.109755 × ΔT
∴ ΔT = 75.4 ÷ 33.109755
ΔT = 2.28 °C
Hence, the change in temperature is 2.28 °C
Learn more here: https://brainly.com/question/13439286
If 1 mol of a pure triglyceride is hydrolyzed to give 2 mol of RCOOH, 1 mol of R'COOH, and 1 mol of glycerol, which of the following compounds might be the triglyceride?
CHOC(O)R
A. CHOC(O)R
CHOC(O)R
CH,OC(O)R
B. CHOC(O)R
CH2OC(O)R
CHOC(O)R
C. CHOC(O)R
CHOC(O)R
CHOC(O)R
D. CHOC(O)R
CHOC(O)R
Answer:
The correct option is C.
Note the full question and structure of the moleculesis found in the attachment below.
Explanation:
Triglycerides or triacylglycerols are non-polar, hydrophobic lipid molecules composed of three fatty acids linked by ester bonds to a molecule of glycerol.
The fatty acids linked to the glycerol molecule are denoted by R and may be of the same kind or different. when the R group is the same, the R is attached in all the three positions for ester bonding in the glycerol molecule but when they are different are denoted by R, R' and R'' respectively.
During the hydrolysis of triglycerides, the three fatty acids molecules are obtained as well as a glycerol molecule.
From the question, when 1 mole of the triglyceride is hydrolysed, 2 moles of RCOOH, 1 mole of R'COOH and 1 mole of glycerol is obtained. The triglyceride must then be composed of two fatty acids which are the same denoted by R, and a different fatty acid molecule denoted by R'.
The correct option therefore, is C
The following reaction, catalyzed by iridium, is endothermic at 700 K: CaO(s) + CH4(g) + 2H2O (g) → CaCO3 (s) + 4H2 (g) For the reaction mixture above at equilibrium at 700 K, how would the following changes affect the total quantity of CaCO3 in the reaction mixture once equilibrium is re-established?
a. Increasing the temperature
b. Adding calcium oxide (CaO)
c. Removing methane (CH4)
d. Increasing the total volume
e. Adding iridium
Answer:
A. Increasing the temperature will favor forward reaction and more CaCo3 formed.
B. More CaCo3 will be formed.
C. CaCo3 will decrease and more react ants formed.
D. Less CaCo3 will be formed.
E. Iridium is a catalyst so there is no effect
Explanation:
A. Temperature will increase because it's an endothermic reaction.
B. Adding Cao will favor forward reaction and more CaCo3 formed.
C. Removing methane, more react ants are formed and CaCo3 decreases.
D. Irridi is a catalyst so it has no effect on the CaCo3 but only speeds its rate of reaction.
Glucose is soluble in water. Why is cellulose, which is made up of glucose, insoluble in water?
.....................
Cellulose is insoluble in water which is made up of glucose because it possesses high inter and intramolecular hydrogen bonding between the hydroxyl groups of the neighboring chains.
What is the function of cellulose?Due to being insoluble in nature, it serves as the fundamental component of the cell membrane in the plant. This is why the cell wall of plant cells are made of cellulose.
The chains of the cellulose are strongly bonded to each other. So, it is very difficult for the molecules of water to rupture or destruct these bonds between the chains. It is a hydrogen bond cross-linked polymer and more complex than glucose.
Therefore, due to high inter and intramolecular hydrogen bonding between the hydroxyl groups of the neighboring chains, cellulose is insoluble in water.
To learn more about Cellulose, refer to the link:
https://brainly.com/question/1768072
#SPJ2
The gas with an initial volume of 24.0 L at a pressure of 565 torr is compressed until the volume is 16.0 L. What is the final pressure of the gas, assuming the temperature and amount of gas does not change
Answer:
848 torr
Explanation:
The only variables are the pressure and the volume, so we can use Boyle's Law.
p₁V₁ = p₂V₂
Data:
p₁ = 565 torr; V₁ = 24.0 L
p₂ = ?; V₂ = 16.0 L
Calculations:
[tex]\begin{array}{rcl}p_{1}V_{1} & = & p_{2}V_{2}\\\text{565 torr} \times \text{24.0 L} & = & p_{2} \times \text{16.0 L}\\\text{13 560 torr} & = & 16.0p_{2}\\p_{2} & = & \dfrac{\text{13 560 torr}}{16.0}\\\\& = &\textbf{848 torr}\\\end{array}\\\text{The final pressure of the gas is $\large \boxed{\textbf{848 torr}}$}[/tex]
Three bonding pairs around a central atom results in a ________. A. octahedral B. trigonal planar compound C. tetrahedral compound D. linear compound
Answer:
B
Explanation:
because it is a trigonal planar compound
Three bonding pairs around a central atom results in a trigonal planar compound. Option B is correct.
In a trigonal planar arrangement, the central atom is surrounded by three bonding pairs of electrons, forming a flat, triangular shape. The bond angles between the bonding pairs are approximately 120 degrees.
This molecular geometry is observed when a molecule has a central atom with three bonded pairs and no lone pairs. Examples of compounds with trigonal planar geometry include boron trifluoride (BF₃) as well as formaldehyde (H₂CO).
The other options are not correct for a molecule with three bonding pairs;
Octahedral refers to a molecular geometry with six bonding pairs around a central atom.
Tetrahedral corresponds to a molecular geometry with four bonding pairs around a central atom.
Linear represents a molecular geometry with two bonding pairs around a central atom.
Hence, B. is the correct option.
To know more about bonding pairs here
https://brainly.com/question/32421783
#SPJ2
how many moles of oxygen atoms are present in 0.4 moles of oxygen gas
Answer:
Each molecule of O2 is made up of 2 oxygen atoms. So 1 mole of O2 molecules is made up of 2 moles of oxygen atoms. Therefore 1 mole of oxygen gas contains 2 moles of oxygen atoms. And 0.4 moles of oxygen gas contains 0.8 moles of oxygen atoms.
There are 0.8 moles of oxygen atoms in 0.4 moles of oxygen gas.
Oxygen gas (O₂) consists of two oxygen atoms bonded together. Therefore, to determine the number of moles of oxygen atoms present in a given amount of oxygen gas, we can simply multiply the number of moles of oxygen gas by the number of oxygen atoms per molecule, which is 2.
Given that we have 0.4 moles of oxygen gas, we can calculate the number of moles of oxygen atoms as follows:
Number of moles of oxygen atoms = Number of moles of oxygen gas × Number of oxygen atoms per molecule
= 0.4 moles × 2
= 0.8 moles
Therefore, there are 0.8 moles of oxygen atoms present in 0.4 moles of oxygen gas.
This calculation is based on the stoichiometry of oxygen gas, which indicates that each molecule of O₂ contains two oxygen atoms. By considering the mole ratio between oxygen gas and oxygen atoms, we can determine the number of moles of oxygen atoms in a given quantity of oxygen gas.
To learn more about moles, here
https://brainly.com/question/34302357
#SPJ2
What would happen to the measured cell potentials if 30 mL solution was used in each half-cell instead of 25 mL
Answer:
The answer is "[tex]\bold{\log \frac{[0] mole}{[R]mole}}[/tex]"
Explanation:
[tex]E_{cell} =E_{cell}^{\circ} - \frac{0.0591}{n}= \log\frac{[0]}{[R]}\\[/tex]
In the above-given equation, we can see from [tex]E_{ceu}[/tex], of both oxidant [tex]conc^n[/tex]as well as the reactant were connected. however, weight decreases oxidant and reduction component concentration only with volume and the both of the half cells by the very same factor and each other suspend
[tex]\to \log \frac{\frac{\text{oxidating moles}}{25 \ ml}}{\frac{\text{moles of reduction}}{25 ml}} \ \ = \ \ \log \frac{\frac{\text{oxidating moles}}{30 \ ml}}{\frac{\text{moles of reduction}}{30 ml}} \\\\\\[/tex]
[tex]\to {\log \frac{[0] mole}{[R]mole}}[/tex]
The cell potential of the electrochemical reaction has been the same when the volume has been reduced from 30 mL to 25 mL in each half cells.
The cell potential has been given as the difference in the potential of the two half cells in the electrochemical reaction.
The two cells has been set with the concentration of solutions in the oxidation and reduction half cells.
Cell potential changeThe cell potential has been changed when there has been a change in the potential of the half cells.
The volume of 30 mL to the solution has been, resulting in the cell potential difference of x.
With the volume of 25 mL, there has been the difference in the potential being similar to the 30 mL solution, i.e. x.
Thus, the cell potential of the electrochemical reaction has been the same when the volume has been reduced from 30 mL to 25 mL in each half cells.
Learn more about cell potential, here:
https://brainly.com/question/1313684
Given the balanced chemical equation for the decomposition for INO, and the rate of disappearance of INO, write the expressions for the rates of appearance of I2 and NO.
2INO(g) → I2(g) + 2NO(g)
Reactant: Product(I2): Product(NO):
-∆[INO]/2∆t = ??/??
Answer:
rate of disappearance of -0.5d[INO]/dt
rate of appearance of I2 = d[I2]/dt
rate of appearance of No = 0.5*d[NO]/dt
Explanation:
According to chemical equilibrium, d[I₂]/dt and d[NO]/dt is the expressions for the rates of appearance of I₂ and NO respectively.
What is chemical equilibrium?Chemical equilibrium is defined as the condition which arises during the course of a reversible chemical reaction with no net change in amount of reactants and products.A reversible chemical reaction is the one wherein the products as soon as they are formed react together to produce back the reactants.
At equilibrium, the two opposing reactions which take place take place at equal rates and there is no net change in amount of the substances which are involved in the chemical reaction.At equilibrium, the reaction is considered to be complete . Conditions which are required for equilibrium are given by quantitative formulation.
Factors which affect chemical equilibrium are change in concentration , change in pressure and temperature and presence of catalyst.
Learn more about chemical equilibrium,here:
https://brainly.com/question/4289021
#SPJ6
Calculate the [H+] and pH of a 0.0010 M acetic acid solution. The Ka of acetic acid is 1.76×10−5. Use the method of successive approximations in your calculations.
Answer:
[tex][H^+]=0.000123M[/tex]
[tex]pH=3.91[/tex]
Explanation:
Hello,
In this case, dissociation reaction for acetic acid is:
[tex]CH_3COOH\rightleftharpoons CH_3COO^-+H^+[/tex]
For which the equilibrium expression is:
[tex]Ka=\frac{[CH_3COO^-][H^+]}{[CH_3COOH]}[/tex]
Which in terms of the reaction extent [tex]x[/tex] could be written as:
[tex]1.74x10^{-5}=\frac{x*x}{[CH_3COOH]_0-x}=\frac{x*x}{0.0010M-x}[/tex]
Thus, solving by using a solver or quadratic equation we obtain:
[tex]x_1=0.000123M\\\\x_2=-0.000141M[/tex]
And clearly the result is 0.000123M, which also equals the concentration of hydronium ion in solution:
[tex][H^+]=0.000123M[/tex]
Now, the pH is computed as follows:
[tex]pH=-log([H^+])=-log(0.000123)\\\\pH=3.91[/tex]
Best regards.
Given that π = n M R T, rearrange the equation to solve for V
Answer:
V= n/M
Explanation:
From;
π = nRT/V = MRT
Where;
n= number of moles
R= gas constant
T= absolute temperature
M= molar mass
V= volume of the solution
π= osmotic pressure
Thus;
nRT/V = MRT
nRT = VMRT
V= nRT/MRT
V= n/M
An element has 6 protons and 6 neutrons. What is the atomic number? What is its mass number?
Answer:
The atomic is 6, the mass number is 12
Explanation:
The element being described is Carbon.
The number of protons in the nucleus of an atom is called its atomic number, Z.
The number of protons pluss the number of neutronsin the nucleus of an atom gives the atom's mass number, A.
oxide. b) Silicon dio
43. What is the nature of an enzyme?
a) Vitamin. b) Lipid. c) Carbohydrate. d) Protein
44. Name the enzyme which catalyzes the oxidation-reduction reaction?
a) Transaminase. b) Glutamine synthetase. c) Phosphofructokinase. d) Oxidoreductase
nontido
Answer:
43) protein
44) oxidoreductase
When the equation MnO₄⁻ + I⁻ + H₂O → MnO₂ + IO₃⁻ is balanced in basic solution, what is the smallest whole-number coefficient for OH⁻?
Answer:
The smallest whole-number coefficient for OH⁻ is 2
Explanation:
Step 1: The equation redox reaction is divided into two half equations
Reduction half equation: MnO₄⁻ ----> MnO₂
Oxidation half-equation: I⁻ ---> IO₃⁻
Step 2: Next the atoms are balanced by adding OH⁻ ions and H₂O molecules to the appropriate side of each half equation;
MnO₄⁻ + 2H₂O ----> MnO₂ + 4OH⁻
I⁻ + 6OH⁻ ---> IO₃⁻ + 3H₂O
Step 3 : The charges are then balanced by adding electrons to the appropriate sides of each half equation
MnO₄⁻ + 2H₂O + 3e⁻ ----> MnO₂ + 4OH⁻
I⁻ + 6OH⁻ ---> IO₃⁻ + 3H₂O + 6e⁻
Step 4: Oxidation half equation is multiplied by 2 while reduction half equation is multiplied by 1 to balance the number of electrons gained and lost for the reaction
2MnO₄⁻ + 4H₂O + 6e⁻ ----> 2MnO₂ + 8OH⁻
I⁻ + 6OH⁻ ---> IO₃⁻ + 3H₂O + 6e⁻
Step 5 : addition of the two half equations to yield a net ionic equation
2MnO₄⁻ + I⁻ + H₂O ----> 2MnO₂ + IO₃⁻ + 2OH⁻
The smallest whole number coefficient for OH⁻ is 2
A redox reaction is divided into two half equations which are shown below:
Reduction half equation: MnO₄⁻ ----> MnO₂
Oxidation half-equation: I⁻ ---> IO₃⁻
Atoms are balanced by adding OH⁻ ions and H₂O molecules to the appropriate side of each half equation to make the equation complete ;
MnO₄⁻ + 2H₂O ----> MnO₂ + 4OH⁻
I⁻ + 6OH⁻ ---> IO₃⁻ + 3H₂O
The charges needs to be balanced and this is done by adding electrons to the appropriate sides of each half equation
MnO₄⁻ + 2H₂O + 3e⁻ ----> MnO₂ + 4OH⁻
I⁻ + 6OH⁻ ---> IO₃⁻ + 3H₂O + 6e⁻
The equation needs to be balanced by multiplying the oxidation half equation by 2 while reduction half equation is multiplied by 1 to balance the number of electrons on both sides of the equations.
2MnO₄⁻ + 4H₂O + 6e⁻ ----> 2MnO₂ + 8OH⁻
I⁻ + 6OH⁻ ---> IO₃⁻ + 3H₂O + 6e⁻
The two half equations are then added and written together to form a net ionic equation
2MnO₄⁻ + I⁻ + H₂O ----> 2MnO₂ + IO₃⁻ + 2OH⁻
The smallest whole-number coefficient for OH⁻ is therefore 2.
Read more on https://brainly.com/question/17156617
.) At 500 oC, cyclopropane, C3H6, rearranges to form propene. The reaction is first order with a rate constant of 6.7 x 10-4 s-1. If the initial concentration of C3H6 is 0.0500 M, (a) what is the molarity of C3H6 after 30 min
Answer:
0.015 M
Explanation:
For a first order reaction;
ln[A] =ln[A]o - kt
[A] = final concentration
[A]o =initial concentration
k= rate constant
t= time taken
ln[A] =ln[A]o - kt
ln[A] = ln(0.0500) - 6.7 x 10-4 (30 × 60)
ln[A] = -2.9957 - 1.206
ln[A] = -4.202
e^ln[A] = e^(-4.202)
A= 0.015 M
Name the following compound from the concise formula:______.
CH3CH(CH3)CHCHCH(CH3)CH2CH3
A. 2,4-dimethyl-3-heptene
B. 2,5-dimethyl-3-heptene
C. 3,5-dimethyl-3-heptene
D. 2,5-dimethyl-4-heptene
Answer:
B. 2,5-dimethyl-3-heptene
Explanation:
Answer:
B. 2,5-dimethyl-3-heptene
Explanation:
"How much NH4Cl, when present in 2.00 liters of 0.200 M ammonia, will give a solution with pH = 8.20? For NH3, Kb = 1.8 x 10-5"
Answer:
245.66g of NH₄Cl is the mass we need to add to obtain the desire pH
Explanation:
The mixture of NH3/NH4Cl produce a buffer. We can find the pH of a buffer using H-H equation:
pH = pKa + log [A⁻] / [HA]
Where [A⁻] is the molar concentration of the base, NH₃, and [HA] molar concentration of the acid, NH₄⁺. This molar concentration can be taken as the moles of each chemical
First, we need to find pKa of NH₃ using Kb. Then, the moles of NH₃ and finally replace these values in H-H equation to solve moles of NH₄Cl we need to obtain the desire pH.
pKa NH₃/NH₄⁺pKb = - log Kb
pKb = -log 1.8x10⁻⁵ = 4.74
pKa = 14 - pKb
pKa = 14 - 4.74
pKa = 9.26
Moles NH₃2.00L ₓ (0.200mol NH₃ / L) = 0.400 moles NH₃
H-H equation:pH = pKa + log [NH₃] / [NH₄Cl]
8.20 = 9.26 + log [0.400 moles] / [NH₄Cl]
-1.06 = log [0.400 moles] / [NH₄Cl]
0.0087 = [0.400 moles] / [NH₄Cl]
[NH₄Cl] = 0.400 moles / 0.0087
[NH₄Cl] = 4.59 moles of NH₄Cl we need to add to original solution to obtain a pH of 8.20. In grams (Using molar mass NH₄Cl=53.491g/mol):
4.59 moles NH₄Cl ₓ (53.491g / mol) =
245.66g of NH₄Cl is the mass we need to add to obtain the desire pH
What type of bonding is occuring in the compound below?
A. Covalent polar
B. Metallic
C. Ionic
D. Covalent nonpolar
Answer:
(B). it's metallic bonding
Consider the reaction: C(s) + O2(g)CO2(g) Write the equilibrium constant for this reaction in terms of the equilibrium constants, Ka and Kb, for reactions a and b below: a.) C(s) + 1/2 O2(g) CO(g) Ka b.) CO(g) + 1/2 O2(g) CO2(g) Kb
Answer:
A. Ka = [CO2] / [C] [O2]^1/2
B. Kb = [CO2] / [CO] [O2]^1/2
Explanation:
Equilibrium constant is simply defined as the ratio of the concentration of the products raised to their coefficient to the concentration of the reactants raised to their coefficient.
Now, we shall obtain the expression for the equilibrium constant for the reaction as follow:
A. Determination of the expression for equilibrium constant Ka.
This is illustrated below:
C(s) + 1/2 O2(g) <==> CO(g)
Ka = [CO2] / [C] [O2]^1/2
B. Determination of the expression for equilibrium constant Kb.
This is illustrated below:
CO(g) + 1/2 O2(g) <==> CO2(g)
Kb = [CO2] / [CO] [O2]^1/2
If for a particular process, ΔH=308 kJmol and ΔS=439 Jmol K, in what temperature range will the process be spontaneous?
Answer:
The process will be spontaneous above 702 K.
Explanation:
Step 1: Given data
Standard enthalpy of the reaction (ΔH°): 308 kJ/molStandard entropy of the reaction (ΔS°): 439 J/mol.KStep 2: Calculate the temperature range in which the process will be spontaneous
The reaction will be spontaneous when the standard Gibbs free energy (ΔG°) is negative. We can calculate ΔG° using the following expression.
ΔG° = ΔH° - T × ΔS°
When ΔG° < 0,
ΔH° - T × ΔS° < 0
ΔH° < T × ΔS°
T > ΔH°/ΔS°
T > (308,000 J/mol)/(439 J/mol.K)
T > 702 K
The process will be spontaneous above 702 K.
A 1 liter solution contains 0.436 M hypochlorous acid and 0.581 M potassium hypochlorite. Addition of 0.479 moles of barium hydroxide will: (Assume that the volume does not change upon the addition of barium hydroxide.)
Answer:
Exceed the buffer capacity and Raise the pH by several units
Explanation:
Options are:
Raise the pH slightly
Lower the pH slightly
Raise the pH by several units
Lower the pH by several units
Not change the pH
Exceed the buffer capacity
The hypochlorous acid, HClO, is in equilibrium with Hypochlorite ion (From potassium hypochlorite, ClO⁻) producing a buffer. Using H-H equation, pH of initial buffer is:
pH = pKa + log [ClO⁻] / [HClO]
pKa for hypochlorous acid is 7.53
pH = 7.53 + log [0.581M] / [0.436M]
pH = 7.65
Barium hydroxide reacts with HClO producing more ClO⁻, thus:
Ba(OH)₂ + 2HClO → 2ClO⁻ + 2H₂O
As 0.479 moles of Barium hdroxide are added. For a complete reaction you require 0.479mol * 2 = 0.958 moles of HClO
As you have just 0.436 moles (Volume = 1L),
The addition will:
Exceed the buffer capacityThe Ba(OH)₂ that reacts is:
0.436 moles HClO * (1mole (Ba(OH)₂ / 2 mol HClO) = 0.218 moles Ba(OH)₂ and will remain:
0.479 mol - 0.218 mol = 0.261 moles Ba(OH)₂
As 1 mole of Ba(OH)₂ contains 2 moles of OH⁻, moles of OH⁻ and molarity is:
0.261 moles* 2 = 0.522 moles OH⁻ = [OH⁻]
pOH = -log [OH⁻]
pOH = 0.28
And pH = 14 - pOH:
pH = 13.72
Thus, after the addition the pH change from 7.65 to 13.62:
Raise the pH by several units
The ceramic glaze on a red-orange Fiestaware plate is U2O3 and contains 50.1 grams of 238U, but very little 235U. (a) What is the activity of the plate (in Ci)
Answer:
The correct answer is 1.68 × 10⁻⁵ Ci
Explanation:
The activity of the uranium is determined by using the formula,
R = 0.693 N/t1/2 -------------- (i)
The number of atoms is, N = nNA
Here, NA is the Avogadro number and n is the number of moles. The value of n is m/M, that is, mass/molecular mass. Now the value of N becomes,
N = (m/M) NA
The m or mass of uranium given is 50.1 grams, and the molecular mass is 238 g/mol, now putting the values we get,
N = (50 g/238 g) (6.023 × 10²³) = 1.26 × 10²³
The half-life of 238U from year to second is,
t1/2 = (4.468 × 10⁸ year) (3.16 × 10⁷ s/ 1 year) = 1.412 × 10¹⁶ s
Substituting the values of t1/2 as 1.412 × 10¹⁶, and 1.26 × 10²³ for N in equation (i) we get,
R = 0.639 (1.26 × 10²³) / 1.412 × 10¹⁶ s
= 6.18 × 10⁶ Bq (2.7027 × 10⁻¹¹ Ci/1 Bq)
= 1.68 × 10⁻⁵ Ci
Hence, the activity of the plate is 1.68 × 10⁻⁵ Ci
Which term describes the repeated arrangement of the same molecule?
Answer:
1. C
Carbon atoms
2. C
CH3CH2OH
3. C
extended structure
AND 4. B
One grey sphere, four white spheres, one red sphere
TOOK THE QUIZ. YOUR WELCOME :))
The term which describe the repeated arrangement of same molecules is extended structure. Thus option D is correct.
What is extended structure?Extended structure can be defined as a structure in which the subunits are arranged in a repeating pattern and occur in a consistent ratio.
Sodium chloride and diamond are some of the example of extended structure.
The expanded or extended structure departs from the bilayer configuration, with well-separated hydrophilic and hydrophobic layers made up of propagating chains along the calixarene cavity axis are some characteristics.
Thus, the term which describe the repeated arrangement of same molecules is extended structure. Thus option D is correct.
To learn more about extended structure, refer to the link below:
https://brainly.com/question/21597101
#SPJ2
Your question is incomplete but probably your complete question was
Which term describes the repeated arrangement of the molecule?
A. Bonds
B. Atoms
C. Molecular Model
D. Extended Structure