Answer:
In order from lowest to highest:
Methane < Ethane < Chloroethene < Methanol
i.e: CH4 < CH3CH3 < CH3CH2OH < CH3CH2Cl
Explanation:
Compounds with stronger molecular fore have higher boiling points, thus making the molecules more difficult to pull apart. The presence of chains also increases the molecular dispersion. The dipole force of ethanol makes it have a very high boiling point.
I'm positive this explanation would suffice. Best of luck.
The order of increasing boiling points of the substances listed is; CH4 < CH3CH3 < CH3CH2Cl < CH3CH2OH.
Intermolecular interactions occur between molecules. The boiling point and melting points of substances depends on the nature and magnitude of intermolecular interaction between the molecules of the substance.
The order of increasing boiling points of the substances listed is as follows; CH4 < CH3CH3 < CH3CH2Cl < CH3CH2OH. CH3CH2OH has the highest boiling point due to intermolecular hydrogen bonds in the molecule. Though CH4 and CH3CH3 are both alkanes, CH3CH3 has a higher molecular mass and consequently greater dispersion forces and a higher boiling point.
Learn more: https://brainly.com/question/865531
Given the balanced chemical equation for the decomposition for INO, and the rate of disappearance of INO, write the expressions for the rates of appearance of I2 and NO.
2INO(g) → I2(g) + 2NO(g)
Reactant: Product(I2): Product(NO):
-∆[INO]/2∆t = ??/??
Answer:
rate of disappearance of -0.5d[INO]/dt
rate of appearance of I2 = d[I2]/dt
rate of appearance of No = 0.5*d[NO]/dt
Explanation:
According to chemical equilibrium, d[I₂]/dt and d[NO]/dt is the expressions for the rates of appearance of I₂ and NO respectively.
What is chemical equilibrium?Chemical equilibrium is defined as the condition which arises during the course of a reversible chemical reaction with no net change in amount of reactants and products.A reversible chemical reaction is the one wherein the products as soon as they are formed react together to produce back the reactants.
At equilibrium, the two opposing reactions which take place take place at equal rates and there is no net change in amount of the substances which are involved in the chemical reaction.At equilibrium, the reaction is considered to be complete . Conditions which are required for equilibrium are given by quantitative formulation.
Factors which affect chemical equilibrium are change in concentration , change in pressure and temperature and presence of catalyst.
Learn more about chemical equilibrium,here:
https://brainly.com/question/4289021
#SPJ6
A 2.87g sample of carbon reacts with hydrogen to form 3.41g of car fuel. What is the empirical formula of the car fuel?
Answer:
The empirical formulae for the car fuel is C4H9
A skydiver slows down from 65 m/s to 5 m/s by opening the parachute. If this
takes 0.75 seconds, what is the skydiver's acceleration?
A. 45 m/s2 up
B. 80 m/s2 up
C. 45 m/s2 down
D. 80 m/s2 down
Answer:
D. -80m/s^2
Explanation:
V = u + at
5 = 65 + a (0.75)
0.75a = -60
a = -60/0.75
a = -80m/s^2
Therefore, is decelerating at 80m/s^2
Answer:
[tex]\boxed {\boxed {\sf D. \ 80 \ m/s^2 \ down}}[/tex]
Explanation:
We are asked to find the acceleration of a skydiver. Acceleration is the change in velocity over the change in time, so the formula for calculating acceleration is:
[tex]a= \frac{v_f-v_i}{t}[/tex]
The skydiver was initially traveling 65 meters per second, then he slowed down to a final velocity of 5 meters per second. He slowed down in 0.75 seconds.
[tex]\bullet \ v_f = 5 \ m/s \\\bullet \ v_i= 65 \ m/s \\\bullet \ t= 0.75 \ s[/tex]
Substitute the values into the formula.
[tex]a= \frac{ 5 \ m/s - 65 \ m/s}{0.75 \ s}[/tex]
Solve the numerator.
[tex]a= \frac{-60 \ m/s}{0.75 \ s}[/tex]
Divide.
[tex]a= -80 \ m/s^2[/tex]
The acceleration of the skydiver is -80 meters per second squared or 80 meters per second squared down. The skydiver is slowing down or decelerating, so the acceleration is negative or down.
The valves in the heart open and close to move blood in between heart chambers. O a) three directions O b) two directions O c) four directions d) one direction
Answer:
im not sure but i think its four directions
Hi,
The valves in the heart open and close to move blood in between heart chambers.
Answer:
d) one direction
For the reaction CO2(g) + H2(g)CO(g) + H20(g)
∆H°=41.2 kJ and ∆S°=42.1 J/K
The standard free energy change for the reaction of 1.96 moles of Co2(g) at 289 K, 1 atm would be_________KJ.
This reaction is (reactant, product)___________ favored under standard conditions at 289 K.
Assume that ∆H° and ∆S° are independent of temperature.
Answer:
The ΔG° is 29 kJ and the reaction is favored towards reactant.
Explanation:
Based on the given information, the ΔH°rxn or enthalpy change is 41.2 kJ, the ΔS°rxn or change in entropy is 42.1 J/K or 42.1 * 10⁻³ kJ/K. The temperature given is 289 K. Now the Gibbs Free energy change can be calculated by using the formula,
ΔG° = ΔH°rxn - TΔS°rxn
= 41.2 kJ - 289 K × 42.1 × 10⁻³ kJ/K
= 41.2 kJ - 12.2 kJ
= 29 kJ
As ΔG° of the reaction is positive, therefore, the reaction is favored towards reactant.
What is the rate constant of a reaction if rate = 1 x 10-2 (mol/L)/s, [A] is 2 M,
[B] is 3 M, m = 2, and n = 1?
Answer:
[tex]0.10 \text{ L$^2$mol$^{-2}$s$^{-1}$}[/tex]
Explanation:
The general formula for a rate law is
[tex]\text{rate} = k\text{[A]}^m \text{[B]}^{n}[/tex]
With your numbers, the rate law becomes
1.2 mol·L⁻¹s⁻¹ = k(2 mol·L⁻¹)²(3 mol·L⁻¹)¹ = k × 4 mol²L⁻² × 3 mol·L⁻¹
= 12k mol³L⁻³
[tex]\\ k = \dfrac{\text{1.2 mol $\cdot$ L$^{-1}$s$^{-1}$} }{12\text{ mol$^{3}$L}^{-3}} = \mathbf{0.10} \textbf{ L$\mathbf{^2}$mol$^{\mathbf{-2}}$s$^{\mathbf{-1}}$}[/tex]
What are the correct half reactions for the following reaction: Cu2+ + Mg -> Cu + Mg2+
Answer:
Cu2 + 2Mg-> 2Cu+ Mg2
Explanation:
Balance the equation and make sure both the reactant and the products are the same
Hope it will be helpful
[tex]Cu^{+2} + 2Mg[/tex] -> [tex]2Cu + Mg^+2[/tex] is the correct half-reactions.
What is a balanced equation?A balanced equation is an equation for a chemical reaction in which the number of atoms for each element in the reaction and the total oxidation numbers is the same for both the reactants and the products.
[tex]Cu^{+2} + 2Mg[/tex] -> [tex]2Cu + Mg^+2[/tex] is the correct half-reactions.
Magnesium is oxidized because its oxidation state increased from 0 to +2 while Cu is reduced because its oxidation state decreased from +2 to 0.
Learn more about balanced equations here:
brainly.com/question/15052184
#SPJ5
clacium hydroxide is slightly soluable in water about 1 gram will dissolve in 1 liter what are the spectator ions in the reaction ions in the reaction of such a dilute solution of calcium hydroxide with hydrochloric acid
Answer:
Ca²⁺ and Cl⁻
Explanation:
In a chemical reaction, spectator ions are ions that are not involved in the reaction, that means are the same before and after the reaction.
In water, calcium hydroxide, Ca(OH)₂ is dissociated in Ca²⁺ and OH⁻. Also, hydrochloric acid, HCl, dissociates in H⁺ and Cl⁻. The reaction is:
Ca²⁺ + 2OH⁻ + 2H⁺ + 2Cl⁻ → 2H₂O + Ca²⁺ + 2Cl⁻
The ions that react are H⁺ and OH⁻ (Acid and base producing water)
And the ions that are not reacting, spectator ions, are:
Ca²⁺ and Cl⁻A critical reaction in the production of energy to do work or drive chemical reactions in biological systems is the hydrolysis of adenosine triphosphate, ATP, to adenosine diphosphate, ADP, as described by the reaction
ATP(aq)+H2O(l)→ADP(aq)+HPO2−4(aq) for which ΔGrxn=30.5 kJ/mol at 37.0∘C and pH 7.0.
Required:
Calculate the value of ΔGrxn in a biological cell in which [ATP]=5.0 mM, [ADP]=0.60 mM, and [HPO2−4]=5.0 mM
Answer:
ΔG = -49.64 KJ/mol
Explanation:
The actual free energy change of the reaction under the given conditions, ΔG is given by the formula below;
ΔG = ΔG'° + RT ln([ADP][HPO₂⁴⁻] / [ATP])
where ΔG'° = -30.5 KJ/mol; R = 8.315 J/mol.K; T = 37°C = 310 K; [ADP] = 5.0 mM = 0.005 M; [HPO₂⁴⁻] = 0.60 mM = 0.0006 M; [ATP] = 5.0 mM = 0.005 M
ΔG = -30.5 KJ/mol + (8.315 J/mol.K)(310 K) ln {(0.005)(0.0006)/(0.005)}
ΔG = -30.5 KJ/mol + (2.58 KJ/mol * -7.4186)
ΔG = -30.5 KJ/mol - 19.14 KJ/mol
ΔG = -49.64 KJ/mol
3. Write the following isotope in hyphenated form (e.g., "carbon-14”): Kr
a. Krypton-109
b. Krypton -37
c. Krypton -36
d. Krypton -73
Answer:
Krypton -73
Explanation:
There are 33 known isotopes of krypton (36Kr) with atomic mass numbers from 69 through 101.
Good luck!
Answer:
D. Krypton-73
Explanation:
An isotope of an element has the same atomic number and the same number of protons but a different number of neutrons and a different atomic weight. Krypton is the 36th element on the periodic table. It has 36 protons and 48 neutrons. Krypton-73 is one of 33 known isotopes of Krypton and is the only one that actually exists from the list of choices.
Hope that helps.
Calculate the [H+] and pH of a 0.0010 M acetic acid solution. The Ka of acetic acid is 1.76×10−5. Use the method of successive approximations in your calculations.
Answer:
[tex][H^+]=0.000123M[/tex]
[tex]pH=3.91[/tex]
Explanation:
Hello,
In this case, dissociation reaction for acetic acid is:
[tex]CH_3COOH\rightleftharpoons CH_3COO^-+H^+[/tex]
For which the equilibrium expression is:
[tex]Ka=\frac{[CH_3COO^-][H^+]}{[CH_3COOH]}[/tex]
Which in terms of the reaction extent [tex]x[/tex] could be written as:
[tex]1.74x10^{-5}=\frac{x*x}{[CH_3COOH]_0-x}=\frac{x*x}{0.0010M-x}[/tex]
Thus, solving by using a solver or quadratic equation we obtain:
[tex]x_1=0.000123M\\\\x_2=-0.000141M[/tex]
And clearly the result is 0.000123M, which also equals the concentration of hydronium ion in solution:
[tex][H^+]=0.000123M[/tex]
Now, the pH is computed as follows:
[tex]pH=-log([H^+])=-log(0.000123)\\\\pH=3.91[/tex]
Best regards.
An unknown compound has the following chemical formula:
Co(OH),
where x stands for a whole number.
Measurements also show that a certain sample of the unknown compound contains 5.1 mol of oxygen and 2.59 mol of cobalt.
Write the complete chemical formula for the unknown compound.
since we are given the moles for Co and O, we'll divide both of those moles by the lowest mole quantity, which is, in this case, 2.59. After dividing, we see that the ratio of O to Co is 2:1. So, for every 1 Co atom, there has to be 2 O atoms. we can then insert the 2 in for OH to satisfy this ratio.
What do you predict the chemical formula for the compound formed between calcium and sulfur?
Answer:
calcium donates two vanence electrons to sulfur atom to form Ca2+ ion and an S2+ - ion
If 75.4 J of energy is absorbed by 0.25 mol of CCl4 at constant pressure, what is the change in temperature? The specific heat of CCl4 is 0.861 J/g·°C.
Answer:
ΔT = 2.28°C
Explanation:
Heat, H = 75.4J
Number of moles = 0.25 mol
Specific heat capacity, c = 0.861 J/g·°C
Change in temperature, ΔT = ?
These quantities are related by the following equation;
H = mc ΔT
Mass, m = Number of moles * Molar mass
m = 0.25mol * 153.82 g/mol
m = 38.455g
S back to the equation;
H = mc ΔT
Substituting the values;
75.4 = 38.455 * 0.861 * ΔT
ΔT = 75.4 / 33.11
ΔT = 2.28°C
The change in temperature is 2.28 °C
First, we will determine the mass of CCl₄ absorbed
From the given information,
Number of moles of CCl₄ absorbed = 0.25 mol
Using the formula
Mass = Number of moles × Molar mass
Molar mass of CCl₄ = 153.82 g/mol
∴ Mass of CCl₄ absorbed = 0.25 × 153.82
Mass of CCl₄ absorbed = 38.455 g
Now, using the formula
Q = mcΔT
Where Q is the quantity of heat
m is the mass
c is the specific heat of substance
and ΔT is the change in temperature
From the given information
Q = 75.4 J
c = 0.861 J/g.°C
Putting the parameters into the formula, we get
75.4 = 38.455 × 0.861 ×ΔT
75.4 = 33.109755 × ΔT
∴ ΔT = 75.4 ÷ 33.109755
ΔT = 2.28 °C
Hence, the change in temperature is 2.28 °C
Learn more here: https://brainly.com/question/13439286
The ceramic glaze on a red-orange Fiestaware plate is U2O3 and contains 50.1 grams of 238U, but very little 235U. (a) What is the activity of the plate (in Ci)
Answer:
The correct answer is 1.68 × 10⁻⁵ Ci
Explanation:
The activity of the uranium is determined by using the formula,
R = 0.693 N/t1/2 -------------- (i)
The number of atoms is, N = nNA
Here, NA is the Avogadro number and n is the number of moles. The value of n is m/M, that is, mass/molecular mass. Now the value of N becomes,
N = (m/M) NA
The m or mass of uranium given is 50.1 grams, and the molecular mass is 238 g/mol, now putting the values we get,
N = (50 g/238 g) (6.023 × 10²³) = 1.26 × 10²³
The half-life of 238U from year to second is,
t1/2 = (4.468 × 10⁸ year) (3.16 × 10⁷ s/ 1 year) = 1.412 × 10¹⁶ s
Substituting the values of t1/2 as 1.412 × 10¹⁶, and 1.26 × 10²³ for N in equation (i) we get,
R = 0.639 (1.26 × 10²³) / 1.412 × 10¹⁶ s
= 6.18 × 10⁶ Bq (2.7027 × 10⁻¹¹ Ci/1 Bq)
= 1.68 × 10⁻⁵ Ci
Hence, the activity of the plate is 1.68 × 10⁻⁵ Ci
Which term describes the repeated arrangement of the same molecule?
Answer:
1. C
Carbon atoms
2. C
CH3CH2OH
3. C
extended structure
AND 4. B
One grey sphere, four white spheres, one red sphere
TOOK THE QUIZ. YOUR WELCOME :))
The term which describe the repeated arrangement of same molecules is extended structure. Thus option D is correct.
What is extended structure?Extended structure can be defined as a structure in which the subunits are arranged in a repeating pattern and occur in a consistent ratio.
Sodium chloride and diamond are some of the example of extended structure.
The expanded or extended structure departs from the bilayer configuration, with well-separated hydrophilic and hydrophobic layers made up of propagating chains along the calixarene cavity axis are some characteristics.
Thus, the term which describe the repeated arrangement of same molecules is extended structure. Thus option D is correct.
To learn more about extended structure, refer to the link below:
https://brainly.com/question/21597101
#SPJ2
Your question is incomplete but probably your complete question was
Which term describes the repeated arrangement of the molecule?
A. Bonds
B. Atoms
C. Molecular Model
D. Extended Structure
An SN2 reaction is a type of _____________ in which the nucleophile attacks the electrophile.
Answer:
A bimolecular nucleophilic substitution (SN2) reaction is a type of nucleophilic substitution whereby a lone pair of electrons on a nucleophile attacks an electron deficient electrophilic center and bonds to it, resulting in the expulsion of a leaving group.
Given that π = n M R T, rearrange the equation to solve for V
Answer:
V= n/M
Explanation:
From;
π = nRT/V = MRT
Where;
n= number of moles
R= gas constant
T= absolute temperature
M= molar mass
V= volume of the solution
π= osmotic pressure
Thus;
nRT/V = MRT
nRT = VMRT
V= nRT/MRT
V= n/M
An unknown gas diffuses 5 times slower than that of H2.The moleculer mass of unknown gas is??
Answer:
50.
Explanation:
We can write Graham's Law of Diffusion as:
(Rate 1)^2 = Molecular Mass 2
-------------- -------------------------
(Rate 2)^2 Molecular Mass 1
So using the Given Information:
1^2 / (1/5)^2 = Molecular Mass of unknown gas / 2, so:
25 = M/2
M = 50.
Hey. what is the difference between a boulder and a rock? ]
And bonus: what did the duck say when she bought lipstick?
Answer:
The difference between a rock and a boulder can be explained in terms of size and detachment. A rock is defined by geologists as an aggregate of minerals. A boulder is a type of rock, specifically a large detached one. All boulders are rocks, but not all rocks are boulders.
The two common properties of all solids are fixed _____ and _____.
Answer:
shape
volume
Hope this helps! （づ￣3￣）づ╭❤～
Explanation:
What is the molarity of 4 g of NaCl dissolved in 100mL of water?
Answer:
[tex]M=0.684M[/tex]
Explanation:
Hello,
In this case, considering that the solution is formed by NaCl as the solute and water as the solvent, we can compute the molarity as shown below:
[tex]M=\frac{mol_{solute}}{V_{solution}}[/tex]
Whereas the volume of the solution must be in liters. In such a way, since the addition of sodium chloride does not significantly changes the volume of the solution we can say it remains in 100 mL (0.100 L) and the moles of sodium chloride are computed by using its molar mass (58.45 g/mol):
[tex]mol_{solute}=4g*\frac{1mol}{58.45g} =0.0684mol[/tex]
Therefore, the molarity is:
[tex]M=\frac{0.0684mol}{0.100L} \\\\M=0.684\frac{mol}{L}=0.684M[/tex]
Regards.
Which of the following elements is in the same group as Sulfur (S)?
Answer:
PLEASE SHOW ME THE ELEMENTS OR I WOULD ENLIST ALL THE ELEMENTS.
Explanation:
Group 6A (or VIA) of the periodic table are the chalcogens: the nonmetals oxygen (O), sulfur (S), and selenium (Se), the metalloid tellurium (Te), and the metal polonium (Po)
Complete the following reactions
need answers?
i) P + [H]
ii) O2 + [H]
iii) LiH + H2O
iv) CaC2 +H2O
v) NaH + H2O
vi) CaH2 H2O
Answer:
this reaction will produce phosphineP+H---->PH
this reaction will produce waterO2+H---->H2O
this reaction will produce lithium hydroxide and hydrogen gasLiH+H2O---->LiOH+H2
this reaction will produce calcium hydroxide and acetylene gasCaC2+H2O---->Ca(OH)2+C2H2
this reaction will produce sodium hydroxide and hydrogen gasNaH+H2O---->NaOH+H2
this type of reaction will produce calcium hydroxide and hydrogen gasCaH2+H2O---->CaOH+H2
I hope this helps
What is the concentration of A after 50.7 minutes for the second order reaction A → Products when the initial concentration of A is 0.250 M? (k = 0.117 M⁻¹min⁻¹)
Answer:
0.101 M
Explanation:
Step 1: Given data
Initial concentration of A ([A]₀): 0.250 MFinal concentration of A ([A]): ?Time (t): 50.7 minRate constant (k): 0.117 M⁻¹.min⁻¹Step 2: Calculate [A]
For a second-order reaction, we can calculate [A] using the following expression.
1/[A] = 1/[A]₀ + k × t
1/[A] = 1/0.250 M + 0.117 M⁻¹.min⁻¹ × 50.7 min
[A] = 0.101 M
A compound is found to contain 11.21 % hydrogen and 88.79 % oxygen by mass. What is the empirical formula for this compound?
Answer:
H₂O
Explanation:
The empirical formular of the compound is obtained using the following steps;
Step 1: Divide the percentage composition by the atomic mass
Hydrogen = 11.21 / 1 = 11.21
Oxygen = 88.79 / 16 = 5.55
Step 2: Divide by the lowest number
Hydrogen = 11.21 / 5.55 = 2.02 ≈ 2
Oxygen = 5.55 / 5.55 = 1
This means the ratio of the elements is 2 : 1
The empirical formular (simplest formular of a compound) of the compound is;
H₂O
Answer:Empirical formula ======== H₂O
Explanation:The empirical formula of a compound shows the whole number ratio for each atom in a compound.
To find empirical formula. we follow the below steps
The total mass of the compound here is 100 grams, that is (11.21% of hydrogen + 88.79% of oxygen) we can then assume 11.21 grams of hydrogen and 88.79grams of oxygen
Hydrogen Oxygen
1.composition by mass 11.21 88.79
molecular weight 1.007g/mol 15.990g/mol
2.Divide composition by mass 11.21/1.007 88.79/15.99
by each molecular weight to get 11.13 5.553
no of moles
3 Divide by the least number of moles
to get atomic ratio 11.13/5.553 5.553/5.553
2.004 1.00
4.Convert to whole numbers 2 1
Empirical formula ======== H₂O
oxide. b) Silicon dio
43. What is the nature of an enzyme?
a) Vitamin. b) Lipid. c) Carbohydrate. d) Protein
44. Name the enzyme which catalyzes the oxidation-reduction reaction?
a) Transaminase. b) Glutamine synthetase. c) Phosphofructokinase. d) Oxidoreductase
nontido
Answer:
43) protein
44) oxidoreductase
Name the following compound from the concise formula:______.
CH3CH(CH3)CHCHCH(CH3)CH2CH3
A. 2,4-dimethyl-3-heptene
B. 2,5-dimethyl-3-heptene
C. 3,5-dimethyl-3-heptene
D. 2,5-dimethyl-4-heptene
Answer:
B. 2,5-dimethyl-3-heptene
Explanation:
Answer:
B. 2,5-dimethyl-3-heptene
Explanation:
When 1604 J of heat energy is added to 48.9 g of hexane, C6H14, the temperature increases by 14.5 ∘C. Calculate the molar heat capacity of C6H14.
Answer:
THE MOLAR HEAT CAPACITY OF HEXANE IS 290.027 J/ C
Explanation:
1604 J of heat is added to 48.9 g of hexane
To calculate the molar heat capacity of hexane, it is important to note that the molar heat capacity of a substance is the measure of the amount of heat needed to raise 1 mole of a substance by 1 K.
Since 1604 J of heat = 48.9 g of hexane
Molar mass of hexane = 86 g/mol = 1 mole
then;
1604 J = 48.9 g
x = 86 g
x = 1604 * 86 / 48.9
x = 4205.4 J
Hence, 4205.4 J of heat will be added to 1 mole or 86 g of hexane to raise the temperature by 14.5 C.
In other words,
heat = molar heat capacity * temperature change
molar heat capacity = heat/ temperature change
Molar heat capacity = 4205.4 J / 14.5 C
Molar heat capacity = 290.027 J/C
The molar heat capacity of hexane is 290.027 J/ C
Identify a homogeneous catalyst. Identify a homogeneous catalyst. Pd in H2 gas N2 and H2 catalyzed by Fe SO2 over vanadium (V) oxide Pt with methane H2SO4 with concentrated HCl
Answer:
H2SO4 with concentrated HCl