Chloe rolled 2 dice. Given that one die showed a 6, what is the probability that she rolled double 6? (Hint: Conditional Probability)

Answers

Answer 1

Answer:

1/6

Step-by-step explanation:

since they already tells us six has been rolled already, we depend on the second which can only show 1-6. There are six numbers so the answer is 1/6


Related Questions

Father's age is 3 times the sum of ages of his two children. After 5 years his age will be twice the sum of ages of two children. Find the age of father.​

Answers

Answer:

45 is the father's age

Step-by-step explanation:

Please answer this question now

Answers

Answer:

Surface Area = 85.75 ft²

Step-by-step explanation:

Surface area of pyramid = ½(Perimeter of triangular base * slant height of pyramid) + Area of triangular base

Perimeter of triangular base = sum of all sides of the triangular base = 5+5+5 = 15 ft

Slant height of pyramid = 10 ft

Area of triangular base = ½*base of triangle*height of triangle = ½*5*4.3 = 10.75 ft²

Plug in the above values:

Surface Area = ½(15*10) + 10.75

= (15*5) + 10.75

= 75 + 10.75

Surface Area = 85.75 ft²

What is the value of the expression below when x=3
10x²- 7x + 10

Answers

Answer: 79

Concept:

Here, we need to understand the idea of evaluation.  

When encountering questions that gave you an expression with variables, then stated: "If x = a, y = b, z = c" (a, b, c are all constants), this means you should substitute the value given for each variable back to the expression.

Solve:

Given information

10x² - 7x + 10

x = 3

Substitute the value into the expression

= 10 (3)² - 7 (3) + 10

Simplify by multiplication

= 10 (9) - 21 + 10

= 90 - 21 + 10

Simplify by subtraction

= 69 + 10

Simplify by addition

= 79

Hope this helps!! :)

Please let me know if you have any questions

Answer:

92

Step-by-step explanation:

The variable 'x' shows up twice in this expression.  Replace each instance of 'x' with 3:

10(3)^2 - 7(3) + 10  =  10(9) - 21 + 19  =  92

Evaluate the following expression.
10^7 + 9 + 1^3 =

Answers

Anjdjdnjadnosepsjkdsksksks

bzjd

find the perimeter of a square of length of 5cm​

Answers

Answer:

20cm

Step-by-step explanation:

If each side of the square = 5 cm, 5 cm times 4 sides = 20 cm.

Answer:

P=20cm

Step-by-step explanation:

To find the perimeter of a square, you just add all the four sides.

Because it says the sides are 5cm, and squares always have the same length, you just:

5+5+5+6=20cm

So, the perimeter of this square is 20cm.

Hope this helps, and have a nice day:)

A.) Pinky bought 1. 1/2 kg of apples and 5. 1/4 kg of mangoes 1. 1/2 kg of oranges. Find the total weight of fruits B.) if her family eats 3/4 kg of apples and 2. 1/2 kg of mangoes and 1/2 kg of oranges. Find the weight of fruits left (Please say the answer with explanation who says the answer first I will mark them as the brainliest)

Answers

Answer:

A. Total weight of the fruits is 2.25 kg

B. There are no more fruits left.

Step-by-step explanation:

A.

To get the total weight of the fruits, we will first of all have to sort out the fruits and multiply the weight of the fruits by the number available.

Weight of apples:

we have one 1apple weighing 1/2 kg. The weight will be 1 |X 1/2 = 1/2 kg

Weight of mangoes:

We have five mangoes weighing 1/4 kg. Total weight will be 5 X 1/4 = 5/4 kg

Weight of oranges:

We have one orange weighing 1/2 kg. Total weight will be 1X 1/2 = 1/2 kg

Total weight of the fruits will be total weight of Mangoes + oranges + apples

= 1/2 + 5/4 + 1/2 = 2.25kg

B.

If her family begins to eat off some portions of the fruits, we will have to calculate the sum total of all the weights of fruits eaten

The portion eaten will be 3/4 + (2 X 1/2) + 1/2 = 2.25kg

If this happens the family would have eaten all of the fruits because

the original weight present is only 2.25kg of fruits to start with

What is the cost of buying 5 kg of cheese worth
$9.00 per kg?

Answers

$45

Hope this helps you

Cost of 1 kg = $9

So, cost of 5 kg = $9 × 5 = $45

Find the values of the apple, banana and lollypop below.

Pls help

Answers

Answer:

a= Apple = 3

b= Banana =5

v= Lollypop=1

Step-by-step explanation:

36 is divided into 2 giving us 18

Let apple=a

Banana=b

Lollypop=c

In the first half

An apple + 3 bananas=18

a+3b=18 (1)

Second half is further divided into 2

That is,

18÷2=9

First half of the second half

3apples=9

3a=9 (2)

Second half of the second half

1 apple + 1 banana + 1 lollypop=9

a+b+c=9 (3)

a+3b=18 (1)

3a=9 (2)

a+b+c=9 (3)

From (2)

3a=9

Divide both sides by 3

a=9/3

a=3

Substitute a=3 into 1

a+3b=18

3+3b=18

3b=18-3

3b=15

Divide both sides by 3

b=15/3

=5

b=5

Substitute the value of a and b into (3)

a+b+c=9

3+5+c=9

8+c=9

c=9-8

c=1

Therefore,

a= Apple = 3

b= Banana =5

v= Lollypop=1

plz help thanks, will give brainliest!​

Answers

Answer:

D.

Step-by-step explanation:

[tex]\frac{x^{2/3}}{y^{-3/4}}[/tex]

= [tex]x^{2/3}y^{3/4}[/tex]

= [tex]\sqrt[3]{x^2} * \sqrt[4]{y^3}[/tex]

So, D is your answer.

Hope this helps!

Find the area of the circle.
Use 3.14 for n. Do not round your answer.
Hint: A = tr2
18 inches
Area = [?] inches
Enter the number that
belongs in the green box.

Answers

Answer: 254.34

Step-by-step explanation: 3.14(9*9)=254.34

-3x=3x+10 drnrjrjrjirjrjrjrjrje

Answers

Answer:

-1.666666...

Step-by-step explanation:

Algebra
factorize
a4 - 3a2b2 + b4​

Answers

Answer:

The term a⁴-3a²b²+b⁴ can't be factorised

If the measure of the base of a triangle is 3b+2 and the height is 4b,represent the area of the triangle

Answers

Answer:

6b^2 +4b

Step-by-step explanation:

The area of a triangle is

A = 1/2 bh

A = 1/2 * (3b+2) * (4b)

    =1/2 (12 b^2 +8b)

   = 6b^2 +4b

Can u guys answer my question 13 and 14 pls

Answers

Answer:

√2=1.414

then :√8 +2√32 +3√128+4√50

√8=√2³ =2√2

2√32=√2^5 = 4*2√2 = 8√2

3√128 = 3√2^6*2=8*3√2 =24√2

4√50 =4√5²*2= 20√2

add results : 2√2+8√2 +24√2+20√2=54√2

54√2=54×1.414=76.356 ( it is not in the options)

x=7-4√3

√x+ 1/√x

√(7-4√3) +1/√(7-4√3) =

(8-4√3)/√(7-4√3)

(8-6.93)/√(7-6.93) = 4 ( after rounded to the nearest whole number)

4 is your answer

The owner of an organic fruit stand also sells nuts. She wants to mix cashews worth $5.50 per pound with peanuts worth $2.30 per pound to get a 1/2 pound mixture that is worth $2.80 per pound. How much of each kind of nut should she include in the mixed bag?

Answers

Total weight required is half pound, so let the amount of cashews be [tex] a[/tex] , and amount of peanuts be $b$

$\therefore a+b=0.5$ (1)

And we want this to cost $2.80$

Cost of $a$ pound of cashews will be $5.50\times a$ and cost of $b$ pound peanuts will be $2.30\times b$

$\therefore 5.5a+2.3b=2.8$ (2)

Substitute $a=0.5-b$ from equation (1) in equation (2)

$5.5(0.5-b)+2.3b=2.8$

$\implies -3.2b=2.8+5.5\times0.5 $

$\implies -3.2b=0.05$

$b$ comes out to be negative. That means there's no solution with the given conditions.

I checked once , I don't think there's any mistake. Can someone else verify too?

EDIT

I verified all the given options from calculator, and no option gives 2.80

A giant pie is created in an attempt to break a world record for baking. The pie is shown below: A circle is shown with a central angle marked 38 degrees and the diameter marked 20 feet. What is the area of the slice of pie that was cut, rounded to the nearest hundredth? 22.08 ft2 13.19 ft2 33.14 ft2 28.97 ft2

Answers

Answer:

33.14 ft^2

Step-by-step explanation:

First find the area of the circle

The diameter is 20 ft so the radius is 1/2 of the diameter of 20*1/2 = 10 ft

A = pi r^2 = pi ( 10)^2 = 100 pi

The central angle is 38

That is a fraction of the circle, which is 360 degrees

38/360 = 19/180

Multiply the fraction of the circle by the area

19/180 * 100 pi

19/9 * 5 pi

Using 3.14 for pi

33.144444

To the nearest hundredth

33.14 ft^2

The area of the slice of pie that was cut, rounded to the nearest hundredth   33.14 ft^2.

We have to first find the area of the circle.

The diameter is 20 ft so the radius is 1/2 of the diameter of

20*1/2 = 10 ft.

What is the area of the circle?

The area of a circle [tex]A = \pi r^2[/tex]

By using the formula we have,

A= pi ( 10)^2

A = 100 pi

The central angle is 38.

That is a fraction of the circle, which is 360 degrees

38/360 = 19/180

Multiply the fraction of the circle by the area

19/180 * 100 pi

19/9 * 5 pi

Using 3.14 for pi

33.144444

To the nearest hundredth, it is 33.14 ft^2.

To learn more about the circle visit:

https://brainly.com/question/24375372

Sylvia burns 6 calories per minute when she runs, How many calories does she burn when
she runs for 15 minutes?

Answers

Answer: 90 calories

15 x 6 = 90

how to solve 2x+5/6=x/18

Answers

2x + 5/6 = x/18
- 5/6 = x/18 - 5/6
——————————-
2x = x-15
——-
18
———————————

2x x 18 = x-15. x18
——-
18
———————————-

X = -3/7

Of the 40 specimens of bacteria in a dish, 3 specimens have a certain trait. If 5 specimens are to be selected from the dish at random and without replacement, which of the following represents the probability that only 1 of the 5 specimens selected will have the trait?1) (5/1)/(40/3)
2) (5/1)/(40/5)
3) (40/3)/(40/5)
4) (3/1)(37/4)/(40/3)
5) (3/1)(37/4)/(40/5)

Answers

Answer:

[tex]\frac{(^3_1)*(^{37}_4)}{(^{40}_5)}[/tex]

Step-by-step explanation:

The total number of ways in which 5 specimens can be selected from the  dish at random is given as C(40, 5).

Since only one of the five specimens would have the trait, the number of ways of selecting the one specimen out of the 3 specimens with the trait is C(3, 1).

3 specimens have the trait therefore 37 specimens (40 - 3) do not have the trait. The number of ways in which the remaining 4 specimens out of the 5 spemimens that do not have the trait is C(37, 4).

Therefore, the probability that only 1 of the 5 specimens selected will have the trait = [tex]\frac{C(3,1)*C(37,4)}{C(40,5)} =\frac{(^3_1)*(^{37}_4)}{(^{40}_5)}[/tex]

Please help me get the answers

Answers

Answer:

1. (4)

2. (2)

Step-by-step explanation:

Choose the best answer that represents the property used to rewrite the
expression.

log root(12, 125x ^ 3) = 1/4 * log 5x

Answers

Answer:

commutative properties

If f(x) = 3x + 2 and g(x) = x2 + 1, which expression is equivalent to (fog)(x)?
(3x + 2)(x2 + 1)
O 3x 2 + 1 + 2
(3x + 2)2 + 1
3(x2 + 1) + 2

Answers

Answer:

This means you would plug in g(x) into f(x).

Step-by-step explanation:

It would look like this:

[tex]3(x^{2} + 1) + 2[/tex]

Write and solve an inequality for x.
I will give BRAINLIEST TO ANYONE WHO ANSWERS CORRECTLY!

Answers

Answer:

A

Step-by-step explanation:

So, we are given a right triangle and we know that 2x+4 is the length of the hypotenuse and 8 is the length of one of the sides.

Remember that the hypotenuse in a right triangle will always always be the longest side. Therefore, we can write the following inequality:

[tex]2x+4>8\\2x>4\\x>2[/tex]

The answer is A.

Answer:x>2

Step-by-step explanation:

2x+4>8

2x>8-4

2x>4

x>4/2

x>2

really need help to do step by step

Answers

Answer:

8. x = -32

Step-by-step explanation:

1/4x + 10 = 2

Step 1. Subtract 10 from both sides

1/4x = -8

Step 2. Solve for x

Since we’re trying to isolate the variable, convert 1/4 to a decimal

1/4 = 0.25

Then solve for x

x = -8/0.25

x = -32

Answer:

x/4+10=2

x/4=2-10

x/4=-8

x=-8 x 4

x=-32

Step-by-step explanation:

please solve this

.............​

Answers

Answer:

D

Step-by-step explanation:

Note that I will be using a, b, and y instead of their Greek counterparts.

First, we know that sin(c+d) = sin(c)cos(d) + cos(d)sin(a) and sin(c-d) = sin(c)cos(d) - cos(d)sin(a). We can apply these here to get

sin(b+y) = sin(b)cos(y) + cos(b)sin(y)

sin(b-y) = sin(b)cos(y) - cos(b)sin(y)

sin(a+y) = sin(a)cos(y) + cos(a)sin(y)

sin(a-y) = sin(a)cos(y) - cos(a)sin(y)

Plugging these into our equation, we get

(sin(b)cos(y) + cos(b)sin(y) - (sin(b)cos(y) - cos(b)sin(y)))

/

(sin(a)cos(y) + cos(a)sin(y)-(sin(a)cos(y) - cos(a)sin(y)))

=

2cos(b)sin(y) / 2cos(a)sin(y)

= cos(b)sin(y)/cos(a)sin(y)

= cos(b)/cos(a)

Next, we can see that a+b = π, so we can subtract b from both sides to get a = π -b. Plugging that in for a in our equation, we get

cos(b) / cos(π-b)

After that, we know that cos(c-d) = cos(c)cos(d) - sin(c)sin(d). Plugging that in here, we get

cos(π-b) = cos(π)cos(b) - sin(π)sin(b)

= -cos(b) + 0

= -cos(b)

Plugging that back into our equation, we get

cos(b) / -cos(b) = -1

HELPPP MEEE

Ying was planning how to seat guests at a dinner. There were between 50 and 100 people coming. Ying noticed that they could be seated with 8 people to a table and no seats left empty. She also noticed that they could be seated with 12 people to a table with no seats left empty. How many people were coming?

Answers

Answer:

96 people were coming

Step-by-step explanation:

In this question, we want to determine the number of people who were coming to the party.

First of all, we were made to know that this number is between 50 and 100. So whatever figure we will be giving as answer will be something within that range.

We were told that if 8 or 12 people sat at a table, there would be no remainder left. So basically what we need to do here is to calculate the highest multiple of 8 and 12 which is between 50 and 100.

we could have 24, 48 and 96 as multiples of both. But that multiple that sits between 50 and 100 is 96. So therefore, our answer is 96.

Given that line a is parallel to line b and that line c isparallel to line d, if m<13 = (12x – 22)° and m<14 = (9x – 29)°, find m<2

Answers

Answer:

∠ 2 = 70°

Step-by-step explanation:

∠ 13 and ∠ 14 are adjacent angles and sum to 180° , then

12x - 22 + 9x - 29 = 180

21x - 51 = 180 ( add 51 to both sides )

21x = 231 ( divide both sides by 21 )

x = 11

Then

∠ 14 = 9x - 29 = 9(11) - 29 = 99 - 29 = 70°

∠ 7 = ∠ 14 = 70° ( Alternate angles )

∠ 2 = ∠ 7 = 70° ( Alternate angles )

Question 2 Multiple Choice Worth 5 points)
(03.01 LC)
The leg of a right triangle is 2 units and the hypotenuse is 4 units. What is the length, in units, of the other leg of the triangle?
O2 units
0 6 units
O V12 units
O V20 units

Answers

Answer:

√20 units.

Step-by-step explanation:

Please see attached photo for diagram.

The other leg of the triangle is x as shown in the attached photo.

Using the pythagoras theory, we can obtain the the value of x as follow:

x² = 4² + 2²

x² = 16 + 4

x² = 20

Take the square root of both side.

x = √20 units

Therefore, the value of the other leg x of the triangle is √20 units

Answer:

[tex]\sqrt{} 20[/tex] is your answer hope this helps

Step-by-step explanation:

Mr Lim, Mr Tan and Mr Chan have $8650 altogether. Mr Lim has $450 more than Mr Tan. Mr Chan has twice as much money as Mr Tan. How much money does Mr Lim have?​

Answers

Answer:

Mr. Lim will have $2500

Step-by-step explanation:

Given:

The total amount of money which Mr. Lim, Mr. Tan and Mr. Chan is $8650;

Mr. Lim has $450 more than what Mr. Tan has;

Mr. Chan has double the amount of money than what Mr. Tan has.

Therefore, if we assume that the amount of money Mr. Tan has as x, then...

Total money = Mr. Tan + Mr. Lim + Mr. Chan

therefore,

8650 = x + (x + 450) + 2x

8650 = x + 2x + x + 450

8650 = 4x + 450

8650 - 450 = 4x

8200 = 4x

8200/4 = x

2050 = x

As we assumed earlier, x will be equal to the amount of money Mr. Tan has and the question is asking us how much money Mr. Lim has. To find this out, you have to add $450 to the amount of money Mr. Tan has which is $2050. This is because the question also gives us that Mr. Lim has $450 more that Mr. Tan.

I hope this helped you :)

Given that p=x^2-y^2/x^2+xy
I. Express p in the simplest form
ii. Find the value of p, if x=-4 and y=-6

Answers

Answer:

When x = -4 and y = -6, p = 37.75

Step-by-step explanation:

Given that p = x² - y²/x² + x·y, we have;

p = (x² × x² -y² + x·y×x²)/x²

p = (x²⁺² - y² + x¹⁺² × y)/x²

p = (x⁴ - y² + x³·y)/x²

Therefore, p in the simplest form is given as follows;

[tex]p = \dfrac{x^4 - y^2 + x^3 \cdot y }{x^2}[/tex]

To find the value of p when x = -4 and y = -6, we plug in the value of x and y into the above equation to get the following equation;

[tex]p = \dfrac{(-4)^4 - (-6)^2 + (-4)^3 \cdot (-6) }{(-4)^2} = 37.75[/tex]

Therefore, the value of p when x = -4 and y = -6 is equal to 37.75.

Other Questions
southerns who were for redemption wanted which of the following What can you tell about google's Promotional Mix and Promotional strategies ?(10 Marks) Evening news was one of the newspaper in the struggle for Ghana's independence... who was the publisher? A wittig reaction occurs when 4-methylbenzaldehyde and benzyltriphenylphosphonium chloride are stirred together at room temperature in the presence of sodium hydroxide base. Draw the major isomer produced by this reaction. Help!!! please!!! Confused! A car advertisement claims that a certain car can accelerate from rest to 70 km/hr in 7 seconds find the car acceleration Consider a network that is a rooted tree, with the root as its source, the leaves as its sinks, and all the edges directed along the paths from the root to the leaves. Design an efficient algorithm for finding a maximum flow in such a network. What is the time efficiency of your algorithm What meaning is revealed through the use of an analogy in this cartoon? MATH QUESTION: Julie bought a bag of parsnips that weighed 4 2/7 pounds. She also bought a bag of turnips that weighed 1 1/3 times as much as the parsnips. How many pounds of turnips did Julie buy? Express your answer as a simplified mixed number. You spend $7.00 at the store. The sales tax is 6%. How much is your total bill?Please explain how you got the answer if you can. A student wrote the following equation and solution. Explain the error and correctly solve the equation: p = 9/16 p = 3/4 4. The general population (Population 2) has a mean of 30 and a standard deviation of 5, and the cutoff Z score for significance in a study involving one participant is 1.96. If the raw score obtained by the participant is 45, what decisions should be made about the null and research hypotheses? URGENT! 15 PNTSPoints T, R, and P, define _____A. plane BB. line eC. line segment PRD. plane M The _____focuses on bringing different talents and perspectives together to make the best organizational decisions and to produce innovative, competitive products and services.. LLP Company had the following stockholders equity as ofJanuary 1, 2017.Common stock, $1 par value, 120,000 shares issued$120,000Paid-in capital in excess of parcommon stock833,000Retained earnings408,000Total stockholders equity$1,361,000During 2017, the following transactions occurred.Feb. 16LLP repurchased 5,000 shares of treasury stock at a price of $15 per share.Mar. 8200 shares of treasury stock repurchased above were reissued at $16 per share.Apr. 11800 shares of treasury stock repurchased above were reissued at $12 per share.May. 82,000 shares of treasury stock repurchased above were reissued at $18 per shareInstructions:a. Prepare the journal entries to record the treasury stock transactions in 2017, assuming Clemson uses the cost method.b. Prepare the stockholders equity section as of April 30, 2017. Net income for the first 4 months of 2017 was $130,000. (b) State the unit of volume in S.I. system and define it. 4. What rational number, when multiplied by an irrational number, has a product that is a rational number? (1 point) A television camera at ground level is filming the lift-off of a space shuttle at a point 750 meters from the launch pad. Find the angle of elevation to the shuttle when the height of the shuttle is 300 meters. Solve the following system of equations: y + 5 = xy= x2 3x 5 which of the following describes a motivation for European countries establishing empires in the 19th century? A. Europeans needed places to use the new technologies they had developed B. Europeans believed they were morally superior to the peoples of Africa and Asia C. Europeans wanted to leave Europe and relocate to African and Asian countries D. Europeans hoped to spread enlightenment idea, including liberal democracy