Find the slope of the line containing the points (7, 5) and (2, 4).

Answers

Answer 1

Answer:

[tex] \boxed{ \frac{1}{5} }[/tex]

Step-by-step explanation:

Let the points be A and B

A ( 7 , 5 ) ⇒( x₁ , y₁ )

B ( 2 , 4 )⇒( x₂ , y₂ )

Now, let's find the slope of the line which contains these points:

Slope = [tex] \mathsf{\frac{y2 - y1}{x2 - x1} }[/tex]

plug the values

⇒[tex] \mathsf{ \frac{4 - 5}{2 - 7} }[/tex]

Calculate

⇒[tex] \mathsf{ \frac{ - 1}{ - 5} }[/tex]

Reduce the fraction with -1

⇒[tex] \mathsf{ \frac{1}{5} }[/tex]

Hope I helped!

Best regards!


Related Questions

the first four terms of the sequence an=2n+3are
answer
5,8,11,14
3,5,7,9
1,3,5,7
5,7,9,11​

Answers

Step-by-step explanation:

Hey, there!!!

Your required answer is optionD.

checking,

The 1st sequences are,

5,8,11,14

here,

now, use formula,

(an = 2n+3) in the sequences,

a1 = 2×1+3=5 = matching

a2= 2×2+3=7 = not matched

a3= 2×3+3= 9 = not matched

a4= 2×4+3=11 = not matched.

For 2nd sequences

3,5,7,9

Use the formula of an term,

a1 = 2×1+3=5 = not matched

a2 =2×2+3=7not matched

a3 = 2×3+3=9= not matched.

For 3rd sequences,

1,3,5,7

a1=2×1+3=5= not matched

a2=2×2+3=7= not matched

a3=2×3+3=9= not matched

a4=2×4+3=11= not matched

Now, for 4th sequences,

5,79,11

a1=2×1+3=5= matching

a2=2×2+3=7= matching

a3= 2×3+3=9= matching

a4=2×4+4=11= matching

Therefore, the answer is option D.

Hope it helps..

Solve for a.
-4a – 2a – 7 = 11
a =
[?]

Answers

Answer:

a = [-3]

Step-by-step explanation:

-4a - 2a - 7 = 11

Combine like terms

-4a - 2a = -6a

-6a - 7 = 11

Add 7 to both sides

-6a = 18

Solve for a

a = 18/-6
••••••••••••••••••••••••••••••
doomdabomb:
All brainliest and thanks
are appreciated and
would mean a lot to me,
thanks!

a = -3
••••••

Answer:

or, -4a - 2a -7 = 11

or, -4a -2a =11 +7

or, - 6a = 18

or, a= 18÷ -6

a= -3

need help right now please

Answers

its 4

x=4

[tex]4^{2}[/tex]-2x4

16-8

=8

●✴︎✴︎✴︎✴︎✴︎✴︎✴︎✴︎❀✴︎✴︎✴︎✴︎✴︎✴︎✴︎✴︎✴︎●

                Hi my lil bunny!

    ❧⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯☙

Let's solve your equation step-by-step.

[tex]x^2 - 2x = 8[/tex]

Step 1: Subtract 8 from both sides.

[tex]x^2 - 2x - 8 = 8 - 8\\x^2 - 2x - 8 = 0[/tex]

Step 2: Factor left side of equation.

[tex]( x+2) ( x - 4) = 0[/tex]

Step 3: Set factors equal to 0.

[tex]x + 2 = 0[/tex] or [tex]x - 4 = 0[/tex]

[tex]x = -2[/tex] or [tex]x = 4[/tex]

Answer : -2 , 4

     ❧⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯☙

  ●✴︎✴︎✴︎✴︎✴︎✴︎✴︎✴︎❀✴︎✴︎✴︎✴︎✴︎✴︎✴︎✴︎✴︎●

         Have a great day/night!

                    ❀*May*❀

Mrs. barker works 40 hours per week regularly, at a rate of $36.80 per hour. when she works overtime, her rate is time and a half of her regular hourly rate. what is Mrs. Barker hourly overtime rate

Answers

Answer:

$55.20 is Mrs. Barker hourly overtime rate.

Step-by-step explanation:

The term "time and a half" in your question means that Mrs. Baker's overtime rate is 1.5 times her usual hourly rate.

So, ----> $36.80 times 1.5 = $55.20

Hong buys candy that costs $5 per pound. He will buy at least 7 lbs of candy. What are the possible amounts he will spend on candy? Use c for the amount (in dollars) Hong will spend on candy. Write your answer as an inequality solved for c.

Answers

Step-by-step explanation:

if he buys 7 pounds, it will cost 7×5 = $35

he might buy more than that (and it will then also cost more than that) , but not less than that.

so,

c >= $35

Find the x-intercept(s) of the equation: y =3x^2-3x-6

a. x-intercepts: (-1,0) and (2,0)

b. x-intercepts:(0,-3) and (0,2)

c. x-intercept: (-6,0)

d. x-intercept: (0,-6)

Answers

Answer:

(2,0)    ( -1,0)

Step-by-step explanation:

y =3x^2-3x-6

Let y = 0 and solve for x to find the x intercepts

0 =3x^2-3x-6

Factor out a 3

0 =3(x^2-x-2)

Factor inside the parentheses

0 = 3( x-2) (x+1)

Using the zero product property

x-2 =0    x+1 = 0

x=2      x = -1

(2,0)    ( -1,0)

Answer:

[tex]\large \boxed{\mathrm{a. \ x-intercepts: (-1,0) \ and \ (2,0)}}[/tex]

Step-by-step explanation:

The x-intercept(s) is when y = 0.

3x² - 3x - 6 = 0

Factor left side of the equation.

3(x + 1)(x - 2) = 0

Set factors equal to 0.

x + 1 = 0

x = -1

x - 2 = 0

x = 2

The x-intercepts are (-1, 0) and (2, 0).

Find the length of the third side. If necessary, round to the nearest tenth.
20
28
Answer:
Submit Answer
attempt 1 out of 2
PLS HELP ASAP

Answers

Answer:

b = 19.6

Step-by-step explanation:

Since this is a right triangle, we can use the Pythagorean theorem

a^2+b^2 = c^2  where a and b are the legs and c is the hypotenuse

20^2+ b^2 = 28^2  

400 + b^2 = 784

b^2 = 784-400

b^2 =384

Taking the square root of each side

sqrt( b^2) = sqrt(384)

b =19.59591794

To the nearest tenth

b = 19.6

Answer:

19.6

Step-by-step explanation:

It is a right triangle so use the pythagorean theorem; a^2 + b^2 = c^2

a=20

b=?

c=28 - c is the hypotenuse because it is across from the right angle

20^2 + b^2 = 28^2

400+ b^2 =784

b^2=384

b= 19.595917... or 19.6 (rounded to nearest tenth)

If sin 115° ≈ 0.91 and cos 115° = -0.42, then sin -115° =

Answers

Answer:

sin -115° = -0.91

Step-by-step explanation:

Point A is (cos 115°, sin 115°). Since cos 115° = -0.42 and sin 115° ≈ 0.91, it means that the coordinates at point A is (-0.42, 0.91).

As for point B which was revolved around -115°,

the coordinates will be similar to point A but you just have to change the negative.

B(cos -115°, sin -115°) = B(0.42, -0.91)

Answer:

PLATO ANSWER

-0.91; -0.42

Step-by-step explanation:

The sine function is an odd function, meaning that sin -x = -sin x. Because sin 115° ≈ 0.91, sin  -115° ≈ -0.91.

The cosine function is an even function, meaning that cos -x = cos x. Because cos 115° = -0.42, cos -115° = -0.42.

For the polynomial, (((x^3)+3x+2)/5)+((5x^2)/2)-(x^6)
a. Determine the coefficient of x^3.
b. Determine the coefficient of x^6.
c. Determine the constant of the term
polynomial.
d. Determine the degree of the polynomial.

Answers

Answer:

Hello,

Step-by-step explanation:

[tex](((x^3)+3x+2)/5)+((5x^2)/2)-(x^6)\\\\=\dfrac{x^3}{5} +\dfrac{3*x}{5} +\dfrac{2}{5} +\dfrac{5*x^2}{2} -x^6\\\\\\=-x^6+0x^5+0x^4+\dfrac{x^3}{5} +\dfrac{5*x^2}{2} +\dfrac{3*x}{5}+\dfrac{2}{5} \\\\\\a)\ \dfrac{3}{5} \\\\b)\ -1\\\\c)\\degree=6\\[/tex]

Write the parametric equation of the line: 10x - 4y = 20

Answers

The parametric equation of the line10x - y = 20 is given as y = 2.5t - 5

Parametric equation

parametric equation are equations where the dependent variable is expressed in terms of independent variable

say dependent variable y = f(t)

independent variable x = t

Given data

10x - 4y = 20

solution

10x - 4y = 20

10x - 20 = 4y

4y = 10x - 5

y = 2.5x - 5

where x = t

y = 2.5t - 5

Read more on parametric equations here: https://brainly.com/question/12953407

#SPJ1

7th Grade Math Answer ASAP Please <3

Answers

Answer:

Hey there!

Andrew made a mistake in the last step. -11.8+9.8=2, not -21.6.

Let me know if this helps :)

PLEASE HELP!! what is the equation of a line that is perpendicular to y = 2x + 4 and passes through the point (4, 6)?

Answers

Answer:

The answer is B)

[tex]y = - \frac{1}{2}x + 8[/tex]

Answer:

B.  y = -[tex]\frac{1}{2}[/tex]x + 8

Step-by-step explanation:

The line is perpendicular to line whose equation is:

y = 2x + 4 and;

passes through point (4,6) .

The product slopes of two perpendicular lines is -1.

The slope of the line whose equation is y = 2x + 4 is; 2

Let the slope of the perpendicular line (l2) be [tex]m_{l2}[/tex]

[tex]m_{l2} * 2 = -1[/tex]

[tex]m_{l2}[/tex] = [tex]-\frac{1}{2}[/tex]

Taking another point xy on line l2;

[tex]\frac{y - 6}{x - 4} = -\frac{1}{2}[/tex]

Cross multiplying this gives;

y = -[tex]\frac{1}{2}[/tex]x + 8 which is the equation of the perpendicular line!

what is the volume of a cube with and edge length of 4 cm

Answers

Answer:

V = 64 cm^3

Step-by-step explanation:

Volume of a cube is given by

V = s^3 where s is the side length

V = 4^3

V = 64 cm^3

Answer:

64

Step-by-step explanation:

i guess so as the volume is 4×4×4

1. Dada a função exponencial abaixo, se x=1, qual valor de imagem? * a) 1 b) -2 c) 0 d) -1

Answers

Complete question:

Dada a função exponencial abaixo, se x=1, qual valor de imagem? * a) 1 b) -2 c) 0 d) -1

The function in the image is f(x) = 3^x-1

Answer:

A) 1

Step-by-step explanation:

To solve the exponential function above given that x = 1;

Substitute x = 1 into the exponential function

If x = 1

f(x) = 3^(x - 1)

f(1) = 3^(1 - 1)

f(1) = 3^0

f(1) = 1

A car is averaging 50 miles per hour. If the car maintains this speed, how many minutes less would a 450-mile trip take than a 475-mile trip?

Answers

Answer:

1/2 a minute (30 seconds)

Step-by-step explanation:

475/50=9.5

450/50=9

9-9.5=.5

17. ralph is 3 times as old as sarah. in 4 years ralph will only be twice as old as sara will be then. find ralph’s age now.

Answers

Answer:

Sara is now 4, will be 8 in 4 years. Ralph is now 12, will be 16 in 4 years.

daniel thinks of a number and subtracts 2
from it. He divides 32 by the result. If
his answer is 4, what number does he
think of​

Answers

Answer:

the number is 126

Step-by-step explanation:

1) multiply each side by 32: (n-2) / 32 = 4

2) subtract 2 from each side: n-2 = 128

3) n = 126

Answer:

130

Step-by-step explanation:

So basically this number, minus 2, divided by 32 is 4, so lets write the unknown number as x.

So, (x-2)/32 = 4.

First multiply both sides by 32 to get rid of the denominator.

(32)(x-2)/32 = 4(32)          x-2 = 128

Now the -2 remains to figure out x, so you add 2 to both sides to get rid of the -2.

So, x-2+2 = 128+2,    -2 +2 is 0, and 128 +2 is 130, so you have x = 130.

What are the solutions to 3( x + 2)(x – 9) = 0

Answers

Mark Brainliest if correct:

x = -2, 9

Step-by-step explanation:

x2: x + 2 = 0

x = -2

x1: x - 9 = 0

x = 9

x = -2, 9

What is the range of the given function?
{(-2, 0), (-4, -3), (2, -9), (0,5), (-5, 7)}
O {x | x = -5, 4, -2, 0, 2}
{yly = -9, -3, 0, 5, 7}
{x | x = -9, -5, 4, -3, -2,0, 2, 5, 7}
{yl y = -9, -5, 4, -3, -2, 0, 2, 5, 7}

Answers

9514 1404 393

Answer:

  (b)  {yly = -9, -3, 0, 5, 7}

Step-by-step explanation:

The range is the set of y-values in the ordered pairs. It is usually convenient to list a set in alphanumeric order.

The second values of the ordered pairs are 0, -3, -9, 5, 7. So, the range is ...

  y ∈ {-9, -3, 0, 5, 7} . . . . . matches the second choice

if line y bisects line AC, AB = 4 - 5x, and BC = 2x+25, find AC

Answers

Answer:

4-5x = 2x+25

-5x+4 = 2x+25

-7x = 21

x = -3

4 - 5(-3)

4 + 15

19

AC = 2 x 19

AC = 38

Let me know if this helps!

Find the domain for the rational function f of x equals quantity x plus 1 end quantity divided by quantity x minus 2 end quantity.

(−[infinity], 2) (2, [infinity])

(−[infinity], −2) (−2, [infinity])

(−[infinity], 1) (1, [infinity])

(−[infinity], −1) (−1, [infinity])

Answers

Answer:

[tex](- \infty, 2), (2, \infty)[/tex]

Step-by-step explanation:

Given the function:

[tex]f(x) = \dfrac{x+1}{x-2}[/tex]

To find:

Domain of the function.

Solution:

First of all, let us learn about definition of  domain of a function.

Domain of a function is the valid input values that can be provided to the function for which output is defined.

OR

Domain of a function [tex]f(x)[/tex] are the values of [tex]x[/tex] for which the output [tex]f(x)[/tex] is a valid value.

i.e. The function does not tend to [tex]\infty[/tex] or does not have [tex]\frac{0}0[/tex] form.

So, we will check for the values of [tex]x[/tex] for which [tex]f(x)[/tex] is not defined.

For value to tend to [tex]\infty[/tex], denominator will be 0.

[tex]x-2\neq 0 \\\Rightarrow x \neq 2[/tex]

So, the domain can not have x = 2

Any other value of x does not have any undefined value for the function [tex]f(x)[/tex].

Hence, the answer is:

[tex]\bold{(- \infty, 2), (2, \infty)}[/tex]     [2 is not included in the domain].

Every year the Lee family has a big family dinner, and everyone brings a mug to exchange. The mugs are put on wooden hangers on the wall, and each wooden hanger can hold 12 mugs. Last year the family had 15 mugs to hang up. This year the Lee family filled three wooden hangers. How many more mugs were brought to the Lee family dinner this year compared to the previous year? *

Answers

Answer:

21 more mugs were brought this year than last year.

Step-by-step explanation:

We can solve by subtracting the initial amount of mugs from the final amount of mugs.

To find the amount of mugs hung up this year, we will use the equation: m = 12w where m = the number of mugs & w = the number of wooden hangers. The 12 represents the amount of mugs per wooden hanger.

We can plug in 3 for w since 3 wooden hangers were filled up and we would get 12(3) = m = 36 mugs

Now we subtract last year's total mugs hung up from this year's total mugs hung up.

We end up with 36 - 15 = 21

Is this a function or no?

Answers

Function

It is a function

Given the range (1, 1),(4,2), (2, -1), with a coordinate transformation of f(x, y) = (x+1, y-1), what is the
domain?

Answers

Answer:Domain = { (0,2), (3,3), (1,0) }

=============================================

Explanation:

The rule f(x,y) = (x+1,y-1) says to add 1 to the x coordinate and subtract 1 from the y coordinate. So let's say the input point is (7,2). This would move it to (8,1).

Now let's say that you accidentally erased the "(7,2)", but you still have the "(8,1)". You'd have to work through the steps backwards to get back to (7,2)

So you'll effectively use this rule g(x,y) = (x-1, y+1) which is the inverse transformation. Whatever f(x,y) does, the g(x,y) function will undo it and go opposite. We'll subtract 1 from the x coordinate and add 1 to the y coordinate.

------------

So that's what we'll do with the set of points { (1,1), (4,2), (2,-1) }

We have (1,1) become (0,2) after applying the g(x,y) rule

(4,2) becomes (3,3) after using g(x,y)

(2,-1) becomes (1,0) after using g(x,y)

Therefore, the domain is { (0,2), (3,3), (1,0) }

-------------

The mapping diagram is shown below.

Twice the difference between a number and 4 is twenty. Find the number.
А. 8
B. 9
C. 12
D. 14

Please help!!!

Answers

Answer:

D 14

Step-by-step explanation:

Let x be the number

2(x-4) = 20

Divide each side by 2

2/2(x-4) = 20/2

x-4 = 10

Add 4 to each side

x-4+4 = 10+4

x = 14

Answer:

The number is 14

Step-by-step explanation:

Let's call this unknown number of x:

2×(x – 4) = 20

2x – 8 = 20

2x = 20 + 8

2x = 28

x = 28/2

x = 14

Calculate the volume and surface area of a cone with the base of 20cm, the vertical hieght of 34cm and 35.6cm leaning height. ​

Answers

Answer:

Step-by-step explanation:

Volume = 1/3πr²h

Surface Area = πr(r+√(h²+r²))

V = 1/3π(10)²(34) = 3560 .5 cm³

SA = π(10)(10 + √(34²+10²)) = 1427.5 cm²

Help please, thanks :)

Answers

Answer:

х=6

Step-by-step explanation:

[tex]7 + 5(x -3 ) = 22 \\ 7 + 5x - 15 = 22 \\ 5x = 22 - 7 + 15 \\ 5x = 30 \\ x = 6[/tex]

Answer:

C

x=6

Step-by-step explanation:

Please help answer!!!!

Answers

Answer:

? = 4

Step-by-step explanation:

You are in the third quadrant. You want the answer to come out to the equivalent of 225o or pi + pi/ 4 = 5/4 * pi

x - pi/2 = 5/4 pi

x = 5/4 pi + pi/2

x = 5/4 pi + 2*pi / 4

x = 7/4 pi

? = 4

sinx =căn 2/3
sinx=5/4
sinx =1
sin3x=can3/2
sin(x-60)=-1/2
sin3x=1/2

Answers

Answer:

Correct option is

B

0

D

−1

sinx+sin2x+sin3x

=sin(2x−x)+sin2x+sin(2x+x)

=2sin2xcosx+sin2x [ by using sin(A+B)=sinAcosB+sinBcosA and sin(A−B)=sinAcosB−sinBcosA ]

=sin2x(2cosx+1)........(i)

cosx+cos2x+cos3x

=cos(2x−x)+cos2x+cos(2x+x)

=2cos2xcosx+cos2x [By using cos(a−b)=cosa⋅cosb+sina⋅sinb and cos(a+b)=cosa⋅cosb−sina⋅sinb]

=cos2x(2cosx+1).....(ii)

∴(sinx+sin2x+sin3x)

2

+(cosx+cos2x+cos3x)

2

=1

sin

2

2x(2cosx+1)

2

+cos

2

2x(2cosx+1)

2

=1.......[From(i)(ii)]

⇒(2cosx+1)

2

=1

⇒2cosx+1=±1

∴cosx=0or−1

Nathan, a tutor, buys 5 calculators for $7.50 each at a store, planning to provide one to each of his clients. However, the next day, he discovers that the same calculators has gone on sale for $5.00 and also discovers that he will only have three tutoring clients instead of five. He returns the five calculators and purchases three calculators at the new sale price. He uses the following expression to determine the amount he should receive back from the store. (5 x $7.50) - (3 x $5.00) Which of the following expressions could Nathan have used. 5 ($7.50 - $5.00). $7.50 - $5.00. (5 x $7.50) - $5.00. (5 x $7.50) - $5.00. 3 ($7.50 - $5.00) +2 x $7.50

Answers

Answer: 5 (7.50-3 )

Step-by-step explanation:

Given: Previous price of calculator = $7.50

Number of client =5

Total price = (Number of calculators) x (Price for each calculator)

Total price of 5 calculators = (5 x $7.50)

New price of calculator = $5.00

Number of client =3

Total price of 3 calculators  = (3 x $5)

Price will receive = (Total price of 5 calculators) -(Total price of 3 calculators  )

= (5 x $7.50) -  (3 x $5)

= 5 (7.50-3 )

Required expression: 5 (7.50-3 )

Other Questions
How does the design of your experiment control for outside factors that may affect the results? Gasoline is a non-polar liquid that will float on water. 400 grams of gasoline is spilled into a puddle of water. If the density of gasoline is 0.665 g/mL, what volume of gasoline is spilled? Please give me the correct answer If the occurrence of one event does not influence the outcome of another event, then two events are:A. conditionalB. disjointC. independentD. interdependent Select the correct answer.Read the last stanza of Robert Frosts poem The Road Not Taken. Why is it significant that the two roads diverged?I shall be telling this with a sighSomewhere ages and ages hence:Two roads diverged in a wood, and II took the one less traveled by,And that has made all the difference. from "The Road Not Taken" by Robert FrostA. The speaker is recalling, "with a sigh," how difficult it had been for him to choose the more traveled or the less traveled of the two roads. The forked road is a metaphor for the inherent duality in the natural world.B. One of the forks in the road represents the speaker in his youth when he chose a road; the other stands for the speaker "ages and ages hence." The forked road is a metaphor for the many contradictions found in nature.C. The speaker is relieved that he chose the road of moral living over one of temptation and ruin, which would have come from the other path.D. The speaker is imagining what it might be like to describe his choice of a life path after he has taken that path to close to its end. Evaluate the expression for the given value of the variable. 9x 8, when x = 6 Type an equation for thefollowing pattern.XY15N23-1y=[? ]x+[ ]4 Find the value of x. Round to the nearest tenth. 15.9 12.4 12.8 16.3 Help me please please please please atch the term with the correct cellular process or definition. - A molecule containing genetic information - RNA base that pairs with adenine - Carries amino acid to ribosomes - The site of protein synthesis - DNA base that pairs with adenine - Carries the genetic code to ribosomes A. mRNA B. DNA C. tRNA D. Thymine E. Uracil F. rRNA G. Ribosome At December 31, 2017, Larkspur Corporation had an estimated warranty liability of $124,000 for accounting purposes and $0 for tax purposes. (The warranty costs are not deductible until paid.) The effective tax rate is 30%. Compute the amount Larkspur should report as a deferred tax asset at December 31, 2017. Deferred tax asset at December 31, 2017 the auther suggests that the desire to belong is a very poweful-if not the most powerful-human emotion. Do you agree or disagree with this claim a jar had 6 red marbles and 4 blue marbles. you randomly choose two marbles. find the probability that both marbles are red. What is the correct French word that fits the definition?To go on vacation isO travaillerO nagerO acheterO voyager Shelly charges $10 per hour for her babysitting servives. Last month Shelly babysat for 15 hours. This month she babysat for n hours. a. Write an expression using parentheses to describe how much money she made. b. Given that n=12, evaluate your expression using the distributive property. What is the social impact of the bhopal gas tragedy all of the following are examples of organic matter soil except How would you define a cloud today? as a non-factor networking server any remote virtualized computing infrastructure How to do this question plz answer me step by step plzz plz Describe how the development changed societys understanding how is the development applicable outside of the social science