find the unknown side of the right triangle using the information given leg=12m, leg=6 m​

Answers

Answer 1

Answer:

Step-by-step explanation:

Given

Leg =  10

Leg = 6

hypotenuse = ?

equation

c^2 = a^2 + b^2

a = 10

b = 6

Solution

c^2 = 10^2 + 6^2                  Expand

c^2 = 100 + 36                     Combine

c^2 = 136                              Take the square root of both sides

√c^2 = √136

c = 11.66

answer

hypotenuse = 11.66


Related Questions

The scatterplot to the left shows the cost, CCC, in thousands of dollars, and living space, xxx, in square feet (\text{ft}^2)(ft
2
)left parenthesis, start text, f, t, end text, squared, right parenthesis for several houses in a certain neighborhood. According to the data, which of the following best approximates the cost for an additional square foot of living space for homes in this neighborhood?
Choose 1 answer:
\$80$80dollar sign, 80
\$300$300dollar sign, 300
\$1{,}000$1,000dollar sign, 1, comma, 000
\$13{,}000$13,000dollar sign, 13, comma, 000

Answers

According to the data, the cost of this house would increase by 0.08 thousand dollars ($80) for each additional square foot of living space.

How to determine the cost for an additional square foot?

By critically observing the scatter plot, we can logically deduce that it shows a linear trend. Thus, the slope of the line of best fit is given by a ratio of change in cost to the change in living space.

Next, we would approximate two points on the line of best fit and then find the slope as follows:

Slope, m = ΔC/Δx

Slope, m = (C₂ - C₁)/(x₂ - x₁)

Slope, m = (400 - 200)/(4000 - 1500)

Slope, m = 0.08.

Therefore, the cost of this house would increase by approximately 0.08 thousand dollars ($80) for each additional square foot of living space.

Read more on scatterplot here: brainly.com/question/6592115

#SPJ1

Factor
(a-2b) (3x-5y) + (2b-a)(x-y)


Answers

Answer:

8by + 2ax - 4bx - 4ay

Step-by-step explanation:

I assume you mean expand so:

(a - 2b)(3x - 5y) + (2b - a)(x - y)

3ax - 5ay - 6bx + 10by + 2bx - 2by - ax + ay

Now collect like terms:

2ax - 4ay - 4bx + 8by

This is your answer but in a better order:

8by + 2ax - 4bx - 4ay

The equation of line / is y=3x/a +5, where a is a positive constant. If the value of a in this equation is doubled, then the resulting equation will represent a line whose slope is how many times the slope of line / ?

Answers

The resulting equation will represent a line whose slope is 1/2 times the slope of the line

How to determine the slope of the new line?

The equation of the line is given as:

y = 3x/a + 5

The constant a is a positive constant.

So, when the value of a in the equation is doubled, we have:

y = 3x/2a + 5

A linear equation is represented as

y = mx + b

Where m represents the slope.

So, we have:

m1 = 3/a

m2 = 3/2a

Substitute m1 = 3/a in m2 = 3/2a

m2 = 1/2 * m1

Hence, the resulting equation will represent a line whose slope is 1/2 times the slope of the line

Read more about linear equation at:

https://brainly.com/question/14323743

#SPJ1

One month Kevin rented 2 movies and 5 video games for a total of $30. The next month he rented 8 movies and 3 video games for a total of $35. Find the rental cost for each movie and each video game. Rental cost for each movie: s Rental cost for each video game

Answers

Answer:

M = $2.5; V = $5

Step-by-step explanation:

We need to set up a system of equations to find the price for both movies (M) and video games (V).

We can use 2M + 5V = 30 and 8M + 3V = 35

We can use elimination:

[tex]-4(2m+5v=30)\\8m+3v=35\\\\-8m - 20v = -120\\8m+3v=35\\-17v=-85\\v=5\\\\2m+5(5)=30\\2m+25=30\\2m=5\\m=5/2 ;m=2.5[/tex]

Find the integrals:
∫30x^2/√(x-4) dx
u=x-4 and u=√(x-4)

Answers

I assume you're asked to compute

[tex]\displaystyle \int \frac{30x^2}{\sqrt{x-4}} \, dx[/tex]

using both of the substitutions provided.

With [tex]u=x-4[/tex], we have [tex]x=u+4[/tex] and [tex]dx=du[/tex]. Then

[tex]\displaystyle \int \frac{30x^2}{\sqrt{x-4}} \, dx = \int \frac{30(u+4)^2}{\sqrt u} \, du \\\\ ~~~~~~~~ = 30 \int \frac{u^2 + 8u + 16}{\sqrt u} \, du \\\\ ~~~~~~~~ = 30 \int \left(u^{3/2} + 8u^{1/2} + 16u^{-1/2}\right) \, du \\\\ ~~~~~~~~ = 30 \left(\frac25 u^{5/2} + \frac{16}3 u^{3/2} + 32 u^{1/2}\right) + C \\\\ ~~~~~~~~ = 12 u^{5/2} + 160 u^{3/2} + 960 u^{1/2} + C \\\\ ~~~~~~~~ = 12 (x-4)^{5/2} + 160 (x-4)^{3/2} + 960 (x-4)^{1/2} + C \\\\ ~~~~~~~~ = 4 \sqrt{x-4} \left(3 (x-4)^2 + 40 (x-4) + 240\right) + C \\\\ ~~~~~~~~ = \boxed{4 \sqrt{x-4} \left(3x^2 + 16x + 128\right) + C}[/tex]

With [tex]u=\sqrt{x-4}[/tex], we have

[tex]u^2 = x-4 \implies x^2 = (u^2+4)^2[/tex]

and [tex]2u\,du=dx[/tex]. Then

[tex]\displaystyle \int \frac{30x^2}{\sqrt{x-4}} \, dx = \int \frac{60u \left(u^2+4\right)^2}u \, du \\\\ ~~~~~~~~ = 60 \int \left(u^4 + 8u^2 + 16\right) \, du  \\\\ ~~~~~~~~ = 60 \left(\frac15 u^5 + \frac83 u^3 + 16u\right) + C  \\\\ ~~~~~~~~ = 12 (x-4)^{5/2} + 160 (x-4)^{3/2} + 960 (x-4)^{1/2} + C \\\\ ~~~~~~~~ = 4 \sqrt{x-4} \left(3 (x-4)^2 + 40 (x-4) + 240\right) + C \\\\ ~~~~~~~~ = \boxed{4\sqrt{x-4} \left(3x^2 + 16x + 128\right) + C}[/tex]

Need help with defining this question.

Answers

Answer:

B.) 19

Step-by-step explanation:

According to F(5), the question wants you to plug x = 5 into the equation. Then, you need to simplify to find the output.

F(x) = x² - 2x + 4                             <----- Original equation

F(5) = (5)² - 2(5) + 4                        <----- Plug 5 into "x"

F(5) = 25 - 10 + 4                            <----- Solve 5² and -2 x 5

F(5) = 19                                         <----- Combine like terms

PLEASE someone help me with this question, I’ve been stuck on it for so long :(

Help is greatly appreciated! I know what the answer is ( back of my textbook) but i dont know how to figure it out

Oh also if it’s possible could you please take a picture of your handwritten answer instead of typing it since its easier for me to understand , but either way is fine :)

Answers

Answer:

13.5 litres

Step-by-step explanation:

the ratios are 2 : 3 : 4 = 2x : 3x : 4x ( x is a multiplier )

given Henrietta produced 1.5 litres more than Gladys , then

4x = 3x + 1.5 ( subtract 3x from both sides )

x = 1.5

then total milk produced by the 3 cows is

total = 2x + 3x + 4x = 9x = 9 × 1.5 = 13.5 litres

solve the equation: z^ +4z+20+iz(a+1)=0 Where A is constant, has complex conjuget root. if one of roots this quadratic is z=B+2i?​

Answers

The complex conjugate roots exists A = -1 - 4i or A = -1 + 12i.

How to estimate complex conjugate roots?

If one of the roots exists w = B + 2i, then the other root exists its conjugate w = B - 2i. So we can factorize the quadratic to

[tex]z^2+4z+20+iz(A+1) = (z-(B+2i))(z-(B-2i))[/tex]

Expand the right side and collect all the coefficients.

[tex]z^2+(4+(A+1)i)z+20 = z^2-2Bz+B^2+4[/tex]

From the z and constant terms, we have

[tex]$\left \{ {{4+(A+1)i = -2B} \atop {20 = B^2+4}} \right.[/tex]

From the second equation, we get

[tex]B^2 = 16[/tex]

B = ± 4

Then 4+(A+1)i = ± 8

(A + 1)i = 4 or (A + 1)i = -12

Since [tex]$\frac{1}{i} = -i[/tex], we have

[tex]$\frac{-A+1}{i} =4[/tex] or [tex]$\frac{-A+1}{i} =-12[/tex]

A+1 = -4i or A+1 = 12i

A = -1-4i or A = -1+12i

Therefore, the complex conjugate roots exists A = -1-4i or A = -1+12i.

To learn more about complex conjugate roots refer to:

https://brainly.com/question/28064613

#SPJ9

A ball is thrown downward from the top of a 120-foot building with an initial velocity of 20 feet per second. The
height of the ball h in feet after t seconds is given by the equation h= - 16t²-20t+120. How long after the
ball is thrown will it strike the ground?

Answers

Answer:

[tex]t=\frac{-5+\sqrt{505}}{8}[/tex]

Step-by-step explanation:

The ball strikes the ground when h = 0.

[tex]-16t^2 - 20t + 120 = 0 \\ \\ 4t^2 + 5t - 30=0 \\ \\ t=\frac{-5 \pm \sqrt{5^{2}-4(4)(-30)}}{4(2)} \\ \\ t=\frac{-5 \pm \sqrt{505}}{8}[/tex]

However, as time most be positive, we only consider the positive case.

So,

[tex]t=\frac{-5+\sqrt{505}}{8}[/tex]

1. Which of the following results in the difference of two squares?
O (3r-5y) (3x - 5y)
O (5x+3y) (5x-3y)
O 4r²(3r-9)
O (2r-3y)2

Answers

The difference of two squares is (5x+3y) (5x-3y)

How to determine the difference of two squares?

The difference of two squares of variables a and b is represented as:

(a + b)(a - b) = a^2 - b^2

By comparing the list of options, we have:

(5x+3y) (5x-3y)

This means that

a = 5x and b = 3y

Hence, the difference of two squares is (5x+3y) (5x-3y)

Read more about the difference of two squares at:

https://brainly.com/question/3189867

#SPJ1

In the following triangle, point O is the midpoint of LM, and point P is the midpoint if LN.

Below is the proof that OP||MN. The proof is divided into four parts, where the title of each part indicates its main purpose.
Complete part D of the proof.

Part A: Prove LM/LO=2

Part B: Prove LN/LP=2

Part C: Prove LMN ~ LOP

Part D: Prove OP||MN

Answers

The complete proof for part D is given in the attached text. Hence, by the nature of the converse corresponding angle,

OP is parallel to MN. (OP ║ MN).

What is a mathematical proof?

A mathematical proof is an argument that is inferential with respect to a mathematical assertion that demonstrates that the provided assumptions logically ensure the conclusion.

The complete proof for part D is given as follow:

If a transversal line "t" divides through OP and MN as given in the attached image, and SE and "T.F" are the divider of ∠QSD and ∠STM, then:

∠QSE = 1/2 ∠QSO; and

∠"STF" = 1/2 ∠STM

If the corresponding angle is ∠QST = "STF", then

QSD = "STF"

Hence, by the nature of the converse corresponding angle,

OP is parallel to MN

Learn more about mathematical proofs at;https://brainly.com/question/26456364

#SPJ1

What is the value of a?
O 5 units
05/
units
6 units
O 7 units

Answers

From the Δ YWZ we get c = 5 then the value of  [tex]$a= 5 \frac{1}{3}[/tex].

How to estimate the value of a?

In the given Δ YWZ

WZ² = YW² + YZ²

c² = 4² + 3² = 16 + 9 = 25

c = 5

In the Δ XYW

b² = 4² + a²-----(1)

In the right-angle Δ WXZ

(a + 3)² = b² + c²

a² + 9 + 6a = b²+ c²

By putting the value of b² from (1)

a² + 9 + 6a = 16 + a² + 25

Simplifying the above equation, we get

6a + 9 = 41

6a = 41 - 9

6a = 32

[tex]$a = \frac{32}{6} = \frac{16}{3}[/tex]

[tex]$a= 5 \frac{1}{3}[/tex]

Therefore, the value of [tex]$a= 5 \frac{1}{3}[/tex].

To learn more about the value of a refer to:

https://brainly.com/question/4060697

#SPJ9

f(x) = |2x +1| +3
g(x) = −2
Find (ƒ + g)(x).

Answers

Hello!

We are going to solve the question with our given functions.

We were given:

f(x) = |2x +1| + 3g(x) = -2

Those are our two given functions, we will use those to solve for (f + g)(x).

Keep in mind that (f + g)(x) could also be written as f(x) + g(x)

With this knowledge, we can solve our question.

Solve:

(ƒ + g)(x) = f(x) + g(x)

Plug in our f(x) and g(x) functions and solve.

f(x) + g(x) = |2x +1| + 3 - 2

Simplify.

|2x +1| + 3 - 2

|2x +1| + 1

Since we can't simplify this any further, the above will be our answer.

(f + g)(x) = |2x +1| + 1

Answer:

|2x +1| + 1

You want to put in a new concrete patio behind your house. You want it to be 12 ft wide by 14 ft long and it needs to be eight inches thick. You know that an 80 lb. bag of concrete yields 0.60 cubic feet. How many 80 lb. bags of concrete will you need for your patio?

Answers

Answer:

You will need 187 80 pounds bags of concrete.

Step-by-step explanation:

12x14x(2/3) x 0.6 = 186.666 or 187

Solve the following:
3 x 10³ - 7000
(8 × (−5)) + (4² +2²)
Give your answer in simplest form.
Enter can you help me solve this I was doing very good up to now

Answers

Answer:

3x(10x10x10): 3x(1000): 3000-7000: -4000. (8x(-5)): -40. (4x4) +(2x2): (16 +4): 20

Find the period of the function y = 2∕3 cos(4∕7x) + 2. Question 11 options: A) 7∕2π B) 4∕7π C) 3π D) 7∕4π

Answers

The period of the function y = 2∕3 cos(4∕7x) + 2. is 7/2π

How to determine the period of the function?

The function is given as:

y = 2∕3 cos(4∕7x) + 2.

The above function is a cosine function

A cosine function is represented as:

y = A cos(B(x + C)) + D

Where the period is

Period = 2π/B

By comparing the equations, we have

B = 4/7

Substitute B = 4/7 in Period = 2π/B

Period = 2π/(4/7)

Express as product

Period = 2π * 7/4

Divide 4 by 2

Period = π * 7/2

Evaluate the product

Period = 7/2π

Hence, the period of the function y = 2∕3 cos(4∕7x) + 2. is 7/2π

Read more about cosine functions at:

https://brainly.com/question/17075439

#SPJ1

i dont know answer please im in summer school

Answers

The centre and the radius of the circle is (-7, -1) and 6 units

Equation of a circle

The equation of the circle in standard from is expressed as:

x^2+y^2+2gx+2fy+C = 0

where;

(-g, -f) is the centre

r= √g²+f²-C

Given the equation below

x^2+y^2+14x+2y+14 = 0

2g = 14

g = 7

2f = 2

f =1

Hence the centre of the circle is (-7, -1)

Radius = √49+1-14

Radius = √36 = 6 units

Hence the centre and the radius of the circle is (-7, -1) and 6 units

Learn more on equation of a circle here: https://brainly.com/question/1506955

#SPJ1

he graph of f(x) = log x + 3 is the graph of
g(x) = log x translated 3 units

Answers

We conclude that the graph of f(x) is the graph of g(x) translated 3 units upwards.

How do relate the graphs of f(x) and g(x)?

Here we have the functions:

[tex]f(x) = log(x) + 3\\\\g(x) = log(x)[/tex]

And we want to find a relation between them.

Remember that a vertical translation of N units (the sign of N defines the direction of the translation) is written as:

[tex]f(x) = g(x) + N[/tex]

In this case, we can see that N = 3, it is positive, so the translation is upwards. (This means that the whole graph of the function f(x) is translated upwards 3 units in the coordinate axis)

Then we conclude that the relation between the graphs of the given functions is that the graph of f(x) is the graph of g(x) translated 3 units upwards.

If you want to learn more about translations:

https://brainly.com/question/24850937

#SPJ1

Maths-4
What is the smallest number that is divisible by each of the numbers given below
{1, 2, 3, 4, 5, 6, 7, 8, 9, 10 }
5040
3780
1260
2520
None of the above

Answers

Answer:

5040 is the right answer

Step-by-step explanation:

5040/1=5040

5040/2=2520

5040/3=1680

5040/4=1260

5040/5=1008

5040/6=840

5040/7=720

5040/8=630

5040/9=560

5040/10=504

Rational expressions are often used in combining rates of work.

Answers

Rational expressions are often used in combining rates of work. Therefore, it's true.

What is rational expression?

It should be noted that a rational expression is simply defined by a rational fraction.

They're are used in combining rates of work. Fir example, if Mr John performs 1/2 of his work and does 1/3 on another day. This can be expressed as:

= 1/2 + 1/3

= 5/6

Learn more about rational expression on:

brainly.com/question/2264785

#SPJ1

How do you find the value of 5,016 with as few steps as possible?​

Answers

The estimated value of 5,016 exists 1 / 264 ≈ 0.00379.

What is a fraction?

Fractions describe the regions of a complete or group of objects. A fraction contains two regions. The number on the top of the line exists named the numerator. It describes how many equivalent regions of the real or group stand accepted. The number below the line exists named the denominator. It exhibits the total number of equivalent regions the whole exists divided into or the total number of the exact objects in a group.

How to estimate the value of 5,016 with as few steps?​

The value of 5,016 can be simplified by using a fraction

Consider a denominator 19, then

19 divided by 5,016, then we get

19 and 5016 have a common divisor of 19.

then, we get

19 / 5016 = 1 / 264

Now, you need to divide.

1 / 264 ≈ 0.00379

Therefore, the estimated value of 5,016 exists 1 / 264 ≈ 0.00379.

To learn more about fractions refer to:

https://brainly.com/question/11701340

#SPJ9

11. You want to save all the money you earn to buy a guitar that costs $400. You earn $9 per hour and
plan to work 15 hours each week for the next 3 weeks. Will you earn enough money in that time to buy
the guitar? Explain your answer.

Answers

Answer:

The answer is YES

Step-by-step explanation:

You want to save all the money you earn to buy a guitar that costs $400. You earn $9 per hour and

plan to work 15 hours each week for the next 3 weeks. Will you earn enough money in that time to buy

the guitar? Explain your answer.

15 hours × 3 weeks × $9 per hour

15 × 3 × 9 =

45 × 9 = 405$

The answer is YES

a study of nickels showed that the standard deviation of the weight of nickels is 300 milligrams. A coin counter manufacture wishes to find the 90% confidence interval for the average weight of a nickel. What is the minimum number of nickels he needs to weigh to obtain an average accurate to within 20 milligrams?

Answers

Using the z-distribution, a sample of 609 nickels has to be weighed.

What is a z-distribution confidence interval?

The confidence interval is:

[tex]\overline{x} \pm z\frac{\sigma}{\sqrt{n}}[/tex]

The margin of error is:

[tex]M = z\frac{\sigma}{\sqrt{n}}[/tex]

In which:

[tex]\overline{x}[/tex] is the sample mean.z is the critical value.n is the sample size.[tex]\sigma[/tex] is the standard deviation for the population.

For this problem, the parameters are:

[tex]M = 20, \sigma = 300, z = 1.645[/tex]

We solve for n to find the sample size, then:

[tex]M = z\frac{\sigma}{\sqrt{n}}[/tex]

[tex]20 = 1.645\frac{300}{\sqrt{n}}[/tex]

[tex]20\sqrt{n} = 1.645 \times 300[/tex]

[tex]\sqrt{n} = 1.645 \times 15[/tex]

[tex](\sqrt{n})^2 = (1.645 \times 15)^2[/tex]

n = 608.9

Rounding up, a sample of 609 nickels has to be weighed.

More can be learned about the z-distribution at https://brainly.com/question/25890103

#SPJ1

Complete the frequency table:


Method of Travel to School
Walk/Bike Bus Car Row totals
Under age 15 18 165
Age 15 and above 65 195
Column totals 152 110 98 360


What percentage of students age 15 and above travel to school by bus? Round to the nearest whole percent.

Answers

The percentage of students age 15 and above travel to school by bus is 47%

How to complete the table?

The table of values is given as:

                     Method of Travel to School

                            Walk/Bike    Bus    Car Row totals

Under age 15                            18                 165

Age 15 and above    65                                 195

Column totals          152          110        98      360

Using the column total of column 1, we have:

Under age 15 + 65 = 152

This gives

Under age 15 = 87

Using the column total of column 2, we have:

Age 15 and above + 18 = 110

This gives

Age 15 and above  = 92

Using the row total of row 1, we have:

Car + 87 + 18 = 165

This gives

Car = 60

Using the row total of row 2, we have:

Car + 65 + 92 = 195

This gives

Car = 38

So, the complete frequency table is

                     Method of Travel to School

                            Walk/Bike    Bus    Car Row totals

Under age 15           87              18      60        165

Age 15 and above    65          92        38        195

Column totals          152          110        98      360

The percentage of students age 15 and above travel to school by bus is:

Percentage = 92/195 * 100%

This gives

Percentage = 47%

Read more about frequency table at:

https://brainly.com/question/12576014

#SPJ1

The volume of a prism with side lengths measured in millimeters is 20. How could this measurement be written? Check all that apply.

Answers

The unit measurement of the a volume in mm is mm³(millimetres cube.)

How to find volume ?

Volume is is defined as the space occupied within the boundaries. The objects are usually solid objects.

The volume of a 3 dimensional figure is the product of the base area and the height.

Therefore, the units of volume is measured in cubic units.

The volume of a prism with side lengths measured in millimetres is 20.

Therefore, the measurement can be represented as follows:

20 mm³

learn more on volume here: https://brainly.com/question/16310824

#SPJ1

According to the American Community Survey, 27% of residents of the United States 25 years old or older had earned a bachelor degree. Suppose you select 12 residents of the United States 25 years old or older and recorded the number who had earned a bachelor degree. Round probabilities to 4 decimal places.

Explain why this is a binomial experiment.

Find and interpret the probability that exactly 5 of them had a bachelor degree.

Find and interpret the probability that fewer than 5 of them had a bachelor degree.

Find and interpret the probability that at least 5 of them had a bachelor degree.

Compute the mean and standard deviation of the binomial random variable.

Answers

a. The reason why this question is a binomial experiment is based on the fact that it is made up of an independent sample, it has a number that is fixed and a probability.

Each event is made up of two outcomes and they are random with the same success rate.

b. How to solve probability that exactly 5 had a bachelor

we have the following data n = 12, p = 0.27 and k = 5

We have to use the function to solve electronically

binompdf(n,p,k)

input the values

= binompdf(12,0.27,5)

This gives us

= 0.1255

(C) Probability that fewer than 5 have bachelor

We use the formula below

= binompdf(12,0.27,5-1)

This is = 0.7984

D. Probability of at least 5

1 - probability of fewer than 5

= 1 - 0.7984

= 0.2016

How to solve for the Mean = n*p

n = 12 , p = 0.27

Mean = 12*0.27 = 3.24

and

standard deviation = √npq

n = 12, p = 0.27 , q = 1- 0.27

= 0.73

sd = √12*.27*.73

= 1.54

Read more on binomial experiment here:

https://brainly.com/question/9325204

#SPJ1

In a survey of 320 college graduates, 36% reported that they stayed on their first full-time job less than 1 year. If 15 of those subjects are randomly selected without replacement for a follow-up survey, find the probability that exactly 5 of them stayed on their job for less than one-year.
Name the variables in the context of the problem.
State the requirements for binomial distribution for this problem.
Use the long formula above to find P(x)

Answers

Using the binomial distribution, there is a 0.2094 = 20.94% probability that exactly 5 of them stayed on their job for less than one-year.

What is the binomial distribution formula?

The formula is:

[tex]P(X = x) = C_{n,x}.p^{x}.(1-p)^{n-x}[/tex]

[tex]C_{n,x} = \frac{n!}{x!(n-x)!}[/tex]

The parameters are:

x is the number of successes.n is the number of trials.p is the probability of a success on a single trial.

In this problem, there is a fixed number of independent trials, each with only two possible outcomes, hence the binomial distribution is used. The values of the parameters are:

n = 15, p = 0.36.

The probability is P(X = 5), hence:

[tex]P(X = x) = C_{n,x}.p^{x}.(1-p)^{n-x}[/tex]

[tex]P(X = 5) = C_{15,5}.(0.36)^{5}.(0.64)^{10} = 0.2094[/tex]

0.2094 = 20.94% probability that exactly 5 of them stayed on their job for less than one-year.

More can be learned about the binomial distribution at https://brainly.com/question/24863377

#SPJ1

Zendaya runs a farm stand that sells blueberries and grapes. Each pound of blueberries sells for $2.50 and each pound of grapes sells for $1.25. Zendaya made $55 from selling a total of 33 pounds of blueberries and grapes. Write a system of equations that could be used to determine the number of pounds of blueberries sold and the number of pounds of grapes sold. Define the variables that you use to write the system.

Answers

The number of pounds of blueberries and grapes sold are 11 and 22.

According to the statement

we have given that the:

Each pound of blueberries sells for $2.50 and each pound of grapes sells for $1.25.

And total money collected by selling pounds is $55

And total number of pounds sells = 33

And we have to find the Number of pounds of blueberries and grapes.

Let the number of pounds of blueberries is X

And Let the number of pounds of grapes is Y

So,

The equation becomes is:

X + Y = 33  -(1)

2.50X + 1.25Y = 55  -(2)

Now, From substitution method

From (1) equation

Y = 33 - X

put these in equation (2) then

2.50X + 1.25(33 - X ) = 55

2.50X + 41.25 - 1.25X = 55

1.25X = 13.75

X = 11

and the the value of Y becomes

Y = 33 - X

Y = 33 - 11

Y = 22.

So, The number of pounds of blueberries and grapes sold are 11 and 22.

Learn more about substitution method here https://brainly.com/question/22340165

#SPJ1

An exponential function f ( x ) = a b x f ( x ) = a b x passes through the points (0, 10000) and (3, 2160). What are the values of a and b ?

Answers

The values of a and b of the exponential function are 10000 and 0.6 respectively

How to solve exponential functions?

We are given that the exponential function is expressed in general form as; f(x) = abˣ

where;

a is a non-zero real number called the initial value

b is any positive real number such that

b ≠ 1.

The domain of f is all real numbers.

The range of f is all positive real numbers if a > 0.

The range of f is all negative real numbers if a < 0.

The y-intercept is (0, a)

The horizontal asymptote is; y = 0.

We are told that this exponential function passes through the coordinate points (0, 10000) and (3, 2160).

At coordinate point (0, 10000), we have;

10000 = ab⁰

a = 10000

Now, at the coordinate point (3, 2160), we have;

2160 = 10000(b)³

2160/10000 = b³

0.216 = b³

b = ∛0.216

b = 0.6

Thus, we can conclude that the values of a and b of the given exponential function are respectively 10000 and 0.6.

Read more about Exponential Functions at; https://brainly.com/question/11464095

#SPJ1

What is the domain of y = 4 log5 (x - 3)?
A. all real numbers
B. all real numbers greater than 4
C. all real numbers greater than 5
D. all real numbers greater than 3.

Answers

The domain of [tex]y=4\log_5(x-3)[/tex] is (d) all real numbers greater than 3.

How to determine the domain?

The function is given as:

[tex]y=4\log_5(x-3)[/tex]

Set the expression in bracket greater than 0

x -3 > 0

Add 3 to both sides

x > 3

Hence, the domain of [tex]y=4\log_5(x-3)[/tex] is (d) all real numbers greater than 3.

Read more about domain at:

https://brainly.com/question/1770447

#SPJ1

Other Questions
what systems are available and specifically the financial benefits iy holds for the user and owner. A client who has been experiencing prolonged vomiting has the following ABG results: pH 7.48; pCO2 40 mm Hg; HCO3 34 mEq/L; pO2 85 mm Hg. The nurse determines that the client is experiencing which of the following imbalance give a speech on doing the right thing does not always make you popular A mutant strain of e. coli produces galactosidase in the presence and in the absence of lactose. where in the operon might the mutation in this strain occur, and why? While the nature of adenosine action on central circuits is not well understood, adenosine is thought to have an inhibitory or relaxing effect based on which observation? If you were going to get a loan to purchase a new car, which financial intermediary would you use?a. an investment bank. b. a credit union c. a commercial ban Which method is automatically called when you pass an object as an argument to the print function? You are buying a house and you are financing the purchase with a mortgage of $130,000. The mortgage has a 30 year term and requires monthly payments. The mortgage charges an interest rate of 0.3% every month. What is the total interest payment over the life of the mortgage? Complete the recursive formula of the geometric sequence -0.25\,,-2\,,-16\,,-128,...0.25,2,16,128,...minus, 0, point, 25, comma, minus, 2, comma, minus, 16, comma, minus, 128, comma, point, point, point.b(1)=b(1)=b, left parenthesis, 1, right parenthesis, equals b(n)=b(n-1)\cdotb(n)=b(n1)b, left parenthesis, n, right parenthesis, equals, b, left parenthesis, n, minus, 1, right parenthesis, dot A sample of air at room temperature in a 4.00 L container holds approximately 0.562 moles of O2and 2.11 moles of N2 along with other trace elements to total 2.67 moles. What is the mole fraction of N2 in the mixture The limits of wartime tolerance were tested in 1943 los angeles with the:_______ What point was Paine making through the use of hyperbole?1.It is time for action.2.It is time to be scared.3.It is wise to be cautious.4.It is foolish to rebel. 9. Two hexagons are similar in shape. The larger hexagon has an area of7350 mm. Find the area of the smaller hexagon.22,509.3 mm12,862.5 mm4,214.3 mm2,400 mm Surface area=Volume =Help me please thanks What is developing the ability to produce goods or services previously purchased or actually buying a supplier or a distributor?. The stamp act was passed in 1765. this act required __________ to pay a tax on every printed paper they purchased. Choose one of the six personality measures currently used in law enforcement. Describe the instrument, including what the test measures and what we know about its validity. A 35 year old man is pulseless and apneic. He was found in a lake after falling through the ice. His wife says he left the house 3 hours ago. His is cold and rigid. What should you do Which best describes the reducing agent in the reaction below? cl2(aq) 2br(aq) right arrow. 2cl(aq) br2(aq) How will you design your curriculum, instruction, and classroom management to maximize the learning of the diverse population of students you can expect to find in your classroom