In 2018, the population of a district was 25,000. With a continuous annual growth rate of approximately 4%, what will the
population be in 2033 according to the exponential growth function?
Round the answer to the nearest whole number.

Answers

Answer 1

Answer:

40,000 populations

Step-by-step explanation:

Initial population in 2018 = 25,000

Annual growth rate (in %) = 4%

Yearly Increment in population = 4% of 25000

= 4/100 * 25000

= 250*4

= 1000

This means that the population increases by 1000 on yearly basis.

To determine what the  population will be in 2033, we need to first know the amount of years we have between 2018 and 2033.

Amount of years we have between 2018 and 2033 = 2033-2018

= 15 years

After 15 years, the population will have increased by 15*1000 i.e 15,000 more than the initial population.

Hence the population in 2033 will be Initial population + Increment after 15years = 25,000+15000 = 40,000 population.


Related Questions

The number of weekly hours spent on a smart device varies inversely with the person's age. If a 20-year-old person spends 52 hours on their smart device each week, how many hours does a 50-year-old person spend on their smart device?

Answers

Answer:

20.8 hours

Step-by-step explanation:

Given that hours (h) varies inversely with age (a) then the equation relating them is

h = [tex]\frac{k}{a}[/tex] ← k is the constant of variation

To find k use the condition h = 52 when a = 20, thus

52 = [tex]\frac{k}{20}[/tex] ( multiply both sides by 20 )

1040 = k

h = [tex]\frac{1040}{a}[/tex] ← equation of variation

When a = 50, then

h = [tex]\frac{1040}{50}[/tex] = 20.8 hours

a polynomial p has zeros when x=1/5,x=-4, andx=2 what could be the equation of p?​

Answers

Answer:

x^3 + (9/5)x^2 -(42/5)x + (8/5)

Step-by-step explanation:

since 1/5, -4, and 2 are all zeroes, (x-1/5)(x+4)(x-2) must be a factor of p. if you distribute the statement, you get

Pimeter or area of a rectangle given one of these...
The length of a rectangle is three times its width.
If the perimeter of the rectangle is 48 cm, find its area.

Answers

Answer:

A=108 cm²

Step-by-step explanation:

length (l)=3w

perimeter=2l+2w

P=2(3w)+2w

48=6w+2w

width=48/8

w=6

l=3w=3(6)=18

l=18 cm  ,  w=6 cm

Area=l*w

A=18*6

A=108 cm²

What's the simplified expression of -2a-3 bº?

Answers

Answer:

-2a - 3

Step-by-step explanation:

bº equals 1 due to the zero exponent.

Thus, -2a-3 bº simplifies to -2a - 3.

Answer:

−2/a^3  

Step-by-step explanation:

Can someone please help I don't understand. Determine the domain and range of the following function. Record your answers in set notation.

Answers

Look at the screenshot!!!

Use Taylor series to evaluate
limx→0(tan x − x)/x^3

Answers

Recall that

tan(x) = sin(x)/cos(x)

and

sin(x) = x - x ³/6 + x ⁵/120 - x ⁷/5040 + …

cos(x) = 1 - x ²/2 + x ⁴/24 - x ⁶/720 + …

Truncate the series to three terms. Then

[tex]\displaystyle \lim_{x\to0}\frac{\tan(x)-x}{x^3} = \lim_{x\to0}\frac{\frac{x-x^3/6+x^5/120}{1-x^2/2+x^4/24}-x}{x^3} \\\\ = \lim_{x\to0}\left(\frac{x-x^3/6+x^5/120}{x^3-x^5/2+x^7/24}-\frac1{x^2}\right) \\\\ = \lim_{x\to0}\left(\frac{1-x^2/6+x^4/120}{x^2-x^4/2+x^6/24}-\frac1{x^2}\right) \\\\ = \lim_{x\to0}\left(\frac{1-x^2/6+x^4/120}{x^2\left(1-x^2/2+x^4/24\right)}-\frac1{x^2}\right) \\\\ = \lim_{x\to0}\left(\frac{1-x^2/6+x^4/120}{x^2\left(1-x^2/2+x^4/24\right)}-\frac{1-x^2/2+x^4/24}{x^2\left(1-x^2/2+x^4/24\right)}\right) \\\\ = \lim_{x\to0}\frac{x^2/3-x^4/30}{x^2\left(1-x^2/2+x^4/24\right)} \\\\ = \lim_{x\to0}\frac{1/3-x^2/30}{1-x^2/2+x^4/24} = \boxed{\frac13}[/tex]

For
90° < 0 < 270°
, which of the primary trigonometric functions may have positive values?

Answers

Answer:

sine and tangent

will be positive.

Write the polar form of a complex number in standard form for [tex]8[cos(\frac{\pi}{2}) + isin(\frac{\pi}{2})][/tex]

Answers

Answer:

Solution : 8i

Step-by-step explanation:

We can use the trivial identities cos(π / 2) = 0, and sin(π / 2) = 1 to solve this problem. Let's substitute,

[tex]8\left[cos\left(\frac{\pi }{2}\right)+isin\left(\frac{\pi \:}{2}\right)\right][/tex] = [tex]8\left(0+1i\right)[/tex]

And of course 1i = i, so we have the expression 8(0 + i ). Distributing the " 8, " 8( 0 ) = 0, and 8(i) = 8i, making the fourth answer the correct solution.

A quiz has 4 multiple-choice questions with 4 possible answer choices each. For each question, there is only 1 correct answer.

A student guesses each answer at random. What is the probability of getting exactly 3 questions correct, to the nearest percent?

(3 correct and 1 incorrect)

Answers

Answer:

5%

Step-by-step explanation:

so, for 3 questions he has a 1 in 4 chances to get it right.

4³ chances, so a 1/4³ probability.

and he has one other question with a 3 in 4 chance to get it wrong.

a 3/4 probability.

that is in total

1/4³ × 3/4 = 3/4⁴

and now we have 4 over 3 combinations as possibilities to get 3 right and 1 wrong.

that is 4! / (3! × (4-3)!) = 4

so our total probability is

4 × 3/4⁴ = 3/4³ = 3/64 ≈ 0.05 = 5%

in other words, the expected quote for him to achieve that result is in 5 out of 100 (or 1 out of 20) attempts.

If ‘BOXES’ is OBXSE, then BOARD is

Answers

9514 1404 393

Answer:

  OBADR

Step-by-step explanation:

The first two letters are swapped, and the last two letters are swapped.

  BOARD . . . becomes

  OBADR

Find the volume of this composite figure. Show all work.

Please!!!!!

Answers

Answer:

718.75ft³

Step-by-step explanation:

Rectangular Prism=5x5x17.5=437.5

Cube=5x5x5=125

Triangular Prism=5x5x12.5x.5=156.25

437.5+125+156.25=718.75ft³

What best explains whether a triangle with side links 5 cm 13 cm and 12 cm is a right triangle

Answers

Step-by-step explanation:

Pythagoras Theorem

If the sum of the squares of the smaller two sides is equal to the square if the third side then it is a right triangle

[tex] {a}^{2} + {b}^{2} = {c}^{2} [/tex]

So, (5)^2 + (12)^2

is 25 + 144 = 169

Which is equal to (13)^2 which is also 169

The sides of the given triangle follows pythagoras theorem, therefore it is a right triangle

Hope it helps:)

Answer:

Pythagorean theorem

Step-by-step explanation:

We can explain it using  the Pythagorean theorem. Right triangles always have a hypotenuse which is the longest side. That means 13 must be the hypotenuse of the triangle. The Pythagorean theorem is a^2+b^2=c^2

We already know all the values since every side is given so we just fill it in.

5^2+12^2=13^2

25+144=169

169=169

It is a right triangle

Complete the equation describing how x
and y are related.
Х у
y = [? ]x +
07
1 9
2 11
3 13
4 15
5 17
Enter the answer that
belongs in [?]

Answers

Answer:

Hello,

Answer 2

Step-by-step explanation:

7=2*0+7

9=2*1+7

11=2*2+7

13=2*3+7

15=2*4+7

17=2*5+7

y=2*x+7

An other way:

[tex]points\ ( 0,7)\ and\ (1,9)\\\\\Delta\ y=9-7=2\\\Delta\ x=1-0=1\\\\\\y-7=(x-0)*2\\\\y=2x+7\\[/tex]

The complete equation is [tex]y = 2x+7[/tex].

What is equation?

An equation is a condition on a variable such that two expressions in the variable should have equal value.

What is substitution?

Substitution means replacing the variables (letters) in an algebraic expression with their numerical values.

According to the question.

We have a table which shows the relation between x and y.

Let the missing term be a and b.

The the given equation becomes

[tex]y = ax + b[/tex]

For finding the value of a and b.

Substitute x = 0 and y = 7 in equation y = ax + b.

[tex]\implies 7 = a(0) + b\\\implies b = 7[/tex]

Again, substitute  x = 1 and y = 9 in the equation y = ax+ b

[tex]\implies 9 = a(1) +b\\\implies 9 = a + 7\\\implies a = 2[/tex]

substitute the value of a and b in the equation y = ax + b.

[tex]\implies y = 2x+ 7[/tex]

Therefore, the complete equation is [tex]y = 2x+7[/tex].

Find out more information about equation and substitution here:

https://brainly.com/question/2581775

#SPJ2

How many 1/8 servings can I get from 3/4

Answers

Answer:

6 1/8th cups in 3/4 cups

Step-by-step explanation:

Answer:

6

Step-by-step explanation:

you convert 3/4 into 8ths which will be 6/8

A carpenter is making doors that are 20582058 millimeters tall. If the doors are too long they must be trimmed, and if they are too short they cannot be used. A sample of 1010 doors is made, and it is found that they have a mean of 20462046 millimeters with a standard deviation of 1515. Is there evidence at the 0.050.05 level that the doors are too short and unusable

Answers

Answer:

Z= 0.253

Z∝/2 = ± 1.96

Step-by-step explanation:

Formulate the null and alternative hypotheses as

H0 : u1= u2 against Ha : u1≠ u2 This is a two sided test

Here ∝= 0.005

For alpha by 2 for a two tailed test Z∝/2 = ± 1.96

Standard deviation = s= 15

n= 10

The test statistic used here is

Z = x- x`/ s/√n

Z= 2058- 2046 / 15 / √10

Z= 0.253

Since the calculated value of Z= 0.253 falls in the critical region we reject the null hypothesis.

There is  evidence at the 0.05 level that the doors are too short and unusable.

A sample contains 61 pairs of values. Find the critical value for the linear correlation coefficient from Table A-6 corresponding to a 0.05 significance level.

0.236

0.254

0.279

0.330

Answers

Answer:

0.254

Step-by-step explanation:

Table A-6 will be shown below for reference. Since none of the answer choices contain the critical value for 61, we can just round that number to 60. We will see that the critical value is 0.254. If you're having trouble reading the table below, look at the columns to find the corresponding significance level you are working with then find the sample value.

Best of Luck!

Please help!!
A) In a movie, a mad scientist enlarges a cow to 100 times its normal size. How much stronger would its legs be than a normal cow?
B) How many times more would it weigh than a normal cow?
C) Can you see how results A and B would yield a cow that would collapse under its own weight?

Answers

Answer:

100 times everything.

Step-by-step explanation:

If the cow is 100 times larger than its normal size, obviously everything else should be 100 times stronger and heavier.

Find all real solutions of the equation: x 2 + 3x − 10 = 0

Answers

Answer: x=8/3 or x= 2.6666....

Step-by-step explanation:

[tex]2+3x-10=0[/tex]

[tex]2-10=-8[/tex]

[tex]3x-8=0[/tex]

add 8 on both sides

[tex]3x-8+8=0+8[/tex]

[tex]3x=8[/tex]

divide 3 on both sides

[tex]x=\frac{8}{3}[/tex]

Answer:

8/3

Step-by-step explanation:

2 +3x + 10 = 0

2-10 +3x = 0

-8 + 3x = 0

3x = 8

x = 8/3

A random sample of size results in a sample mean of and a sample standard deviation of . An independent sample of size results in a sample mean of and sample standard deviation of . Does this constitute sufficient evidence to conclude that the population means differ at the level of​ significance?

Answers

Answer:

A typical example would be when a statistician wishes to estimate the ... by the standard deviation ó) is known, then the standard error of the sample mean is given by the formula: ... The central limit theorem is a significant result which depends on sample size. ... So, the sample mean X/n has maximum variance 0.25/ n.

Step-by-step explanation:

prove that 2^n+1>(n+2).sin(n)​

Answers

Step-by-step explanation:

F(n)=|sin(n)|+|sin(n+1)|

then

F(n+π)=|sin(n+π)|+|sin(n+π+1)|=|sin(n)|+|sin(n+1)|=F(n)

and

F(π−n)=|sin(π−n)|+|sin(π−n+1)|=|sinn|+|sin(n−1)|≠F(n)

so we must prove when n∈(0,π), have

F(n)>2sin12

when n∈(0,π−1),then

F(n)=sinn+sin(n+1)=sinn(1+cos1)+sin1cosn

and n∈(π−1,π),then

F(n)=sinn−sin(n+1)

How prove it this two case have F(n)>2sin12? Thank you

and I know this well know inequality

|sinx|+|sin(x+1)|+|sin(x−1)|≥2sin1,x∈R

B is the midpoint of line segment AD, and C is the midpoint of line segment BD. If AD = 12, what is BC?

A. 1.5
B. 3
C. 4
D. 6

Answers

The only way to answer this is to see the diagram

An ‘in shuffle’ is a perfect shuffle on a standard deck of 52 playing cards that splits the deck in half, then interleaves cards starting with the top half.

Required:
a. What is the position of the first card after the 7th shuffle?
b. How many times must one perform the shuffle so that the top card becomes the bottom card?
c. When do the first and last cards in the deck touch?

Answers

Answer:

  a) position 22

  b) 26

  c) shuffle 25

Step-by-step explanation:

Assuming the shuffling occurs so that the bottom card of the top half of the deck (card 26) becomes the bottom card (card 52), while the top card of the bottom half (card 27) becomes the top card (card 1), the sequence of card 1 positions with successive shuffles is ...

  {2, 4, 8, 16, 32, 11, 22, 44, 35, 17, 34, 15, 30, 7, 14, 28, 3, 6, 12, 24, 48, 43, 33, 13, 26, 52, 51, 49, 45, 37, 21, 42, 31, 9, 18, 36, 19, 38, 23, 46, 39, 25, 50, 47, 41, 29, 5, 10, 20, 40, 27, 1}

That is, after the first shuffle, card 1 is at position 2; after the second shuffle, it is at position 4; and so on.

(a) Hence the position of card 1 after the 7th shuffle is 22.

__

(b) The top card is in position 52 after 26 shuffles.

__

(c) The top card is in position 26 after 25 shuffles; the bottom card is in position 27 after 25 shuffles. That is when they first touch. (They touch again after 51 shuffles.)

Needs to be done using the Pythagorean Theorem

Answers

Answer:

11.3 ft high

Step-by-step explanation:

Pythagorean Theorem: a² + b² = c²

4² + b² = 12²

16 + b² = 144

b² = √128

b = 11.3

How do you compress this?

Answers

[tex]\displaystyle\\(a+b)^n\\T_{r+1}=\binom{n}{r}a^{n-r}b^r\\\\\\(x+2)^7\\a=2x\\b=3\\r+1=4\Rightarrow r=3\\n=5\\T_4=\binom{5}{3}\cdot (2x)^{5-3}\cdot3^3\\T_4=\dfrac{5!}{3!2!}\cdot 4x^2\cdot27\\T_4=\dfrac{4\cdot5}{2}\cdot 4x^2\cdot27\\\\T_4=1080x^2[/tex]

Simone invests $2,000 in an account that compounds interest quarterly and earns 9%. How many years will it take for his money to double? (Round your answer to one decimal place.)

Answers

no te puedo contestarte yo no hablo inglés

Find the intersection point for the following liner function f(x)= 2x+3 g(x)=-4x-27

Answers

Answer:

( -5,-7)

Step-by-step explanation:

f(x)= 2x+3 g(x)=-4x-27

Set the two functions equal

2x+3 = -4x-27

Add 4x to each side

2x+3+4x = -4x-27+4x

6x+3 = -27

Subtract 3

6x+3 - 3 = -27-3

6x = -30

Divide each side by 6

6x/6 = -30/6

x =-5

Now we need to find the output

f(-5) = 2(-5) +3 = -10+3 = -7

Answer:

Step-by-step explanation:

big burgewr

Find the measure of c.

Answers

Answer:

149 degrees

Step-by-step explanation:

This shape is a cyclic, so opposite angles add up to 180 degrees.

180-31 = 149

For a closed rectangular box, with a square base x by x cm and height h cm, find the dimensions giving the minimum surface area, given that the volume is 18 cm3.

Answers

Answer:

∛18 * ∛18 * 18/(∛18)²

Step-by-step explanation:

Let the surface area of the box be expressed as S = 2(LB+BH+LH) where

L is the length of the box = x

B is the breadth of the box = x

H is the height of the box = h

Substituting this variables into the formula, we will have;

S = 2(x(x)+xh+xh)

S = 2x²+2xh+2xh

S = 2x² + 4xh and the Volume V = x²h

If V = x²h; h = V/x²

Substituting h = V/x² into the surface area will give;

S = 2x² + 4x(V/x²)

Since the volume V = 18cm³

S = 2x² + 4x(18/x²)

S =  2x² + 72/x

Differentiating the function with respect to x to get the minimal point, we will have;

dS/dx = 4x - 72/x²

at dS/dx = 0

4x - 72/x² = 0

- 72/x² = -4x

72 = 4x³

x³ = 72/4

x³  = 18

[tex]x = \sqrt[3]{18}[/tex]

Critical point is at [tex]x = \sqrt[3]{18}[/tex]

If x²h = 18

(∛18)²h =18

h = 18/(∛18)²

Hence the dimension is  ∛18 * ∛18 * 18/(∛18)²

Arbitron Media Research Inc. conducted a study of the iPod listening habits of men and women. One facet of the study involved the mean listening time. It was discovered that the mean listening time for a sample of 13 men was 35 minutes per day. The standard deviation was 8 minutes per day. The mean listening time for a sample of 11 women was also 35 minutes, but the standard deviation of the sample was 18 minutes. Use a two-tailed test and at 0.10 significance level, can we conclude that there is a difference in the variation in the listening times for men and women?

Answers

Answer:

Since the critical f-value of the test statistic is less than the f value of 2.9130, we will fail to reject the null hypothesis and conclude that there's no sufficient evidence to support the claim that there is a difference in the variation in the listening times for men and women

Step-by-step explanation:

We are given;

Sample size for men; n1 = 13

Sample size for women; n2 = 11

standard deviation for men; s1 = 8 minutes

Standard deviation for women; s2 = 18 minutes.

Significance level; α = 0.1

Let's state the hypothesis;

Null hypothesis;H0: (μ1)² = (μ2)²

Alternative hypothesis;Ha: (μ1)² ≠ (μ2)²

The value of the test statistic would be;

F = (s1)²/(s2)²

F = 8²/18² = 0.1975

Now, degree of freedom for n1 is;

DF1 = n1 - 1

DF1 = 13 - 1

DF1 = 12

Also, degree of freedom for n2 is;

DF2 = 11 - 1

DF2 = 10

Now, since it's two tailed, we will make use of α/2 for the F-distribution table.

Thus, α/2 = 0.1/2 = 0.05

So,from the f-table attached, at df1 = 12 and df2 = 10,the F-Critical value is;

F_α/2 = 2.9130

Since,the critical f-value of the test statistic is less than 2.9130, we will fail to reject the null hypothesis and conclude that there's no sufficient evidence to support the claim that there is a difference in the variation in the listening times for men and women

Variable g is 8 more than variable w. Variable g is also 2 less than w. Which pair of equations best models the relationship between g and w? g = 8w g = w + 2 w = g + 8 w = g − 2 w = 8g w = g + 2 g = w + 8 g = w − 2

Answers

Answer: g = w + 8    g=w-2

Step-by-step explanation:

We could represent the word phrases by the equations.

g = w + 8  

g = w - 2  

Answer:

g = w + 8

g = w - 2

Step-by-step explanation:

Assuming that g and w exists, then we can show the relation as described:

"Variable g is 8 more than variable w."

g = w + 8

"Variable g is also 2 less than w."

g = w - 2

These are the two equations of the described relationship between g and w.

Note that g could not actually exist in the real number system:

g = w + 8

g = w - 2

w + 8 = w - 2

w - w = -2 - 8

0 != -10

This is impossible within the real number system.

Cheers.

Other Questions
Help me pleaseeeeeee Rashad consistently went above and beyond to meet his personal deadlines and to help other team members to ensure a recent product launch was completed on time. His manager was impressed and offered Rashad the opportunity for a coveted leadership position on the next generation product team. The manager's action is consistent with _______ justice. distributive restorative customary reparative frontier what privacy risks do new technologies present,and how do we decide if they're worth it? how do plants use carbon dioxide A.They release it as waste B.To build proteins C.They store it as fuel in limestone deposits D.To produce sugars Solve equation show all steps what 2x-3x+5=18 Which iseasierPushor pull.when force is at angle what should a compare and contrast essay not identify? WAS/WERE,PAST PASSIVE, ayuda:( por favor ! I need help with 6 and 7 Why is the lowest c in treble clef called middle c?A. Points to the middle staff line of treble clefB. Points to the middle staff line of the grand staffC.points to the middle staff line of bass clef The graph of the function f(x) = (x 3)(x + 1) is shown.On a coordinate plane, a parabola opens up. It goes through (negative 1, 0), has a vertex at (1, negative 4), and goes through (3, 0).Which describes all of the values for which the graph is positive and decreasing?all real values of x where x < 1all real values of x where x < 1all real values of x where 1 < x < 3all real values of x where x > 3 Which of the following compounds is more soluble in a 0.10 M NaCN solution than in pure neutral water? Ca3(PO4)2 AgBr CaCO3 Mg(OH)2 NH4ClO4 y =18x + 3A) Slope: 8; y-intercept: 3B) Slope: 13; y-intercept: 18C) Slope: 1; y-intercept: 18D) Slope: 18; y-intercept: 3 Men are more likely than women to be diagnosed with ________________ disorders. Anxiety substance use mood schizophrenia help. What is the Fall of mankind? sun inc factors 2,000,000 of its accounts receivables withou recourse for a finance charge of 5%. the company retains equal to 10% of the accounts recevable for possible adjustments. sun estimates of the recourse liabilitty at 75,000. What would be recorded as gain or loss on the transfer of receivables? If p varies directly with T and p =105 when T=400.Find p when T =500 Solve.Simplify 7 to the fifth power times 4 to the 5th power explain the delay in hearing of a sound sodium bisulfite is an ionic compound that is used as a mild bleaching agent and a food preservative. It contains the bisulfate ion, an amphiprotic ion with the chemical formula HSO-. a. Write the chemical equation for the reaction of HSO- with OH-. Is the bisulfite ion functioning as an acid or a base in this reaction?b. Write the chemical equation for the reaction of HSO- with HO+. Is the bisulfite ion functioning as an acid or a base in this reaction?