One more than three times a number is the same as four less than double a number

Answers

Answer 1

Answer:

3x + 1 = 2x - 4.  x = -5

Step-by-step explanation:


Related Questions

Find the fractal dimension of the object.

Answers

Answer:

maaqqqf aku ngak tau soal jawaban in

What is the formula for the volume of a pyramid?

V = πr2h
V = 3/4πr2h
V = 1/3πr2h
V = 1/3Bh

Answers

Which behavior would best describe someone who has good communication skills with customers ? a) Following up with some customers b) Talking to customers more than listening to them c) Repeating back what the customer says d) Interrupting customers frequently
The formula is V=1/3Bh

Question 6 of 10
Which situation shows a constant rate of change?
A. The number of tickets sold compared with the number of minutes
before a football game
B. The height of a bird over time
C. The cost of a bunch of grapes compared with its weight
D. The outside temperature compared with the time of day
SUBMI

Answers

I’d personally say either A or C, and here’s why: with B and D, you don’t know what will change it, or make it go from a linear rate of change to exponential for B, and for D it’s more of a quadratic than a linear. It’s for that same reasoning that I’d hesitate to say A over C: there are other factors other than strictly the number of tickets sold and the number of minutes pre-football game. C, with the grapes, on the other hand, is a linear one that will always changeable depending on weight of the grapes.

a) the cost of a bunch of grapes compared with its weight

GRAAAAAAAAAAAAAAAAAAAAAAAAAAAAPES!!!!!

look at the image below for the question !!!!!!

Answers

Answer:

136 cm2

Step-by-step explanation:

6*2=12    12*2=24

6*7=42   42*2=84

7*2=14    14*2=28

Add.

24+84+28=136

I hope this helps!

A tortoise is walking in the desert. It walks 7.5 meters in 3 minutes. What is its speed?
meters per minute

Answers

9514 1404 393

Answer:

  2.5 m/min

Step-by-step explanation:

To find meters per minute, divide meters by minutes:

  (7.5 m)/(3 min) = 2.5 m/min

The speed of the tortoise is 2.5 meters per minute.

x
Find the value
of x. Show
3
10
your work.

Answers

Step-by-step explanation:

Hello, there!!!

Let ABC be a Right angled triangle,

where, AB = 3

BC= 10

and AC= x

now,

As the triangle is a Right angled triangle, taking angle C asrefrence angle. we get,

h= AC = x

p= AB = 3

b= BC= 10

now, by Pythagoras relation we get,

[tex]h = \sqrt{ {p}^{2} + {b}^{2} } [/tex]

[tex]or ,\: h = \sqrt{ {3}^{2} + {10}^{2} } [/tex]

by simplifying it we get,

h = 10.44030

Therefore, the answer is x= 10.

Hope it helps...

the sum of √12 and √3 is

Answers

Step-by-step explanation:

You're going to break√12 into ✓4 and √3 because 4*3 = 12. Square rooting 4 will give you two, and now you can add since the argument of the roots are the same.

Find the standard form of the equation of the ellipse with the given characteristics and center at the origin. Foci: (±7, 0); major axis of length 18

Answers

Answer: [tex]\dfrac{x^2}{81}+\dfrac{y^2}{32}=1[/tex]

Step-by-step explanation:

The standard form of equation of ellipse with foci (±c,0) as:

[tex]\dfrac{x^2}{a^2}+\dfrac{y^2}{b^2}=1[/tex]

, where major axis = 2a and minor axis = 2b

Given: Foci: (±7, 0); major axis of length 18

i.e. c= 7 and 2a =18 ⇒a= 9

Also,

[tex]c^2=a^2-b^2\Rightarrow\ b^2= a^2-c^2\\\\\Rightarrow\ b^2={9^2-7^2}={81-49}\\\\\Rightarrow\ b^2=32[/tex]

Put value of [tex]a^2[/tex] and [tex]b^2[/tex] , we get the required equation :

[tex]\dfrac{x^2}{81}+\dfrac{y^2}{32}=1[/tex]

Given the following three points, find by the hand the quadratic function they represent (0,6, (2,16, (3,33)

Answers

Answer:

[tex] f(x) = 4x^2 - 3x + 6 [/tex]

Step-by-step explanation:

Quadratic function is given as [tex] f(x) = ax^2 + bx + c [/tex]

Let's find a, b and c:

Substituting (0, 6):

[tex] 6 = a(0)^2 + b(0) + c [/tex]

[tex] 6 = 0 + 0 + c [/tex]

[tex] c = 6 [/tex]

Now that we know the value of c, let's derive 2 system of equations we would use to solve for a and b simultaneously as follows.

Substituting (2, 16), and c = 6

[tex] f(x) = ax^2 + bx + c [/tex]

[tex] 16 = a(2)^2 + b(2) + 6 [/tex]

[tex] 16 = 4a + 2b + 6 [/tex]

[tex] 16 - 6 = 4a + 2b + 6 - 6 [/tex]

[tex] 10 = 4a + 2b [/tex]

[tex] 10 = 2(2a + b) [/tex]

[tex] \frac{10}{2} = \frac{2(2a + b)}{2} [/tex]

[tex] 5 = 2a + b [/tex]

[tex] 2a + b = 5 [/tex] => (Equation 1)

Substituting (3, 33), and c = 6

[tex] f(x) = ax^2 + bx + x [/tex]

[tex] 33 = a(3)^2 + b(3) + 6 [/tex]

[tex] 33 = 9a + 3b + 6 [/tex]

[tex] 33 - 6 = 9a + 3b + 6 - 6 [/tex]

[tex] 27 = 9a + 3b [/tex]

[tex] 27 = 3(3a + b) [/tex]

[tex] \frac{27}{3} = \frac{3(3a + b)}{3} [/tex]

[tex] 9 = 3a + b [/tex]

[tex] 3a + b = 9 [/tex] => (Equation 2)

Subtract equation 1 from equation 2 to solve simultaneously for a and b.

[tex] 3a + b = 9 [/tex]

[tex] 2a + b = 5 [/tex]

[tex] a = 4 [/tex]

Replace a with 4 in equation 2.

[tex] 2a + b = 5 [/tex]

[tex] 2(4) + b = 5 [/tex]

[tex] 8 + b = 5 [/tex]

[tex] 8 + b - 8 = 5 - 8 [/tex]

[tex] b = -3 [/tex]

The quadratic function that represents the given 3 points would be as follows:

[tex] f(x) = ax^2 + bx + c [/tex]

[tex] f(x) = (4)x^2 + (-3)x + 6 [/tex]

[tex] f(x) = 4x^2 - 3x + 6 [/tex]

f(x)=−5x^3−4x^2+8x and g(x)=−4x^2+8, find (f−g)(x) and (f−g)(−2).

Answers

Answer:

see explanation

Step-by-step explanation:

(f - g)(x) = f(x) - g(x) , that is

f(x) - g(x)

= - 5x³ - 4x² + 8x - (- 4x² + 8) ← distribute parenthesis by - 1

= - 5x³ - 4x² + 8x + 4x² - 8 ← collect like terms

= - 5x³ + 8x - 8

Substitute x = - 2 into this expression, thus

(f - g)(- 2)

= - 5(- 2)³ + 8(- 2) - 8

= - 5(- 8) - 16 - 8

= 40 - 16 - 8

= 16

Please help. I’ll mark you as brainliest if correct!

Answers

Answer:

The system is dependent:

x=-3t-7

y=-5t-15

z=t

Step-by-step explanation:

I chose to use a matrix to solve this system of equations. Once put into matrix form, you need to row reduce the system into its simplest form (Row Reduced Echelon form). Doing this, we find that the system is dependent on the z variable. And following usual procedures, we let z equal some other letter; which is t in this case. Then we isolate each variable to get the answer.

Check the attachment for the work.

[The arrows indicate a row swap and the parenthesis indicates addition if a constant multiple of one row to another]

Which of the following is a solution for 5 - 2x ≤ -3?

Answers

Answer:

x≥4

Step-by-step explanation:

The required solution for the inequality 5 - 2x ≤ -3 is x ≥ 4 or x ∈ [4, ∞).

What is inequality?

Inequality shows relation between two expression which are not equal to each others.

The given inequality is,

5 - 2x ≤ -3.

Solve the inequality,

Add 3 to both the sides,

5 - 2x + 3 ≤ -3 + 3

8 - 2x ≤ 0

-2x  ≤ -8

Multiply -1 both the sides,

2x ≥ 8

x ≥ 4

The solution for the inequality is x ≥ 4 or x ∈ [4, ∞).

To know more about Inequality on:

https://brainly.com/question/20383699

#SPJ2

Of 900 people surveyed, 480 were male and 410 had cell phones. Of those with cell phones, 290 were female. What is the probability that a person surveyed was either male or had a cell phone? A. 600/900 = 0.6667 B. 770/900 = 0.8556 C. 360/900 = 0.40 D. 820/900 = 0.9111

Answers

Answer:

C. 360/900 = 0.40

Step-by-step explanation:

The number of the males that are using cellphone and the females who are using cell phones are in total 410. The total people surveyed are 900 people. There are total 480 males and rest 420 are females. Among the 420 females there are 290 females who use cellphones. The probability for males can be given by 360/900.

(2)
Study the figure below and use the counting square method to determine
the perimeter and area of the diagram in the grid. The idea for using the
counting squares is to enable you to develop the formulae that can be used
to calculate the area and perimeter of a rectangle.
2
G
7
8 9
12 LIS
o 23 24 25
2427128129130
3132333435
363 ks halu
L22HLLLS 4.12712849 Sos: S-3 54 55
56 57 58 591696162163164165 66 67 68 69174
772 19L4214277879808182838485
66 87 88 89 90 91 92 93 94 95 96 97 98 99 100
5
plu2!3114
Gise 2212 213 24 2a2a134
8
Adapted from Tess-India (Elementary Mathematics)
Explain step by step, how you arrived at your answer to determine the area
and perimeter of the figure in the grid paper.​

Answers

The perimeter of a shape is the summation of the visible lengths of the figure. The area; however, is the product of the length and the width of the figure

The perimeter of the figure is 58 units and the area of the figure is 130 unit square

Your question is not properly formatted and the diagram required to solve the question is missing. I've included the appropriate diagram.

Having said that, the perimeter is:

Perimeter = sum of all sides

[tex]Perimeter = 7 + 8 + 5 + 8 + 3 + 6 + 3 + 5 + 7 + 6[/tex]

[tex]Perimeter = 58[/tex]

To calculate the area, we use a different approach.

First, we split the figure into 3, we then calculate the area of each sub-figure, and then we add up the calculated areas.

From left to right, we have:

Rectangle 1

[tex]Length = 7\\Width = 6[/tex]

Rectangle 2

[tex]Length = 5\\Width = 6+8 = 14[/tex]

Rectangle 3

[tex]Length = 3\\Width = 6[/tex]

The area of a rectangle is:

[tex]Area = Length * Width[/tex]

So, the area of the figure is:

[tex]Area = 7 * 6 + 5 * 14 + 3 * 6[/tex]

[tex]Area = 130[/tex]

Learn more at:

https://brainly.com/question/2649416

Find the perimeter of a rectangle that is 7 centimeters long and 7 centimeters wide

Answers

Answer:

28cm

Step-by-step explanation:

2L+2W=

14+14=28

(It’s a square)

write 768,676 in words

Answers

Answer:

seven hundred sixty-eight thousand six hundred seventy-six

hope this answer correct :)

that might be “ seven hundred sixty-eight thousand six hundred seventy-six”

Determine whether each equation has one solution, no solution or infinitely many solutions. 4x + 10 = 2(2x + 5) 4x - 5 = 4x + 10 4x - 5 = -5

Answers

Answer:

see below

Step-by-step explanation:

4x + 10 = 2(2x + 5)

Distribute

4x+10 = 4x+10

Since the left side is identical to the right side, there are infinite solutions

4x - 5 = 4x + 10

Subtract 4x from each side

-5 = 10

This is never true, so there are no solutions

4x-5 = -5

Add 5 to each side

4x = 0

x=0

There is one solutions

Hunda Corporation’s expected year end dividend amounting to RM1.60, and its required return is 11 percent. The dividend yield is 6 percent and its growth rate is expected to be constant in the future. What is Hunda Corporation’s expected stock price in 7 years?

Answers

Answer:

Hunda expected stock price in 7 years = RM48.12

Step-by-step explanation:

expected year end dividend = RM1.60

required return = 11%

dividend yield = 6%

growth rate = constant

Determine Hunda corporation's expected stock price in 7 years

stock price in 7 years

= expected year end dividend / (required return rate - dividend yield rate )

= 1.6 * (1.06)^7  / ( 0.11 - 0.06 )

= 2.4058 / 0.05 =  48.12%

A 95% confidence interval indicates that:
A. 95% of the intervals constructed using this process based on samples from this population will
include the population mean
B. 95% of the time the interval will include the sample mean
C. 95% of the possible population means will be included by the interval
D. 95% of the possible sample means will be included by the interval

Answers

95% interval would be 95% of the population mean.

The answer should be:

A. 95% of the intervals constructed using this process based on samples from this population will

include the population mean

Answer:

A

Step-by-step explanation:

A 95% confidence interval indicates that 95% of the intervals constructed using this process based on samples from this population will

include the population mean

Simplify 10 - [14 = (3 + 4) · 2]+3

Answers

Answer:

There is a typo near the equal sign.

There can be two different answers if we think that = sign as + or -.

First way: Making = as +

=> 10 - [14 + (3+4) x 2] +3

=> 10 - [14 + 7 x 2] + 3

=> 10 - [14 + 14] + 3

=> 10 - 28 + 3

=> 10 + 3 - 28

=> 13 - 28

=> -15

=> So, -15 is the answer if we consider "=" sign as "+" sign.

Second way: Making = as -

=> 10 - [14 - (3+4) x 2] + 3

=> 10 - [14 - 7 x 2] + 3

=> 10 - [14 - 14] + 3

=> 10 - 0 + 3

=> 10 + 3

=> 13

=> So, 13 is the answer if we consider "=" sign as "-" sign.

To make a batch of salad dressing, combine 9 tablespoons of oil with 18 tablespoons of vinegar. How many tablespoons of vinegar are needed for every tablespoon of oil?

Answers

Answer:

18 divided by nine is two. so for every one table spoon of oil there's two table spoons of vinegar. Please give brainliest

Answer:

2

Step-by-step explanation:

Make a ratio:

Oil : Vinegar

9 : 18

1 : 2

For each tablespoon of oil, 2 tablespoons of vinegar is needed.

Hope this helped.

Word problems ! Please help

Answers

Answer:

19- 2(xy+yz+xz)

20- 16t(5-t)

Step-by-step explanation:

19) factor 2xy+2yz+2xz

2xy+2yz+2xz

=2(xy+yz+xz)

20) factor -16t^2 +80t

=80t-16t^2

=16(5t-t^2)

=16t(5-t)

4 trillion = 4x 10million missing exponent

Answers

Answer:

3

Step-by-step explanation:

im pretty sure

Solve for x.
–5(–2x – 5) – 2 – 1= -12

Answers

Answer:

x=-17/5

Step-by-step explanation:

–5(–2x – 5) – 2 – 1= -12

+10x+25-2-1=-12

10x+22=-12

10x=-12-22

10x=-34

x=-34/10

x=-17/5

Step-by-step explanation:

Open the brackets

10x +25 -2 - 1= -12

Collect the like terms

10x = -12-25+2+1

10x = -34

Divide both sides by 10

Therefore,x = -34/10 = -3.4

HELP PRECALC NEED IN PROOF FORM

Answers

Hello, please consider the following.

We know the following, right ?

[tex](\forall a, b \in \mathbb{R}) \left( sin(a+b)=sin(a)sin(b)+cos(a)cos(b) \right)[/tex]

So, here, it gives.

[tex]Asin(\omega t+\phi)=Asin(\phi){\sf \bf sin(\omega t)}+Acos(\phi){\sf \bf cos(\omega t)}\\\\=c_2{\sf \bf sin(\omega t)}+c_1{\sf \bf cos(\omega t)}\\\\\text{ *** where }c_2=Asin(\phi) \text{ and } c_1=Acos(\phi) \text{ ***}[/tex]

Do not hesitate if you need further explanation.

Solve the formula for t
V = 4(3.14)ct + 6(3.14)c^2

Answers

9514 1404 393

Answer:

  t = (V -6(3.14)c^2)/(4(3.14)c)

Step-by-step explanation:

Isolate the term containing t, then divide by the coefficient of t

  [tex]V=4(3.14)ct+6(3.14)c^2\\\\V-6(3.14)c^2=t(4(3.14)c)\\\\\boxed{t=\dfrac{V-6(3.14)c^2}{4(3.14)c}}[/tex]

can you please help me with this

Answers

Answer:

  [tex]\displaystyle A=\dfrac{1}{2}\int_\pi^{\frac{7\pi}{6}}{(\cos{\theta}+\sin{2\theta})^2}\,d\theta[/tex]

Step-by-step explanation:

The shaded area is the area of the curve bounded by θ = π and θ = 7π/6.* A differential of area in polar coordinates is ...

  dA = (1/2)r^2·dθ

So, the shaded area is ...

   [tex]\displaystyle\boxed{A=\dfrac{1}{2}\int_\pi^{\frac{7\pi}{6}}{(\cos{\theta}+\sin{2\theta})^2}\,d\theta}[/tex]

_____

* We found these bounds by trial and error using a graphing calculator to plot portions of the curve.

8. When dividing polynomials using factorization, cancelling identical factors in the denominator and the numerator will give the _______.
A. remainder
B. dividend
C. quotient
D. divisor

Answers

●✴︎✴︎✴︎✴︎✴︎✴︎✴︎✴︎❀✴︎✴︎✴︎✴︎✴︎✴︎✴︎✴︎✴︎●

          Hi my lil bunny!

❧⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯☙

When dividing polynomials using factorization, cancelling identical factors in the denominator and the numerator will give the remainder.

A. remainder

B. dividend

C. quotient

D. divisor

❧⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯☙

●✴︎✴︎✴︎✴︎✴︎✴︎✴︎✴︎❀✴︎✴︎✴︎✴︎✴︎✴︎✴︎✴︎✴︎●

Hope this helped you.

Could you maybe give brainliest..?

❀*May*❀

Answer:

a. remainder

Step-by-step explanation:

took the test

dont leave your house without a vest

or you will get hit in the vital organs in your chest


PLZ HELP ME AND IF U CAN XPLAIN

Answers

Answer:

B. 1/2

Step-by-step explanation:

Slope formula = [tex]\frac{y_{2}-y_{1} }{x_{2}-x_{1}}[/tex]

[tex]\frac{(-4)-(-8) }{(6)-(-2)}[/tex]

[tex]\frac{4}{8}[/tex]

[tex]\frac{1}{2}[/tex]

Students who score within 14 points of the number 88 will pass a particular test. Write this statement using absolute value notation and use the variable x for the score.

Answers

Answer:

|88-x| ≤ 14

Step-by-step explanation:

their score has to be within 14 points of 88.

if their score is above 88, the number will be negative, but the absolute value makes the number positive. if that number is still within 14 of 88, they pass.

if their score is below 88, the number will be negative, and the absolute value keeps the number positive. if that number is still within 14 of 88, they pass.

Other Questions
Which structure is found in the cytoplasm of a prokaryotic cell, but is not found in the cytoplasm of a eukaryotic cell?DNAribosomesnucleusmitochondria A couple has a total household income of $84,000. The husband earns $18,000 less than twice what the wife earns. How much does the wife earn? Select the correct answer below: Assuming you are a rational investor, the amount you should be willing to pay for a 20-year ordinary annuity that makes payments of $4,000 per year and you require a 6% rate of return per year is closest to: n experimenter shows a child two clay "sausages" that are identical in size and shape and then allows the child to watch as she rolls one of the clay sausages into a longer, thinner sausage. The experimenter then asks the child whether the two clay sausages still contain the same amount of clay. A child in Piaget's concrete operational stage would be MOST likely to say: 20. Stoichiometry is based onA. molecular weight.B. temperature.C. conservation of matter.D. pressure. What was the name of the government that Napoleon formed in France in 1799? Triangle ABC is formed by a reflection over y = 3 and dilation by a scale factor of 2 from the origin. Which equation shows the correct relationship between ABC and ABC? coordinate plane with triangle ABC at A negative 3 comma 3, B 1 comma negative 3, and C negative 3 comma negative 3 Describe the culture of Jewish Orthodox in America Identify the biome shown in the photographs above. In a short paragraph, explain at least three of its characteristics. Evaluate the following expression if a=-9, b=-7,c=9 and d=32cd + 3ab = PLEASE HELP ASAP Why do you think Georgias climate might be attractive to the military and other industries? What is the rule for the transformation from triangle EFG to triangle E'F'G'? Write the integer represented by H. List its opposite and absolute value. While interoperability and unrestricted connectivity is an important trend in networking, the reality is that many diverse systems with different hardware and software exist. Programming that serves to "glue together" or mediate between two separate and usually already existing programs is known as: Find the perimeter and area , Please help me on this will give brainlist 7. Assume two people, Swanson and Suzie, are standing 35 feet apart and are watching a boatrace. At a given moment, Swanson approximates the angle formed by the lead boat, himself, andSuzie to be 30. Suzie approximates the angle formed by the lead boat, herself, and Swanson to be130. How far is the boat from Swanson?13030"35 feetSwansonSuziePart I: What is the missing angle in this triangle? (1 point)Part II: Use the law of sines to find the distance from Swanson to the boat. (2 points) Determine what product will be produced at the negative electrode for the following reaction:2KCl(aq) + 2H20(1) -> H2(g) + Cl2(g) + 2KOH(aq)A. H2B. Cl2. D. K If you love surfing you can travel to this country and try surfing on water during the season called la canicula the country that has the la canicula is the maximum value of 3/5sinx-12cosx+19 The risk-free rate is 6% and the expected rate of return on the market portfolio is 13%. a. Calculate the required rate of return on a security with a beta of 1.25.