Penelope determined the solutions of the quadratic function by completing the square. F(x) = 4x2 8x 1 –1 = 4x2 8x –1 = 4(x2 2x) –1 1 = 4(x2 2x 1) 0 = 4(x 2)2 0 = (x 2)2 0 = x 2 –2 = x What error did Penelope make in her work? Penelope should have subtracted 1 from both sides instead of adding 1. Penelope should have subtracted 4 from both sides instead of adding 1. Penelope should have added 4 to both sides instead of adding 1. Penelope should have subtracted 8 from both sides instead of adding 1.

Answers

Answer 1

By solving the quadratic equation using completing the square method we got that Penelope should have added 4 to both sides instead of adding 1.

What is quadratic equation ?

Any equation of the form [tex]ax^2+bx+c=0[/tex] where x is variable and a, b, and c are any real numbers where a ≠ 0 is called quadratic equation .

Given work of Penelope is

[tex]$$\begin{aligned}&f(x)=4 x^{2}+8 x+1 \\&-1=4 x^{2}+8 x \\&-1=4\left(x^{2}+2 x\right) \\&-1+1=4\left(x^{2}+2 x+1\right) \\&0=4(x+2)^{2} \\&0=(x+2)^{2} \\&0=x+2 \\&-2=x\end{aligned}$$[/tex]

Now we can see that Penelope determined the solutions of the quadratic function by completing the square. so he must have been done as following

[tex]$$\begin{aligned}&f(x)=4 x^{2}+8 x+1 \\&-1=4 x^{2}+8 x \\&-1=4\left(x^{2}+2 x\right) \\&-1+4=4\left(x^{2}+2 x+1\right) \\&3=4(x+2)^{2} \\&\frac{3}{4} =x+2)^{2} \\&\frac{\pm\sqrt3}{2} =x+2 \\&\frac{-2\pm\sqrt3}{2} =x\end{aligned}$$[/tex]

By solving the quadratic equation using completing the square method we got that Penelope should have added 4 to both sides instead of adding 1.

To learn more about quadratic equations visit : https://brainly.com/question/1214333

Answer 2

Answer:

C) Penelope should have added 4 to both sides instead of adding 1.

Step-by-step explanation:
Got it right on edge! Good Luck <3


Related Questions

Find the midpoint of the line segment with end coordinates of:
(

3
,

1
)
and
(
4
,

5
)

Give coordinates as decimals where appropriate.

Answers

Answer:

(0.5, -3)

Step-by-step explanation:

(-3, -1) (4, -5)

midpoint formula

(x1 + x2) /2, (y1 + y2) /2

-3 + 4 = 1 / 2 = 0.5

-1 + -5 = -6 / 2 = -3

Find the measurement of angle ( A ) round to the nearest hundred

Answers

Answer:

all you have to do is round to the nearest.

Step-by-step explanation:

just do it .

The weight that a horizontal beam can support varies inversely as the length of the beam. Suppose that a 2-m beam can support 310 kg. How many kilograms can a 10-m beam support? a. 0. 0161 kg b. 62 kg c. 15. 5 kg d. 0. 0645 kg.

Answers

A beam of length 10m can support a weight of 62kg.

It is given that

Weight W ∝ 1/ Length L

W ∝ 1/L

W = k/L...........eq1

where k is constant of proportionality

What is the constant of proportionality?

The constant of proportionality is the ratio that relates two given values.

It is given that when L= 2m, W = 310kg

310 = k/2

k = 620

So put the k value in eq1,

eq1 becomes,

W = 620/L

when L = 10

W = 620/10

W =62kg

Therefore, a beam of length 10m can support a weight of 62kg.

To get more about the constant of proportionality visit:

https://brainly.com/question/26171814

What is the value of x? (5 points)

Answers

30 + 2x = 90
2x = 60
x = 30

Answer:
x = 30

Let x, y, and z represent three rational numbers, such that y is 512 times x and z is 50.25 more than x. If y=15.5, what is the value of z?

Answers

The value of z is equal to 50.28.

System of Linear Equations

System of linear equations is the given term math for two or more equations with the same variables. The solution of these equations represents the point at which the lines intersect.

Rational Numbers

These numbers are represented by a ratio between two integers numbers ([tex]\frac{a}{b}[/tex]), where b[tex]\neq[/tex]0.  Besides, this ratio can be simplified in decimal form.

For solving this equation, firstly, rewrite the information given:

                                          [tex]y=512x \;(1)\\ \\ z=50.25+x \;(2)\\ \\ y=15.5 \;(3)[/tex]

As the question gives the values for y, you can find x.

                                        [tex]y=512x\\ \\ 15.5=512x\\ \\ x=\frac{15.5}{512} =0.03[/tex]

Applying x=0.03 in the equation (3), you can find z.

                              [tex]z=50.25+x \\ \\ z=50.25+0.03\\ \\ z=50.28[/tex]

Learn more about the system of equations here:

https://brainly.com/question/384631

i need help asap pls

Answers

Step-by-step explanation:

[tex]m + 148 = 3m + 10[/tex]

[tex]148 - 10 = 3m - m[/tex]

therefore

3m = 138

m = 138/3

m = 46°

pls give brainliest

Colin is c years old. His 14 year old sister, Katie, is 4 years younger than Colin. write an expression

Answers

Answer: C - 4 = 14

Step-by-step explanation: In the expression, "c" is colin's age so, if you subtract 4 years for his age, you get Katie's age, which is 14.

Also 5 3/7 x 3 1/2 Thanks

Answers

Answer: 19

5 3/7 to an improper fraction is = 38/7
3 1/2 to an improper fraction is = 7/2

38x7 = 266
7x2 = 14

266/14 = 19

What decimal best represents 1/4

Answers

Answer:

.25

Step-by-step explanation:

.25 or 1/4 is one-fourth of 1

You can divide 1 by 4 to get .25

PLEASE HELP FAST URGENT!!!

Answers

Answer:

A= Origen C= q1 B=Q2

Step-by-step explanation

your left-hand side is quadrant TWO Your top right-hand corner is Quadrant ONE and your second to the last one is left-hand side down Is Quadrant THREE last but not least is Quadrant FOUR. And the zero in the middle means ORIGEN.

Please please help me please

Answers

Answer:

A

Step-by-step explanation:

It could just be it was dilated (I think thats the word) by 3. 6×3=18, 8×3=24

PLEASE HELP ANSWER THESE FAST, will give brainliest and 100 points

Answers

Step-by-step explanation:

11.

x is sin(60) in a circle with radius of 8.

x = sin(60)×8 = 6.92820323... ≈ 6.9

12.

x is sin(30) in a circle with radius "diagonal length".

6 is cos(30) in the same circle.

6 = cos(30)×r

r = 6/cos(30) = 6.92820323...

x = sin(30)×r = 3.464101615... ≈ 3.5

13.

similar to 12.

but we refer to the angle at the bottom right vertex.

remember, the sum of all angles in a triangle is always 180°.

so, the angle over there at the right is

180 - 90 - 68 = 22°

x = sin(22)×r

25 = cos(22)×r

r = 25/cos(22) = 26.96336857...

x = sin(22)×r = 10.10065565... ≈ 10.1

14.

9 is the sine of the complementary angle of 49 in a circle with radius x.

the complementary angle is the angle that adds up with the original angle to 90° and is therefore

90 - 49 = 41°

9 = sin(41)×x

x = 9/sin(41) = 13.71827778... ≈ 13.7

18.

we use the extended Pythagoras :

c² = a² + b² - 2ab×cos(C)

with c being the side opposite of the angle C.

so we have

LK² = 16² + 24² - 2×16×24×cos(29) =

= 256 + 576 - 768×cos(29) =

= 832 - 671.7079351... = 160.2920649...

LK = 12.66065026... ≈ 12.7

19.

law of sine

a/sin(A) = b/sin(B) = c/sin(C)

with the sides being always opposite to the corresponding angles.

to find the angle at H we need to find the angle at G first, because we don't know GF yet.

so,

28/sin(76) = 18/sin(G)

sin(G) = 18×sin(76)/28 = 0.623761538...

G = 38.59134528...°

remember the 180° rule in triangles.

H = 180 - 76 - G = 65.40865472...° ≈ 65.4°

20.

GF is now calculated using the law of sine again.

28/sin(76) = GF/sin(H)

GF = 28×sin(H)/sin(76) = 26.23980579... ≈ 26.2

hey so im also looking for the first answer and the choices were “ is not “ and “ is “

Answers

so the investigator found the skid marks were 75 feet long hmmm what speed will that be?

[tex]s=\sqrt{30fd}~~ \begin{cases} f=\stackrel{friction}{factor}\\ d=\stackrel{skid}{feet}\\[-0.5em] \hrulefill\\ f=\stackrel{dry~day}{0.7}\\ d=75 \end{cases}\implies s=\sqrt{30(0.7)(75)}\implies s\approx 39.69~\frac{m}{h}[/tex]

nope, the analysis shows that Charlie was going faster than 35 m/h.

now, assuming Charlie was indeed going at 35 m/h, then his skid marks would have been

[tex]s=\sqrt{30fd}~~ \begin{cases} f=\stackrel{friction}{factor}\\ d=\stackrel{skid}{feet}\\[-0.5em] \hrulefill\\ f=\stackrel{dry~day}{0.7}\\ s=35 \end{cases}\implies 35=\sqrt{30(0.7)d} \\\\\\ 35^2=30(0.7)d\implies \cfrac{35^2}{30(0.7)}=d\implies 58~ft\approx d[/tex]

Determine is (x-3) is a factor of
x^3 - 5x^2 - 4x + 6 using the remainder
theorem:

Answers

Answer:

(x - 3) is not a factor

Step-by-step explanation:

If (x - h) is a factor of f(x) then f(h) = 0

here

f(x) = x³ - 5x² - 4x + 6 , then

f(3) = 3³ - 5(3)² - 4(3) + 6 = 27 - 5(9) - 12 + 6 = 27 - 45 - 6 = - 24

since f(x) ≠ 0 then (x - 3) is not a factor of f(x)

After spending $6.75 on a meal and $1.25 on drinks, Maria had $12 left.
What percent of her money did Maria spend?

Answers

Answer:

40%

Step-by-step explanation:

6.75 + 1.25 = 8 (Total she just spent)

8 (Total she just spent) + 12 (Total she had left) = 20 (Total she started with)

8/20 = 0.4 = 40%

(Total spent / total she started with = 40%)

Instructions: Find the length of the missing sides.
I WILL GIVE A BRAINIST !!
please explain how to do this

Answers

Answer:

y = 8sqr3,

x = 4sqr3

Step-by-step explanation:

Use SOH CAH TOA, to solve this.

Here I know the opposite, so I could use either SOH either TOA or both to find the 2 unknowns.

To find y, I would use SOH, which is Sin(angle) = opposite/hypotenuse.

When I rearrange it, I get opposite/Sin(angle) = hypotenuse.

Now let's fill in with the values to give:

12/sin(60) = 8sqr3

And then to find x, let's use TOA, which is Tan(angle) = opposite/adjacent.

Rearrange it to get opposite/Tan(angle) = adjacent. This gives us a side x with a value of:

12/tan(60) = 4sqr3

A triangle has two sides of length 17 and 2. What is the smallest possible whole-number length for the third side?

Answers

Answer: 16

Step-by-step explanation:

A rectangular prism has a length of 3 meters, a height of 7 meters, and a width of 7 meters. What is its volume, in cubic meters?​

Answers

Volume = length • height • width
= 3•7•7 = 147 cubic meters

tell me how to decompose 792

Answers

Answer:

break it down to prime factorization

so the ans will be 2^3 * 3^2 *11


A lil help would be nice

(Explained answer will get brainlyist)

Answers

Answer:

10 cm

Step-by-step explanation:

Out of that [tex]160 cm^2[/tex], part of it is given by the surface of the top and bottom faces, which have area [tex]2\times 5 cm^2 = 10 cm^2[/tex] each, for a total of [tex]20 cm^2[/tex] . We are then left with [tex]140 cm^2[/tex] of surface from the side area. That area you can imagine as a rectangle of height h (which we need to know) and base [tex]5+2+5+2 cm = 14 cm[/tex] (imagine it as a box opened on a flat surface)

At this point we have [tex]140cm^2 = 14 cm \times h \rightarrow h= 10 cm[/tex]

look at the attachment
Simplified it too
pls take it seriously ​

Answers

[tex]\\ \rm\rightarrowtail \dfrac{sin(180+A)+2cos(180+A).cos(A-180)}{2cos^2(360+A)-cos(-A)}[/tex]

[tex]\\ \rm\rightarrowtail \dfrac{-sinA+2(cos^2A-sin^2A)}{2cos^2A-cosA}[/tex]

[tex]\\ \rm\rightarrowtail \dfrac{-sinA+2cos^2A-2sin^2A}{cosA(2cosA-1)}[/tex]

[tex]\\ \rm\rightarrowtail \dfrac{-sinA+2-2sin^2A-2sin^2A}{cosA(2cosA-1)}[/tex]

[tex]\\ \rm\rightarrowtail \dfrac{-sinA-4sin^2A}{cosA(2cosA-1)}[/tex]

[tex]\\ \rm\rightarrowtail \dfrac{-sinA(4sinA-1)}{cosA(2cosA-1)}[/tex]

[tex]\\ \rm\rightarrowtail -tanA\left(\dfrac{4sinA-1}{2cosA-1}\right)[/tex]

Laura is building a fence around a circular pond. The pond has a diameter of 30 feet. What is the minimum amount of fencing Laura will need?

Answers

Answer:

Step-by-step explanation:

Minimum Amount = circumference of the pond.

Formulas

C = pi * d

Givens

pi = 3.14

d = 30 feet

Solution

C = pi*d             Substitute for the givens.

C = 3.14 * 30      Multiply

C =  94.2

The function f(x)= -45x + 270 represents the total distance, in miles, a traveler is from home x hours after beginning the trip home. What is the average rate of change over the interval from x = 1 to x = 3, in miles per hour?

Answers

[tex]\bold{\huge{\underline{ Solution }}}[/tex]

Given :-

We have given one function f(x) = -45x + 270 The given function represents the total distance in miles. The initial interval was x = 1 and final interval was x = 3

To Find :-

We have to find the rate of change over the given interval

Let's Begin :-

Here, We have

Function = f(x) = -45x + 270

The given function represents the total distance in miles covered by the traveller.

Therefore,

For initial interval that is x = 1 , Distance covered by the traveller

[tex]\sf{ f(x) = -45x + 270 }[/tex]

[tex]\sf{ f(1) = - 45(1) + 270 }[/tex]

[tex]\sf{ f(1) = - 45 + 270 }[/tex]

[tex]\sf{ f(1) = 225 }[/tex]

For final interval that is x = 3, Distance covered by the traveller

[tex]\sf{ f(x) = - 45x + 270 }[/tex]

[tex]\sf{ f(1) = - 45(3) + 270 }[/tex]

[tex]\sf{ f(1) = - 135 + 270 }[/tex]

Now,

We have to find the average rate of change over the given time interval

Therefore,

Average rate of change in the given time interval

[tex]\sf{ = }{\sf{\dfrac{ f(1) + f(3) }{3 - 1}}}[/tex]

[tex]\sf{ = }{\sf{\dfrac{ 225 + ( -135) }{ 2}}}[/tex]

[tex]\sf{ = }{\sf{\dfrac{ 225 - 135 }{ 2}}}[/tex]

[tex]\sf{ = }{\sf{\dfrac{ 90 }{ 2}}}[/tex]

[tex]\sf{ = 45 }[/tex]

Hence, The average rate of change over the given interval is 45 miles per hour.

100!!! Points
Select the correct answer.
What is the range of the function shown in the graph?

Answers

See the line is parallel to x axis.The equation of that top is y<5

So

The range is

(-oo,0)U(oo,5)

So

-oo<y<5

Option D is correct

Shelley drew a scale drawing of the high school. She used the scale 5 millimeters: 3 meters.
If the actual width of the parking lot is 42 meters, how wide is the parking lot in the drawing?

Answers

Answer:

70 meters

Step-by-step explanation:

Based on the given conditions, formulate:: 45x5/3

Cross out the common factor: 14x5

Calculate the product or quotient: 70

The width of the parking lot in the drawing is, 70 milliliters.

What is Multiplication?

To multiply means to add a number to itself a particular number of times. Multiplication can be viewed as a process of repeated addition.

Given that;

She used the scale 5 millimeters: 3 meters.

And, The actual width of the parking lot is 42 meters.

Hence, We can formulate;

The width of the parking lot in the drawing = 42 × 5 / 3

                                                                  = 70 milliliters

Learn more about the multiplication visit:

https://brainly.com/question/10873737

#SPJ2

PLEASE HELP ME ITS URGENT!!!!


A rectangular garden has a walkway around it. The area of the garden is 4(5.5x + 1.5). The combined
area of the garden and the walkway is 4.5(8x + 4). Find the area of the walkway around the garden as
the sum of two terms.
CD
The area of the walkway around the garden is 1
(Simplify your answer. Use integers or decimals for any numbers in the expression.)

Answers

Solving the Question

We're given:

Area (garden) = 4(5.5x + 1.5)Area (garden + walkway) = 4.5(8x + 4)

To find the area of the garden alone, we can subtract the area of the garden from the combined area of the garden and walkway:

[tex]4.5(8x + 4)-4(5.5x + 1.5)[/tex]

Open up the parentheses:

[tex]= 36x +18 -22x - 6[/tex]

Combine like terms:

[tex]= 36x +18 -22x - 6\\= 14x +18 - 6\\= 14x +12[/tex]

Answer

The area of the walkway around the garden is 14x + 12.

A model of a skyscraper is made using a scale of 1 inch: 75 feet. What is the height of the actual building if the height of the model is 19 2/5 inches?

Answers

4. If 8 ft = 1 in
Then 60 ft = 60 x 1/8 = 7.5 in
Length of model = 7.5 in
Scale factor = 1/8

5. If 4 m = 1 cm
Then 192 m = 192/4 x 1 = 48 cm
Length of model = 48 cm
Scale factor = 1/4

6. If 1.5 ft = 2 in
Then 13.5 ft = 13.5 x2/1.5 = 18 in
Length of model = 18 in
Scale factor = 2/1.5 =1.333

Skyscraper

Scale = 1 in : 75 ft
Height of model= 19 2/5in=19.4in

Height of actual building
19.4 x 75 = 1455 ft

What is the value of v?

Answers

Answer: 43

Step-by-step explanation:

Which number line shows the solution of –5x + 10 > –15?

Answers

Answer:

B.

Step-by-step explanation:

-5x + 10 > -15

-5x + 10 - 10 > -15 - 10

-5x > -25

-5x / -5 > -25/(-5)

x < 5

Ratio volume of 2 cylinders is 125:343

Answers

Answer:

5145cm²

125/343=1875/x

x=1875×343÷125=5145

Other Questions
good evening! Can someone please answer this, ill give you brainliest and your earning 50 points. Would be very appreciated.someone answer part B. What is the inverse of function f?A. B. C. D. Choose the inequality that represents the following graph.HELP HELP HELP Which south american leader was known as ""el libertador""?. Please see the attached file and answer. I need this ASAP!Giving Brainliest! Jonathan needs to make 5 bowl of pasta.if he uses 145mL of sauce.how many milliliters of sauce will he use for each bowl of pasta Black figure painting is ____________________ a. A hard, white, translucent ceramic that is made by firing kaolin and other materials. B. An advanced technique allowing for more detailed figures. C. A process in which the outside rim is designed with geometric patterns consisting of horizontal and vertical lines. D. An ancient greek technique in which the figures appear as black silhouettes on red background. Please select the best answer from the choices provided a b c d Ming is studying to be a surgeon and works in a teaching hospital. He wants to join several student organizations to help network, volunteer, and connect with people of similar interests. Which groups would best fit his needs? What is a reflex?Behavior that does not involve What is a reflex?Behavior that does not involve the forebrain, or "higher" centers of an animal'sbrain.Similar nerve cells grouped together in a nervous system. Time period before the onset of labor; before giving birth. Meters and feet are two different scales for measuring distance. Five meters isapproximately 12 m, and 16.41 ft is approximately 39.37 ft. Write an equation thatshows the approximate distance in feet as a function of the distance in meters? Owen has a mask collection of 300 masks. He keeps 63 of the masks on his wall. What percentage of Owen's mask collection does he keep on his wall? A farmer in a rain forest climate wants to make his farm sustainable. What question should he ask himself? N2O is the chemical formula of a covalent compound used in the production of whipping cream. The elements thatmake up this compound are nitrogen and oxygen.What is the name of the second element in the chemical name of this compound? When Juan got home from school, he worked on his homework for 45 minutes. Then, he took a break and had a snack for 35 minutes, and after that went to baseball practice for 1 hour and 55 minutes. He finished baseball practice at 6:05 p.m. What time did he get home from school? of Select the correct answer. Why do authors use red herrings? what are some facts about the King Ranch The system in which the country pegs its currency (e.g., Chinese yuan, Saudi Arabian riyal) at a fixed rate to a major currency or basket of currencies, while the exchange rate fluctuates within a narrow margin around a central rate is called a(n) 1. Factual gray areas can lead to problems in the accuracy of nonfiction writing. How is this issue MOST likely categorized? Someone pls help?????????????????????