Please answer question now

Please Answer Question Now

Answers

Answer 1

Answer:

MN = 3

Step-by-step explanation:

The following are congruent to each other as each pair are tangents of a circle drawn from the same external point:

PQ = QJ = 1

JK = KL = 4 - 1 = 3

MN = ML

Thus, ML = KM - KL

ML = 6 - 3 = 3

Therefore, MN = ML = 3 (both are tangents drawn from the same external point, M.


Related Questions

7th Grade Math Answer ASAP Please <3

Answers

Answer:

Hey there!

Andrew made a mistake in the last step. -11.8+9.8=2, not -21.6.

Let me know if this helps :)

the first four terms of the sequence an=2n+3are
answer
5,8,11,14
3,5,7,9
1,3,5,7
5,7,9,11​

Answers

Step-by-step explanation:

Hey, there!!!

Your required answer is optionD.

checking,

The 1st sequences are,

5,8,11,14

here,

now, use formula,

(an = 2n+3) in the sequences,

a1 = 2×1+3=5 = matching

a2= 2×2+3=7 = not matched

a3= 2×3+3= 9 = not matched

a4= 2×4+3=11 = not matched.

For 2nd sequences

3,5,7,9

Use the formula of an term,

a1 = 2×1+3=5 = not matched

a2 =2×2+3=7not matched

a3 = 2×3+3=9= not matched.

For 3rd sequences,

1,3,5,7

a1=2×1+3=5= not matched

a2=2×2+3=7= not matched

a3=2×3+3=9= not matched

a4=2×4+3=11= not matched

Now, for 4th sequences,

5,79,11

a1=2×1+3=5= matching

a2=2×2+3=7= matching

a3= 2×3+3=9= matching

a4=2×4+4=11= matching

Therefore, the answer is option D.

Hope it helps..

1. Dada a função exponencial abaixo, se x=1, qual valor de imagem? * a) 1 b) -2 c) 0 d) -1

Answers

Complete question:

Dada a função exponencial abaixo, se x=1, qual valor de imagem? * a) 1 b) -2 c) 0 d) -1

The function in the image is f(x) = 3^x-1

Answer:

A) 1

Step-by-step explanation:

To solve the exponential function above given that x = 1;

Substitute x = 1 into the exponential function

If x = 1

f(x) = 3^(x - 1)

f(1) = 3^(1 - 1)

f(1) = 3^0

f(1) = 1

Please help answer!!!!

Answers

Answer:

? = 4

Step-by-step explanation:

You are in the third quadrant. You want the answer to come out to the equivalent of 225o or pi + pi/ 4 = 5/4 * pi

x - pi/2 = 5/4 pi

x = 5/4 pi + pi/2

x = 5/4 pi + 2*pi / 4

x = 7/4 pi

? = 4

For the polynomial, (((x^3)+3x+2)/5)+((5x^2)/2)-(x^6)
a. Determine the coefficient of x^3.
b. Determine the coefficient of x^6.
c. Determine the constant of the term
polynomial.
d. Determine the degree of the polynomial.

Answers

Answer:

Hello,

Step-by-step explanation:

[tex](((x^3)+3x+2)/5)+((5x^2)/2)-(x^6)\\\\=\dfrac{x^3}{5} +\dfrac{3*x}{5} +\dfrac{2}{5} +\dfrac{5*x^2}{2} -x^6\\\\\\=-x^6+0x^5+0x^4+\dfrac{x^3}{5} +\dfrac{5*x^2}{2} +\dfrac{3*x}{5}+\dfrac{2}{5} \\\\\\a)\ \dfrac{3}{5} \\\\b)\ -1\\\\c)\\degree=6\\[/tex]

What is the range of the given function?
{(-2, 0), (-4, -3), (2, -9), (0,5), (-5, 7)}
O {x | x = -5, 4, -2, 0, 2}
{yly = -9, -3, 0, 5, 7}
{x | x = -9, -5, 4, -3, -2,0, 2, 5, 7}
{yl y = -9, -5, 4, -3, -2, 0, 2, 5, 7}

Answers

9514 1404 393

Answer:

  (b)  {yly = -9, -3, 0, 5, 7}

Step-by-step explanation:

The range is the set of y-values in the ordered pairs. It is usually convenient to list a set in alphanumeric order.

The second values of the ordered pairs are 0, -3, -9, 5, 7. So, the range is ...

  y ∈ {-9, -3, 0, 5, 7} . . . . . matches the second choice

1/4(8x-4)=
need help please answer

Answers

Answer:

2x-1 is the answer (or if you're trying to multiply it, the answer is -8.)

Step-by-step explanation:

17. ralph is 3 times as old as sarah. in 4 years ralph will only be twice as old as sara will be then. find ralph’s age now.

Answers

Answer:

Sara is now 4, will be 8 in 4 years. Ralph is now 12, will be 16 in 4 years.

Calculate the volume and surface area of a cone with the base of 20cm, the vertical hieght of 34cm and 35.6cm leaning height. ​

Answers

Answer:

Step-by-step explanation:

Volume = 1/3πr²h

Surface Area = πr(r+√(h²+r²))

V = 1/3π(10)²(34) = 3560 .5 cm³

SA = π(10)(10 + √(34²+10²)) = 1427.5 cm²

PLEASE HELP!! what is the equation of a line that is perpendicular to y = 2x + 4 and passes through the point (4, 6)?

Answers

Answer:

The answer is B)

[tex]y = - \frac{1}{2}x + 8[/tex]

Answer:

B.  y = -[tex]\frac{1}{2}[/tex]x + 8

Step-by-step explanation:

The line is perpendicular to line whose equation is:

y = 2x + 4 and;

passes through point (4,6) .

The product slopes of two perpendicular lines is -1.

The slope of the line whose equation is y = 2x + 4 is; 2

Let the slope of the perpendicular line (l2) be [tex]m_{l2}[/tex]

[tex]m_{l2} * 2 = -1[/tex]

[tex]m_{l2}[/tex] = [tex]-\frac{1}{2}[/tex]

Taking another point xy on line l2;

[tex]\frac{y - 6}{x - 4} = -\frac{1}{2}[/tex]

Cross multiplying this gives;

y = -[tex]\frac{1}{2}[/tex]x + 8 which is the equation of the perpendicular line!

Given the range (1, 1),(4,2), (2, -1), with a coordinate transformation of f(x, y) = (x+1, y-1), what is the
domain?

Answers

Answer:Domain = { (0,2), (3,3), (1,0) }

=============================================

Explanation:

The rule f(x,y) = (x+1,y-1) says to add 1 to the x coordinate and subtract 1 from the y coordinate. So let's say the input point is (7,2). This would move it to (8,1).

Now let's say that you accidentally erased the "(7,2)", but you still have the "(8,1)". You'd have to work through the steps backwards to get back to (7,2)

So you'll effectively use this rule g(x,y) = (x-1, y+1) which is the inverse transformation. Whatever f(x,y) does, the g(x,y) function will undo it and go opposite. We'll subtract 1 from the x coordinate and add 1 to the y coordinate.

------------

So that's what we'll do with the set of points { (1,1), (4,2), (2,-1) }

We have (1,1) become (0,2) after applying the g(x,y) rule

(4,2) becomes (3,3) after using g(x,y)

(2,-1) becomes (1,0) after using g(x,y)

Therefore, the domain is { (0,2), (3,3), (1,0) }

-------------

The mapping diagram is shown below.

Solve for a.
-4a – 2a – 7 = 11
a =
[?]

Answers

Answer:

a = [-3]

Step-by-step explanation:

-4a - 2a - 7 = 11

Combine like terms

-4a - 2a = -6a

-6a - 7 = 11

Add 7 to both sides

-6a = 18

Solve for a

a = 18/-6
••••••••••••••••••••••••••••••
doomdabomb:
All brainliest and thanks
are appreciated and
would mean a lot to me,
thanks!

a = -3
••••••

Answer:

or, -4a - 2a -7 = 11

or, -4a -2a =11 +7

or, - 6a = 18

or, a= 18÷ -6

a= -3

Twice the difference between a number and 4 is twenty. Find the number.
А. 8
B. 9
C. 12
D. 14

Please help!!!

Answers

Answer:

D 14

Step-by-step explanation:

Let x be the number

2(x-4) = 20

Divide each side by 2

2/2(x-4) = 20/2

x-4 = 10

Add 4 to each side

x-4+4 = 10+4

x = 14

Answer:

The number is 14

Step-by-step explanation:

Let's call this unknown number of x:

2×(x – 4) = 20

2x – 8 = 20

2x = 20 + 8

2x = 28

x = 28/2

x = 14

what is the volume of a cube with and edge length of 4 cm

Answers

Answer:

V = 64 cm^3

Step-by-step explanation:

Volume of a cube is given by

V = s^3 where s is the side length

V = 4^3

V = 64 cm^3

Answer:

64

Step-by-step explanation:

i guess so as the volume is 4×4×4

A car is averaging 50 miles per hour. If the car maintains this speed, how many minutes less would a 450-mile trip take than a 475-mile trip?

Answers

Answer:

1/2 a minute (30 seconds)

Step-by-step explanation:

475/50=9.5

450/50=9

9-9.5=.5

if line y bisects line AC, AB = 4 - 5x, and BC = 2x+25, find AC

Answers

Answer:

4-5x = 2x+25

-5x+4 = 2x+25

-7x = 21

x = -3

4 - 5(-3)

4 + 15

19

AC = 2 x 19

AC = 38

Let me know if this helps!

Write the parametric equation of the line: 10x - 4y = 20

Answers

The parametric equation of the line10x - y = 20 is given as y = 2.5t - 5

Parametric equation

parametric equation are equations where the dependent variable is expressed in terms of independent variable

say dependent variable y = f(t)

independent variable x = t

Given data

10x - 4y = 20

solution

10x - 4y = 20

10x - 20 = 4y

4y = 10x - 5

y = 2.5x - 5

where x = t

y = 2.5t - 5

Read more on parametric equations here: https://brainly.com/question/12953407

#SPJ1

daniel thinks of a number and subtracts 2
from it. He divides 32 by the result. If
his answer is 4, what number does he
think of​

Answers

Answer:

the number is 126

Step-by-step explanation:

1) multiply each side by 32: (n-2) / 32 = 4

2) subtract 2 from each side: n-2 = 128

3) n = 126

Answer:

130

Step-by-step explanation:

So basically this number, minus 2, divided by 32 is 4, so lets write the unknown number as x.

So, (x-2)/32 = 4.

First multiply both sides by 32 to get rid of the denominator.

(32)(x-2)/32 = 4(32)          x-2 = 128

Now the -2 remains to figure out x, so you add 2 to both sides to get rid of the -2.

So, x-2+2 = 128+2,    -2 +2 is 0, and 128 +2 is 130, so you have x = 130.

Hong buys candy that costs $5 per pound. He will buy at least 7 lbs of candy. What are the possible amounts he will spend on candy? Use c for the amount (in dollars) Hong will spend on candy. Write your answer as an inequality solved for c.

Answers

Step-by-step explanation:

if he buys 7 pounds, it will cost 7×5 = $35

he might buy more than that (and it will then also cost more than that) , but not less than that.

so,

c >= $35

Find the x-intercept(s) of the equation: y =3x^2-3x-6

a. x-intercepts: (-1,0) and (2,0)

b. x-intercepts:(0,-3) and (0,2)

c. x-intercept: (-6,0)

d. x-intercept: (0,-6)

Answers

Answer:

(2,0)    ( -1,0)

Step-by-step explanation:

y =3x^2-3x-6

Let y = 0 and solve for x to find the x intercepts

0 =3x^2-3x-6

Factor out a 3

0 =3(x^2-x-2)

Factor inside the parentheses

0 = 3( x-2) (x+1)

Using the zero product property

x-2 =0    x+1 = 0

x=2      x = -1

(2,0)    ( -1,0)

Answer:

[tex]\large \boxed{\mathrm{a. \ x-intercepts: (-1,0) \ and \ (2,0)}}[/tex]

Step-by-step explanation:

The x-intercept(s) is when y = 0.

3x² - 3x - 6 = 0

Factor left side of the equation.

3(x + 1)(x - 2) = 0

Set factors equal to 0.

x + 1 = 0

x = -1

x - 2 = 0

x = 2

The x-intercepts are (-1, 0) and (2, 0).

Every year the Lee family has a big family dinner, and everyone brings a mug to exchange. The mugs are put on wooden hangers on the wall, and each wooden hanger can hold 12 mugs. Last year the family had 15 mugs to hang up. This year the Lee family filled three wooden hangers. How many more mugs were brought to the Lee family dinner this year compared to the previous year? *

Answers

Answer:

21 more mugs were brought this year than last year.

Step-by-step explanation:

We can solve by subtracting the initial amount of mugs from the final amount of mugs.

To find the amount of mugs hung up this year, we will use the equation: m = 12w where m = the number of mugs & w = the number of wooden hangers. The 12 represents the amount of mugs per wooden hanger.

We can plug in 3 for w since 3 wooden hangers were filled up and we would get 12(3) = m = 36 mugs

Now we subtract last year's total mugs hung up from this year's total mugs hung up.

We end up with 36 - 15 = 21

Is this a function or no?

Answers

Function

It is a function

What are the solutions to 3( x + 2)(x – 9) = 0

Answers

Mark Brainliest if correct:

x = -2, 9

Step-by-step explanation:

x2: x + 2 = 0

x = -2

x1: x - 9 = 0

x = 9

x = -2, 9

Help please, thanks :)

Answers

Answer:

х=6

Step-by-step explanation:

[tex]7 + 5(x -3 ) = 22 \\ 7 + 5x - 15 = 22 \\ 5x = 22 - 7 + 15 \\ 5x = 30 \\ x = 6[/tex]

Answer:

C

x=6

Step-by-step explanation:

Nathan, a tutor, buys 5 calculators for $7.50 each at a store, planning to provide one to each of his clients. However, the next day, he discovers that the same calculators has gone on sale for $5.00 and also discovers that he will only have three tutoring clients instead of five. He returns the five calculators and purchases three calculators at the new sale price. He uses the following expression to determine the amount he should receive back from the store. (5 x $7.50) - (3 x $5.00) Which of the following expressions could Nathan have used. 5 ($7.50 - $5.00). $7.50 - $5.00. (5 x $7.50) - $5.00. (5 x $7.50) - $5.00. 3 ($7.50 - $5.00) +2 x $7.50

Answers

Answer: 5 (7.50-3 )

Step-by-step explanation:

Given: Previous price of calculator = $7.50

Number of client =5

Total price = (Number of calculators) x (Price for each calculator)

Total price of 5 calculators = (5 x $7.50)

New price of calculator = $5.00

Number of client =3

Total price of 3 calculators  = (3 x $5)

Price will receive = (Total price of 5 calculators) -(Total price of 3 calculators  )

= (5 x $7.50) -  (3 x $5)

= 5 (7.50-3 )

Required expression: 5 (7.50-3 )

Find the length of the third side. If necessary, round to the nearest tenth.
20
28
Answer:
Submit Answer
attempt 1 out of 2
PLS HELP ASAP

Answers

Answer:

b = 19.6

Step-by-step explanation:

Since this is a right triangle, we can use the Pythagorean theorem

a^2+b^2 = c^2  where a and b are the legs and c is the hypotenuse

20^2+ b^2 = 28^2  

400 + b^2 = 784

b^2 = 784-400

b^2 =384

Taking the square root of each side

sqrt( b^2) = sqrt(384)

b =19.59591794

To the nearest tenth

b = 19.6

Answer:

19.6

Step-by-step explanation:

It is a right triangle so use the pythagorean theorem; a^2 + b^2 = c^2

a=20

b=?

c=28 - c is the hypotenuse because it is across from the right angle

20^2 + b^2 = 28^2

400+ b^2 =784

b^2=384

b= 19.595917... or 19.6 (rounded to nearest tenth)

Find the domain for the rational function f of x equals quantity x plus 1 end quantity divided by quantity x minus 2 end quantity.

(−[infinity], 2) (2, [infinity])

(−[infinity], −2) (−2, [infinity])

(−[infinity], 1) (1, [infinity])

(−[infinity], −1) (−1, [infinity])

Answers

Answer:

[tex](- \infty, 2), (2, \infty)[/tex]

Step-by-step explanation:

Given the function:

[tex]f(x) = \dfrac{x+1}{x-2}[/tex]

To find:

Domain of the function.

Solution:

First of all, let us learn about definition of  domain of a function.

Domain of a function is the valid input values that can be provided to the function for which output is defined.

OR

Domain of a function [tex]f(x)[/tex] are the values of [tex]x[/tex] for which the output [tex]f(x)[/tex] is a valid value.

i.e. The function does not tend to [tex]\infty[/tex] or does not have [tex]\frac{0}0[/tex] form.

So, we will check for the values of [tex]x[/tex] for which [tex]f(x)[/tex] is not defined.

For value to tend to [tex]\infty[/tex], denominator will be 0.

[tex]x-2\neq 0 \\\Rightarrow x \neq 2[/tex]

So, the domain can not have x = 2

Any other value of x does not have any undefined value for the function [tex]f(x)[/tex].

Hence, the answer is:

[tex]\bold{(- \infty, 2), (2, \infty)}[/tex]     [2 is not included in the domain].

Mrs. barker works 40 hours per week regularly, at a rate of $36.80 per hour. when she works overtime, her rate is time and a half of her regular hourly rate. what is Mrs. Barker hourly overtime rate

Answers

Answer:

$55.20 is Mrs. Barker hourly overtime rate.

Step-by-step explanation:

The term "time and a half" in your question means that Mrs. Baker's overtime rate is 1.5 times her usual hourly rate.

So, ----> $36.80 times 1.5 = $55.20

need help right now please

Answers

its 4

x=4

[tex]4^{2}[/tex]-2x4

16-8

=8

●✴︎✴︎✴︎✴︎✴︎✴︎✴︎✴︎❀✴︎✴︎✴︎✴︎✴︎✴︎✴︎✴︎✴︎●

                Hi my lil bunny!

    ❧⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯☙

Let's solve your equation step-by-step.

[tex]x^2 - 2x = 8[/tex]

Step 1: Subtract 8 from both sides.

[tex]x^2 - 2x - 8 = 8 - 8\\x^2 - 2x - 8 = 0[/tex]

Step 2: Factor left side of equation.

[tex]( x+2) ( x - 4) = 0[/tex]

Step 3: Set factors equal to 0.

[tex]x + 2 = 0[/tex] or [tex]x - 4 = 0[/tex]

[tex]x = -2[/tex] or [tex]x = 4[/tex]

Answer : -2 , 4

     ❧⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯⎯☙

  ●✴︎✴︎✴︎✴︎✴︎✴︎✴︎✴︎❀✴︎✴︎✴︎✴︎✴︎✴︎✴︎✴︎✴︎●

         Have a great day/night!

                    ❀*May*❀

sinx =căn 2/3
sinx=5/4
sinx =1
sin3x=can3/2
sin(x-60)=-1/2
sin3x=1/2

Answers

Answer:

Correct option is

B

0

D

−1

sinx+sin2x+sin3x

=sin(2x−x)+sin2x+sin(2x+x)

=2sin2xcosx+sin2x [ by using sin(A+B)=sinAcosB+sinBcosA and sin(A−B)=sinAcosB−sinBcosA ]

=sin2x(2cosx+1)........(i)

cosx+cos2x+cos3x

=cos(2x−x)+cos2x+cos(2x+x)

=2cos2xcosx+cos2x [By using cos(a−b)=cosa⋅cosb+sina⋅sinb and cos(a+b)=cosa⋅cosb−sina⋅sinb]

=cos2x(2cosx+1).....(ii)

∴(sinx+sin2x+sin3x)

2

+(cosx+cos2x+cos3x)

2

=1

sin

2

2x(2cosx+1)

2

+cos

2

2x(2cosx+1)

2

=1.......[From(i)(ii)]

⇒(2cosx+1)

2

=1

⇒2cosx+1=±1

∴cosx=0or−1

Other Questions
When Production decreases what is a very likely possibility? a hire new workers b expand production c purchase new equipment d downsizing a reaction mixture initially contains 10.0 atm N2 and 10.0 atm H2. If the equilibrium pressure of NH3 is measured to be 6.0 atm, find the equilibrium constant (Kp) for the reaction. g Solve for x: 2x+1= -3x+36 Write an algebraic expression for the pair of numbers such that one is 33% more than the other one Middle-aged people who lose their jobs may be discriminated against when trying to find a new job, which is not only illegal, but also based on misguided assumptions. All of the following statements are true about middle-aged workers EXCEPT __________. a. they miss fewer work days than younger workers b. they hold their jobs longer and are more reliable c. they lack sufficient technolog What was happening in the world and in the United States in 1979 and 1980 that is connected to the story The Boys of Winter. What are differences between viruses and bacteria? Bones provide both structure and protection for the body.Please select the best answer from the choices provided.OTOFSave and ExitSubmitMark this and returnbones provide both structure and protection for the body? Solve the following system3x+y=94x-3y=6 Sally's paycheck this week was $100. She spent $220.45 for a shirt, $12.95 for a CD, $15 for gasoline, and put the balance in the bank.a. What percent of her total pay was spent on the shirt?b. What percent of her total pay did she put in the bank? Identfy the incorrect statement about active transport. a)It doesn't require the use of a cell's energy b)None of the choices. c)It moves substances across the cell membrane against their concentration gradients d)Sometimes active transport involves the use of carrier proteins to transport substances in much the same way as passive transport. Which written set of laws that applied to everyone under a government was written during theBabylonian Empire in Mesopotamia?O HieroglyphicsO Epic of GilgameshO Hammurabi's CodeO cuneiform The bookkeeper prepared a check for $48 but accidently recorded it as $95. When preparing the bank reconciliation, this should be corrected by: A parallel-plate capacitor has square plates that are 7.40 cm on each side and 3.20 mm apart. The space between the plates is completely filled with two square slabs of dielectric, each 7.40 cm on a side and 1.60 mm thick. One slab is Pyrex glass and the other slab is polystyrene. If the potential difference between the plates is 84.0 V, find how much electrical energy (in nJ) can be stored in this capacitor. How would the period of this pendulum differ from an equivalent one on earth? Explain what it means that the Muscogee society was matriarchal and give an example EWhat is the value of x in the equation 3x.. by y 18, when y27 which perspective believes that behavior is learned through awards and punishments When asked what a guilty person should do when being interrogated by police, younger adolescents are more likely than older adolescents to say that the person: Based on what you know about how light travels, explain whyyou can't see the back of your own head without using a mirror,camera or other device.