Solve for x. Round to the nearest tenth, if necessary

Solve For X. Round To The Nearest Tenth, If Necessary

Answers

Answer 1

Answer:

x = 2.5

Step-by-step explanation:

Since this is a right triangle, we can use trig functions

tan theta = opp /adj

tan 26 = 1.2 /x

x tan 26 = 1.2

x = 1.2/ tan 26

x=2.46036

Rounding to the nearest tenth

x = 2.5


Related Questions

Question 2 Evaluate the expression 2(x - 3) + 3y when x = 5 and y = 3. Mark the correct answer.
A. 13
B. 15
C. 16
D. 25​

Answers

Answer:

A. 13

Step-by-step explanation:

2(x - 3) + 3y

2(5 - 3) + 3×3

2× 2 + 3×3

4 + 9

13

Answer:

The correct answer is A

Step-by-step explanation:

2(x-3) + 3y so you replace them and get 2( 5 - 3) +3(3)

next,

you would solve it

2 x 5 and 2 x 3 you get 10-6 + 9, the 9 is from multiplying 3 by 3

finally you solve it

10-6 = 4 +9

= 13!

Mrs. Yadav purchase 25 kg of vegetable at Rs 20 per kg and sold at a loss of Rs 50 find her
Selling rate and loss percent​

Answers

Answer:

[tex] \boxed{loss\% \: = 10\%}[/tex][tex] \boxed{selling \: price = Rs 450}[/tex]

Step-by-step explanation:

Given,

Cost price of 25 kg of vegetables ( CP ) = 25 × 20

= Rs 500

Loss amount = Rs 50

Selling price ( SP ) = ?

Loss percent = ?

Now, let's find the loss percent :

[tex] \mathsf{ \frac{loss}{cost \: price} \times 100\%}[/tex]

[tex] \mathsf{ = \frac{50}{500} \times 100\%}[/tex]

[tex] \mathsf{ = 10\%}[/tex]

Loss % = 10 %

Now, let's find the selling price:

[tex] \mathsf{ \frac{CP(100 - l\%)}{100} }[/tex]

[tex] \mathsf{ = \frac{500(100 - 10)}{100}} [/tex]

[tex] \mathsf{ = \frac{500 \times 90}{100} }[/tex]

[tex] \mathsf{ = \frac{45000}{100} }[/tex]

[tex] \mathsf{= 450}[/tex]

Hope I helped!

Best regards!

Convert 25 feet per second to miles per hour.​

Answers

1 mile = 5,280 feet

1 hour = 3600 seconds

3600/5280 = 0.681818 feet per second

25 ft per second x 0.681818 = 17.045 miles per hour

Round the answer as needed.

Answer:

The correct answer is 17.045 miles per hour.

The midpoint of a sègment is (6,-4) and one endpoint is (13,-2). Find the coordinates of the other endpoint.

Answers

let other one be (x,y)

We know midpoint formula

[tex]\boxed{\sf (x,y)=\left(\dfrac{x_1+x_2}{2},\dfrac{y_1+y_2}{2}\right)}[/tex]

[tex]\\ \sf\longmapsto (6,-4)=\left(\dfrac{13+x}{2},\dfrac{-2+y}{2}\right)[/tex]

[tex]\\ \sf\longmapsto \dfrac{13+x}{2}=6[/tex]

[tex]\\ \sf\longmapsto 13+x=12[/tex]

[tex]\\ \sf\longmapsto x=12-13[/tex]

[tex]\\ \sf\longmapsto x=-1[/tex]

And

[tex]\\ \sf\longmapsto \dfrac{-2+y}{2}=-4[/tex]

[tex]\\ \sf\longmapsto -2+y=-8[/tex]

[tex]\\ \sf\longmapsto y=-8+2[/tex]

[tex]\\ \sf\longmapsto y=-6[/tex]

Answer:

(- 1, - 6 )

Step-by-step explanation:

Given endpoints (x₁, y₁ ) and (x₂, y₂ ) then the midpoint is

( [tex]\frac{x_{1}+x_{2} }{2}[/tex] , [tex]\frac{y_{1}+y_{2} }{2}[/tex] ) ← midpoint formula

Use this formula on the endpoints and equate to the coordinates of the midpoint.

let the other endpoint = (x, y) , then

[tex]\frac{13+x}{2}[/tex] = 6 ( multiply both sides by 2 )

13 + x = 12 ( subtract 13 from both sides )

x = - 1

[tex]\frac{-2+y}{2}[/tex] = - 4 ( multiply both sides by 2 )

- 2 + y = - 8 ( add 2 to both sides )

y = - 6

The coordinates of the other endpoint are (- 1, - 6 )

Which equation represents the line that is perpendicular to y=3/4x+1 and passes through (-5,11)
Will give brainliest!!

Answers

Answer:

y = - [tex]\frac{4}{3}[/tex] x + [tex]\frac{13}{3}[/tex]

Step-by-step explanation:

The equation of a line in slope- intercept form is

y = mx + c ( m is the slope and c the y- intercept )

y = [tex]\frac{3}{4}[/tex] x + 1 ← is in slope- intercept form

with slope m = [tex]\frac{3}{4}[/tex]

Given a line with slope m then the slope of a line perpendicular to it is

[tex]m_{perpendicular}[/tex] = - [tex]\frac{1}{m}[/tex] = - [tex]\frac{1}{\frac{3}{4} }[/tex] = - [tex]\frac{4}{3}[/tex] , thus

y = - [tex]\frac{4}{3}[/tex] x + c ← is the partial equation

To find c substitute (- 5, 11) into the partial equation

11 = [tex]\frac{20}{3}[/tex] + c ⇒ c = 11 - [tex]\frac{20}{3}[/tex] = [tex]\frac{13}{3}[/tex]

y = - [tex]\frac{4}{3}[/tex] x + [tex]\frac{13}{3}[/tex] ← equation of perpendicular line

The equation of the line that passes through (-5, 11) and perpendicular to y = (3/4)x + 1 is

y = -2x + 1

What is an equation of a line?

The equation of a line is given by:

y = mx + c

where m is the slope of the line and c is the y-intercept.

Example:

The slope of the line y = 2x + 3 is 2.

The slope of a line that passes through (1, 2) and (2, 3) is 1.

We have,

y = (2/4)x + 1 is in the form of y = m(2)x + c

So,

m(2) = 2/4 = 1/2

The equation of the line y = m(1)x + c is perpendicular to y = (2/4)x + 1.

So,

m(1) x m(2) = -1

m(1) = -1/(1/2)

m(1) = -2

Now,

y = -2x + c passes through (-5, 11).

This means,

11 = -2 x (-5) + c

11 = 10 + c

11- 10 = c

c = 1

Thus,

The equation of the line is y = -2x + 1.

Learn more about equation of a line here:

https://brainly.com/question/23087740

#SPJ2

At 11,560 feet above sea level, Climax, Colorado, is the highest town in the united States. The lowest town in Calipatria, California, at 185 feet below sea level. Express both of these distance as integers and tell which is closer to sea level. How much closer to sea level is the town that is closer?

Answers

Answer:

Climax:  11,560. Calipatria: 185 Calipatra is closer by 11,375ft

Step-by-step explanation:

Climax is 11,560ft above sea level, which means it is 11,560ft away from sea level. Calipatria 185ft away from sea level by the same logic. The one whih is closer to sea level would be the smaller number, which would be 185, and how much closer would be 11,560-185= 11,560.

If you're wondering why the 185 isn't negative, it's because the question is asking how far away from zero the numbers are, so you would take the absolute value of -185 which would be 185.

What is a 27 of the sequence 15, 10,5,...?
A.O
B. -75
c.
1/625
D. -115

Answers

Answer:

B. -75

Step-by-step explanation:

you count backwards from 5, 27 times

A.) Pinky bought 1. 1/2 kg of apples and 5. 1/4 kg of mangoes 1. 1/2 kg of oranges. Find the total weight of fruits B.) if her family eats 3/4 kg of apples and 2. 1/2 kg of mangoes and 1/2 kg of oranges. Find the weight of fruits left (Please say the answer with explanation who says the answer first I will mark them as the brainliest)

Answers

Answer:

A. Total weight of the fruits is 2.25 kg

B. There are no more fruits left.

Step-by-step explanation:

A.

To get the total weight of the fruits, we will first of all have to sort out the fruits and multiply the weight of the fruits by the number available.

Weight of apples:

we have one 1apple weighing 1/2 kg. The weight will be 1 |X 1/2 = 1/2 kg

Weight of mangoes:

We have five mangoes weighing 1/4 kg. Total weight will be 5 X 1/4 = 5/4 kg

Weight of oranges:

We have one orange weighing 1/2 kg. Total weight will be 1X 1/2 = 1/2 kg

Total weight of the fruits will be total weight of Mangoes + oranges + apples

= 1/2 + 5/4 + 1/2 = 2.25kg

B.

If her family begins to eat off some portions of the fruits, we will have to calculate the sum total of all the weights of fruits eaten

The portion eaten will be 3/4 + (2 X 1/2) + 1/2 = 2.25kg

If this happens the family would have eaten all of the fruits because

the original weight present is only 2.25kg of fruits to start with

Fachorise completely
x^2y^2-1​

Answers

Answer:

[tex](xy+1)(xy-1)[/tex]

Step-by-step explanation:

x²y²-1

=(xy)²-(1)²

=(xy+1)(xy-1)

Of the 40 specimens of bacteria in a dish, 3 specimens have a certain trait. If 5 specimens are to be selected from the dish at random and without replacement, which of the following represents the probability that only 1 of the 5 specimens selected will have the trait?1) (5/1)/(40/3)
2) (5/1)/(40/5)
3) (40/3)/(40/5)
4) (3/1)(37/4)/(40/3)
5) (3/1)(37/4)/(40/5)

Answers

Answer:

[tex]\frac{(^3_1)*(^{37}_4)}{(^{40}_5)}[/tex]

Step-by-step explanation:

The total number of ways in which 5 specimens can be selected from the  dish at random is given as C(40, 5).

Since only one of the five specimens would have the trait, the number of ways of selecting the one specimen out of the 3 specimens with the trait is C(3, 1).

3 specimens have the trait therefore 37 specimens (40 - 3) do not have the trait. The number of ways in which the remaining 4 specimens out of the 5 spemimens that do not have the trait is C(37, 4).

Therefore, the probability that only 1 of the 5 specimens selected will have the trait = [tex]\frac{C(3,1)*C(37,4)}{C(40,5)} =\frac{(^3_1)*(^{37}_4)}{(^{40}_5)}[/tex]

help please! Darren is finding the equation in the form y = m x + b for a trend line that passes through the points (2, 18) and (–3, 8). Which value should he use as b in his equation? a) –34 b) –19 c) 2 d) 14

Answers

Answer:  d) 14

Step-by-step explanation:

Equation of a line passing through (a,b) and (c,d):

[tex](y-b)=\dfrac{d-b}{c-a}(x-a)[/tex]

Equation of a line passing through (2, 18) and (–3, 8):

[tex](y-18)=\dfrac{8-18}{-3-2}(x-2)\\\\\Rightarrow\ (y-18)=\dfrac{-10}{-5}(x-2)\\\\\Rightarrow\ (y-18)=2(x-2)\\\\\Rightarrow\ y-18=2x-4\\\\\Rightarrow\ y=2x-4+18\\\\\Rightarrow\ y=2x+14[/tex]

Comparing resulting equation [tex]y=2x+14[/tex] to [tex]y = m x + b[/tex], we get value of b= 14.

Hence, correct option is d) 14

convert 13 into binary numbers​

Answers

Answer:

8  4  2  1

1    1  0  1

[tex]13_{ 10} = 1101_{ 2 }[/tex]

Step-by-step explanation:

8421
———
1101
That’s gonna be your anwser

Please help explanation if possible

Answers

Answer:

(1, - 2 )

Step-by-step explanation:

Given the equations

3x - 4y = 11 → (1)

y + 3x = 1 ( subtract 3x from both sides )

y = 1 - 3x → (2)

Substitute y = 1 - 3x into (1)

3x - 4(1 - 3x) = 11 ( distribute and simplify left side )

3x - 4 + 12x = 11

15x - 4 = 11 ( add 4 to both sides )

15x = 15 ( divide both sides by 15 )

x = 1

Substitute x = 1 into (2) for corresponding value of y

y = 1 - 3(1) = 1 - 3 = - 2

solution is (1, - 2 )

What value of x is in the solution set of 2(3х – 1) > 4х – 6?
—10
-5
—3
-1
Help me

Answers

Answer:

-1

Step-by-step explanation:

2(3х – 1) > 4х – 6

Distribute

6x -2 > 4x-6

Subtract 4x from each side

6x-2-4x > 4x-6-4x

2x-2 > -6

Add 2 to each side

2x-2+2> -6+2

2x> -4

Divide by 2

2x/2 > -4/2

x > -2

The number is greater than -2

The only number that is greater than -2 is -1

What is the most direct use of a compass in geometric constructions?

A.
to draw congruent angles

B.
to draw arcs of a given size

C.
to draw perpendicular lines

D.
to draw straight lines

Answers

Answer:

B

Step-by-step explanation:

to draw arcs of a given size

Answer:

B. to draw arcs of a given size.

Step-by-step explanation:

its correct on plato :)

Geometry, please answer question ASAP

Answers

Answer:

It's 5 which is A.

Step-by-step explanation:

An environmental agency worries that many cars may be violating clean air emissions standards. The agency hopes to check a sample of vehicles in order to estimate that percentage with a margin of error of 5​% and 95​% confidence. To gauge the size of the​ problem, the agency first picks 50 cars and finds 12 with faulty emissions systems. How many should be sampled for a full​ investigation?

Answers

Answer:

197

Step-by-step explanation:

Sample proportion is; p^ = 12/50 = 0.24

Margin of error of 5% is given by the formula;

ME = (z_0.05) √[p^(1 - p^)/n]

Let's make n(number of sample) the subject.

n = ((z_0.05)/ME)²((p^)(1 - p^))

From tables, the z-score of 0.05 is 1.645

Thus;

n = ((1.645)/0.05)²(0.24(1 - 0.24))

n ≈ 197

Given that p=x^2-y^2/x^2+xy
I. Express p in the simplest form
ii. Find the value of p, if x=-4 and y=-6

Answers

Answer:

When x = -4 and y = -6, p = 37.75

Step-by-step explanation:

Given that p = x² - y²/x² + x·y, we have;

p = (x² × x² -y² + x·y×x²)/x²

p = (x²⁺² - y² + x¹⁺² × y)/x²

p = (x⁴ - y² + x³·y)/x²

Therefore, p in the simplest form is given as follows;

[tex]p = \dfrac{x^4 - y^2 + x^3 \cdot y }{x^2}[/tex]

To find the value of p when x = -4 and y = -6, we plug in the value of x and y into the above equation to get the following equation;

[tex]p = \dfrac{(-4)^4 - (-6)^2 + (-4)^3 \cdot (-6) }{(-4)^2} = 37.75[/tex]

Therefore, the value of p when x = -4 and y = -6 is equal to 37.75.

Select the correct answer.
The product of two numbers is 21. If the first number is -3, which equation represents this situation and what is the second number?
ОА
The equation that represents this situation is x-3 = 21. The second number is 24.
ОВ.
The equation that represents this situation is 3x = 21. The second number is 7.
Ос.
The equation that represents this situation is -3x = 21. The second number is -7.
OD.
The equation that represents this situation is -3 + x = 21. The second number is 18.

Answers

nOSE

D

AS

DA

DAS

DA

SD

ADA

SD

Answer:

Oc

Step-by-step explanation:

Oc because product means multiplication and there is a negative sign

The sum of 3 consecutive odd numbers is 183. What is the second number in this sequence?

Answers

Answer:

61

Step-by-step explanation:

x+x+1+x+2 = 183

3x+3 = 183

3x = 180

x = 60

Second number = x+1 = 61

What is the value of the expression below when x=3
10x²- 7x + 10

Answers

Answer: 79

Concept:

Here, we need to understand the idea of evaluation.  

When encountering questions that gave you an expression with variables, then stated: "If x = a, y = b, z = c" (a, b, c are all constants), this means you should substitute the value given for each variable back to the expression.

Solve:

Given information

10x² - 7x + 10

x = 3

Substitute the value into the expression

= 10 (3)² - 7 (3) + 10

Simplify by multiplication

= 10 (9) - 21 + 10

= 90 - 21 + 10

Simplify by subtraction

= 69 + 10

Simplify by addition

= 79

Hope this helps!! :)

Please let me know if you have any questions

Answer:

92

Step-by-step explanation:

The variable 'x' shows up twice in this expression.  Replace each instance of 'x' with 3:

10(3)^2 - 7(3) + 10  =  10(9) - 21 + 19  =  92

If the measure of the base of a triangle is 3b+2 and the height is 4b,represent the area of the triangle

Answers

Answer:

6b^2 +4b

Step-by-step explanation:

The area of a triangle is

A = 1/2 bh

A = 1/2 * (3b+2) * (4b)

    =1/2 (12 b^2 +8b)

   = 6b^2 +4b

WHERE ARE THE EXPERTS AND ACE!!!!!!! I NEED HELP PLS SHARE YO SMARTNESS!!!!! WILL GIVE BRAINLIEST AND RATE AND VOTE!!! EASY IM JUST NOT SMART

PLEASE GIVE EXPLANATION

Answers

Answer:

Yo it's A

Step-by-step explanation:

An infinite sequence is one that goes on forever, in this case it's the one with the "..." at the end because that is what shows that the sequence is infinite

There are two infinite sequences, and you just have to figure out which one is an arithmetic sequence.  An arithmetic sequence is one that subtracts or adds the same number every time to the previous number.

Out of the two infinite sequence choices, it's obviously not B because you aren't subtracting or adding the same number every time

It's A because you add 122 every time and it goes on forever.

hope this helps lol

please solve this

.............​

Answers

Answer:

D

Step-by-step explanation:

Note that I will be using a, b, and y instead of their Greek counterparts.

First, we know that sin(c+d) = sin(c)cos(d) + cos(d)sin(a) and sin(c-d) = sin(c)cos(d) - cos(d)sin(a). We can apply these here to get

sin(b+y) = sin(b)cos(y) + cos(b)sin(y)

sin(b-y) = sin(b)cos(y) - cos(b)sin(y)

sin(a+y) = sin(a)cos(y) + cos(a)sin(y)

sin(a-y) = sin(a)cos(y) - cos(a)sin(y)

Plugging these into our equation, we get

(sin(b)cos(y) + cos(b)sin(y) - (sin(b)cos(y) - cos(b)sin(y)))

/

(sin(a)cos(y) + cos(a)sin(y)-(sin(a)cos(y) - cos(a)sin(y)))

=

2cos(b)sin(y) / 2cos(a)sin(y)

= cos(b)sin(y)/cos(a)sin(y)

= cos(b)/cos(a)

Next, we can see that a+b = π, so we can subtract b from both sides to get a = π -b. Plugging that in for a in our equation, we get

cos(b) / cos(π-b)

After that, we know that cos(c-d) = cos(c)cos(d) - sin(c)sin(d). Plugging that in here, we get

cos(π-b) = cos(π)cos(b) - sin(π)sin(b)

= -cos(b) + 0

= -cos(b)

Plugging that back into our equation, we get

cos(b) / -cos(b) = -1

really urgent...i need the working also ...pls help me​

Answers

Answer:

See below.

Step-by-step explanation:

In each case, you are looking for time. We know speed is distance divided by time. Lets start with the speed formula.

speed = distance/time

Now we solve it for time. Multiply both sides  by time and divide both sides by speed.

speed * time = distance

time = distance/speed

Time is distance divided by speed. In each problem, you have a speed and a distance. Divide the distance by the speed to to find the time.

1) speed = 44.1 km/h; distance = 150 km

time = distance/speed = 150 km/(44.1 km/h) =

= 3.401 hours = 3 hours + 0.401 hour * 60 min/hour = 3 hours 24 minutes

2) speed = 120 km/h; distance = 90 km

time = distance/speed = 90 km/(120 km/h) =

= 0.75 hours = 0.75 hour * 60 min/hour = 45 minutes

3) speed = 125 m/s; distance = 500 m

time = distance/speed = 500 m/(125 m/s) =

= 4 seconds

Choose the best answer that represents the property used to rewrite the
expression.

log root(12, 125x ^ 3) = 1/4 * log 5x

Answers

Answer:

commutative properties

PLEASE Help! I need this by tomorrow!

Answers

Answer:

18m

Step-by-step explanation:

6 times 3 = 18

???? help please i don’t understand this

Answers

Answer:

  1.5

Step-by-step explanation:

We hope there is something in the context of this question that tells you this is a geometric sequence. If not, it is not possible to choose an appropriate answer.

__

Assuming a geometric sequence, the n-th term is found from the first term (a1) and the common ratio (r) to be ...

  an = a1·r^(n-1)

Using the given values, we can solve simultaneous equations to find a1 and r:

  a2 = 48 = a1·r^(2-1) = a1·r

  a5 = 6 = a1·r^(5-1) = a1·r^4

The ratio of these terms is ...

  a5/a2 = (a1·r^4)/(a1·r) = r^3

  6/48 = r^3 = 1/8

  r = ∛(1/8) = 1/2

__

To find the 7th term, we can make use of the fact that one term is related to the next by the common ratio. (We don't need to find a1.)

Then the 7th term is ...

  a7 = a1·r^(7-1) = a1·r^6 = (a1·r^4)·r^2 = a5·r^2

  a7 = 6·(1/2)^2 = 6/4 = 1.5 . . . . . . substitute for a5 and r

The 7th term is 1.5.

ILL MARK BRAINIEST IF YOU DO THIS CORRECTLY!!!

Answers

Answer:

55%

Step-by-step explanation:

55%
You just move the decimal over two places.

The owner of an organic fruit stand also sells nuts. She wants to mix cashews worth $5.50 per pound with peanuts worth $2.30 per pound to get a 1/2 pound mixture that is worth $2.80 per pound. How much of each kind of nut should she include in the mixed bag?

Answers

Total weight required is half pound, so let the amount of cashews be [tex] a[/tex] , and amount of peanuts be $b$

$\therefore a+b=0.5$ (1)

And we want this to cost $2.80$

Cost of $a$ pound of cashews will be $5.50\times a$ and cost of $b$ pound peanuts will be $2.30\times b$

$\therefore 5.5a+2.3b=2.8$ (2)

Substitute $a=0.5-b$ from equation (1) in equation (2)

$5.5(0.5-b)+2.3b=2.8$

$\implies -3.2b=2.8+5.5\times0.5 $

$\implies -3.2b=0.05$

$b$ comes out to be negative. That means there's no solution with the given conditions.

I checked once , I don't think there's any mistake. Can someone else verify too?

EDIT

I verified all the given options from calculator, and no option gives 2.80

Other Questions
The English bill of rights effectively ended the threat of Write parametric equations of the line [tex]-4x+y=-2[/tex]a. [tex]x=t, y=4t-2[/tex]b. [tex]x=t, y=-4t-2[/tex]c. [tex]x=t, y=4t+2[/tex]d. [tex]x=t, y=-4t+2[/tex] The base of a triangle is 4 cm greater than theheight. The area is 30 cm. Find the height andthe length of the basehThe height of the triangle isThe base of the triangle is Vamos a viajar de Boston a Madrid. Para hacer un viaje internacional. necesitamos un documento que se llama? Solve. 100+[12{20(105)}] Simplify:5x+2(32x)+7x + 1312x9x + 13 How do I do this? I think I know how But I am not 100% sure! Thanks in advance! I will mark answer the Branliest! Calculate the break-even level of customers needed. whats an example of cyber world pls help i only have 20 minutes left to turn this in!!! What are the correct half reactions for the following reaction: Cu2+ + Mg -> Cu + Mg2+ A bank account earned 3.5% continuously compounded annual interest. After the initial deposit, no deposits or withdrawals were made. At the end of an 8 year period, the balance in the account was $13231.30. What was the dollar amount of the initial deposit? Round your answer to the nearest dollar. Do not include a dollar sign ($) or comma in your answer. Find the missing value. Hint: Use the number line to find the missing value. 7 = 7=minus, 7, equals ( 2 ) (2)minus, left parenthesis, minus, 2, right parenthesis CH4 + 2O2 CO2 + 2H2O In the chemical reaction, if 10 moles of H2O are produced, moles of CO2 are also produced Write the equation in slope-intercept form, y = 4(x - 5) + 7x iu g s xy ra nu b mt ly nc nng vo t ng ? Thomas loves tomatoes. He plans to fill the container shown below with soil to grow his own tomatoplants. The dimensions of the container are shown in inches.umindo20 ingeo10 in-How much soil will the container hold?Either enter an exact answer in terms of or use 3.14 for .inches? What is nine thousandths as a decimal A) A 2-N force is applied to a spring, and there is displacement of 0.4 m. How much would the spring be displaced if a 5-N force was applied? (1 point)1 m4 m0.08 m2 m Point B is on line segment AC. Given BC=9 and AB=11, determine the length AC. In a pluralistic society, special interest groups have a right to which of the following? Select all that apply. 1. ignore legislation on behalf of small business 2. lobby the White House for a higher tax on the wealthiest 1% 3. testify in court on behalf of immigrants 4. get a Senator to introduce legislation to ensure healthcare for Hispanic children 5. meet with Congressional leaders to ask for the protection of religious minorities Indicate whether each of the following statements is true or false.a. A company has the following assets at the end of the year: cash on hand $40,000, cash refund due from customer $30,000, and checking account balance $22,000. Cash and cash equivalents is therefore $62,000.b. A company that has received NSF checks should report these checks as a current liability on the balance sheet.c. Restricted cash that is a current asset is reported as part of cash and cash equivalents.d. A company has cash in the bank of $50,000, petty cash of $400, and stock investments of $100,000. Total cash and cash equivalents is therefore $50,400.