Sulfur dioxide reacts with oxygen to form sulfur trioxide. What change in hybridization of the sulfur occurs in this reaction ? g

Answers

Answer 1

Answer:

PLEASE LOOK INN TO THE FILE YOU WILL GET ANSWER AND ALSO SUMMARY THANKS FOR ASKING QUESTION.

Explanation:

Sulfur Dioxide Reacts With Oxygen To Form Sulfur Trioxide. What Change In Hybridization Of The Sulfur

Related Questions

Glucose is soluble in water. Why is cellulose, which is made up of glucose, insoluble in water?​

Answers

.....................

Cellulose is insoluble in water which is made up of glucose because it possesses high inter and intramolecular hydrogen bonding between the hydroxyl groups of the neighboring chains.

What is the function of cellulose?

Due to being insoluble in nature, it serves as the fundamental component of the cell membrane in the plant. This is why the cell wall of plant cells are made of cellulose.

The chains of the cellulose are strongly bonded to each other. So, it is very difficult for the molecules of water to rupture or destruct these bonds between the chains. It is a hydrogen bond cross-linked polymer and more complex than glucose.

Therefore, due to high inter and intramolecular hydrogen bonding between the hydroxyl groups of the neighboring chains, cellulose is insoluble in water.

To learn more about Cellulose, refer to the link:

https://brainly.com/question/1768072

#SPJ2

.) At 500 oC, cyclopropane, C3H6, rearranges to form propene. The reaction is first order with a rate constant of 6.7 x 10-4 s-1. If the initial concentration of C3H6 is 0.0500 M, (a) what is the molarity of C3H6 after 30 min

Answers

Answer:

0.015 M

Explanation:

For a first order reaction;

ln[A] =ln[A]o - kt

[A] = final concentration

[A]o =initial concentration

k= rate constant

t= time taken

ln[A] =ln[A]o - kt

ln[A] = ln(0.0500) - 6.7 x 10-4 (30 × 60)

ln[A] = -2.9957 - 1.206

ln[A] = -4.202

e^ln[A] = e^(-4.202)

A= 0.015 M

Given the balanced chemical equation for the decomposition for INO, and the rate of disappearance of INO, write the expressions for the rates of appearance of I2 and NO.

2INO(g) → I2(g) + 2NO(g)

Reactant: Product(I2): Product(NO):

-∆[INO]/2∆t = ??/??

Answers

Answer:

rate of disappearance of -0.5d[INO]/dt

rate of appearance of I2 = d[I2]/dt

rate of appearance of No = 0.5*d[NO]/dt

Explanation:

According to chemical equilibrium,  d[I₂]/dt and d[NO]/dt is  the expressions for the rates of appearance of I₂ and NO respectively.

What is chemical equilibrium?

Chemical equilibrium is defined as the condition which arises during the course of a reversible chemical reaction with no net change in amount of reactants and products.A reversible chemical reaction is the one wherein the products as soon as they are formed react together to produce back the reactants.

At equilibrium, the two opposing reactions which take place take place at equal rates and there is no net change in amount of the substances which are involved in the chemical reaction.At equilibrium, the reaction is considered to be complete . Conditions which are required for equilibrium are given by quantitative formulation.

Factors which affect chemical equilibrium are change in concentration , change in pressure and temperature and presence of catalyst.

Learn more about chemical equilibrium,here:

https://brainly.com/question/4289021

#SPJ6

What would happen to the measured cell potentials if 30 mL solution was used in each half-cell instead of 25 mL

Answers

Answer:

The answer is "[tex]\bold{\log \frac{[0] mole}{[R]mole}}[/tex]"

Explanation:

[tex]E_{cell} =E_{cell}^{\circ} - \frac{0.0591}{n}= \log\frac{[0]}{[R]}\\[/tex]

In the above-given equation, we can see from [tex]E_{ceu}[/tex], of both oxidant [tex]conc^n[/tex]as well as the reactant were connected. however, weight decreases oxidant and reduction component concentration only with volume and the both of the half cells by the very same factor  and each other suspend

[tex]\to \log \frac{\frac{\text{oxidating moles}}{25 \ ml}}{\frac{\text{moles of reduction}}{25 ml}} \ \ = \ \ \log \frac{\frac{\text{oxidating moles}}{30 \ ml}}{\frac{\text{moles of reduction}}{30 ml}} \\\\\\[/tex]

[tex]\to {\log \frac{[0] mole}{[R]mole}}[/tex]

The cell potential of the electrochemical reaction has been the same when the volume has been reduced from 30 mL to 25 mL in each half cells.

The cell potential has been given as the difference in the potential of the two half cells in the electrochemical reaction.

The two cells has been set with the concentration of solutions in the oxidation and reduction half cells.

Cell potential change

The cell potential has been changed when there has been a change in the potential of the half cells.

The volume of 30 mL to the solution has been, resulting in the cell potential difference of x.

With the volume of 25 mL, there has been the difference in the potential being similar to the 30 mL solution, i.e. x.

Thus, the cell potential of the electrochemical reaction has been the same when the volume has been reduced from 30 mL to 25 mL in each half cells.

Learn more about cell potential, here:

https://brainly.com/question/1313684

A 2.87g sample of carbon reacts with hydrogen to form 3.41g of car fuel. What is the empirical formula of the car fuel?

Answers

Answer:

The empirical formulae for the car fuel is C4H9

Calculate the moles of Iron (Fe) in 3.8 x 10^{21} atoms of Iron. Please show your work

Answers

Answer: 6.31×10⁻³ moles Fe

Explanation:

To calculate moles when given atoms, we need to use Avogadro's number.

Avogadro's number: 6.022×10²³ atoms/mol

[tex](3.8*10^2^1 atoms)*\frac{mol}{6.022*10^2^3 atoms} =6.31*10^-^3 mols[/tex]

The atoms cancel out, and we are left with moles. There are 6.31×10⁻³ moles Fe.

When the following molecular equation is balanced using the smallest possible integer coefficients, the values of these coefficients are: potassium hydrogen sulfate (aq) potassium hydroxide (aq) potassium sulfate (aq) water (l)\

Answers

Answer:

Explanation:

Answer:

1, 1, 1, 1  

Explanation:

potassium hydrogen sulfate + potassium hydroxide ⟶ potassium sulfate + water(l)

                 KHSO₄                   +               KOH              ⟶            K₂SO₄   + H₂O

1. Put a 1 in front of the most complicated-looking formula (K₂SO₄?):

KHSO₄  + KOH ⟶ 1K₂SO₄ + H₂O

2. Balance S:

We have fixed 1 S on the right. We need 1 S on the left. Put a 1 in front of KHSO₄ to fix it.

1KHSO₄  + KOH ⟶ 1K₂SO₄ + H₂O

3. Balance K:

We have fixed 2 K on the right and 1 K on the left. We need 1 more K on the left. Put a 1 in front of KOH.

1KHSO₄  + 1KOH ⟶ 1K₂SO₄ + H₂O

4. Balance O

We have fixed 4 O on the right and 5 O on the left. We need 1 more O on the right. Put a 1 in front of H₂O.

1KHSO₄  + 1KOH ⟶ 1K₂SO₄ + 1H₂O

Every formula has a coefficient. The equation should be balanced.

5. Check that atoms balance:

[tex]\begin{array}{ccc}\textbf{Atom} & \textbf{On the left} & \textbf{On the right}\\\text{K} & 2 &2\\\text{H} & 2 & 2\\\text{S} & 1 & 1\\\text{O}&5&5\\\end{array}[/tex]

It checks.

The coefficients are 1, 1, 1, 1.

 

A 1 liter solution contains 0.436 M hypochlorous acid and 0.581 M potassium hypochlorite. Addition of 0.479 moles of barium hydroxide will: (Assume that the volume does not change upon the addition of barium hydroxide.)

Answers

Answer:

Exceed the buffer capacity and Raise the pH by several units

Explanation:

Options are:

Raise the pH slightly

Lower the pH slightly

Raise the pH by several units

Lower the pH by several units

Not change the pH

Exceed the buffer capacity

The hypochlorous acid, HClO, is in equilibrium with Hypochlorite ion (From potassium hypochlorite, ClO⁻) producing a buffer. Using H-H equation, pH of initial buffer is:

pH = pKa + log [ClO⁻] / [HClO]

pKa for hypochlorous acid is 7.53

pH = 7.53 + log [0.581M] / [0.436M]

pH = 7.65

Barium hydroxide reacts with HClO producing more ClO⁻, thus:

Ba(OH)₂ + 2HClO →  2ClO⁻ + 2H₂O

As 0.479 moles of Barium hdroxide are added. For a complete reaction you require 0.479mol * 2 = 0.958 moles of HClO

As you have just 0.436 moles (Volume = 1L),

The addition will:

Exceed the buffer capacity

The Ba(OH)₂ that reacts is:

0.436 moles HClO * (1mole (Ba(OH)₂ / 2 mol HClO) = 0.218 moles Ba(OH)₂ and will remain:

0.479 mol - 0.218 mol = 0.261 moles Ba(OH)₂

As 1 mole of Ba(OH)₂ contains 2 moles of OH⁻, moles of OH⁻ and molarity is:

0.261 moles* 2 = 0.522 moles OH⁻ = [OH⁻]

pOH = -log [OH⁻]

pOH = 0.28

And pH = 14 - pOH:

pH = 13.72

Thus, after the addition the pH change from 7.65 to 13.62:

Raise the pH by several units

A sailor on a trans-Pacific solo voyage notices one day that if he puts 735.mL of fresh water into a plastic cup weighing 25.0g, the cup floats in the seawater around his boat with the fresh water inside the cup at exactly the same level as the seawater outside the cup (see sketch at right).

Calculate the amount of salt dissolved in each liter of seawater. Be sure your answer has a unit symbol, if needed, and round it to 2 significant digits.

You'll need to know that the density of fresh water at the temperature of the sea around the sailor is 0.999/gcm3. You'll also want to remember Archimedes' Principle, that objects float when they displace a mass of water equal to their own mass.

Answers

Answer:

Amount of salt in 1 L seawater = 34 g

Explanation:

According to Archimedes' principle, mass of freshwater and cup = mass of equal volume of seawater

mass of freshwater = density * volume

1 cm³ = 1 mL

mass of freshwater = 0.999 g/cm³ * 735 cm³ = 734.265 g

mass of freshwater + cup = 734.265 + 25 = 759.265 g

Therefore,  mass of equal volume of seawater = 759.265 g

Volume of seawater displaced = 735 mL = 0.735 L (assuming the cup volume is negligible)

1 liter = 1000 cm³ = 1000 mL;

Density of seawater = mass / volume

Density of seawater = 759.265 g / 0.735 L = 1033.01 g/L

Density of freshwater in g/L = 0.999 g/ (1/1000) L = 999 g/L

mass of 1 Liter seawater = 1033.01 g

mass of 1 Liter freshwater = 999 g

mass of salt dissolved in 1 L of seawater = 1033.01 g - 999 g = 34.01 g

Therefore, amount of salt in 1 L seawater = 34 g

An element has 6 protons and 6 neutrons. What is the atomic number? What is its mass number?

Answers

Answer:

The atomic is 6, the mass number is 12

Explanation:

The element being described is Carbon.

The number of protons in the nucleus of an atom is called its atomic number, Z.

The number of protons pluss the number of neutronsin the nucleus of an atom gives the atom's mass number, A.

Given that π = n M R T, rearrange the equation to solve for V

Answers

Answer:

V= n/M

Explanation:

From;

π = nRT/V = MRT

Where;

n= number of moles

R= gas constant

T= absolute temperature

M= molar mass

V= volume of the solution

π= osmotic pressure

Thus;

nRT/V = MRT

nRT = VMRT

V= nRT/MRT

V= n/M

Hey. what is the difference between a boulder and a rock? ]
And bonus: what did the duck say when she bought lipstick?

Answers

Answer:

The difference between a rock and a boulder can be explained in terms of size and detachment. A rock is defined by geologists as an aggregate of minerals. A boulder is a type of rock, specifically a large detached one. All boulders are rocks, but not all rocks are boulders.

When the equation MnO₄⁻ + I⁻ + H₂O → MnO₂ + IO₃⁻ is balanced in basic solution, what is the smallest whole-number coefficient for OH⁻?

Answers

Answer:

The smallest whole-number coefficient for OH⁻ is 2

Explanation:

Step 1: The equation redox reaction is divided into two half equations

Reduction half equation: MnO₄⁻  ----> MnO₂

Oxidation half-equation: I⁻  ---> IO₃⁻

Step 2: Next the atoms are balanced by adding OH⁻ ions and H₂O molecules to the appropriate side of each half equation;

MnO₄⁻ +  2H₂O ----> MnO₂ + 4OH⁻

I⁻ + 6OH⁻ ---> IO₃⁻ + 3H₂O

Step 3 : The charges are then balanced by adding electrons to the appropriate sides of each half equation

MnO₄⁻ +  2H₂O + 3e⁻ ----> MnO₂ + 4OH⁻

I⁻ + 6OH⁻ ---> IO₃⁻ + 3H₂O + 6e⁻

Step 4: Oxidation half equation is multiplied by 2 while reduction half equation is multiplied by 1 to balance the number of electrons gained and lost for the reaction

2MnO₄⁻ +  4H₂O + 6e⁻ ----> 2MnO₂ + 8OH⁻

I⁻ + 6OH⁻ ---> IO₃⁻ + 3H₂O + 6e⁻

Step 5 : addition of the two half equations to yield a net ionic equation

2MnO₄⁻  + I⁻ + H₂O ----> 2MnO₂ + IO₃⁻ + 2OH⁻

The smallest whole number coefficient for OH⁻ is 2

A redox reaction is divided into two half equations which are shown below:

Reduction half equation: MnO₄⁻  ----> MnO₂

Oxidation half-equation: I⁻  ---> IO₃⁻

Atoms are balanced by adding OH⁻ ions and H₂O molecules to the appropriate side of each half equation to make the equation complete ;

MnO₄⁻ +  2H₂O ----> MnO₂ + 4OH⁻

I⁻ + 6OH⁻ ---> IO₃⁻ + 3H₂O

The charges needs to be balanced and this is done by adding electrons to the appropriate sides of each half equation

MnO₄⁻ +  2H₂O + 3e⁻ ----> MnO₂ + 4OH⁻

I⁻ + 6OH⁻ ---> IO₃⁻ + 3H₂O + 6e⁻

The equation needs to be balanced by multiplying the oxidation half equation by 2 while reduction half equation is multiplied by 1 to balance the number of electrons on both sides of the equations.

2MnO₄⁻ +  4H₂O + 6e⁻ ----> 2MnO₂ + 8OH⁻

I⁻ + 6OH⁻ ---> IO₃⁻ + 3H₂O + 6e⁻

The two half equations are then added and written together to form a net ionic equation

2MnO₄⁻  + I⁻ + H₂O ----> 2MnO₂ + IO₃⁻ + 2OH⁻

The smallest whole-number coefficient for OH⁻ is therefore 2.

Read more on https://brainly.com/question/17156617

If 1 mol of a pure triglyceride is hydrolyzed to give 2 mol of RCOOH, 1 mol of R'COOH, and 1 mol of glycerol, which of the following compounds might be the triglyceride?
CHOC(O)R
A. CHOC(O)R
CHOC(O)R
CH,OC(O)R
B. CHOC(O)R
CH2OC(O)R
CHOC(O)R
C. CHOC(O)R
CHOC(O)R
CHOC(O)R
D. CHOC(O)R
CHOC(O)R

Answers

Answer:

The correct option is C.

Note the full question and structure of the moleculesis found in the attachment below.

Explanation:

Triglycerides or triacylglycerols are non-polar, hydrophobic lipid molecules composed of three fatty acids linked by ester bonds to a molecule of glycerol.

The fatty acids linked to the glycerol molecule are denoted by R and may be of the same kind or different. when the R group is the same, the R is attached in all the three positions for ester bonding in the glycerol molecule but when they are different are denoted by R, R' and R'' respectively.

During the hydrolysis of triglycerides, the three fatty acids molecules are obtained as well as a glycerol molecule.

From the question, when 1 mole of the triglyceride is hydrolysed, 2 moles of RCOOH, 1 mole of R'COOH and 1 mole of glycerol is obtained. The triglyceride must then be composed of two fatty acids which are the same denoted by R, and a different fatty acid molecule denoted by R'.

The correct option therefore, is C

Calculate the [H+] and pH of a 0.0010 M acetic acid solution. The Ka of acetic acid is 1.76×10−5. Use the method of successive approximations in your calculations.

Answers

Answer:

[tex][H^+]=0.000123M[/tex]

[tex]pH=3.91[/tex]

Explanation:

Hello,

In this case, dissociation reaction for acetic acid is:

[tex]CH_3COOH\rightleftharpoons CH_3COO^-+H^+[/tex]

For which the equilibrium expression is:

[tex]Ka=\frac{[CH_3COO^-][H^+]}{[CH_3COOH]}[/tex]

Which in terms of the reaction extent [tex]x[/tex] could be written as:

[tex]1.74x10^{-5}=\frac{x*x}{[CH_3COOH]_0-x}=\frac{x*x}{0.0010M-x}[/tex]

Thus, solving by using a solver or quadratic equation we obtain:

[tex]x_1=0.000123M\\\\x_2=-0.000141M[/tex]

And clearly the result is 0.000123M, which also equals the concentration of hydronium ion in solution:

[tex][H^+]=0.000123M[/tex]

Now, the pH is computed as follows:

[tex]pH=-log([H^+])=-log(0.000123)\\\\pH=3.91[/tex]

Best regards.

If 75.4 J of energy is absorbed by 0.25 mol of CCl4 at constant pressure, what is the change in temperature? The specific heat of CCl4 is 0.861 J/g·°C.

Answers

Answer:

ΔT = 2.28°C

Explanation:

Heat, H = 75.4J

Number of moles = 0.25 mol

Specific heat capacity, c = 0.861 J/g·°C

Change in temperature, ΔT = ?

These quantities are related by the following equation;

H = mc ΔT

Mass, m = Number of moles * Molar mass

m = 0.25mol * 153.82 g/mol

m = 38.455g

S back to the equation;

H = mc ΔT

Substituting the values;

75.4 = 38.455 * 0.861 * ΔT

ΔT = 75.4 /  33.11

ΔT = 2.28°C

The change in temperature is 2.28 °C

First, we will determine the mass of CCl₄ absorbed

From the given information,

Number of moles of CCl₄ absorbed = 0.25 mol

Using the formula

Mass = Number of moles × Molar mass

Molar mass of CCl₄ = 153.82 g/mol

∴ Mass of CCl₄ absorbed = 0.25 × 153.82

Mass of CCl₄ absorbed = 38.455 g

Now, using the formula

Q = mcΔT

Where Q is the quantity of heat

m is the mass

c is the specific heat of substance

and ΔT is the change in temperature

From the given information

Q = 75.4 J

c = 0.861 J/g.°C

Putting the parameters into the formula, we get  

75.4 = 38.455 × 0.861 ×ΔT

75.4 = 33.109755 × ΔT

∴ ΔT = 75.4 ÷ 33.109755

ΔT = 2.28 °C

Hence, the change in temperature is 2.28 °C

Learn more here: https://brainly.com/question/13439286

Name the following compound from the concise formula:______.
CH3CH(CH3)CHCHCH(CH3)CH2CH3
A. 2,4-dimethyl-3-heptene
B. 2,5-dimethyl-3-heptene
C. 3,5-dimethyl-3-heptene
D. 2,5-dimethyl-4-heptene

Answers

Answer:

B. 2,5-dimethyl-3-heptene

Explanation:

Answer:

B. 2,5-dimethyl-3-heptene

Explanation:

When 1604 J of heat energy is added to 48.9 g of hexane, C6H14, the temperature increases by 14.5 ∘C. Calculate the molar heat capacity of C6H14.

Answers

Answer:

THE MOLAR HEAT CAPACITY OF HEXANE IS 290.027 J/ C

Explanation:

1604 J of heat is added to 48.9 g of hexane

To calculate the molar heat capacity of hexane, it is important to note that the molar heat capacity of a substance is the measure of the amount of heat needed to raise 1 mole of a substance by 1 K.

Since 1604 J of heat = 48.9 g of hexane

Molar mass of hexane = 86 g/mol = 1 mole

then;

1604 J = 48.9 g

x = 86 g

x = 1604 * 86 / 48.9

x = 4205.4 J

Hence, 4205.4 J of heat will be added to 1 mole or 86 g of hexane to raise the temperature by 14.5 C.

In other words,

heat = molar heat capacity * temperature change

molar heat capacity = heat/ temperature change

Molar heat capacity = 4205.4 J / 14.5 C

Molar heat capacity = 290.027 J/C

The molar heat capacity of hexane is 290.027 J/ C

Which term describes the repeated arrangement of the same molecule?

Answers

Answer:

1. C

Carbon atoms

2. C

CH3CH2OH

3. C

extended structure

AND 4. B

One grey sphere, four white spheres, one red sphere

TOOK THE QUIZ. YOUR WELCOME :))

The term which describe the repeated arrangement of same molecules is extended structure. Thus option D is correct.    

What is extended structure?

Extended structure can be defined as a structure in which the subunits are arranged in a repeating pattern and occur in a consistent ratio.

Sodium chloride and diamond are some of the example of extended structure.

The expanded or extended  structure departs from the bilayer configuration, with well-separated hydrophilic and hydrophobic layers made up of propagating chains along the calixarene cavity axis are some characteristics.  

Thus, the term which describe the repeated arrangement of same molecules is extended structure. Thus option D is correct.  

To learn more about extended structure, refer to the link below:

https://brainly.com/question/21597101

#SPJ2

Your question is incomplete but probably your complete question was

Which term describes the repeated arrangement of the molecule?

A. Bonds

B. Atoms

C. Molecular Model

D. Extended Structure

"How much NH4Cl, when present in 2.00 liters of 0.200 M ammonia, will give a solution with pH = 8.20? For NH3, Kb = 1.8 x 10-5"

Answers

Answer:

245.66g of NH₄Cl is the mass we need to add to obtain the desire pH

Explanation:

The mixture of NH3/NH4Cl produce a buffer. We can find the pH of a buffer using H-H equation:

pH = pKa + log [A⁻] / [HA]

Where [A⁻] is the molar concentration of the base, NH₃, and [HA] molar concentration of the acid, NH₄⁺. This molar concentration can be taken as the moles of each chemical

First, we need to find pKa of NH₃ using Kb. Then, the moles of NH₃ and finally replace these values in H-H equation to solve moles of NH₄Cl we need to obtain the desire pH.

pKa NH₃/NH₄⁺

pKb = - log Kb

pKb = -log 1.8x10⁻⁵ = 4.74

pKa = 14 - pKb

pKa = 14 - 4.74

pKa = 9.26

Moles NH₃

2.00L ₓ (0.200mol NH₃ / L) = 0.400 moles NH₃

H-H equation:

pH = pKa + log [NH₃] / [NH₄Cl]

8.20 = 9.26 + log [0.400 moles] / [NH₄Cl]

-1.06 =  log [0.400 moles] / [NH₄Cl]

0.0087 =  [0.400 moles] / [NH₄Cl]

[NH₄Cl] = 0.400 moles / 0.0087

[NH₄Cl] = 4.59 moles of NH₄Cl we need to add to original solution to obtain a pH of 8.20. In grams (Using molar mass NH₄Cl=53.491g/mol):

4.59 moles NH₄Cl ₓ (53.491g / mol) =

245.66g of NH₄Cl is the mass we need to add to obtain the desire pH

The two common properties of all solids are fixed _____ and _____.

Answers

Answer:

shape

volume

Hope this helps! (づ ̄3 ̄)づ╭❤~

Explanation:

Shape and volume is the correct answer

What do you predict the chemical formula for the compound formed between calcium and sulfur?

Answers

Answer:

calcium donates two vanence electrons to sulfur atom to form Ca2+ ion and an S2+ - ion

When titrating a strong acid with a strong base, after the equivalence point is reached, the pH will be determined exclusively by: Select the correct answer below:
A) hydronium concentration
B) hydroxide concentration
C) conjugate base concentration
D) conjugate acid concentration

Answers

Answer:

B) hydroxide concentration

Explanation:

Hello,

In this case, since we are talking about strong both base and acid, since the base is the titrant and the acid the analyte, once the equivalence point has been reached, some additional base could be added before the experimenter realizes about it, therefore, since the titrant is a strong base, it completely dissociates in hydroxide ions and metallic ions which allows us to compute the pOH of the solution by known the hydroxide ions concentration.

After that, due to the fact that the pH is related with the pOH as shown below:

pH=14-pOH

We can directly compute the pH.

Best regards.

oxide. b) Silicon dio
43. What is the nature of an enzyme?
a) Vitamin. b) Lipid. c) Carbohydrate. d) Protein
44. Name the enzyme which catalyzes the oxidation-reduction reaction?
a) Transaminase. b) Glutamine synthetase. c) Phosphofructokinase. d) Oxidoreductase
nontido

Answers

Answer:

43) protein

44) oxidoreductase

16. The concentration of a solution of potassium hydroxide is determined by titration with nitric
acid. A 30.0 mL sample of KOH is neutralized by 42.7 mL of 0.498 M HNO3. What is the
concentration of the potassium hydroxide solution?

Answers

Answer:

[tex]M_{base}=0.709M[/tex]

Explanation:

Hello,

In this case, since the reaction between potassium hydroxide and nitric acid is:

[tex]KOH+HNO_3\rightarrow KNO_3+H_2O[/tex]

We can see a 1:1 mole ratio between the acid and base, therefore, for the titration analysis, we find the following equality at the equivalence point:

[tex]n_{acid}=n_{base}[/tex]

That in terms of molarities and volumes is:

[tex]M_{acid}V_{acid}=M_{base}V_{base}[/tex]

Thus, solving the molarity of the base (KOH), we obtain:

[tex]M_{base}=\frac{M_{acid}V_{acid}}{V_{base}} =\frac{0.498M*42.7mL}{30.0mL}\\ \\M_{base}=0.709M[/tex]

Regards.

how many moles of oxygen atoms are present in 0.4 moles of oxygen gas​

Answers

Answer:

Each molecule of O2 is made up of 2 oxygen atoms. So 1 mole of O2 molecules is made up of 2 moles of oxygen atoms. Therefore 1 mole of oxygen gas contains 2 moles of oxygen atoms. And 0.4 moles of oxygen gas contains 0.8 moles of oxygen atoms.

There are 0.8 moles of oxygen atoms in 0.4 moles of oxygen gas.

Oxygen gas (O₂) consists of two oxygen atoms bonded together. Therefore, to determine the number of moles of oxygen atoms present in a given amount of oxygen gas, we can simply multiply the number of moles of oxygen gas by the number of oxygen atoms per molecule, which is 2.

Given that we have 0.4 moles of oxygen gas, we can calculate the number of moles of oxygen atoms as follows:

Number of moles of oxygen atoms = Number of moles of oxygen gas × Number of oxygen atoms per molecule

= 0.4 moles × 2

= 0.8 moles

Therefore, there are 0.8 moles of oxygen atoms present in 0.4 moles of oxygen gas.

This calculation is based on the stoichiometry of oxygen gas, which indicates that each molecule of O₂ contains two oxygen atoms. By considering the mole ratio between oxygen gas and oxygen atoms, we can determine the number of moles of oxygen atoms in a given quantity of oxygen gas.

To learn more about moles, here

https://brainly.com/question/34302357

#SPJ2

If for a particular process, ΔH=308 kJmol and ΔS=439 Jmol K, in what temperature range will the process be spontaneous?

Answers

Answer:

The process will be spontaneous above 702 K.

Explanation:

Step 1: Given data

Standard enthalpy of the reaction (ΔH°): 308 kJ/molStandard entropy of the reaction (ΔS°): 439 J/mol.K

Step 2: Calculate the temperature range in which the process will be spontaneous

The reaction will be spontaneous when the standard Gibbs free energy (ΔG°) is negative. We can calculate ΔG° using the following expression.

ΔG° = ΔH° - T × ΔS°

When ΔG° < 0,

ΔH° - T × ΔS° < 0

ΔH° < T × ΔS°

T > ΔH°/ΔS°

T > (308,000 J/mol)/(439 J/mol.K)

T > 702 K

The process will be spontaneous above 702 K.

Three bonding pairs around a central atom results in a ________. A. octahedral B. trigonal planar compound C. tetrahedral compound D. linear compound

Answers

Answer:

B

Explanation:

because it is a trigonal planar compound

Three bonding pairs around a central atom results in a trigonal planar compound. Option B is correct.

In a trigonal planar arrangement, the central atom is surrounded by three bonding pairs of electrons, forming a flat, triangular shape. The bond angles between the bonding pairs are approximately 120 degrees.

This molecular geometry is observed when a molecule has a central atom with three bonded pairs and no lone pairs. Examples of compounds with  trigonal planar geometry include boron trifluoride (BF₃) as well as formaldehyde (H₂CO).

The other options are not correct for a molecule with three bonding pairs;

Octahedral refers to a molecular geometry with six bonding pairs around a central atom.

Tetrahedral corresponds to a molecular geometry with four bonding pairs around a central atom.

Linear represents a molecular geometry with two bonding pairs around a central atom.

Hence, B. is the correct option.

To know more about bonding pairs here

https://brainly.com/question/32421783

#SPJ2

The ceramic glaze on a red-orange Fiestaware plate is U2O3 and contains 50.1 grams of 238U, but very little 235U. (a) What is the activity of the plate (in Ci)

Answers

Answer:

The correct answer is 1.68 × 10⁻⁵ Ci

Explanation:

The activity of the uranium is determined by using the formula,  

R = 0.693 N/t1/2 -------------- (i)

The number of atoms is, N = nNA

Here, NA is the Avogadro number and n is the number of moles. The value of n is m/M, that is, mass/molecular mass. Now the value of N becomes,  

N = (m/M) NA

The m or mass of uranium given is 50.1 grams, and the molecular mass is 238 g/mol, now putting the values we get,  

N = (50 g/238 g) (6.023 × 10²³) = 1.26 × 10²³

The half-life of 238U from year to second is,  

t1/2 = (4.468 × 10⁸ year) (3.16 × 10⁷ s/ 1 year) = 1.412 × 10¹⁶ s

Substituting the values of t1/2 as 1.412 × 10¹⁶, and 1.26 × 10²³ for N in equation (i) we get,  

R = 0.639 (1.26 × 10²³) / 1.412 × 10¹⁶ s  

= 6.18 × 10⁶ Bq (2.7027 × 10⁻¹¹ Ci/1 Bq)

= 1.68 × 10⁻⁵ Ci

Hence, the activity of the plate is 1.68 × 10⁻⁵ Ci

Complete the following reactions
need answers?

i) P + [H]

ii) O2 + [H]

iii) LiH + H2O

iv) CaC2 +H2O

v) NaH + H2O

vi) CaH2 H2O

Answers

Answer:

this reaction will produce phosphine

P+H---->PH

this reaction will produce water

O2+H---->H2O

this reaction will produce lithium hydroxide and hydrogen gas

LiH+H2O---->LiOH+H2

this reaction will produce calcium hydroxide and acetylene gas

CaC2+H2O---->Ca(OH)2+C2H2

this reaction will produce sodium hydroxide and hydrogen gas

NaH+H2O---->NaOH+H2

this type of reaction will produce calcium hydroxide and hydrogen gas

CaH2+H2O---->CaOH+H2

I hope this helps

Other Questions
pls help me with this friends 3. How might your current dating behaviors affect your short-term health? Long-term health? (2 points) 4 3/4 - 2 3/8 thanks what does clause 40 in the Magna Carta mean? ( please explain) can anybody help with english 3 on flvs about "The taming of the Shrew"? write brackets () in this statement to make it correct 6 + 4 x 5 - 3 = 14 Glycolysis and gluconeogenesis are opposing pathways in that they begin or end with the same metabolites and share common intermediates and/or enzymes. Yet, for energetic reasons, the two processes cannot be the exact reverse of each other. How is this possible The supreme choice pizza at Paolo's Pizzeria contains 3 different meats and 5 different vegetables. The customer can select any one of 4 types of crust. If there are 5 meats and 7 vegetables to choose from, how many different supreme choice pizzas can be made? A straight wire that is 0.56 m long is carrying a current of 2.6 A. It is placed in a uniform magnetic field, where it experiences a force of 0.24 N. The wire makes an angle of 900 with the magnetic field. What is the magnitude of the magnetic field Data pertaining to a company's joint production for the current period followsL M Quantities produced 310 lbs 260 lbsMarket value at split-off point . $10.2Mb $20.4/lb Compute the cost to be allocated to Product L for this period's $792 of joint costs if the value basis is used. (Do not round intermediate calculations.) a. $295.81. b. $49619. c. $39600. d. $2,926.00. e. $962.19. Select the scenario that describes a top-down approach to data warehouse design.Cathys Cards and Gifts, which has three stores, creates data marts for its sales, marketing, and delivery departments to study the possibility of establishing a new store.Crawford's Fabrics, which wants to expand its operations, combines data from the purchasing and sales departments into a central database, to be divided into new data marts as needed.Cynthias Florals, which is dealing with debt, creates new data marts for the service, delivery, and sales departments to develop a strategy to stay in business.Connors Meat Market, which just opened, creates data marts to track the sale of each of the following meats: beef, pork, lamb, and fish. 3(-2-4v) A couple thinking about retirement decide to put aside $3,000 each year in a savings plan that earns 8% interest. In 5 years they will receive a gift of $10,000 that also can be invested. a. How much money will they have accumulated 30 years from now Maths! 1) Calculate the variance and standard division of the set of the data2) If each value is added by 2, calculate the new standard deviation of the set3) What is the effect on the measure of dispersion if each value is changed uniformly Help please I need answers for these questions A woman bought some large frames for $17 each and some small frames for $6 each at a closeout sale. If she bought 18 frames for $141, find how many of each type she bought. She bought ____ large frames. prevention of hypertension Determine if the following set of ordered pairs represents a quadratic function. Explain.(5, 7), (7, 11). (9, 14). (11, 18)(1 point) The Sherman Antitrust Act: Multiple Choice was passed in 1800. All of these statements are true. was actively used by President Roosevelt in the early 20th century. no longer applies to business practices today. Simplify {[(0.2)^3] x 8} / (0.4)^2400.40.20.04