Suppose h(x)=3x-2 and j(x) = ax +b. Find a relationship between a and b such that h(j(x)) = j(h(x))

Probably a simple answer, but I'm completely lost at what I'm being asked here.

Answers

Answer 1

Answer:

[tex]\displaystyle a = \frac{1}{3} \text{ and } b = \frac{2}{3}[/tex]

Step-by-step explanation:

We can use the definition of inverse functions. Recall that if two functions, f and g are inverses, then:

[tex]\displaystyle f(g(x)) = g(f(x)) = x[/tex]

So, we can let j be the inverse function of h.

Function h is given by:

[tex]\displaystyle h(x) = y = 3x-2[/tex]

Find its inverse. Flip variables:

[tex]x = 3y - 2[/tex]

Solve for y. Add:

[tex]\displaystyle x + 2 = 3y[/tex]

Hence:

[tex]\displaystyle h^{-1}(x) = j(x) = \frac{x+2}{3} = \frac{1}{3} x + \frac{2}{3}[/tex]

Therefore, a = 1/3 and b = 2/3.

We can verify our solution:

[tex]\displaystyle \begin{aligned} h(j(x)) &= h\left( \frac{1}{3} x + \frac{2}{3}\right) \\ \\ &= 3\left(\frac{1}{3}x + \frac{2}{3}\right) -2 \\ \\ &= (x + 2) -2 \\ \\ &= x \end{aligned}[/tex]

And:

[tex]\displaystyle \begin{aligned} j(h(x)) &= j\left(3x-2\right) \\ \\ &= \frac{1}{3}\left( 3x-2\right)+\frac{2}{3} \\ \\ &=\left( x- \frac{2}{3}\right) + \frac{2}{3} \\ \\ &= x \stackrel{\checkmark}{=} x\end{aligned}[/tex]


Related Questions

A quiz has 4 multiple-choice questions with 4 possible answer choices each. For each question, there is only 1 correct answer.

A student guesses each answer at random. What is the probability of getting exactly 3 questions correct, to the nearest percent?

(3 correct and 1 incorrect)

Answers

Answer:

5%

Step-by-step explanation:

so, for 3 questions he has a 1 in 4 chances to get it right.

4³ chances, so a 1/4³ probability.

and he has one other question with a 3 in 4 chance to get it wrong.

a 3/4 probability.

that is in total

1/4³ × 3/4 = 3/4⁴

and now we have 4 over 3 combinations as possibilities to get 3 right and 1 wrong.

that is 4! / (3! × (4-3)!) = 4

so our total probability is

4 × 3/4⁴ = 3/4³ = 3/64 ≈ 0.05 = 5%

in other words, the expected quote for him to achieve that result is in 5 out of 100 (or 1 out of 20) attempts.

Pimeter or area of a rectangle given one of these...
The length of a rectangle is three times its width.
If the perimeter of the rectangle is 48 cm, find its area.

Answers

Answer:

A=108 cm²

Step-by-step explanation:

length (l)=3w

perimeter=2l+2w

P=2(3w)+2w

48=6w+2w

width=48/8

w=6

l=3w=3(6)=18

l=18 cm  ,  w=6 cm

Area=l*w

A=18*6

A=108 cm²

Find the measure of c.

Answers

Answer:

149 degrees

Step-by-step explanation:

This shape is a cyclic, so opposite angles add up to 180 degrees.

180-31 = 149

For
90° < 0 < 270°
, which of the primary trigonometric functions may have positive values?

Answers

Answer:

sine and tangent

will be positive.

A random sample of size results in a sample mean of and a sample standard deviation of . An independent sample of size results in a sample mean of and sample standard deviation of . Does this constitute sufficient evidence to conclude that the population means differ at the level of​ significance?

Answers

Answer:

A typical example would be when a statistician wishes to estimate the ... by the standard deviation ó) is known, then the standard error of the sample mean is given by the formula: ... The central limit theorem is a significant result which depends on sample size. ... So, the sample mean X/n has maximum variance 0.25/ n.

Step-by-step explanation:

Needs to be done using the Pythagorean Theorem

Answers

Answer:

11.3 ft high

Step-by-step explanation:

Pythagorean Theorem: a² + b² = c²

4² + b² = 12²

16 + b² = 144

b² = √128

b = 11.3

If ‘BOXES’ is OBXSE, then BOARD is

Answers

9514 1404 393

Answer:

  OBADR

Step-by-step explanation:

The first two letters are swapped, and the last two letters are swapped.

  BOARD . . . becomes

  OBADR

Find the volume of this composite figure. Show all work.

Please!!!!!

Answers

Answer:

718.75ft³

Step-by-step explanation:

Rectangular Prism=5x5x17.5=437.5

Cube=5x5x5=125

Triangular Prism=5x5x12.5x.5=156.25

437.5+125+156.25=718.75ft³

An ‘in shuffle’ is a perfect shuffle on a standard deck of 52 playing cards that splits the deck in half, then interleaves cards starting with the top half.

Required:
a. What is the position of the first card after the 7th shuffle?
b. How many times must one perform the shuffle so that the top card becomes the bottom card?
c. When do the first and last cards in the deck touch?

Answers

Answer:

  a) position 22

  b) 26

  c) shuffle 25

Step-by-step explanation:

Assuming the shuffling occurs so that the bottom card of the top half of the deck (card 26) becomes the bottom card (card 52), while the top card of the bottom half (card 27) becomes the top card (card 1), the sequence of card 1 positions with successive shuffles is ...

  {2, 4, 8, 16, 32, 11, 22, 44, 35, 17, 34, 15, 30, 7, 14, 28, 3, 6, 12, 24, 48, 43, 33, 13, 26, 52, 51, 49, 45, 37, 21, 42, 31, 9, 18, 36, 19, 38, 23, 46, 39, 25, 50, 47, 41, 29, 5, 10, 20, 40, 27, 1}

That is, after the first shuffle, card 1 is at position 2; after the second shuffle, it is at position 4; and so on.

(a) Hence the position of card 1 after the 7th shuffle is 22.

__

(b) The top card is in position 52 after 26 shuffles.

__

(c) The top card is in position 26 after 25 shuffles; the bottom card is in position 27 after 25 shuffles. That is when they first touch. (They touch again after 51 shuffles.)

What's the simplified expression of -2a-3 bº?

Answers

Answer:

-2a - 3

Step-by-step explanation:

bº equals 1 due to the zero exponent.

Thus, -2a-3 bº simplifies to -2a - 3.

Answer:

−2/a^3  

Step-by-step explanation:

Are we adding all 4 sides ?

Answers

Answer:

Yes

Step-by-step explanation:

you would do 2(5x-10) + 2(8x+4)= 26x-12

Answer:

26x - 12

Step-by-step explanation:

The perimeter is the sum of all the exterior sides of a figure.

Here, we have a parallelogram, and its sides are 5x - 10, 8x + 4, 5x - 10, and 8x + 4. Adding these, we get:

(5x - 10) + (8x + 4) + (5x - 10) + (8x + 4) = 26x - 12

Thus, the answer is 26x - 12. Note that since the problem doesn't give a value for x, this cannot be simplified further.

~ an aesthetics lover

How many 1/8 servings can I get from 3/4

Answers

Answer:

6 1/8th cups in 3/4 cups

Step-by-step explanation:

Answer:

6

Step-by-step explanation:

you convert 3/4 into 8ths which will be 6/8

B is the midpoint of line segment AD, and C is the midpoint of line segment BD. If AD = 12, what is BC?

A. 1.5
B. 3
C. 4
D. 6

Answers

The only way to answer this is to see the diagram

For a closed rectangular box, with a square base x by x cm and height h cm, find the dimensions giving the minimum surface area, given that the volume is 18 cm3.

Answers

Answer:

∛18 * ∛18 * 18/(∛18)²

Step-by-step explanation:

Let the surface area of the box be expressed as S = 2(LB+BH+LH) where

L is the length of the box = x

B is the breadth of the box = x

H is the height of the box = h

Substituting this variables into the formula, we will have;

S = 2(x(x)+xh+xh)

S = 2x²+2xh+2xh

S = 2x² + 4xh and the Volume V = x²h

If V = x²h; h = V/x²

Substituting h = V/x² into the surface area will give;

S = 2x² + 4x(V/x²)

Since the volume V = 18cm³

S = 2x² + 4x(18/x²)

S =  2x² + 72/x

Differentiating the function with respect to x to get the minimal point, we will have;

dS/dx = 4x - 72/x²

at dS/dx = 0

4x - 72/x² = 0

- 72/x² = -4x

72 = 4x³

x³ = 72/4

x³  = 18

[tex]x = \sqrt[3]{18}[/tex]

Critical point is at [tex]x = \sqrt[3]{18}[/tex]

If x²h = 18

(∛18)²h =18

h = 18/(∛18)²

Hence the dimension is  ∛18 * ∛18 * 18/(∛18)²

The number of weekly hours spent on a smart device varies inversely with the person's age. If a 20-year-old person spends 52 hours on their smart device each week, how many hours does a 50-year-old person spend on their smart device?

Answers

Answer:

20.8 hours

Step-by-step explanation:

Given that hours (h) varies inversely with age (a) then the equation relating them is

h = [tex]\frac{k}{a}[/tex] ← k is the constant of variation

To find k use the condition h = 52 when a = 20, thus

52 = [tex]\frac{k}{20}[/tex] ( multiply both sides by 20 )

1040 = k

h = [tex]\frac{1040}{a}[/tex] ← equation of variation

When a = 50, then

h = [tex]\frac{1040}{50}[/tex] = 20.8 hours

What best explains whether a triangle with side links 5 cm 13 cm and 12 cm is a right triangle

Answers

Step-by-step explanation:

Pythagoras Theorem

If the sum of the squares of the smaller two sides is equal to the square if the third side then it is a right triangle

[tex] {a}^{2} + {b}^{2} = {c}^{2} [/tex]

So, (5)^2 + (12)^2

is 25 + 144 = 169

Which is equal to (13)^2 which is also 169

The sides of the given triangle follows pythagoras theorem, therefore it is a right triangle

Hope it helps:)

Answer:

Pythagorean theorem

Step-by-step explanation:

We can explain it using  the Pythagorean theorem. Right triangles always have a hypotenuse which is the longest side. That means 13 must be the hypotenuse of the triangle. The Pythagorean theorem is a^2+b^2=c^2

We already know all the values since every side is given so we just fill it in.

5^2+12^2=13^2

25+144=169

169=169

It is a right triangle

Arbitron Media Research Inc. conducted a study of the iPod listening habits of men and women. One facet of the study involved the mean listening time. It was discovered that the mean listening time for a sample of 13 men was 35 minutes per day. The standard deviation was 8 minutes per day. The mean listening time for a sample of 11 women was also 35 minutes, but the standard deviation of the sample was 18 minutes. Use a two-tailed test and at 0.10 significance level, can we conclude that there is a difference in the variation in the listening times for men and women?

Answers

Answer:

Since the critical f-value of the test statistic is less than the f value of 2.9130, we will fail to reject the null hypothesis and conclude that there's no sufficient evidence to support the claim that there is a difference in the variation in the listening times for men and women

Step-by-step explanation:

We are given;

Sample size for men; n1 = 13

Sample size for women; n2 = 11

standard deviation for men; s1 = 8 minutes

Standard deviation for women; s2 = 18 minutes.

Significance level; α = 0.1

Let's state the hypothesis;

Null hypothesis;H0: (μ1)² = (μ2)²

Alternative hypothesis;Ha: (μ1)² ≠ (μ2)²

The value of the test statistic would be;

F = (s1)²/(s2)²

F = 8²/18² = 0.1975

Now, degree of freedom for n1 is;

DF1 = n1 - 1

DF1 = 13 - 1

DF1 = 12

Also, degree of freedom for n2 is;

DF2 = 11 - 1

DF2 = 10

Now, since it's two tailed, we will make use of α/2 for the F-distribution table.

Thus, α/2 = 0.1/2 = 0.05

So,from the f-table attached, at df1 = 12 and df2 = 10,the F-Critical value is;

F_α/2 = 2.9130

Since,the critical f-value of the test statistic is less than 2.9130, we will fail to reject the null hypothesis and conclude that there's no sufficient evidence to support the claim that there is a difference in the variation in the listening times for men and women

A sample contains 61 pairs of values. Find the critical value for the linear correlation coefficient from Table A-6 corresponding to a 0.05 significance level.

0.236

0.254

0.279

0.330

Answers

Answer:

0.254

Step-by-step explanation:

Table A-6 will be shown below for reference. Since none of the answer choices contain the critical value for 61, we can just round that number to 60. We will see that the critical value is 0.254. If you're having trouble reading the table below, look at the columns to find the corresponding significance level you are working with then find the sample value.

Best of Luck!

Based on the dot plots shown in the images, which of the following is a true statement? A. Set B has the greater mode. B. Set A has more items than set B. C. Set A is more symmetric than set B. D. Set B has the greater range.

Answers

D. Set B has the greater range.

Triangle ABC has vertices A(0, 6) , B(−8, −2) , and C(8, −2) . A dilation with a scale factor of 12 and center at the origin is applied to this triangle. What are the coordinates of B′ in the dilated image? Enter your answer by filling in the boxes. B′ has a coordinate pair of ( , )

Answers

Answer:

[tex]B' = (-96,-24)[/tex]

Step-by-step explanation:

Given

[tex]A(0,6)[/tex]

[tex]B(-8,-2)[/tex]

[tex]C(8,-2)[/tex]

Required

Determine the coordinates of B' if dilated by a scale factor of 12

The new coordinates of a dilated coordinates can be calculated using the following formula;

New Coordinates = Old Coordinates * Scale Factor

So;

[tex]B' = B * 12[/tex]

Substitute (-8,-2) for B

[tex]B' = (-8,-2) * 12[/tex]

Open Bracket

[tex]B' = (-8 * 12,-2 * 12)[/tex]

[tex]B' = (-96,-24)[/tex]

Hence the coordinates of B' is [tex]B' = (-96,-24)[/tex]

Answer:

Bit late but the answer is (-4,-1)

Step-by-step explanation:

Took the test in k12

Variable g is 8 more than variable w. Variable g is also 2 less than w. Which pair of equations best models the relationship between g and w? g = 8w g = w + 2 w = g + 8 w = g − 2 w = 8g w = g + 2 g = w + 8 g = w − 2

Answers

Answer: g = w + 8    g=w-2

Step-by-step explanation:

We could represent the word phrases by the equations.

g = w + 8  

g = w - 2  

Answer:

g = w + 8

g = w - 2

Step-by-step explanation:

Assuming that g and w exists, then we can show the relation as described:

"Variable g is 8 more than variable w."

g = w + 8

"Variable g is also 2 less than w."

g = w - 2

These are the two equations of the described relationship between g and w.

Note that g could not actually exist in the real number system:

g = w + 8

g = w - 2

w + 8 = w - 2

w - w = -2 - 8

0 != -10

This is impossible within the real number system.

Cheers.

prove that 2^n+1>(n+2).sin(n)​

Answers

Step-by-step explanation:

F(n)=|sin(n)|+|sin(n+1)|

then

F(n+π)=|sin(n+π)|+|sin(n+π+1)|=|sin(n)|+|sin(n+1)|=F(n)

and

F(π−n)=|sin(π−n)|+|sin(π−n+1)|=|sinn|+|sin(n−1)|≠F(n)

so we must prove when n∈(0,π), have

F(n)>2sin12

when n∈(0,π−1),then

F(n)=sinn+sin(n+1)=sinn(1+cos1)+sin1cosn

and n∈(π−1,π),then

F(n)=sinn−sin(n+1)

How prove it this two case have F(n)>2sin12? Thank you

and I know this well know inequality

|sinx|+|sin(x+1)|+|sin(x−1)|≥2sin1,x∈R

Can someone please help I don't understand. Determine the domain and range of the following function. Record your answers in set notation.

Answers

Look at the screenshot!!!

a polynomial p has zeros when x=1/5,x=-4, andx=2 what could be the equation of p?​

Answers

Answer:

x^3 + (9/5)x^2 -(42/5)x + (8/5)

Step-by-step explanation:

since 1/5, -4, and 2 are all zeroes, (x-1/5)(x+4)(x-2) must be a factor of p. if you distribute the statement, you get

2. About how much is 123.1 do you weigh in pounds? Estimate if you don't know☺ Find an online converter and find out how many kilograms that is.​

Answers

Answer:

123.1 pounds is vary long, and I don't want to repeat, so 55.8372207 repeat.

Step-by-step explanation:

If you have any questions regarding my answer, tell me them in the comments, and I will come answer them for you. Have a good day.

The sum of 2 numbers is -3 . 0ne of the numbers is 115 less than the other

Answers

Answer:

One number is 56 the other is -59

Step-by-step explanation:

Set up your problem, like this:

x+(x-115)=-3

x+x=112

Divide both sides by 2

x=56

For the second number (x-115)

56-115=-59

Any questions, feel free to ask :)

Please mark brainliest and have a great day!

Answer:

56 & -59

Step-by-step explanation:

Find the intersection point for the following liner function f(x)= 2x+3 g(x)=-4x-27

Answers

Answer:

( -5,-7)

Step-by-step explanation:

f(x)= 2x+3 g(x)=-4x-27

Set the two functions equal

2x+3 = -4x-27

Add 4x to each side

2x+3+4x = -4x-27+4x

6x+3 = -27

Subtract 3

6x+3 - 3 = -27-3

6x = -30

Divide each side by 6

6x/6 = -30/6

x =-5

Now we need to find the output

f(-5) = 2(-5) +3 = -10+3 = -7

Answer:

Step-by-step explanation:

big burgewr

Complete the equation describing how x
and y are related.
Х у
y = [? ]x +
07
1 9
2 11
3 13
4 15
5 17
Enter the answer that
belongs in [?]

Answers

Answer:

Hello,

Answer 2

Step-by-step explanation:

7=2*0+7

9=2*1+7

11=2*2+7

13=2*3+7

15=2*4+7

17=2*5+7

y=2*x+7

An other way:

[tex]points\ ( 0,7)\ and\ (1,9)\\\\\Delta\ y=9-7=2\\\Delta\ x=1-0=1\\\\\\y-7=(x-0)*2\\\\y=2x+7\\[/tex]

The complete equation is [tex]y = 2x+7[/tex].

What is equation?

An equation is a condition on a variable such that two expressions in the variable should have equal value.

What is substitution?

Substitution means replacing the variables (letters) in an algebraic expression with their numerical values.

According to the question.

We have a table which shows the relation between x and y.

Let the missing term be a and b.

The the given equation becomes

[tex]y = ax + b[/tex]

For finding the value of a and b.

Substitute x = 0 and y = 7 in equation y = ax + b.

[tex]\implies 7 = a(0) + b\\\implies b = 7[/tex]

Again, substitute  x = 1 and y = 9 in the equation y = ax+ b

[tex]\implies 9 = a(1) +b\\\implies 9 = a + 7\\\implies a = 2[/tex]

substitute the value of a and b in the equation y = ax + b.

[tex]\implies y = 2x+ 7[/tex]

Therefore, the complete equation is [tex]y = 2x+7[/tex].

Find out more information about equation and substitution here:

https://brainly.com/question/2581775

#SPJ2

What is the derivative of 5x^4+4?

Answers

Answer:

[tex]\displaystyle \frac{dy}{dx} = 20x^3[/tex]

General Formulas and Concepts:

Calculus

Differentiation

DerivativesDerivative Notation

Derivative Property [Multiplied Constant]:                                                           [tex]\displaystyle \frac{d}{dx} [cf(x)] = c \cdot f'(x)[/tex]

Derivative Property [Addition/Subtraction]:                                                         [tex]\displaystyle \frac{d}{dx}[f(x) + g(x)] = \frac{d}{dx}[f(x)] + \frac{d}{dx}[g(x)][/tex]  

Basic Power Rule:

f(x) = cxⁿf’(x) = c·nxⁿ⁻¹

Step-by-step explanation:

Step 1: Define

Identify

[tex]\displaystyle y = 5x^4 + 4[/tex]

Step 2: Differentiate

Derivative Property [Addition/Subtraction]:                                                 [tex]\displaystyle y' = \frac{d}{dx}[5x^4] + \frac{d}{dx}[4][/tex]Rewrite [Derivative Property - Multiplied Constant]:                                   [tex]\displaystyle y' = 5\frac{d}{dx}[x^4] + \frac{d}{dx}[4][/tex]Basic Power Rule:                                                                                         [tex]\displaystyle y' = 20x^3[/tex]

Topic: AP Calculus AB/BC (Calculus I/I + II)

Unit: Differentiation

Write the polar form of a complex number in standard form for [tex]8[cos(\frac{\pi}{2}) + isin(\frac{\pi}{2})][/tex]

Answers

Answer:

Solution : 8i

Step-by-step explanation:

We can use the trivial identities cos(π / 2) = 0, and sin(π / 2) = 1 to solve this problem. Let's substitute,

[tex]8\left[cos\left(\frac{\pi }{2}\right)+isin\left(\frac{\pi \:}{2}\right)\right][/tex] = [tex]8\left(0+1i\right)[/tex]

And of course 1i = i, so we have the expression 8(0 + i ). Distributing the " 8, " 8( 0 ) = 0, and 8(i) = 8i, making the fourth answer the correct solution.

Other Questions
When three is added to four times a number, the result is 15(a) Write an equation to represent the above information.Answer(b) Solve your equation in (a) Implement a recursive method named power that takes 2 integer parameters named base and expo. The method will return the base raised to the power of expo. I don't understand word problems can someone please answer it for me and I need it ASAP. Scientists have taken genes from a species of bacteria that is pathogenic to several insects and inserted the genes into potato plants. The bacterial genes cause a cell to produce toxins that kill the insects. As the potato plants grow, every cell of the plant contains the toxin-producing genes. This makes the potato resistant to attack by crop pests. Which of the following is a limitation of this new technology? A. There are no foreseen limitations with inserting bacterial genes into crop plants. B. The introduced gene will cause more diversity in the potato's genome, thus causing the potato plant to become extinct. C. The genetically altered potato plants will kill off so many insects that companies that manufacture pesticides will soon go out of business. D. Over time, insects are likely to develop resistance to the bacterial toxin. Reset Next In a Notes:TM document, the details from the text appear in the right-hand column appear in the left-hand column are written in the center of the page are written in the margins of the text Who was robert clive Sodium hydroxide and water will react at room temperature. What does this indicate about its activation energy? A. The activation energy is very low. B. The activation energy is at exactly 600 kJ. C. The activation energy is very high. D. The reaction cannot reach activation energy. prove that F=Gm1m2/d2 A water chemist measured and recorded the air temperature at 27C when he should have measured the water temperature, which was only 21C. As a result of this error, will the dissolved oxygen concentration be reported as being higher or lower than it should be? Explain. In an experiment you are to flip a two sided coin 100 times and record 55 heads up and 45 tails up. Determine the theoretical and experimental probability of getting a heads up in the experiment.theorical = 11/20, experimental = 11/20theorical = 1/2, experimental = 1/2theorical = 1/2, experimental = 11/20theorical = 11/20, experimental = 1/2 Two interior angles of a convex pentagon are right angles and the other three interior angles are congruent. in degrees, what is the measure of one of the three congruent interior angles? 3/8-(-51/4) simplest form 10 less than k is 35 help please Please help me solve this, urs really important for me. Thank you CIWhich of the following statements is INCORRECT?(1)(2)the compound contains a o molecular orbital formed by the overlap of one carbonsp2 hybrid orbital and one hydrogen sp3 hybrid orbitalthe compound contains a T molecular orbital formed by the overlap of twounhybridized carbon p atomic orbitalsthe compound contains a polar C-Cl bondeach carbon atom of the C=C bond is sp2 hybridized(3)(4) solve for x please help ! (show work) What would happened to the mass of the copper II carbonate when you heated it in the reaction ? Find the value of x. Which of the following is a complex sentence? "Determine the magnitude of the net force of gravity acting on the Moon during an eclipse when it is directly between Earth and the Sun."