The equation of a line is y + 4 = 6x + 13 What is the value of y at the point where the line crosses the y-axis?​

Answers

Answer 1

Answer:

The given equation of line is

[tex] \rm \: y + 4 = 6x + 13[/tex]

This equation further can be written as

[tex] \qquad \sf \longrightarrow \:y = 6x + 13 - 4 \\ \\ \\ \qquad \sf \longrightarrow \: y = 6x + 9 - - - - (i)[/tex]

General line formula in the form can be written as

[tex]\qquad \sf \longrightarrow \:y \: = mx + b - - - - (ii)[/tex]

Point where this equation of line crosses the y-axis is

[tex]\qquad \sf \longrightarrow \:(0,b)[/tex]

On comparing the equation (i) and (ii) we obtain

[tex]\qquad \sf \longrightarrow \:(0,9)[/tex]


Related Questions

tell me how to decompose 792

Answers

Answer:

break it down to prime factorization

so the ans will be 2^3 * 3^2 *11

Determine is (x-3) is a factor of
x^3 - 5x^2 - 4x + 6 using the remainder
theorem:

Answers

Answer:

(x - 3) is not a factor

Step-by-step explanation:

If (x - h) is a factor of f(x) then f(h) = 0

here

f(x) = x³ - 5x² - 4x + 6 , then

f(3) = 3³ - 5(3)² - 4(3) + 6 = 27 - 5(9) - 12 + 6 = 27 - 45 - 6 = - 24

since f(x) ≠ 0 then (x - 3) is not a factor of f(x)

PLEASE HELP FAST URGENT!!!

Answers

Answer:

A= Origen C= q1 B=Q2

Step-by-step explanation

your left-hand side is quadrant TWO Your top right-hand corner is Quadrant ONE and your second to the last one is left-hand side down Is Quadrant THREE last but not least is Quadrant FOUR. And the zero in the middle means ORIGEN.

Ratio volume of 2 cylinders is 125:343

Answers

Answer:

5145cm²

125/343=1875/x

x=1875×343÷125=5145

The weight that a horizontal beam can support varies inversely as the length of the beam. Suppose that a 2-m beam can support 310 kg. How many kilograms can a 10-m beam support? a. 0. 0161 kg b. 62 kg c. 15. 5 kg d. 0. 0645 kg.

Answers

A beam of length 10m can support a weight of 62kg.

It is given that

Weight W ∝ 1/ Length L

W ∝ 1/L

W = k/L...........eq1

where k is constant of proportionality

What is the constant of proportionality?

The constant of proportionality is the ratio that relates two given values.

It is given that when L= 2m, W = 310kg

310 = k/2

k = 620

So put the k value in eq1,

eq1 becomes,

W = 620/L

when L = 10

W = 620/10

W =62kg

Therefore, a beam of length 10m can support a weight of 62kg.

To get more about the constant of proportionality visit:

https://brainly.com/question/26171814

look at the attachment
Simplified it too
pls take it seriously ​

Answers

[tex]\\ \rm\rightarrowtail \dfrac{sin(180+A)+2cos(180+A).cos(A-180)}{2cos^2(360+A)-cos(-A)}[/tex]

[tex]\\ \rm\rightarrowtail \dfrac{-sinA+2(cos^2A-sin^2A)}{2cos^2A-cosA}[/tex]

[tex]\\ \rm\rightarrowtail \dfrac{-sinA+2cos^2A-2sin^2A}{cosA(2cosA-1)}[/tex]

[tex]\\ \rm\rightarrowtail \dfrac{-sinA+2-2sin^2A-2sin^2A}{cosA(2cosA-1)}[/tex]

[tex]\\ \rm\rightarrowtail \dfrac{-sinA-4sin^2A}{cosA(2cosA-1)}[/tex]

[tex]\\ \rm\rightarrowtail \dfrac{-sinA(4sinA-1)}{cosA(2cosA-1)}[/tex]

[tex]\\ \rm\rightarrowtail -tanA\left(\dfrac{4sinA-1}{2cosA-1}\right)[/tex]

What is the value of x? (5 points)

Answers

30 + 2x = 90
2x = 60
x = 30

Answer:
x = 30

A model of a skyscraper is made using a scale of 1 inch: 75 feet. What is the height of the actual building if the height of the model is 19 2/5 inches?

Answers

4. If 8 ft = 1 in
Then 60 ft = 60 x 1/8 = 7.5 in
Length of model = 7.5 in
Scale factor = 1/8

5. If 4 m = 1 cm
Then 192 m = 192/4 x 1 = 48 cm
Length of model = 48 cm
Scale factor = 1/4

6. If 1.5 ft = 2 in
Then 13.5 ft = 13.5 x2/1.5 = 18 in
Length of model = 18 in
Scale factor = 2/1.5 =1.333

Skyscraper

Scale = 1 in : 75 ft
Height of model= 19 2/5in=19.4in

Height of actual building
19.4 x 75 = 1455 ft

The function f(x)= -45x + 270 represents the total distance, in miles, a traveler is from home x hours after beginning the trip home. What is the average rate of change over the interval from x = 1 to x = 3, in miles per hour?

Answers

[tex]\bold{\huge{\underline{ Solution }}}[/tex]

Given :-

We have given one function f(x) = -45x + 270 The given function represents the total distance in miles. The initial interval was x = 1 and final interval was x = 3

To Find :-

We have to find the rate of change over the given interval

Let's Begin :-

Here, We have

Function = f(x) = -45x + 270

The given function represents the total distance in miles covered by the traveller.

Therefore,

For initial interval that is x = 1 , Distance covered by the traveller

[tex]\sf{ f(x) = -45x + 270 }[/tex]

[tex]\sf{ f(1) = - 45(1) + 270 }[/tex]

[tex]\sf{ f(1) = - 45 + 270 }[/tex]

[tex]\sf{ f(1) = 225 }[/tex]

For final interval that is x = 3, Distance covered by the traveller

[tex]\sf{ f(x) = - 45x + 270 }[/tex]

[tex]\sf{ f(1) = - 45(3) + 270 }[/tex]

[tex]\sf{ f(1) = - 135 + 270 }[/tex]

Now,

We have to find the average rate of change over the given time interval

Therefore,

Average rate of change in the given time interval

[tex]\sf{ = }{\sf{\dfrac{ f(1) + f(3) }{3 - 1}}}[/tex]

[tex]\sf{ = }{\sf{\dfrac{ 225 + ( -135) }{ 2}}}[/tex]

[tex]\sf{ = }{\sf{\dfrac{ 225 - 135 }{ 2}}}[/tex]

[tex]\sf{ = }{\sf{\dfrac{ 90 }{ 2}}}[/tex]

[tex]\sf{ = 45 }[/tex]

Hence, The average rate of change over the given interval is 45 miles per hour.

Find the measurement of angle ( A ) round to the nearest hundred

Answers

Answer:

all you have to do is round to the nearest.

Step-by-step explanation:

just do it .

Shelley drew a scale drawing of the high school. She used the scale 5 millimeters: 3 meters.
If the actual width of the parking lot is 42 meters, how wide is the parking lot in the drawing?

Answers

Answer:

70 meters

Step-by-step explanation:

Based on the given conditions, formulate:: 45x5/3

Cross out the common factor: 14x5

Calculate the product or quotient: 70

The width of the parking lot in the drawing is, 70 milliliters.

What is Multiplication?

To multiply means to add a number to itself a particular number of times. Multiplication can be viewed as a process of repeated addition.

Given that;

She used the scale 5 millimeters: 3 meters.

And, The actual width of the parking lot is 42 meters.

Hence, We can formulate;

The width of the parking lot in the drawing = 42 × 5 / 3

                                                                  = 70 milliliters

Learn more about the multiplication visit:

https://brainly.com/question/10873737

#SPJ2

What is the value of v?

Answers

Answer: 43

Step-by-step explanation:

Please please help me please

Answers

Answer:

A

Step-by-step explanation:

It could just be it was dilated (I think thats the word) by 3. 6×3=18, 8×3=24

A triangle has two sides of length 17 and 2. What is the smallest possible whole-number length for the third side?

Answers

Answer: 16

Step-by-step explanation:

Find the midpoint of the line segment with end coordinates of:
(

3
,

1
)
and
(
4
,

5
)

Give coordinates as decimals where appropriate.

Answers

Answer:

(0.5, -3)

Step-by-step explanation:

(-3, -1) (4, -5)

midpoint formula

(x1 + x2) /2, (y1 + y2) /2

-3 + 4 = 1 / 2 = 0.5

-1 + -5 = -6 / 2 = -3

Colin is c years old. His 14 year old sister, Katie, is 4 years younger than Colin. write an expression

Answers

Answer: C - 4 = 14

Step-by-step explanation: In the expression, "c" is colin's age so, if you subtract 4 years for his age, you get Katie's age, which is 14.


A lil help would be nice

(Explained answer will get brainlyist)

Answers

Answer:

10 cm

Step-by-step explanation:

Out of that [tex]160 cm^2[/tex], part of it is given by the surface of the top and bottom faces, which have area [tex]2\times 5 cm^2 = 10 cm^2[/tex] each, for a total of [tex]20 cm^2[/tex] . We are then left with [tex]140 cm^2[/tex] of surface from the side area. That area you can imagine as a rectangle of height h (which we need to know) and base [tex]5+2+5+2 cm = 14 cm[/tex] (imagine it as a box opened on a flat surface)

At this point we have [tex]140cm^2 = 14 cm \times h \rightarrow h= 10 cm[/tex]

After spending $6.75 on a meal and $1.25 on drinks, Maria had $12 left.
What percent of her money did Maria spend?

Answers

Answer:

40%

Step-by-step explanation:

6.75 + 1.25 = 8 (Total she just spent)

8 (Total she just spent) + 12 (Total she had left) = 20 (Total she started with)

8/20 = 0.4 = 40%

(Total spent / total she started with = 40%)

What decimal best represents 1/4

Answers

Answer:

.25

Step-by-step explanation:

.25 or 1/4 is one-fourth of 1

You can divide 1 by 4 to get .25

Laura is building a fence around a circular pond. The pond has a diameter of 30 feet. What is the minimum amount of fencing Laura will need?

Answers

Answer:

Step-by-step explanation:

Minimum Amount = circumference of the pond.

Formulas

C = pi * d

Givens

pi = 3.14

d = 30 feet

Solution

C = pi*d             Substitute for the givens.

C = 3.14 * 30      Multiply

C =  94.2

Let x, y, and z represent three rational numbers, such that y is 512 times x and z is 50.25 more than x. If y=15.5, what is the value of z?

Answers

The value of z is equal to 50.28.

System of Linear Equations

System of linear equations is the given term math for two or more equations with the same variables. The solution of these equations represents the point at which the lines intersect.

Rational Numbers

These numbers are represented by a ratio between two integers numbers ([tex]\frac{a}{b}[/tex]), where b[tex]\neq[/tex]0.  Besides, this ratio can be simplified in decimal form.

For solving this equation, firstly, rewrite the information given:

                                          [tex]y=512x \;(1)\\ \\ z=50.25+x \;(2)\\ \\ y=15.5 \;(3)[/tex]

As the question gives the values for y, you can find x.

                                        [tex]y=512x\\ \\ 15.5=512x\\ \\ x=\frac{15.5}{512} =0.03[/tex]

Applying x=0.03 in the equation (3), you can find z.

                              [tex]z=50.25+x \\ \\ z=50.25+0.03\\ \\ z=50.28[/tex]

Learn more about the system of equations here:

https://brainly.com/question/384631

PLEASE HELP ANSWER THESE FAST, will give brainliest and 100 points

Answers

Step-by-step explanation:

11.

x is sin(60) in a circle with radius of 8.

x = sin(60)×8 = 6.92820323... ≈ 6.9

12.

x is sin(30) in a circle with radius "diagonal length".

6 is cos(30) in the same circle.

6 = cos(30)×r

r = 6/cos(30) = 6.92820323...

x = sin(30)×r = 3.464101615... ≈ 3.5

13.

similar to 12.

but we refer to the angle at the bottom right vertex.

remember, the sum of all angles in a triangle is always 180°.

so, the angle over there at the right is

180 - 90 - 68 = 22°

x = sin(22)×r

25 = cos(22)×r

r = 25/cos(22) = 26.96336857...

x = sin(22)×r = 10.10065565... ≈ 10.1

14.

9 is the sine of the complementary angle of 49 in a circle with radius x.

the complementary angle is the angle that adds up with the original angle to 90° and is therefore

90 - 49 = 41°

9 = sin(41)×x

x = 9/sin(41) = 13.71827778... ≈ 13.7

18.

we use the extended Pythagoras :

c² = a² + b² - 2ab×cos(C)

with c being the side opposite of the angle C.

so we have

LK² = 16² + 24² - 2×16×24×cos(29) =

= 256 + 576 - 768×cos(29) =

= 832 - 671.7079351... = 160.2920649...

LK = 12.66065026... ≈ 12.7

19.

law of sine

a/sin(A) = b/sin(B) = c/sin(C)

with the sides being always opposite to the corresponding angles.

to find the angle at H we need to find the angle at G first, because we don't know GF yet.

so,

28/sin(76) = 18/sin(G)

sin(G) = 18×sin(76)/28 = 0.623761538...

G = 38.59134528...°

remember the 180° rule in triangles.

H = 180 - 76 - G = 65.40865472...° ≈ 65.4°

20.

GF is now calculated using the law of sine again.

28/sin(76) = GF/sin(H)

GF = 28×sin(H)/sin(76) = 26.23980579... ≈ 26.2

100!!! Points
Select the correct answer.
What is the range of the function shown in the graph?

Answers

See the line is parallel to x axis.The equation of that top is y<5

So

The range is

(-oo,0)U(oo,5)

So

-oo<y<5

Option D is correct

Instructions: Find the length of the missing sides.
I WILL GIVE A BRAINIST !!
please explain how to do this

Answers

Answer:

y = 8sqr3,

x = 4sqr3

Step-by-step explanation:

Use SOH CAH TOA, to solve this.

Here I know the opposite, so I could use either SOH either TOA or both to find the 2 unknowns.

To find y, I would use SOH, which is Sin(angle) = opposite/hypotenuse.

When I rearrange it, I get opposite/Sin(angle) = hypotenuse.

Now let's fill in with the values to give:

12/sin(60) = 8sqr3

And then to find x, let's use TOA, which is Tan(angle) = opposite/adjacent.

Rearrange it to get opposite/Tan(angle) = adjacent. This gives us a side x with a value of:

12/tan(60) = 4sqr3

Also 5 3/7 x 3 1/2 Thanks

Answers

Answer: 19

5 3/7 to an improper fraction is = 38/7
3 1/2 to an improper fraction is = 7/2

38x7 = 266
7x2 = 14

266/14 = 19

Which number line shows the solution of –5x + 10 > –15?

Answers

Answer:

B.

Step-by-step explanation:

-5x + 10 > -15

-5x + 10 - 10 > -15 - 10

-5x > -25

-5x / -5 > -25/(-5)

x < 5

A rectangular prism has a length of 3 meters, a height of 7 meters, and a width of 7 meters. What is its volume, in cubic meters?​

Answers

Volume = length • height • width
= 3•7•7 = 147 cubic meters

PLEASE HELP ME ITS URGENT!!!!


A rectangular garden has a walkway around it. The area of the garden is 4(5.5x + 1.5). The combined
area of the garden and the walkway is 4.5(8x + 4). Find the area of the walkway around the garden as
the sum of two terms.
CD
The area of the walkway around the garden is 1
(Simplify your answer. Use integers or decimals for any numbers in the expression.)

Answers

Solving the Question

We're given:

Area (garden) = 4(5.5x + 1.5)Area (garden + walkway) = 4.5(8x + 4)

To find the area of the garden alone, we can subtract the area of the garden from the combined area of the garden and walkway:

[tex]4.5(8x + 4)-4(5.5x + 1.5)[/tex]

Open up the parentheses:

[tex]= 36x +18 -22x - 6[/tex]

Combine like terms:

[tex]= 36x +18 -22x - 6\\= 14x +18 - 6\\= 14x +12[/tex]

Answer

The area of the walkway around the garden is 14x + 12.

i need help asap pls

Answers

Step-by-step explanation:

[tex]m + 148 = 3m + 10[/tex]

[tex]148 - 10 = 3m - m[/tex]

therefore

3m = 138

m = 138/3

m = 46°

pls give brainliest

hey so im also looking for the first answer and the choices were “ is not “ and “ is “

Answers

so the investigator found the skid marks were 75 feet long hmmm what speed will that be?

[tex]s=\sqrt{30fd}~~ \begin{cases} f=\stackrel{friction}{factor}\\ d=\stackrel{skid}{feet}\\[-0.5em] \hrulefill\\ f=\stackrel{dry~day}{0.7}\\ d=75 \end{cases}\implies s=\sqrt{30(0.7)(75)}\implies s\approx 39.69~\frac{m}{h}[/tex]

nope, the analysis shows that Charlie was going faster than 35 m/h.

now, assuming Charlie was indeed going at 35 m/h, then his skid marks would have been

[tex]s=\sqrt{30fd}~~ \begin{cases} f=\stackrel{friction}{factor}\\ d=\stackrel{skid}{feet}\\[-0.5em] \hrulefill\\ f=\stackrel{dry~day}{0.7}\\ s=35 \end{cases}\implies 35=\sqrt{30(0.7)d} \\\\\\ 35^2=30(0.7)d\implies \cfrac{35^2}{30(0.7)}=d\implies 58~ft\approx d[/tex]

Other Questions
What is one way to spearate awater an salt What effect did missionaries have on western missionaries? is this correct please help How long is milk good after sell by date if opened. you make 12 equal payments you pay a total of $1308. how much is each payment? step by step Many anti-imperialists opposed the annexation of the philippines in 1898 because they believed that. A sample originally contains 24 grams of a radioactive isotope. After 18 days, 18.8 grams of the isotope remain in the sample. What is the half-life of the isotope Using the following equation: 5 KNO2 + 2 KMnO4 + 3 H2SO4 ------> 5 KNO3 + 2 MnSO4 + K2SO4 + 3 H2O How many moles and how many grams of KMnO4 are needed to carry out this reaction on 11. 4 grams of KNO2? If you could merge two different animals to create the ultimate animal, what two animals would it be and what would be their product? Can you write about this please Essay on your greatest achievement in life En la misma papelera, a Julin le cobraron $40 por 4 lpices y 8 plumas, mientras que a Estefana le cobraron $25 por 6 lpices y 2 plumas. Cuntos pesos cost cada pluma? The unicellular spores of the fern Ceratopteris richardii are about 100 m in diameter. Calculate the surface-area-to-volume ratio of a cube whose sides are 100 m in length to approximate the surface-area-to-volume ratio of the fern spore cell. Show your work. what are the main biological functions of water 4Al + 3O2 2Al2O3complete the statement to properly convert from moles of aluminum to moles of aluminum oxide. Use numbers as answers.The proper conversion factor has how many moles of aluminum oxide in the numerator and moles of aluminum in the denominator. Joseph is planting a veggie Garden he plants two tamaotos for every 5 peppers. Of Joseph plants 14 tomatos how many pepers does he plant Any student can qualify for a subsidized Stafford loan, regardless of financial need. Please select the best answer from the choices provided T F. All of the following are higher-level processes of the cerebral cortex, except: a. emotion b. reasoning c. breathing d. memory Write and solve a proportion to answer the question. What number is 45% of 60? Two sides of a triangle measure 15 inches and 18 inches, respectively. Which of these is NOT a possible length for the third side of the triangle? A)4 inches B)18 inches C)24 inches D)36 inches Today's farmers most often establish large farms close to big towns because transportation costs are an important factorin profitability; as distance increases, profit goes down.Please select the best answer from the choices provided.TF