What is the condensed structural formula for 2,2-dimethylbutane?

CH3(CH2)2CH3

(CH3)3CCH2CH3

C6H4(CH3)2

CH3CH2CH2CH2CH3

Answers

Answer 1

The structural formula for 2,2-dimethylbutane in the above task is (CH3)3CCH2CH3.

The correct answer choice is option b.

The structural formula for 2,2-dimethylbutane.

It follows that the structural formula for the above compound in the above task has 4 carbon atoms as the parent chain and has 2 different methyl substituents on the same carbon 2.

The image to the paper work is attached for more clearity.

The compound; 2,2-dimethylbutane ( (CH3)3CCH2CH3 ) belong to an alkane family. They have a general formula CnH2n+2.

So therefore, we can now confirm from the explanation given above that the only correct answer for the structural formula of the compound above is (CH3)3CCH2CH3

Read more on structural formula:

https://brainly.com/question/16693647

#SPJ1

What Is The Condensed Structural Formula For 2,2-dimethylbutane?CH3(CH2)2CH3(CH3)3CCH2CH3C6H4(CH3)2CH3CH2CH2CH2CH3

Related Questions

A pitcher throws a baseball with a speed of 90 mi/s. Then the batter hits the ball at 110 mi/s in 2 seconds. What is the acceleration of the ball?

Answers

Answer:20 mi/s

Explanation:


Antimony has two naturally occurring isotopes . The mass of antimony -121 is 120.904 amu and the mass of antimony -123 is 122.904 amu. Using the average mass from the periodic table, find the abundance of each isotope (Remember that the sum of the two abundances must be 100).

Answers

The two isotopes' relative abundances are: 121 antimony = 57.2% and

123 antimony = 42.8%.

The average mass of all antimony isotopes is 121.76 amu.

Taking into account your data,

(the sum of both abundances is 100%), and

120.904x+122.904y=121.76

Now, some high school algebra will assist us in understanding the solution.

= 120.904x+12.2904x=121.76x=0.572, and thus

x+ y= 1

∴y≈ 0.42

Results show that 121 Sb has a relative abundance of about 57.2% and 123 Sb has a relative abundance of about 42.8% when these decimals are converted into percentages.

There are 2 naturally occurring isotopes of antimony. Antimony-121 has a mass of 120.904 amu, and antimony-123 has a mass of 122.904 amu.

To know more about Isotopes, visit-

https://brainly.com/question/28039996

#SPJ13

You time travel 100 years into the future and learn that several new elements have been discovered, as pictured. These elements are frequently found as oxides, and need to be separated in order to extract the pure element. Before going through this effort, it is useful to know what amount of the element can be extracted. What is the mass percent composition of element T in the compound T6O5?

Answers

We obtain the mass percent of the element T as 96.5%.

What is the mass percentage?

We know that the mass percent actually has to do with the mass of the object that we could have in a compound expressed as a percentage. Note that we are told that most of the new elements that were discovered do exist as oxides this implies that they are binary compounds of the element that is involved and oxygen.

Now we have to look at the section of the table that have been given in the question so as to be able to obtain the the mass percent of the element as we have it. We can see as it has been written in the table that the atomic mass of the element T is found to be 362.31.

We would now have;

Molar mass of the compound = 6(362.31) + 5(16)

= 2173.86 + 80

= 2253.86

Mass percent composition of element T =  6(362.31)/2253.86 * 100/1

= 96.5%

Learn more about mass percent:https://brainly.com/question/5394922

#SPJ1

(photosynthesis)
carbon dioxide water glucose/sugar oxygen
6CO2 + 6H2O + heat

–––––––→ C6H12O6 + 6O2
←––––––––
(respiration)
Number of Number of
Elements: C___ Elements: C___
O___ O___
H___ H___
Analyze and Interpret Data
1. Reason Quantitatively In the reaction above, some molecules have a number in front of
the formula showing how many molecules it takes for the reaction to occur. Tally the
number of elements on each side of the reaction and record the values above.
2. Describe Patterns Describe how the number of elements compare on each side of the

Answers

The reaction the reversible reaction is given as :

6CO₂    +    6H₂O   + Heat    ⇄     C₆H₁₂O₆    +    6O₂

The photosynthesis is to convert carbon dioxide and water and light in into glucose and oxygen.

photosynthesis :

6CO₂    +    6H₂O   + Heat    ------>     C₆H₁₂O₆    +    6O₂

In cellular respiration organism release energy stored in the chemical bond of glucose.

C₆H₁₂O₆    +    6O₂   ----->  6CO₂    +    6H₂O   + Heat    

The reversible reaction can be as follows :

6CO₂    +    6H₂O   + Heat    ⇄     C₆H₁₂O₆    +    6O₂

                       reactants                      products

C                             6                                6

H                             12                                12

O                             18                                 18

The number of atoms present in reactant side is equal to the number of atom in product side. the equation is balanced.

6 moles of carbon dioxide produce 1 mole of oxygen

6 mole of water produce 1 mole of carbon dioxide

Thus, the reversible reaction given as:

6CO₂    +    6H₂O   + Heat    ⇄     C₆H₁₂O₆    +    6O₂

To learn more about photosynthesis here

https://brainly.com/question/1388366

#SPJ1

Hydrogen atoms absorb energy so that electrons can be excited to the n = 6 energy level. Electrons then undergo these transitions, among others: (a) n = 4 → n = 3 (b) n = 6 → n = 3 (c) n = 5 → n = 4 (i) Which transition produces a photon with the least energy? (ii) Which transition produces a photon with the highest frequency? (iii) Which transition produces a photon with the shortest wavelength?

Answers

1) The transition that produces the least energy is n = 4 → n = 3

2) The transition that produces a photon with the highest frequency is n = 6 → n = 3

3) The  transition that produces a photon with the shortest wavelength n = 4 → n = 3

What is the Bohr model?

We know from the Bohr model that an electron that is found in the hydrogen atom can be moved from a lower to a higher energy level and that would happen when the electron is able to absorb energy in the form of visible light.

Looking at the transitions as we have it here, we can see that the photon that would photons produce the least energy would be two levels that are closest together.

Also, the photon that would have the highest frequency is the photon that is involved in the transition that has the furthest energy apart from each other.

The transition that produces  a photon with the shortest wavelength must also be farthest  apart in energy.

Learn more about photons;https://brainly.com/question/20912241

#SPJ1

What summarizes the process of cellular respiration in plants and animals

Answers

In both plants and animals, the process of cellular respiration may be broken down into the following steps: Oxygen + carbon dioxide.

When plant cells undergo cellular respiration, oxygen is taken in through the plant's leaves from the surrounding atmosphere, and carbon dioxide is exhaled back into the atmosphere as a byproduct of the process. In contrast, when animal cells undergo cellular respiration, oxygen is taken in through the lungs, and carbon dioxide is exhaled through the lungs.

Therefore, a quick review, throughout the process of cellular respiration, plants and animals trade oxygen and carbon dioxide with one another.

Therefore, we may draw the following conclusion: Oxygen + carbon dioxide is a shorthand for the process of cellular respiration in plants and animals.

Know more about cellular respiration at,

https://brainly.com/question/13721588

Oxygen gas reacts with powdered aluminum according to the following reaction:
4Al(s)+3O2(g)→2Al2O3(s)

What volume of O2 gas (in L), measured at 792 mmHg and 23 ∘C, is required to completely react with 52.6 g of Al?

Answers

The volume (in L) of O₂ gas, measured at 792 mmHg and 23 °C, that is required to completely react with 52.6 g of Al is 34.14 L

How to determine the volume of O₂

We'll begin by obtaining the mole of O₂ that reacted. This can be obtained as follow:

Mass of Al = 52.6 gMolar mass of Al = 27 g/molMole of Al = mass / molar mass = 52.6 / 27 = 1.948 mole

4Al(s) + 3O₂(g) → 2Al₂O₃(s)

From the balanced equation above,

4 moles of Al reacted with 3 moles of O₂

Therefore,

1.948 moles of Al will react with = (1.948 × 3) / 4 = 1.461 mole

Finally, we shall determine the volume of the O₂ required. Details below

Mole of O₂ (n) = 1.461 moles Pressure (P) = 792 mmHg = 792 / 760 = 1.042 atm Temperature (T) = 23 °C = 23 + 273 = 296 KGas constant (R) = 0.0821 atm.L/Kmol Volume (V) =?

PV = nRT

1.042 × V = 1.461 × 0.0821 × 296

Divide both sides by 1.04

V = (1.461 × 0.0821 × 296) / 1.04

V = 34.14 L

Thus, the volume required is 34.14 L

Learn more about volume:

https://brainly.com/question/8476909

#SPJ1

How many common amino acids are formed and used by living organisms?


4


52


20


about 100

Answers

The number of common amino acids that are formed and used by living organisms is twenty (20), and nine are essential for living.

What are amino acids?

Amino acids are the building blocks of proteins that are linked by peptide bonds to form biomolecules. Proteins may be composed of 20 different types of amino acids, which include 9 essential amino acids that the human cannot synthesize and must be consumed from the diet.

Amino acids include, for example, leucine, isoleucine, tryptophan, tyrosine, etc. All these molecules contain an amino group and also a carboxylic group that gives them the name of amino acids.

Therefore, with this data, we can see that amino acids are composed of an amine group and a carboxylic group and they are 20 of which nine (9) are essential because the human body cannot synthesize them and must be obtained from the foods.

Learn more about  amino acids here:

https://brainly.com/question/2526971

#SPJ1

A local AM radio station broadcasts at a frequency of 587 kHz.

Calculate the wavelength at which it is broadcasting.
Wavelength =

Answers

Explanation:

c=v * lambada

lambda= 3*10power of 8m/s ÷587×10power of 3 hz

You are holding a small helium balloon. Your friend says that the buoyant force from the atmosphere is greater on her car than your balloon. Is she correct? Explain your answer.

Answers

Yes , the buoyant force from the atmosphere is greater on her car than your balloon .

So, She is correct.

Since, the density of helium is less than air, the buoyant force exerted by air is less than the weight of the balloon filled with helium, causing the balloon to float in the air and rise.

What do you mean by buoyant force?

The term light power alludes to the vertical coordinated force that a liquid applies on an item that is to some degree or totally drenched in the liquid. The light power emerges from contrasts in hydrostatic strain - the tension applied by a static liquid.

What is the buoyant force on a helium balloon in air?

Helium has 0.0114 pounds per cubic foot. For a one cubic foot helium filled balloon , gravity pulls the down on the helium with a force of 0.0114 pounds while the air pushes up with a force equal to the weight of the air of the helium displaced, or 0.0807 pounds.

        Hence, the buoyant force from the atmosphere is greater on the car than the balloon.

To learn more about buoyant force from the given link:

https://brainly.com/question/28184066

#SPJ1

What are some non-examples of the Van der Waals force?

Answers

Answer:

These forces differ from covalent and ionic chemical bonding because they result from fluctuations in charge density of particles. Examples of van der Waals forces include hydrogen bonding, dispersion forces, and dipole-dipole interactions.

Explanation:

What is the name of the compound CH3CH(CH3)C(CH3)3?

tetramethylpropane

2,2,3-trimethylbutane

isoheptane

1,1,1,2-tetramethylpropane

Answers

The molecular formula for the compound in the task given above is 2,2,3-trimethylbutane.

The correct answer choice is option b.

What is meant by the name or the molecular formula of a compound?

The molecular formula of a compound is the name of the compound derived from its structural formula. From the task given above, the parent chain is butane. There are three different substituents groups; 2 different methyl group on carbon 2 and another methyl substituent at carbon 3.

The image to further illustrate the solution to the above problem is attached.

That being said, organic compounds are those compounds which contains carbon and hydrogen.

In conclusion, from the detailed explanation above, it can be deduced that the name of the compound above is 2,2,3-trimethylbutane

Read more on compunds:

https://brainly.com/question/13779006

#SPJ1

What is the heat change when 1.25 g of water vapor at 185.3C is cooled to 102.1C?The specific heat of steam is 2.02J/g C

Answers

Answer: -210.08 J

Explanation:

Use the formula q = (m)(c)(ΔT)

q = (1.25)(2.02)(102.1-185.3)

q = -210.08 J

This is exothermic! Heat is lost.

Aluminum can be made by reducing alumina Al2O3 by carbon in the reaction equation

2 Al2O3 + 3 C → 4 Al + 3 CO2

according to. How much carbon is needed to reduce Al2O3 to produce 491 grams of pure aluminum? To give an answer to the gram, be sure to add the unit g after the numerical value of your answer.

Answers

Taking into account the reaction stoichiometry, 163.67 grams of C  is needed to reduce Al₂O₃ to produce 491 grams of pure aluminum.

Reaction stoichiometry

In first place, the balanced reaction is:

2 Al₂O₃ + 3 C → 4 Al + 3 CO₂

By reaction stoichiometry (that is, the relationship between the amount of reagents and products in a chemical reaction), the following amounts of moles of each compound participate in the reaction:

Al₂O₃: 2 molesC: 3 molesAl: 4 molesCO₂: 3 moles

The molar mass of the compounds is:

Al₂O₃: 102 g/moleC: 12 g/moleAl: 27 g/moleCO₂: 44 g/mole

Then, by reaction stoichiometry, the following mass quantities of each compound participate in the reaction:

Al₂O₃: 2 moles ×102 g/mole= 204 gramsC: 3 moles ×12 g/mole= 36 gramsAl: 4 moles×27 g/mole= 108 gramsCO₂: 3 moles×44 g/mole= 132 grams

Mass of carbon required

The following rule of three can be applied: if 108 grams of Al are produced by 36 grams of C, 491 grams of Al are produced by how much mass of C?

mass of C= (491 grams of Al× 36 grams of C)÷ 108 grams of Al

mass of C= 163.67 grams

Finally, 163.67 grams of C is required.

Learn more about the reaction stoichiometry:

brainly.com/question/23035393

brainly.com/question/24741074

brainly.com/question/21683406

brainly.com/question/24653699

#SPJ1

You have a container with a semi-permeable membrane in the middle separating a left and right side. On the left side of the container is a high concentration of salt solutes, what will happen to the solutes in the container?

Answers

What will happen to the solute molecules on the left side of the container would depend on the kind of solution present on the right side.

What is osmosis?

What will happen to the solutes in the container can be explained using osmosis.

Osmosis refers to the movement of water molecules from the region of high water potential or low solute concentration to the region of low water potential or high solute concentration through a selectively permeable membrane.

Now, let us assume that the solution on the right side of the container has a lower solute concentration, which means that water molecules would move from the right side to the left side through the semi-permeable membrane. The solutes in the left side of the container would become diluted.

If it were to be the other way round, that is, the solution on the right side has more solutes than the one on the left side. Water molecules will move from the left side to the right side. Thus, the solution on the left side will become more concentrated as a result of water loss.

More on osmosis can be found here: https://brainly.com/question/1799974

#SPJ1

Are there any concerns if you wait an hour or two after you calibrate the spectrophotometer to obtain the absorbance of your solutions and unknown? Explain your answer.

Answers

No, there are no  concerns if you wait an hour or two after you calibrate the spectrophotometer to obtain the absorbance of your solutions and unknown as it will not change because the light source is not aging faster but if your light source age faster, then there are concerns.

Why should it be a problem when the light source is aging faster?

In the case above, light source is the issue because it is deteriorating quickly. If you're lucky, the lamp's usable life will be at least four digits of hours. On the other hand, allowing the lamp to stabilize itself speeds up aging. Given the limited lifespan, it is advisable to calibrate frequently such as daily.

The calibration rate is determined by the goal of the measurement. For most photometric tests, parameter variations in the interval between calibration and measurement will be negligibly large enough to significantly increase the overall measurement error. (Take note that the amount of error in typical analytical measurements, including sample preparation, is often at or above 10%.)

The routine calibration then appears to be unnecessary because the effort you put out will be pointless. In any instance, the experimental analysis of the impact of daily or biweekly calibration (often conducted inside validation studies) will offer the response.

It may even make sense to calibrate the instrument every 5 or 10 operational hours if you are using it continuously for a long length of time. If the manufacturer changes the cuvette materials (they will also change the Lot No.), you should recalibrate depending on the light source's lifespan and the materials you used to place your samples there. however, you should be cautious of dust because it might significantly alter the outcomes if the lenses have dirt.

Learn more about spectrophotometer from

https://brainly.com/question/24864511
#SPJ1

A piece of an unknown metal with mass 23.8g is heated to 100.0 degrees Celsius and dropped into 50.0
cm³ of water at 24.0 degrees Celsius. The final temperature of the system is 32.5 degrees Celsius. What is the specific heat of the metal?

Answers

The specific heat of the metal is 1.1106 J/g°C

Specific heat is the quantity of heat required to raise the temperature of one gram of a substance by one celsius degree

Here given data is

Mass of unknown metal = 23.8g

Temprature = 100°C

Mass of water = 50.0cm³ = 50 g

Temprature of water =  24.0°C

Final temprature of the system = 32.5°C

We have to find specific heat = ?

So first we determine the heat gain by water

Specific heat of water is 4.18 J/g°C

Q = mcΔT

Q =  50 g×8.5°C×4.18 J/g°C

Q = 1776.5 Joules

Then we determine the total heat lost by the unknown metal

Taking the specific heat f the metal to be x

Heat = 23.8g×67.5°C×x

1776.5 Joules = 23.8g×67.5°C×x

1776.5 Joules = 1606.5 J

x =  1606.5 J/1776.5 Joule

x = 1.1106 J/g°C

Specific heat of the metal is  1.1106 J/g°C

Know more about metal

https://brainly.com/question/15188305

#SPJ9

Complete the passage to describe how electrons are represented in electron dot diagrams.

The maximum number of dots an electron dot diagram can have is
. The maximum number of dots drawn on a side of a chemical symbol in an electron dot diagram is
.

Answers

The maximum number of dots an electron dot diagram can have is 8.

The maximum number of dots drawn on the side of a chemical symbol in an electron dot diagram is 2.

Electron dot diagrams

The electron dot diagrams is otherwise known as Lewis electron dot diagrams, Lewis structure, or simple Lewis diagram. It is a diagrammatic representation of the valence electrons of atoms using dots to represent electrons around the symbols of atoms.

The valence electron of an atom is the number of electrons present in the outermost shell of the atom. According to the rules, the first shell of an atom can take a maximum of 2 electrons while the remaining shells can take a maximum of 8 electrons each.

Atoms with 8 electrons in their outermost shells are said to be in an octet state.

The number of dots an atom will have around it will, therefore, depend on the number of valence electrons it has.  As a rule of thumb, each side of an atom can take a maximum of 2 electrons. Thus, an atom with 8 valence electrons will have 2 dots each on its 4 sides.

More on Lewis dot structure can be found here: https://brainly.com/question/20300458

#SPJ1

Answer:

the first is 8 an the second one is 2

Explanation:

B
Which compound has the highest melting point?
O Al₂(CO3)3
O C12H22011
OC8H18
O H₂O

Answers

Al₂(CO3)3 has the highest melting point. Aluminum carbonate has melting point of 58 degree Celsius.

Why melting point of aluminum is high?The strength of the metallic connection affects a metal's melting point.If aluminum has a greater melting point than magnesium, it probably has a stronger metallic bond.Positive ions and electrons in aluminum would be more attracted to one another, maintaining the structure's stability and resistance to heat.What are uses of aluminum carbonate?A phosphate-binding medication known as aluminum carbonate, aluminum hydroxide, and aluminum oxide is occasionally given to dogs and cats to bind intestinal phosphate, stop the absorption of food phosphate, and reduce the absorption of phosphate excreted by the pancreas. Due to safety issues, it is rarely utilized in people, although cats and dogs don't seem to react negatively to its presence.

For more information on melting point kindly visit to

https://brainly.com/question/25777663

#SPJ1

I need help on this question please. This is not graded. Thank you.

Answers

I think it would be one and two

What is the strength and weakness of vaccines ?

Answers

Answer:

Strength:

can prevent diseases from making you ill

Weakness:

the virus/bacteria can change shape and look and your body and the vaccine won't be able to recognize it anymore

9. It says its wrong? someone help!

Answers

The balanced net ionic equation for the reaction between potassium sulfide and lead(II) nitrate is Pb²⁺(aq) + S²⁻(aq) → PbS(s)

Writing balanced net ionic equation for a reaction

From the question, we are to write the balanced net ionic equation for the given chemical reaction.

The given chemical reaction is

K₂S(aq) + Pb(NO₃)₂(aq) →

The between potassium sulfide and lead(II) nitrate will produce potassium nitrate and lead sulfide.

That is,

K₂S(aq) + Pb(NO₃)₂(aq) → KNO₃(aq) + PbS(s)

Now, balance the equation

K₂S(aq) + Pb(NO₃)₂(aq) → 2KNO₃(aq) + PbS(s)

Write the complete ionic equation

2K⁺(aq) + S²⁻(aq) + Pb²⁺(aq) + 2NO₃⁻(aq)  → 2K⁺(aq) + 2NO₃⁻(aq) + PbS(s)

Cancel out the spectator ions

S²⁻(aq) + Pb²⁺(aq)   → + PbS(s)

Hence, the balanced net ionic equation is

Pb²⁺(aq) + S²⁻(aq) → PbS(s)

Learn more on Writing balanced net ionic equation here: https://brainly.com/question/28837770

#SPJ1

2. Balance these chemical equations.
(a) SO₂ + O₂SO3
(b) NH3 + O₂N₂ + H₂O
(c) C4H10+ O₂ CO₂ + H₂O
(d) Pb(NO3)2 →PbO + NO₂ + O₂
(e) Al + Fe3O4 →→→ Al₂O3 + Fe
(f) Sr + H₂O-Sr(OH)₂ + H₂

Answers

The balanced chemical equation is [tex]\rm 2SO_2 + O_2 \rightarrow 2SO_3[/tex].

What is balanced chemical equation?

Balanced chemical equation is defined as a formula where both the reactants and the products have the same amount of atoms of each kind. The law of conservation of mass stipulates that mass cannot be generated or destroyed, hence a chemical equation must always be in balance.

The balanced chemical equation are

[tex]\rm 4NH_3 + 3O_2 \rightarrow 2N_2 + 6H_2O[/tex]

[tex]\rm C_4H_1_0+ 5O_2 \rightarrow 4CO_2 + 5H_2O[/tex]

[tex]\rm 2Pb(NO_3)_2 \rightarrow 2PbO + 4NO_2 + O_2[/tex]

[tex]\rm 8Al + 3Fe_3O_4 \rightarrow 4Al_2O_3 + 9Fe[/tex]

[tex]\rm Sr + 2H_2O \rightarrow Sr(OH)_2 + H_2[/tex]

Thus,  balancing the chemical equation is very important as per the law.

To  learn more about balanced chemical equation, refer to the link below:

https://brainly.com/question/28294176

#SPJ1

thsof
is which acid H2S04

Answers

Explanation:

H2So4=sulphuric acid , strong acid

Which of these is a safe lab practice?

A. Going to talk to your friend across the room while the Bunsen burner is on.

B. Labeling all chemicals immediately.

C. Picking up a hot beaker with your hands.

D. Pouring all the leftover chemicals and products down the drain.​

Answers

Answer:

b labeling all chemical immediately

B.labeling all chemicals immediately

25 POINTS!!! PLS DO IT FAST In each test, iron(II) sulfate and iron(III) nitrate were combined with the same substance or substances. However, the sulfate and nitrate parts of the compounds didn’t participate in any of the chemical reactions; only the iron ions reacted. Comparing the results for each pair of tests, what can you conclude about the iron(II) and iron(III) ions?

Answers

Comparing the results for each pair of tests, we conclude that Displacement reaction is taking place.

In the displacement reaction , one atom is displaced by the the another atom according to their reactive strength . the highly reactive atom displace the low reactive atom called as displacement reaction.

The reactions are given as :

FeSO₄  +  Zn  ---->  ZnSO₄   +   Fe

Fe(NO₃)₂   +  Zn ----->   Zn(NO₃)₂   +  Fe

Here the zinc is more reactive than the iron . so, Zinc displace the iron in both the cases. Zinc displace the iron in both the cases. The reaction is called as displacement reaction.

Thus, Comparing the results for each pair of tests, we conclude that Displacement reaction is taking place.

To learn more about Displacement reaction here

https://brainly.com/question/3172917

#SPJ1

A gas has a pressure of 32,541 kPa at 40.0°C. what is the temperature at standard pressure​

Answers

54.01°C. is the answer

Welding is an industrial process that is used to join pieces of metal. a certain mixture of gases used in welding is composed of carbon dioxide and argon. the partial pressure of carbon dioxide is
0.080 atm and the partial pressure of argon is 0.24 atm.

(a): What is the total pressure of the mixture?
(b): what fraction of the molecules in the mixture are argon?


7. If you were to draw a particulate representation of air that contained 10 particles, how many of the particles you drew would be nitrogen? how many would be oxygen? argon? carbon dioxide? explain your reasoning

Answers

The total pressure of the system is 0.32 atm an the mole fraction argon  of the carbon dioxide is 0.75.

What is the partial pressure?

We know that where we have a mixture of gases, each of the gases would exert pressure on the walls of the container. The pressure that is exerted on the walls of the container is what we call the pressure of the gas.

We have;

Pressure of carbon dioxide = 0.080 atm

Pressure of argon = 0.24 atm

Total pressure of the system =  0.080 atm + 0.24 atm = 0.32 atm

Partial pressure = mole fraction * total pressure

Let the mole fraction be X

0.24 = X *  0.32 atm

X = 0.24 atm/0.32 atm

X =0.75

If I am to draw the number of particles, I would draw one particle for carbon dioxide and three particles for argon based on the value of the mole fraction of the system.

Learn more about partial pressure:https://brainly.com/question/15075781

#SPJ1

What is the solubility of MgCO₃ in a solution that contains 0.055 M Mg²⁺ ions? (Ksp of MgCO₃ is 3.5 × 10⁻⁸)

Answers

The solubility of MgCO₃ in a solution that contains 0.055 M Mg²⁺ ions is 6.36 * 10⁻⁷.

What is the solubility of a solution?

The solubility of a solution is the amount of solute present in a given volume of solvent.

The solubility of MgCO₃ in a solution that contains 0.055 M Mg²⁺ ions is calculated from the dissociation equation for the reaction given below:

MgCO₃ (s) → Mg²⁺ (aq) + CO₃²⁻ (aq)

The solubility product constant, Ksp =  [Mg²⁺] * [CO₃²⁻]

At equilibrium, [Mg²⁺] = 0.055 + x

[CO₃²⁻] = x

Assuming x is <<< 0.055, hence 0.055 + x = 0.055

Ksp = 0.055 * x

x = Ksp / 0.055

x = 3.5 × 10⁻⁸ / 0.055

x = 6.36 * 10⁻⁷

Hence, the solubility of MgCO₃ = 6.36 * 10⁻⁷

Learn more about solubility at: https://brainly.com/question/24124376

#SPJ1


Consider two mixtures of gases available for use to fill a tire. One has the same composition as air (Gas 1: 20% O₂, 80% N₂) and
another has added carbon dioxide (Gas 2: 15% O₂, 80% N₂, 5% CO ₂ ). Compare the partial pressure of nitrogen gas in a 2L sample of
Gas 1 at sea level (1 atm) to the partial pressure of nitrogen gas in a 2L sample of Gas 2 at sea level. Explain your answer.

Answers

The partial pressure of nitrogen gas in 2L sample of gas 1 and gas 2 are equal.

The overall pressure exerted by a mixture of gases is equal to the sum of the partial pressures exerted by each individual gas in the mixture, according to Dalton's law of partial pressures, a gas law.

P'=X° ×Pt ( P' = partial pressure , Xi = mole fraction , Pt= Total pressure )

Gas 1  ( ∵1 mole of gas = 22.4L)

Nitrogen moles = 80% × 2L / 22.4L

=8/5x22.4L

Oxygen moles = 20% ×2L /22.4L

2/5 × 22.4l

Mole fraction of nitrogen =  (8/5 ×22.4L) ÷ (8/5 ×22.4L+ 2/5x22.4L)

=4/5

Partial pressure of nitrogen at 1 atm = 4/5 * 1

=4/5

Similarly Gas 2

Nitrogen moles = 80% × 2L / 22.4L

=16/10 × 22.4L

Oxygen moles = 15%  × 2L /22.4L

3/10 × 22.4l

Carbon dioxide moles = 5% × 2L /22.4L

1/10 × 22.4L

Mole fraction of nitrogen =  (16/10 × 22.4L) ÷ (16/10 ×22.4L+ 3/10x22.4l + 1/10X22.4L) = 4/5

Partial pressure of nitrogen at 1 atm = 4/5 * 1

=4/5

Hence, partial pressure of nitrogen in gas 1 and gas 2 are equal.

To know more about partial pressure

https://brainly.com/question/25547148

#SPJ1

Other Questions
1 Solve for the value of 'x'.50to120 Mexico City had an estimated population of 18,066,000 people while Tokyo had an estimated population of 34,450,000 people. What was their combined population? What is the quotient (x2 9x + 20) (x 4)? (1 point) x 5 x 4 x + 4 x + 5 a fair coin is tossed 28 times. what is the probability that at most 25 tails occur? a) 0.99998628 b) 0.00000152 c) 0.99999848 d) 0.00001220 e) 0.01001372 f) none of the above. florian discovers a rock that is broken into pieces. each piece has several bands.which type of rock does florian predict these pieces will change into when subjected to heat and pressure?igneousmagmametamorphicsedimentary how many coulombs are required to produce 77.0 g of lithium metal from a sample of molten lithium chloride? what the theme for after 20 years& envedent Which objective lens should you start with when attempting to locate something under the microscope?. What is the value of csc 47 to the nearest thousandth? How would switching to solar power affect a city environment? a 75-year-old male is involved in a motor vehicle accident and strikes his forehead on the windshield. he complains of neck pain and severe burning in his shoulders and arms. his physical exam reveals weakness of his upper extremities. what type of spinal cord injury does this patient have? question 4 (10 pts): the first design alternative (a) requires a $300,000 investment and will produce net annual revenue of $55,000 over the 10-year planning horizon. the second alternative (b) requires a $450,000 investment and will produce net annual revenue of $80,000 annually. both alternatives are expected to have negligible salvage values at the end of the 10-year planning horizon. based on a 10 percent marr and an irr comparison, which design (if any) should be chosen? Jonathan is a photographer. He has been hired by a company to shoot an advertisement for their product. Which role does Jonathan play in the advertising process for the product? Jonathan plays the role of a in the advertising process for the product. Which was NOT an argument used by women to gain the right to vote? ? Quincy has a jewelry business in which he designs and sells bracelets. His daily profit, Q(x), can be modeled by the function Q(x) = 8.25x 24.75, where x is the number of bracelets he sells. What is the value of Q(3), and what is its interpretation? Q(3) = 0; If Quincy sells 3 bracelets, he will earn $0. Q(3) = 0; If Quincy sells 0 bracelets, he will earn $3. Q(3) = 3.36; If Quincy sells 3 bracelets, he will earn $3.36. Q(3) = 3.36; If Quincy sells 3.36 bracelets, he will earn $3. Could someone help quick the report found that the public: group of answer choices could not understand the medical terms being used by physicians, ill trained or rightly trained could easily assess if a physician was ill trained or rightly trained could not distinguish between ill trained and rightly trained physicians could more easily figure out what was best for their health on their own 14 11/12 + 3 1/6 need help help meeeeeeeee pleaseeeee rn rnnnn!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!help meeeeeeeee pleaseeeee rn rnnnn!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!help meeeeeeeee pleaseeeee rn rnnnn!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!help meeeeeeeee pleaseeeee rn rnnnn!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!! How did Iberville and Bienville know they had found the Mississippi River? Why did Bienville struggle as a leader?