A(6, -5) and B(-1, 2) in the ratio of 2:5​

Answers

Answer 1

Answer:

p(x,y)= (4,-3)

Step-by-step explanation:

all explainations are in the picture below.

A(6, -5) And B(-1, 2) In The Ratio Of 2:5

Related Questions

) A random sample of size 36 is selected from a normally distributed population with a mean of 16 and a standard deviation of 3. What is the probability that the sample mean is somewhere between 15.8 and 16.2

Answers

Answer:

The probability is 0.31084

Step-by-step explanation:

We can calculate this probability using the z-score route.

Mathematically;

z = (x-mean)/SD/√n

Where the mean = 16, SD = 3 and n = 36

For 15.8, we have;

z = (15.8-16)/3/√36 = -0.2/3/6 = -0.2/0.5 = -0.4

For 16.2, we have

z = (16.2-16)/3/√36 = 0.2/3/6 = 0.2/0.5 = 0.4

So the probability we want to calculate is;

P(-0.4<z<0.4)

We can get this using the standard normal distribution table;

So we have;

P(-0.4 <z<0.4) = P(z<-0.4) - P(z<0.4)

= 0.31084

a polynomial p has zeros when x=1/5,x=-4, andx=2 what could be the equation of p?​

Answers

Answer:

x^3 + (9/5)x^2 -(42/5)x + (8/5)

Step-by-step explanation:

since 1/5, -4, and 2 are all zeroes, (x-1/5)(x+4)(x-2) must be a factor of p. if you distribute the statement, you get

Find the intersection point for the following liner function f(x)= 2x+3 g(x)=-4x-27

Answers

Answer:

( -5,-7)

Step-by-step explanation:

f(x)= 2x+3 g(x)=-4x-27

Set the two functions equal

2x+3 = -4x-27

Add 4x to each side

2x+3+4x = -4x-27+4x

6x+3 = -27

Subtract 3

6x+3 - 3 = -27-3

6x = -30

Divide each side by 6

6x/6 = -30/6

x =-5

Now we need to find the output

f(-5) = 2(-5) +3 = -10+3 = -7

Answer:

Step-by-step explanation:

big burgewr

An ‘in shuffle’ is a perfect shuffle on a standard deck of 52 playing cards that splits the deck in half, then interleaves cards starting with the top half.

Required:
a. What is the position of the first card after the 7th shuffle?
b. How many times must one perform the shuffle so that the top card becomes the bottom card?
c. When do the first and last cards in the deck touch?

Answers

Answer:

  a) position 22

  b) 26

  c) shuffle 25

Step-by-step explanation:

Assuming the shuffling occurs so that the bottom card of the top half of the deck (card 26) becomes the bottom card (card 52), while the top card of the bottom half (card 27) becomes the top card (card 1), the sequence of card 1 positions with successive shuffles is ...

  {2, 4, 8, 16, 32, 11, 22, 44, 35, 17, 34, 15, 30, 7, 14, 28, 3, 6, 12, 24, 48, 43, 33, 13, 26, 52, 51, 49, 45, 37, 21, 42, 31, 9, 18, 36, 19, 38, 23, 46, 39, 25, 50, 47, 41, 29, 5, 10, 20, 40, 27, 1}

That is, after the first shuffle, card 1 is at position 2; after the second shuffle, it is at position 4; and so on.

(a) Hence the position of card 1 after the 7th shuffle is 22.

__

(b) The top card is in position 52 after 26 shuffles.

__

(c) The top card is in position 26 after 25 shuffles; the bottom card is in position 27 after 25 shuffles. That is when they first touch. (They touch again after 51 shuffles.)

How do I determine which is y=-1/3x+2?

Answers

Step-by-step explanation:

This is a linear equation in slope intercept form which is

[tex]y = mx + b[/tex]

where m is the slope and b is the y intercept.

The equation

[tex]y = - \frac{1}{3} x + 2[/tex]

Has a slope of -1/3 so this means that the slope will be decreasing. A negative linear equation increases as we go left. and decreases as we go right. The y intercept is 2. So this means the graph must pass through (0,2) and when x=0, y must be 2.

In other words, look for a line that the y values increase as we go left and decrease we go right. Also look for a point (0,2) and make sure the graph pass through it.

Variable g is 8 more than variable w. Variable g is also 2 less than w. Which pair of equations best models the relationship between g and w? g = 8w g = w + 2 w = g + 8 w = g − 2 w = 8g w = g + 2 g = w + 8 g = w − 2

Answers

Answer: g = w + 8    g=w-2

Step-by-step explanation:

We could represent the word phrases by the equations.

g = w + 8  

g = w - 2  

Answer:

g = w + 8

g = w - 2

Step-by-step explanation:

Assuming that g and w exists, then we can show the relation as described:

"Variable g is 8 more than variable w."

g = w + 8

"Variable g is also 2 less than w."

g = w - 2

These are the two equations of the described relationship between g and w.

Note that g could not actually exist in the real number system:

g = w + 8

g = w - 2

w + 8 = w - 2

w - w = -2 - 8

0 != -10

This is impossible within the real number system.

Cheers.

15 < −5x can someone please solve for x?

Answers

Answer:

x <-3

Step-by-step explanation:

15 <-5x

divide both sides by 5 but since the coefficient of x is negative after dividing the sign changes.

x <-3

Answer:

x < −3

I hope this helps!

The sum of 2 numbers is -3 . 0ne of the numbers is 115 less than the other

Answers

Answer:

One number is 56 the other is -59

Step-by-step explanation:

Set up your problem, like this:

x+(x-115)=-3

x+x=112

Divide both sides by 2

x=56

For the second number (x-115)

56-115=-59

Any questions, feel free to ask :)

Please mark brainliest and have a great day!

Answer:

56 & -59

Step-by-step explanation:

Based on the dot plots shown in the images, which of the following is a true statement? A. Set B has the greater mode. B. Set A has more items than set B. C. Set A is more symmetric than set B. D. Set B has the greater range.

Answers

D. Set B has the greater range.

Identifying equivalent statements and negations of a conditional statement: help


Attached is the photo reference.

Answers

Answer:

1: Equal

2: Negation

3: Negation

4: Neither

Step-by-step explanation:

Sorry if I got any of them wrong

Complete the equation describing how x
and y are related.
Х у
y = [? ]x +
07
1 9
2 11
3 13
4 15
5 17
Enter the answer that
belongs in [?]

Answers

Answer:

Hello,

Answer 2

Step-by-step explanation:

7=2*0+7

9=2*1+7

11=2*2+7

13=2*3+7

15=2*4+7

17=2*5+7

y=2*x+7

An other way:

[tex]points\ ( 0,7)\ and\ (1,9)\\\\\Delta\ y=9-7=2\\\Delta\ x=1-0=1\\\\\\y-7=(x-0)*2\\\\y=2x+7\\[/tex]

The complete equation is [tex]y = 2x+7[/tex].

What is equation?

An equation is a condition on a variable such that two expressions in the variable should have equal value.

What is substitution?

Substitution means replacing the variables (letters) in an algebraic expression with their numerical values.

According to the question.

We have a table which shows the relation between x and y.

Let the missing term be a and b.

The the given equation becomes

[tex]y = ax + b[/tex]

For finding the value of a and b.

Substitute x = 0 and y = 7 in equation y = ax + b.

[tex]\implies 7 = a(0) + b\\\implies b = 7[/tex]

Again, substitute  x = 1 and y = 9 in the equation y = ax+ b

[tex]\implies 9 = a(1) +b\\\implies 9 = a + 7\\\implies a = 2[/tex]

substitute the value of a and b in the equation y = ax + b.

[tex]\implies y = 2x+ 7[/tex]

Therefore, the complete equation is [tex]y = 2x+7[/tex].

Find out more information about equation and substitution here:

https://brainly.com/question/2581775

#SPJ2

Can someone please help I don't understand. Determine the domain and range of the following function. Record your answers in set notation.

Answers

Look at the screenshot!!!

prove that 2^n+1>(n+2).sin(n)​

Answers

Step-by-step explanation:

F(n)=|sin(n)|+|sin(n+1)|

then

F(n+π)=|sin(n+π)|+|sin(n+π+1)|=|sin(n)|+|sin(n+1)|=F(n)

and

F(π−n)=|sin(π−n)|+|sin(π−n+1)|=|sinn|+|sin(n−1)|≠F(n)

so we must prove when n∈(0,π), have

F(n)>2sin12

when n∈(0,π−1),then

F(n)=sinn+sin(n+1)=sinn(1+cos1)+sin1cosn

and n∈(π−1,π),then

F(n)=sinn−sin(n+1)

How prove it this two case have F(n)>2sin12? Thank you

and I know this well know inequality

|sinx|+|sin(x+1)|+|sin(x−1)|≥2sin1,x∈R

2. About how much is 123.1 do you weigh in pounds? Estimate if you don't know☺ Find an online converter and find out how many kilograms that is.​

Answers

Answer:

123.1 pounds is vary long, and I don't want to repeat, so 55.8372207 repeat.

Step-by-step explanation:

If you have any questions regarding my answer, tell me them in the comments, and I will come answer them for you. Have a good day.

A farmer decides to try out a new fertilizer on a test plot containing 10 stalks of corn. Before applying the fertilizer, he measures the height of each stalk. Two weeks later, after applying the fertilizer, he measures the stalks again. He compares the heights of these stalks to 10 stalks that did not receive fertilizer. Did the fertilizer help? Use a significance level of 0.10 to test whether the height of the stalks increased.


The differences are calculated and the mean difference is found to be -3.36 inches with a standard deviation of 1.05 inches. Set up the appropriate hypothesis test and find the standardized test statistic.


t* = -14.31


t* = 3.2


t* = -3.2


t* = -10.12

Answers

Answer:

d)  t = -10.12

Step-by-step explanation:

Explanation:-

Given sample size 'n'=10

Given the differences of mean x⁻ -μ = -3.36

Standard deviation of the sample 'S' =1.05 inches

We will use t-statistic

                      [tex]t = \frac{x^{-}-Mean }{\frac{S}{\sqrt{n} } }[/tex]

                     [tex]t= \frac{-3.36}{\frac{1.05}{\sqrt{10} } }[/tex]

                    t = -10.12

Answer: D

Step-by-step explanation:

A sample contains 61 pairs of values. Find the critical value for the linear correlation coefficient from Table A-6 corresponding to a 0.05 significance level.

0.236

0.254

0.279

0.330

Answers

Answer:

0.254

Step-by-step explanation:

Table A-6 will be shown below for reference. Since none of the answer choices contain the critical value for 61, we can just round that number to 60. We will see that the critical value is 0.254. If you're having trouble reading the table below, look at the columns to find the corresponding significance level you are working with then find the sample value.

Best of Luck!

What is the derivative of 5x^4+4?

Answers

Answer:

[tex]\displaystyle \frac{dy}{dx} = 20x^3[/tex]

General Formulas and Concepts:

Calculus

Differentiation

DerivativesDerivative Notation

Derivative Property [Multiplied Constant]:                                                           [tex]\displaystyle \frac{d}{dx} [cf(x)] = c \cdot f'(x)[/tex]

Derivative Property [Addition/Subtraction]:                                                         [tex]\displaystyle \frac{d}{dx}[f(x) + g(x)] = \frac{d}{dx}[f(x)] + \frac{d}{dx}[g(x)][/tex]  

Basic Power Rule:

f(x) = cxⁿf’(x) = c·nxⁿ⁻¹

Step-by-step explanation:

Step 1: Define

Identify

[tex]\displaystyle y = 5x^4 + 4[/tex]

Step 2: Differentiate

Derivative Property [Addition/Subtraction]:                                                 [tex]\displaystyle y' = \frac{d}{dx}[5x^4] + \frac{d}{dx}[4][/tex]Rewrite [Derivative Property - Multiplied Constant]:                                   [tex]\displaystyle y' = 5\frac{d}{dx}[x^4] + \frac{d}{dx}[4][/tex]Basic Power Rule:                                                                                         [tex]\displaystyle y' = 20x^3[/tex]

Topic: AP Calculus AB/BC (Calculus I/I + II)

Unit: Differentiation

Arbitron Media Research Inc. conducted a study of the iPod listening habits of men and women. One facet of the study involved the mean listening time. It was discovered that the mean listening time for a sample of 13 men was 35 minutes per day. The standard deviation was 8 minutes per day. The mean listening time for a sample of 11 women was also 35 minutes, but the standard deviation of the sample was 18 minutes. Use a two-tailed test and at 0.10 significance level, can we conclude that there is a difference in the variation in the listening times for men and women?

Answers

Answer:

Since the critical f-value of the test statistic is less than the f value of 2.9130, we will fail to reject the null hypothesis and conclude that there's no sufficient evidence to support the claim that there is a difference in the variation in the listening times for men and women

Step-by-step explanation:

We are given;

Sample size for men; n1 = 13

Sample size for women; n2 = 11

standard deviation for men; s1 = 8 minutes

Standard deviation for women; s2 = 18 minutes.

Significance level; α = 0.1

Let's state the hypothesis;

Null hypothesis;H0: (μ1)² = (μ2)²

Alternative hypothesis;Ha: (μ1)² ≠ (μ2)²

The value of the test statistic would be;

F = (s1)²/(s2)²

F = 8²/18² = 0.1975

Now, degree of freedom for n1 is;

DF1 = n1 - 1

DF1 = 13 - 1

DF1 = 12

Also, degree of freedom for n2 is;

DF2 = 11 - 1

DF2 = 10

Now, since it's two tailed, we will make use of α/2 for the F-distribution table.

Thus, α/2 = 0.1/2 = 0.05

So,from the f-table attached, at df1 = 12 and df2 = 10,the F-Critical value is;

F_α/2 = 2.9130

Since,the critical f-value of the test statistic is less than 2.9130, we will fail to reject the null hypothesis and conclude that there's no sufficient evidence to support the claim that there is a difference in the variation in the listening times for men and women

Consider the following functions. f={(−1,1),(1,−2),(−5,−1),(5,3)} and g={(0,2),(−3,−4),(1,−2)} Step 1 of 4: Find (f+g)(1).

Answers

Answer:

  -4

Step-by-step explanation:

(f+g)(1) = f(1) +g(1)

In each case, you need to locate the ordered pair with 1 as the first element.

  (1, f(1)) = (1, -2) . . . . f(1) = -2

  (1, g(1)) = (1, -2) . . . . g(1) = -2

  f(1) +g(1) = (-2) +(-2) = -4

(f+g)(1) = -4

Are we adding all 4 sides ?

Answers

Answer:

Yes

Step-by-step explanation:

you would do 2(5x-10) + 2(8x+4)= 26x-12

Answer:

26x - 12

Step-by-step explanation:

The perimeter is the sum of all the exterior sides of a figure.

Here, we have a parallelogram, and its sides are 5x - 10, 8x + 4, 5x - 10, and 8x + 4. Adding these, we get:

(5x - 10) + (8x + 4) + (5x - 10) + (8x + 4) = 26x - 12

Thus, the answer is 26x - 12. Note that since the problem doesn't give a value for x, this cannot be simplified further.

~ an aesthetics lover

Triangle ABC has vertices A(0, 6) , B(−8, −2) , and C(8, −2) . A dilation with a scale factor of 12 and center at the origin is applied to this triangle. What are the coordinates of B′ in the dilated image? Enter your answer by filling in the boxes. B′ has a coordinate pair of ( , )

Answers

Answer:

[tex]B' = (-96,-24)[/tex]

Step-by-step explanation:

Given

[tex]A(0,6)[/tex]

[tex]B(-8,-2)[/tex]

[tex]C(8,-2)[/tex]

Required

Determine the coordinates of B' if dilated by a scale factor of 12

The new coordinates of a dilated coordinates can be calculated using the following formula;

New Coordinates = Old Coordinates * Scale Factor

So;

[tex]B' = B * 12[/tex]

Substitute (-8,-2) for B

[tex]B' = (-8,-2) * 12[/tex]

Open Bracket

[tex]B' = (-8 * 12,-2 * 12)[/tex]

[tex]B' = (-96,-24)[/tex]

Hence the coordinates of B' is [tex]B' = (-96,-24)[/tex]

Answer:

Bit late but the answer is (-4,-1)

Step-by-step explanation:

Took the test in k12

For
90° < 0 < 270°
, which of the primary trigonometric functions may have positive values?

Answers

Answer:

sine and tangent

will be positive.

Let f(x) = 2x + 2. Solve f−1(x) when x = 4. (1 point)

Answers

Answer:

1

Step-by-step explanation:

First, find the inverse of the original function.

x = 2y + 2

x-2/2

Second, substitute x with 4 and solve.

4-2/2

2/2

1

Best of Luck!

If f(x) = 2x + 2 is invertible, then its inverse is another function f ⁻¹(x) such that

f(f ⁻¹(x)) = 2 f ⁻¹(x) + 2 = x

Solve for f ⁻¹(x) :

2 f ⁻¹(x) + 2 = x

2 f ⁻¹(x) = x - 2

f ⁻¹(x) = (x - 2)/2 = x/2 - 1

Then when x = 4, we have f ⁻¹ (4) = 4/2 - 1 = 2 - 1 = 1.

Write the polar form of a complex number in standard form for [tex]8[cos(\frac{\pi}{2}) + isin(\frac{\pi}{2})][/tex]

Answers

Answer:

Solution : 8i

Step-by-step explanation:

We can use the trivial identities cos(π / 2) = 0, and sin(π / 2) = 1 to solve this problem. Let's substitute,

[tex]8\left[cos\left(\frac{\pi }{2}\right)+isin\left(\frac{\pi \:}{2}\right)\right][/tex] = [tex]8\left(0+1i\right)[/tex]

And of course 1i = i, so we have the expression 8(0 + i ). Distributing the " 8, " 8( 0 ) = 0, and 8(i) = 8i, making the fourth answer the correct solution.

The present population of a town is 2024800. It the rate of growth population is 5% per year per year. Find the Increased population in 2years. ​

Answers

Answer:

2232342

Step-by-step explanation:

2024800 : 100 * 5 = 101240

2024800 + 101240 = 2126040

2126040 : 100 * 5 = 106302

2126040 + 106302 = 2232342

in the first year, it increases by 5% of the original number, making the population at the end of that year 2 126 040. Then, the second year, it will increase by 5% of  2 126 040. This means that the final product or population after 2 years would be 2232342.

B is the midpoint of line segment AD, and C is the midpoint of line segment BD. If AD = 12, what is BC?

A. 1.5
B. 3
C. 4
D. 6

Answers

The only way to answer this is to see the diagram

For a closed rectangular box, with a square base x by x cm and height h cm, find the dimensions giving the minimum surface area, given that the volume is 18 cm3.

Answers

Answer:

∛18 * ∛18 * 18/(∛18)²

Step-by-step explanation:

Let the surface area of the box be expressed as S = 2(LB+BH+LH) where

L is the length of the box = x

B is the breadth of the box = x

H is the height of the box = h

Substituting this variables into the formula, we will have;

S = 2(x(x)+xh+xh)

S = 2x²+2xh+2xh

S = 2x² + 4xh and the Volume V = x²h

If V = x²h; h = V/x²

Substituting h = V/x² into the surface area will give;

S = 2x² + 4x(V/x²)

Since the volume V = 18cm³

S = 2x² + 4x(18/x²)

S =  2x² + 72/x

Differentiating the function with respect to x to get the minimal point, we will have;

dS/dx = 4x - 72/x²

at dS/dx = 0

4x - 72/x² = 0

- 72/x² = -4x

72 = 4x³

x³ = 72/4

x³  = 18

[tex]x = \sqrt[3]{18}[/tex]

Critical point is at [tex]x = \sqrt[3]{18}[/tex]

If x²h = 18

(∛18)²h =18

h = 18/(∛18)²

Hence the dimension is  ∛18 * ∛18 * 18/(∛18)²

What's the simplified expression of -2a-3 bº?

Answers

Answer:

-2a - 3

Step-by-step explanation:

bº equals 1 due to the zero exponent.

Thus, -2a-3 bº simplifies to -2a - 3.

Answer:

−2/a^3  

Step-by-step explanation:

please help brainliest to correct answer

Answers

The first one is -4 and the second one is 6.

Answer:

Question for number 3 is -3

Question for number 4 is 6

Step-by-step explanation:

Brainless please


A right circular cone has a volume of 30π m. If the height of the cone is multiplied by 6 but the radius remains fixed, which expression represents the resulting volume of the larger cone?
A. 6 + 30π m
B. 6 x 30π m
C. 6 x 30π m
D. 6 x (30π) m
PLZ HURRY IM TIMED

Answers

Answer:

Below

Step-by-step explanation:

The formula of the volule of a cone is:

● V= (1/3) × Pi × r^2 × h

h is the height and r is the radius.

■■■■■■■■■■■■■■■■■■■■■■■■■■

We are given that the volume is 30 Pi m^3

● V = 30 Pi

● 1/3 × Pi × r^2 × h = 30 Pi

If we multiply h by 6 we should do the same for 30 Pi since it's an equation

● 1/3 × Pi × r^2 × h = 30 × Pi × 6

Answer:

REVIEW: B is Correct    Exit

A right circular cone has a volume of 30π m. If the height of the cone is multiplied by 6 but the radius remains fixed, which expression represents the resulting volume of the larger cone?

A. 6 + 30π m

B. 6 x 30π m

C. 6 x 30π m

D. 6 x (30π) m

Step-by-step explanation:

The answer is be all i did was dig into what the other person was saying and got b it is correct:)

Other Questions
In the expression 7 - 4 3 +8, the first operation is? A. An Exponent B. Subtraction C. Multiplication D. Addition Hello!! Please help me ASAPUsing special right triangles show and explain all work for each problem. Each solution and work should demonstrate your understanding of Special Right Triangles (30-60-90 and 45-45-90)Find the missing side length and angle of this triangle. I've attached the triangle. Suppose that prices of a certain model of new homes are normally distributed with a mean of $150,000. Use the 68-95-99.7 rule to find the percentage of buyers who paid: between $150,000 and $152,400 if the standard deviation is $1200. A. 68% B. 99.7% C. 47.5% D. 34% Anderson sold a property to Kelly. The contract contained the following statement: "Buyer to accept the property in an 'as is' condition." Both the seller and the broker knew that the plumbing was in a major state of disrepair, but did not tell Kelly. Would an action against the broker and the seller be successful? 1. What is the midpoint of AB? write 1,245 in word form A rectangular prism has volume 1,088 ft3 and height 8 ft. What is the area of the base of the prism? a. 146 ft2 c. 136 ft2 b. 1,080 ft2 d. 1,096 ft2 It is late in the afternoon, and your team is finishing its third match of the volleyball tournament on the beach. The day has been hot, with temperatures in the 90s. Suddenly, a teammate collapses. They are responsive, but do not appear to be fully awake, only opening their eyes when you talk to them. They are breathing rapidly. You notice the skin is very warm, sunburned and moist. They are unable to get up from the ground. You want to help. How do you proceed? Mention any three disadvantages of early age marriage in points..PLZZ answer my question in relation to health education.... a mother has heterozygous type a blood and the father has type ab blood. what is the probability of the offspring having type O blood Help pleaseeeee!!!!!! Simon Company's year-end balance sheets follow. At December 31 2015 2014 2013AssetsCash $25,267 $30,131 $31,387Accounts receivable, net 75,450 50,642 41,435 Merchandise inventory 92,074 68,299 44,128Prepaid expenses 8,301 8,066 3,418 193,532Plant assets, net 231,487 215,775 Total assets $432,579 372,913 313,900 Liabilities and Equity Accounts payable $106,635 $62,392 $41,849 Long-term notes payable secured by mortgages on plant assets 79,698 84,912 71,453Common stock, $10 par value 163,500 163,500 163,500 Retained earnings 82,746 62,109 37,098 Total liabilities and equity $432,579 $372,313 313,900 Express the balance sheets in common-size percents. Does movement is a respiratory gas occurs towards the area of higher concentration of that particular respiratory gas? In terms of the natural laws that act on cars and drivers, what role do safety belts play? Air at 30 C, 1 bar, 50% relative humidity enters an insulated chamber operating at steady state with a mass flow rate of 3 kg/min and mixes with a saturated moist air stream entering at 5 C, 1 bar with a mass flow rate of 5 kg/min. A single mixed stream exits at 1 bar. Determine (a) the relative humidity and temperature, in C, of the exiting stream. (b) the rate of exergy destruction, in kW, for T0 What is planning of family? Which of the following should a pregnant client avoid during exercise? Suppose that it rains in Spain an average of once every 9 days, and when it does, hurricanes have a 2% chance of happening in Hartford. When it does not rain in Spain, hurricanes have a 1% chance of happening in Hartford. What is the probability that it rains in Spain when hurricanes happen in Hartford? (Round your answer to four decimal places.) All of the following statements about NAD are true except: Group of answer choices NAD is reduced to NADH during both glycolysis and the Krebs cycle. NAD has more chemical energy than NADH. NAD is reduced by the action of enzymes. NAD can receive electrons for use in chemiosmosis. NAD can be recycled many times. A sample of copper is heated to 100C and placed into a calorimeter containing 50 g of water at 25C after a few minutes the final temperature of the system reaches 40C how much heat in joules was released by the copper Sample