how many primary carbon are in 2,3 dimethylpentane​

Answers

Answer 1

Answer:

There are 7 carbons in 2,3 dimethylpentane

Explanation:

Because 2,3-dimethlypentane is an organic compound of carbon and hydrogen with formula C7H16


Related Questions

The boiling point of water is 100ºC. The boiling point of acetone is 56ºC. Which statement about distilling a mixture of acetone and water is correct?

Acetone remains in the original container.

Water will vaporize from the mixture before acetone.

Acetone is captured and cooled.

Water is collected as it leaves the mixture.

Answers

Answer:

Acetone is captured and cooled.

Explanation:

The boiling point of acetone is lower than that of water, so it will vaporise before water. Then acetone will be captured and cooled to separate it from its mixture with water.

The statement which is correct about distilling a mixture of acetone and water is as follows:

Acetone is captured and cooled.

Thus, the correct option is C.

What is Distillation?

Distillation may be defined as a procedure that generally involves the conversion of a liquid into a vapor that is eventually condensed back to liquid form. With the help of this process, the separation of components or substances from a liquid mixture by using selective boiling and condensation occurs.

Acetone has the lowest boiling point as compared to water. So, it boils faster than that water and vaporizes before water. After the termination of this process, the acetone will be predominantly captured and cooled to separate it from its mixture with water.

Therefore, the correct option for this question is C.

To learn more about the Boiling point of acetone, refer to the link:

https://brainly.com/question/17467265

#SPJ2

When an object falls toward the ground due to gravity, what type of energy becomes kinetic energy?

Answers

Answer:

potential energy (gravitational)

Explanation:

Potential energy is the energy that is stored in an object due to its position relative to some zero position. An object possesses gravitational potential energy if it is positioned at a height above (or below) the zero height. If we think of the ground as the zero height, the height of the object is coming down from a positive height.  Wherever it is relative to the zero height, it is stored at that height, meaning that it is potential energy at that particular height.  When it moves to the ground, it becomes kinetic, by gravitational means.

Answer:

Potential

Explanation:

Chemistry deals with all the following except: Select one: a. The composition of matter. b. The properties of matter. c. Our eating habits. d. The conversion of matter between various states.

Answers

Answer:

C. Our eating habits

Hope that helps.

Which of the following statements about a chemical reaction is false? Group of answer choices The phases in a chemical reaction tell us the state of the reactants and the products. An individual coefficient, with no reactant or product, in a balanced equation is meaningless. The subscripts in a balanced equation tell us the number of atoms in a molecule.

Answers

Answer:

Option B

Explanation:

Let us go through each of the options individually.

option A.

he phases in a chemical reaction tell us the state of the reactants and the products.

This is true because phases representations such as s, l , g and q tells us the state of the reactants if they are in the solid or liquid or gaseous or aqueous state of matter respectively. So this is not our answer.

option B

An individual coefficient, with no reactant or product, in a balanced equation is meaningless.

This option is correct, because in every reaction, there must be the reactant and product present.

option C

The subscripts in a balanced equation tell us the number of atoms in a molecule.

This is correct. Consider the equation below;

2H₂ + O₂ --> 2H₂O

In the reactant phase, the subscripts tells us that we have just two atoms of oxygen present.

prepare a dialogue between two friends about development of society .​

Answers

Answer:

Pls pls pls mark brainliest

water and development are substitute of one another.
explanation with it, please

Answers

Fawn spends hours each week managing employee shifts and schedules, time she should be spending on other restaurant operations. What can she do? O a) Start leaving more time in her week for scheduling-related tasks b) Write everything down in a weekly planner O c) Consider online inventory management software O d) Consider online scheduling software

What is the boiling point (in °C) of a 0.743 m aqueous solution of KCI?

Enter your rounded answer with

3 decimal places.

Answers

The correct answer is 100.761

What is the difference between a strong base and a weak base?
A. A strong base is always more concentrated than a weak base,
B. A strong base has a lower Ki than a weak base.
C. A strong base produces more ions in solution than a weak base,
D. A strong base is not as conductive as a weak base.

Answers

Answer:

C

Explanation:

percentage of carbon in urea

Answers

The percentage of carbon in urea is [CO(NH 2) 2] is 20%

Describe what happens to the particles when a substance:

1. Melts

2. Freezes

3. Boils

4. Condenses

Answers

Particles vibrate when frozen when it boils it moves like you had 4 monsters in the morning
1. It will melt.
2. It will freeze.
3. It will evaporation.
4. It will freeze.

Energy in the amount of 420 J is added to a 35 g sample of water at a temperature of 10°C. What is the final temperature of the water?

Answers

The final temperature of the water, T2 = 38.57°C

Temperature can be defined as a measure of the degree of hotness or coldness of a physical object (body). Thus, it is measured with a thermometer and its units are degree Celsius (°C), Fahrenheit (°F) and Kelvin (°K).

A calorie refers to the amount of heat required to raise the temperature of a gram of water by one (1) degree Celsius (1°C).

Given the following data:

Quantity of energy = 420JMass = 35 gramsInitial temperature, T1 = 10°C

The specific heat capacity of water is 4.2 J/g°C.

To find the final temperature of the water (T2):

Mathematically, the quantity of energy (heat capacity) is given by the formula;

[tex]Q = mcdt[/tex]

Where;

Q represents the heat capacity or quantity of heat.M represents the mass of an object.C represents the specific heat capacity of water.dt represents the change in temperature.

Substituting the values into the formula, we have;

[tex]420 = 3.5 \; * \; 4.2 \; * \; dt[/tex]

[tex]420 = 14.7 \; * \; dt\\\\dt = \frac{420}{14.7}[/tex]

Change in temperature, dt = 28.57°C

Next, we would solve for the final temperature by using this formula;

[tex]dt = T2 - T1[/tex]

[tex]28.57 = T_{2} - 10\\\\T_{2} = 28.57 \; + \; 10\\\\T_{2} = 38.57[/tex]

Final temperature, T2 = 38.57°C

Therefore, the final temperature of the water, T2 is equal to 38.57°C

For more information visit: https://brainly.com/question/22736508

What is the specific latent heat of fusion of ice if it takes 863 kJ to convert 4.6 kg of ice into water at 0 C?

Answers

Answer:

The correct answer is 187.7 J/Jg.

Explanation:

The formula for finding the specific heat of fusion is,  

Specific heat of fusion = Q/m

Here Q is the heat energy added, signified in kJ, and m is the mass of the object in kg.  

Based on the given information, the heat energy added or Q is 869 kJ and the mass of the ice is 4.6 Kg

Now putting the values in the formula we get,  

Specific heat of fusion = Q/m

Specific heat of fusion = 863 kJ / 4.6 Kg = 187.7 J/Kg

A sample of kerosene has a mass of 36.4g. It’s volume is 45.6mL. What is the density of kerosene?

Answers

Answer:

Density = 0.8 g/cm³

Explanation:

The density of an object can be found using the formula

[tex]Density(\rho) = \frac{mass}{volume} [/tex]

From the question

mass of kerosene = 36.4 g

volume of kerosene = 45.6 mL

To find the density substitute the values into the above formula and solve

We have

[tex]Density = \frac{36.4}{45.6} [/tex]

= 0.7982

We have the final answer as

Density = 0.8 g/cm³

Hope this helps you

Which one of these is most likely to gain electrons and which one is most likely to lose electrons? (And please explain why)
1. Ra (Radium)
2. In (Indium)
3. P (Phosphorus)
4. Te (Tellurium)
5. Br (Bromine)
6. Rb (Rubidium)

Answers

Answer:

(I). The most likely to lose electron is Rubidium

(II). The most likely to lose electron is Bromine

Explanation:

Given that,

Radium, Indium, Phosphorus, Tellurium, Bromine and Rubidium

We know that,

Metal :

They atom which to lose electron these is called metal.

When the atom loses the electron then the positive charge come on the atom.

The most likely to lose electron is Rubidium

Non metal :

They atome which is gains electron. It is called non metal.

So, we can say that, the non metal gains electron.

When the atom gains the electron then the negative charge come on the atom.

The most likely to gain electron is Bromine

Hence, This is required answer.

Consider the hypothetical chemical reaction represented by the equation 3 A + 2 B → A 3B 2 Which of the following is a correct interpretation of this equation? i. 3 grams of A react with 2 grams of B to form 1 gram of A 3B 2 ii. 3 atoms of A react with 2 atoms of B to form 1 molecule of A 3B 2 iii. 3 moles of A react with 2 moles of B to form 1 mole of A 3B 2

Answers

Answer:

iii. 3 moles of A react with 2 moles of B to form 1 mole of A 3B 2

Explanation:

A + 2 B → A 3B 2

A chemical equation among other things, gives the stoichiometry of the reaction; that is the relationship between reactants and products.

This relationship is basically stated in moles form the coefficients of the reactants and product.

From the reaction above, we can say;

1 mol of A reacts with 2 mol of B to form 1 mol of A3B2

It cannot be grams because the reactants and products all have different molar masses.

The correct interpretation of the equation of the hypothetical chemical reaction is; Choice (iii) 3 moles of A react with 2 moles of B to form 1 mole of A 3B 2.

Definition:

Chemical equations are equations that make use of chemical formulae and symbols to represent chemical reactions. The left-hand side of a chemical equation represents the reactants and the right-hand side represents the products.

Each reacting entity is also assigned its corresponding stoichiometric coefficient.

However, this stoichiometric coefficient is to quantify the no. of moles of the reactants consumed or products formed as the case may be.

Read more:

https://brainly.com/question/12271256

es with hydrogen
atoms
Fill the valencies with
C
+
() C c-c=c
(ii)
(
c
C - C = C
/
c
(ii)
c
- C
با
-
1
c - c
С — С
co

Answers

Answer:

all u have to do is inserting hydrogen atoms where it's possible, if carbon is not bonded to any element, then it can have 4 hydrogens. for the first chain, the first carbon can have 3 hydrogen atoms, the second carbon 1 hydrogen atom only the third also 1 hydrogen since there is double bond and the 4th 2 hydrogen atoms

Answer:

a rat and a cat can have sex

xD

Explanation:

A cylinder containing 14.71 L of helium gas at a pressure of 169.1 atm is to be used to fill toy balloons to a pressure of 1.086 atm. Each inflated balloon has a volume of 2.414 L. What is the maximum number of balloons that can be inflated? Report your answer to 1 decimal place. (Remember that 14.71 L of helium at 1.086 atm will remain in the exhausted (empty) cylinder)

Answers

Answer:

The number of balloons is 948.8.

Explanation:

The number of balloons can be calculated as follows:

[tex] N = \frac{V_{f}}{V_{T}} [/tex]

Where:

[tex]V_{f}[/tex]: is the volume at 1.086 atm

[tex]V_{T}[/tex]: is the balloon volume = 2.414 L  

The volume at 1.086 atm can be found using Boyle's law:

[tex] P_{i}V_{i} = P_{f}V_{f} [/tex]

[tex] V_{f} = \frac{P_{i}V_{i}}{P_{f}} = \frac{169.1 atm*14.71 L}{1.086 atm} = 2290.5 L [/tex]

Now, the number of balloons is:

[tex] N = \frac{V_{f}}{V_{T}} = \frac{2290.5 L}{2.414 L} = 948.8 [/tex]

Therefore, the number of balloons is 948.8.

I hope it helps you!        

Which of the following is an example of matter? Question 5 options: A) The air around you B) Your thoughts C) Radio waves D) Heat from a fire

Answers

Answer:

the air around you

Explanation:matter is physical like the particles in the air or the oxygen in the air. so rocks, earth the sun, anything you can touch is matter. even gasses.

Over the period of a few days, a hospital receives an overwhelming increase in the number of patients with food poisoning. How would a scientist respond to this increase in sick patients?

Answers

Answer:

Hey there!

A scientist would try to determine the cause of the food poisoning, and see if the people who got poisoned had anything in common, for example: they ate at the same restaurant, they are all people of a certain age, etc.

Let me know if this helps :)

Compound A, C6H12O2, was found to be optically active, and it was slowly oxidized to an optically active carboxylic acid B, C6H12O3, by Ag(NH3)2. Oxidation of A by anhydrous CrO3 gave an optically inactive compound D that reacted with Zn amalgam/HCl to give 3-methylpentane. With aqueous H2CrO4, compound A was oxidized to an optically inactive dicarboxylic acid C, C6H10O4. Give structures for compounds A, B, and C; do not specify stereochemistry.

Answers

Answer:

kindly check the attach file for the drawing of the chemical structures.

Explanation:

So, we are going to start from the compound D, which is stated in the question to be optically active. Therefore, we will have that:

STEP ONE: THE OXIDATION OF COMPOUND A, C6H12O2 TO GIVE COMPOUND C.

The oxidation of compound A,C6H12O2 gives another chemical compound that is chemical compound C which is a optical inactive di-carboxylic acid. The chemical equation is given below:

C6H12O2 + H2Cr2O4 --------------------------------------------> HOOCCH2CHCH3CH2COOH.

STEP TWO: THE OXIDATION OF COMPOUND A, C6H12O2 TO GIVE COMPOUND B.

The oxidation of compound A,C6H12O2 gives another chemical compound that is chemical compound C which is a optically active acid. The chemical equation is given below:

C6H12O2 + Ag(NH3)2^+ -----------------------------> C6H12O3.

Since the question asked us to give the structures of Compound A,B and C there is no need to to show the chemical reaction for compound D.

Kindly check the picture below for the chemical structures.

What would you use to measure the height of a sample?

Question 2 options:

ruler


beaker


graduated cylinder


electronic balance

Answers

Answer:

please clear ur ques with image

it's unable to be understood

...

How many protons does an atom of zinc contain?
It contains an amount

Answers

a single neutral atom of zinc has 30 protons

step by step of how to convert fahrenheit and celsius to kelvins -5F to kelvins please and thank you

Answers

(-5-32)•5/9 + 273.5= K

(-37)•5/9 + 273.5=K

185/9 + 273.5=K

-20.55+273.5=K

252.59=K


( that 9 is dividing the (-5-32)•5 )

what is the question tag for Lynne speaks french and German

Answers

Answer:here is it...

Explanation:

The question tag for the statement "Lynne speaks French and German" would be "doesn't she?"

The question tag is a short question added to the end of a statement to turn it into a question and seek confirmation or agreement. It is usually formed by using an auxiliary verb opposite in polarity to the main verb in the statement.

In the given statement, "Lynne speaks French and German," the main verb is "speaks." Since the main verb is in the affirmative form, the question tag should use the negative form.

Therefore, we use the auxiliary verb "doesn't" (the negative form of "does") and add the pronoun "she" to match the subject of the statement.

Know more about question tag:

https://brainly.com/question/33778833

#SPJ2

ammonium hydroxide molecular weight?step by step????​

Answers

Lets find

[tex]\\ \sf\longmapsto NH_4OH[/tex]

[tex]\\ \sf\longmapsto 14u+4(1u)+16u+1u[/tex]

[tex]\\ \sf\longmapsto 14u+4u+17u[/tex]

[tex]\\ \sf\longmapsto 18u+17u[/tex]

[tex]\\ \sf\longmapsto 35u[/tex]

for every __sodium ions transported ___postassium ions are transported

Answers

Answer:

In fact, in many neurons three sodium ions are transported for every potassium ion; sometimes the ratio is three sodium ions for every two potassium ions, and in a few neurons it is two sodium ions for one potassium ion.

How does the chemistry of the ocean change in response to high levels of CO2 in the atmosphere?

Answers

Ocean acidification is occurring because excess carbon dioxide (CO2) in the atmosphere is being absorbed at the surface of the ocean at an increasing rate. This excess CO2 results in more hydrogen ions, which increases the acidity of the ocean.

why is an element considered a pure substance​

Answers

Answer:

Because they cannot be separated into more then one type of substance.

Explanation:

Answer:

Elements are made of only one kind of atom. The particles can be a single atom or a molecule made of only one kind of atom. There is no physical change that can separate elements into more than one kind of substance. This makes an element a pure substance.An element is made up of only one type of atom. An element cannot be broken down into a simpler form.

What is the term for the belief that one's own culture is superior to other
cultures?
O A. Cultural behavior
O B. Cultural competence
C. Cultural relativism
D. Cultural absolutism

Answers

The belief that one's own culture is superior to others would be D - Cultural Absolutism. It
declares a society's culture to be of supreme ethical value to other cultures.

Hope this helps!

Cultural absolutism is the term for the belief that one's own culture is superior to other cultures.

What is cultural absolutism?

Cultural absolutism is one of the perspectives which is common in anthropology, but it can  also be applied to non-scientific thoughts also. It assumes that there is a set of universal values which are objectively valid in every  situation.

Today, pure cultural absolutism is seen as a harmful effect of ethnocentrism focusing on  the belief that one's own culture is superior and the practice of holding other's cultures to the standard of our own. However, purely relativist anthropologists have also been critiqued for going too far, by  denying any common humanity and being too lenient towards morally questionable practices. Contemporary approaches try to find a balance between  the universal values, such as human dignity, and a more inclusive and relativistic side  of culture.

Learn more about cultural absolutism,here:

https://brainly.com/question/12391889

#SPJ2

Charles is given two electrical conductors – aluminium and graphite. Help him to select one for making an electric wire. Justify your reason.

Answers

Answer:

I think the answer is aluminium because both graphite and Al are good conductors of electricity but Al is more ductile than graphite. also pls mark as Brainilest.

Explanation:

Other Questions
Suppose you exert a force of 185 N tangential to the outer edge of a 1.73-m radius 76-kg grindstone (which is a solid disk).Required:a. What torque is exerted?b. What is the angular acceleration assuming negligible opposing friction?c. What is the angular acceleration if there is an opposing frictional force of 20.0 N exerted 1.50 cm from the axis? URGENT/EDGE: An individuals health is affected by their environment and personal genetic makeup.True or False==============I feel like common sense says it's true but another person answered the same question with false - edge2021 vit topic sentence v nc Large capacitors can hold a potentially dangerous charge long after a circuit has been turned off, so it is important to make sure they are discharged before you touch them. Suppose a 120 F capacitor from a camera flash unit retains a voltage of 140 V when an unwary student removes it from the camera. If the student accidentally touches the two terminals with his hands, and if the resistance of his body between his hands is 1.8 k, for how long will the current across his chest exceed the danger level of 50 mA? What does Kuno say to Vashti look at the image below The values of 9s in 9905482 Please Help me!! An 8 foot high camel is loping away from a streetlight. The camel is loping at 12 feet/second. The streetlight is 20 feet high. How fast is the camels shadow growing? Why was the Pequot War 1637 important? ActivityWrite sentences using the verbs saber and conocer to express that you know the people listed below or know something about them.People you Might Know or Know AboutPart AAntonio Banderas It takes 250 \text{ g}250 g250, start text, space, g, end text of pasta and 240 \text{ ml}240 ml 240, start text, space, m, l, end text of sauce to make one batch of spaghetti, and it takes 600 \text{ g}600 g600, start text, space, g, end text of pasta and 700 \text{ ml}700 ml 700, start text, space, m, l, end text of sauce to make one batch of lasagna. Pens cost 15 pence each. Rulers cost 20 pence each. Write down an expression for the cost of x pens and x rulers. Work out the mean for the data set below: 3, 5, 4, 3, 5, 6 Give your answer as a fraction. answer Name the following compound from the concise formula:______. CH3CH(CH3)CHCHCH(CH3)CH2CH3 A. 2,4-dimethyl-3-heptene B. 2,5-dimethyl-3-heptene C. 3,5-dimethyl-3-heptene D. 2,5-dimethyl-4-heptene You are planning to use a tile design in your new room. The tiles are equilateral triangles. You decide to arrange the tiles in a hexagonal shape as shown. If the side of each tile measures 11 cm, what will be the exact area of each hexagonal shape? A. 3,993 cm^2 B. 181.5 root 3 cm^2 C. 132 root 3 cm^2 D. 33 cm^2 Midpoint City operates its own municipal public drinking water system for which the Environmental Protection Agency has set maximum levels of pollutants. The city does not use any equipment to meet these standards. With regard to any contamination of the water, under the Safe Drinking Water Act, this is most likely What name did the pro slavery rebel states take on when they broke from the United States? A. Dixie B. The Mason-Dixie line C. The Confederate States of America D. The Rebel States of America Which of the following best describes Chinas status during the 1980s? The core belief in this movement promotes an ideal spiritual state that 'transcends' the physical and empirical and is only realized through the individual's intuition, rather than through the doctrines of established religions. It placed individualism at a high level. a. Abolitionist movement.b. Domesticity movement.c. Transcendentalist movement.d. Temperance movement. Create a class called Date that includes three pieces of information as data members -- a month (type int), a day (type int) and a year (type int). Your class should have a constructor with three parameters that uses the parameters to initialize the three data members. For the purpose of this exercise, assume that the values provided for the year and day are correct, but ensure that the month value is in the range 1-12; if it isn't, set the month to 1. Provide a set and a get function for each data member. Provide a member function displayDate that displays the month, day and year separated by forward slashes (/).