Name the following compound from the concise formula:______.
CH3CH(CH3)CHCHCH(CH3)CH2CH3
A. 2,4-dimethyl-3-heptene
B. 2,5-dimethyl-3-heptene
C. 3,5-dimethyl-3-heptene
D. 2,5-dimethyl-4-heptene

Answer:

Lies predominantly to the left.

Explanation:

In the reaction:

NH4⁺(aq) + Br-(aq) ⇄ NH3(aq) + HBr(aq)

Conjugate acid + Ion ⇄ weak base + strong acid

HBr is a strong acid whereas NH3/NH4⁺ are the weak base and its conjugate base. A strong acid as HBr dissociates completely in solution as H⁺ and Br⁻. That means in solution you will never have HBr without dissociation doing the reaction:

Explanation:

Don't know wwwwmkbnkkkoo

Explanation:

1. boiling and melting point

2. electrical conductivity

3. Bond strength

4. bond length

A covalent bond consists of negative electrons that are shared in between atoms. Because of this bond, they possess and manifest physical abilities, including electrical pressure/conductivity and lower melting points compared to ionic compounds.

Answer:

d

Explanation:answer is d on edg 2020

Answer:

[tex]M_{acid}=0.141M[/tex]

Explanation:

Hello,

In this case, the reaction between sulfuric acid and hydroxide is:

[tex]H_2SO_4+2NaOH\rightarrow Na_2SO_4+2H_2O[/tex]

We can notice a 1:2 molar ratio between the acid and the base respectively, therefore, at the equivalence point we have:

[tex]2*n_{acid}=n_{base}[/tex]

And in terms of volumes and concentrations:

[tex]2*M_{acid}V_{acid}=M_{base}V_{base}[/tex]

So we compute the molarity of sulfuric acid as shown below:

[tex]M_{acid}=\frac{M_{base}V_{base}}{2*V_{acid}} =\frac{0.100M*28.15mL}{2*10.0mL}\\ \\M_{acid}=0.141M[/tex]

Best regards.

not 100% sure but I think its C

The correct name for the given alkane molecule is 2,2-dimethylpropane. (Option C)

The given alkane molecule is composed of three carbon atoms. The central carbon atom is bonded to two methyl groups (CH₃) on either side. This results in a branched structure where the methyl groups are attached to the same carbon atom.

According to the rules of IUPAC nomenclature, the prefix "2,2-" indicates that the methyl groups are attached to the second carbon atom in the main chain. The parent chain, which consists of three carbon atoms, is named propane. Since there are two identical methyl groups attached to the second carbon atom, the compound is named 2,2-dimethylpropane.

Hence, the name of the given alkane molecule is 2,2-dimethylpropane.

Learn more about IUPAC here:

https://brainly.com/question/16631447

#SPJ 6

Answer:

c

Explanation:

it takes 10,000 years to just reduce down the decay

Answer:

Water when it freezes into ice

Explanation:

Most liquids expand when heated and contract when cooled, water behaves in an anomalous fashion. Water rather expands when cooled and contracts when heated.

Water usually contracts on cooling from any temperature until 4°C, after 4°C, the water begins to expand rapidly. Hence water has its least volume at 4°C and increases rapidly afterwards.

Thus the largest volume change for water occurs during freezing since it expands when cooled.

Answer:

Explanation:

The total kinetic energy of a body is known as Thermal energy. Option A

Thermal energy is the direct sum of all the available random kinetic energies of molecules.

Also note that thermal energy is directly proportional to temperature in Kelvin.

Thus, the total kinetic energy of a body is known as Thermal energy. Option A

Learn more about thermal energy here:

https://brainly.com/question/19666326

#SPJ1

Answer:

A.) Thermal energy

Explanation:

I got it correct on founders edtell

Answer:

Higher temperature = more bouncing.

So, the correct answer is that there will be less bouncing at 39 degrees F. (Lower at 39 F)

Let me know if this helps!

Answer:

0.9718M

Explanation:

Rate constant, k =  0.255 M-1s-1

time, t = 8.00 s

Initial concentration, [A]o = 1.33 M

Final concentration, [A] = ?

These quantities are represented by the equation;

1 / [A] = 1 / [A]o + kt

1 / [A] = 1 /1.33 + (0.255 * 8)

1 / [A] = 0.7519 + 2.04

[A] = 1 / 2.7919 = 0.3582 M

How much of NO2 decomposed is obtained from the change in concentration;

Change in concentration = Initial - Final

Change = 1.33 - 0.3582 = 0.9718M

Answer:

Jesseca Kusher, an 18-year-old researcher from Spartansburg, S.C., invented a paint-on coating for roofing shingles. Her formula could reduce a home's cooling costs and possibly cut ozone pollution in urban areas...

SUPPORT ME ...........

Answer:

Jesseca created mixtures containing graphite, gypsum, and mica that could be painted on roof shingles.

Explanation:

Hope this helped!!

Answer:

The coefficients are; 4, 0, 2, 2

Explanation:

The equation is given as;

HCl + O2 --> H2O + Cl2

Upon balancing the equation, we have;

4HCl + O2 --> 2H2O + 2Cl2

Answer:

A) Forms a racemic mixture of the two possible enantiomers

When carbonyl compounds are reduced with a reagent such as LiAlH₄ or NaBH₄ and  new stereogenic center is formed chemical change will lead to products that form a racemic mixture of the two possible enantiomers.

Chemical changes are defined as changes which occur when a substance combines with another substance to form a new substance.Alternatively, when a substance breaks down or decomposes to give new substances it is also considered to be a chemical change.

There are several characteristics of chemical changes like change in color, change in state , change in odor and change in composition . During chemical change there is also formation of precipitate an insoluble mass of substance or even evolution of gases.

There are three types of chemical changes:

1) inorganic changes

2)organic changes

3) biochemical changes

During chemical changes atoms are rearranged and changes are accompanied by an energy change as new substances are formed.

Learn more about chemical change,here:

https://brainly.com/question/2591189

#SPJ6

Answer:

B. pOH = 14 - pH and D. pH = 14 - pOH.

Explanation:

Hello,

In this case, we must remember that pH and pOH are referred to a measure of acidity and basicity  respectively, since pH accounts for the concentration of H⁺ and pOH for the concentration of OH⁻ in a solution. In such a way, since the maximum scale is 14, we say that the addition between the pH and pOH must be 14:

[tex]pH+pOH=14[/tex]

Therefore, the correct answers are B. pOH = 14 - pH and D. pH = 14 - pOH since the both of them are derived from the previous definition.

Best regards.

Answer:

D: by subtracting the pOH from 14.

Explanation:

Answer:

Explanation:

Answer in attached file .

Answer:

Major product does not undergo oxidation since it is a tertiary alcohol whereas minor product undergoes oxidation to ketone as it is  secondary alcohol.

Explanation:

Hello,

In this case, given the attached picture, the hydration of the 1 methylcyclohexene yields to alcohols; 1-methylcyclohexan-1-ol and 1-methylcyclohexan-2-ol. Thus, since the OH in the 1-methylcyclohexan-1-ol (major product) is bonded to a tertiary carbon (bonded with other three carbon atoms) it is not able to increase the number of oxygen bonds (oxidation) as it already attained the octet whereas the 1-methylcyclohexan-2-ol (minor product) is able to undergo oxidation to ketone as the carbon bonded to it is secondary (bonded with other two carbon atoms), so one extra bond the oxygen is allowed to be formed to carbonyl.

Best regards.

Answer:

[tex]\large \boxed{1.10 \times 10^{-3}\text{ mol/L}}[/tex]

Explanation:

1. Concentration of SO₄²⁻

SrSO₄(s) ⇌ Sr²⁺(aq) +SO₄²⁻(aq); Ksp = 3.44 × 10⁻⁷

                   0.0150          x

[tex]K_{sp} =\text{[Sr$^{2+}$][SO$_{4}^{2-}$]} = 0.0150x = 3.44 \times 10^{-7}\\x = \dfrac{3.44 \times 10^{-7}}{0.0150} = \mathbf{2.293 \times 10^{-5}} \textbf{ mol/L}[/tex]

2. Concentration of Pb²⁺

PbSO₄(s) ⇌ Pb²⁺(aq) + SO₄²⁻(aq); Ksp = 2.53 × 10⁻⁸

                        x          2.293 × 10⁻⁵

[tex]K_{sp} =\text{[Pb$^{2+}$][SO$_{4}^{2-}$]} = x \times 2.293 \times 10^{-5} = 2.53 \times 10^{-8}\\\\x = \dfrac{2.53 \times 10^{-8}}{2.293 \times 10^{-5}} = \mathbf{1.10 \times 10^{-3}} \textbf{ mol/L}\\\\\text{The concentration of Pb$^{2+}$ is $\large \boxed{\mathbf{1.10 \times 10^{-3}}\textbf{ mol/L}}$}[/tex]

Answer:

atagcca

Explanation:

t goes with a, and c goes with g

atagcca matches with

ta tcggt

Answer:

Crop rotation

Explanation:

The growing of different crops in succession on a piece of land to avoid exhausting the soil and to control weeds,pets,and diseases

Average rainfall is 20.0 inch and temperature ranges from 2.5° to 80.8° in the Jackson, Wyoming.

Rainfall: The average rainfall occurs in Jackson, Wyoming is 20.0 inch, the average amount of snowfall in Jackson, Wyoming is  109.0 inch.

Precipitation occurs about 113.3 days in a year whereas 215 days are sunny at the Jackson, Wyoming.

Temperature: The maximum temperature is 80.8° that occurs in the month of June, July, August and September whereas the minimum temperature is 2.5° that occurs in the month of December and January.

https://brainly.com/question/24326696

Answer:

W = 278.64375 Joules

Explanation:

The information given in this problem are;

Initial volume = 0L

Final volume = 2.50L

ΔV = 2.50 - 0 = 2.50 L

External pressure, P =  1.10 atm

Work = ?

These parameters are related by the equation;

w = - P ΔV

W = - (1.10 )(2.50)

W = 2.75 L atm

Upon conversion to joules;

1 liter atmosphere is equal to 101.325 joule

W = 278.64375 Joules

Answer:

[tex]m_{AgBr}=1.48gAgBr[/tex]

Explanation:

Hello,

In this case, the undergoing chemical reaction is:

[tex]KBr(aq)+AgNO_3(aq)\rightarrow AgBr(s)+KNO_3(aq)[/tex]

Thus, since the potassium bromide and silver nitrate are in a 1:1 mole ratio, the first step is to identify the limiting reactant, by considering the reacting volumes of reactants in order to compute the available moles of potassium bromide and the moles of potassium bromide consumed by the 15.4 mL of 0.512-M solution of silver nitrate:

[tex]n_{KBr}=0.0599L*0.282\frac{molKBr}{L} =0.0169molKBr\\\\n_{KBr}^{consumed}=0.0154L*0.512\frac{molAgNO_3}{L} *\frac{1molKBr}{1molAgNO_3}=0.00788molKBr[/tex]

In such a way, since less moles are consumed than available, we infer that silver nitrate is the limiting reactant, for which the resulting grams of silver bromide (molar mass 187.8 g/mol) result:

[tex]m_{AgBr}=0.00788molAgNO_3*\frac{1molAgBr}{1molAgNO_3} *\frac{187.8gAgBr}{1molAgBr} \\\\m_{AgBr}=1.48gAgBr[/tex]

Best regards.

Answer:

Pb + 2H2O --> PbO2 + 2H2

Explanation:

Products:

Solid metal; PbO2

Hydrogen; H

Reactants:

Metal; Pb

Steam; H2O

Reactants --> Products

Pb + H2O --> PbO2 + H2

Upon balancing we have;

Pb + 2H2O --> PbO2 + 2H2

Answer:

It is a hydrogen bond but if I had to coose one of thee answers it is b. chemical bonding

Explanation:

Answer: [tex]\Delta H = -272.25kJ[/tex] for 1 mole of NO.

Explanation: Hess' Law of Constant Summation or Hess' Law states that the total enthalpy change of a reaction with multiple stages is the sum of the enthalpies of all the changes.

For this question:

1) [tex]N_{2}_{(g)} + 3H_{2}_{(g)}[/tex] => [tex]2NH_{3}_{(g)}[/tex]       [tex]\Delta H=-92kJ[/tex]

2) [tex]4NH_{3}_{(g)}+5O_{2}_{(g)}[/tex] => [tex]4NO_{(g)}+6H_{2}O_{(g)}[/tex]       [tex]\Delta H=-905kJ[/tex]

Amonia ([tex]NH_{3}_{(g)}[/tex]) appeares as product in the first equation and as reagent in the 2 reaction, so when adding both, there is no need to inverse reactions. However, in the 2nd, there are 4 moles of that molecule, so to cancel it, you have to multiply by 2 the first chemical equation and enthalpy:

[tex]2N_{2}_{(g)} + 6H_{2}_{(g)}[/tex] => [tex]4NH_{3}_{(g)}[/tex]     [tex]\Delta H=-184kJ[/tex]

Now, adding them:

[tex]2N_{2}_{(g)} + 6H_{2}_{(g)}[/tex] => [tex]4NH_{3}_{(g)}[/tex]     [tex]\Delta H=-184kJ[/tex]  

[tex]4NH_{3}_{(g)}+5O_{2}_{(g)}[/tex] => [tex]4NO_{(g)}+6H_{2}O_{(g)}[/tex]       [tex]\Delta H=-905kJ[/tex]

[tex]2N_{2}_{(g)}+6H_{2}_{(g)}+5O_{2}_{(g)}=>4NO_{(g)}+6H_{2}O_{(g)}[/tex]  [tex]\Delta H = -185-905[/tex]

[tex]2N_{2}_{(g)}+6H_{2}_{(g)}+5O_{2}_{(g)}=>4NO_{(g)}+6H_{2}O_{(g)}[/tex]  [tex]\Delta H = -1089kJ[/tex]

Note net enthalpy is for the formation of 4 moles of nitric oxide.

For 1 mole:

[tex]\Delta H = \frac{-1089}{4}[/tex]

[tex]\Delta H=-272.25kJ[/tex]

To form 1 mol of nitric oxide from nitrogen, oxygen and hydrogen, net change in enthalpy is [tex]\Delta H=-272.25kJ[/tex].

Answer:

For a given element, the number of postively charged, massive nuclear particles, the number of protons, is fixed. ... Because the number of protons determines Z , the atomic number, which determines the identity of the atom. The nucleus can also contains neutrons, massive, neutrally charged nuclear particles.

Explanation:

Answer:

0.27 V

Explanation:

Given that the both half cells contain 1.0 molar solutions of their respective electrolytes.

E°Pb= -0.13 V

E°Cd = -0.40 V

Since it is a galvanic cell, the electrode having a more negative electrode potential will serve as the anode and the electrode having a less negative electrode potential will serve as the cathode.

Hence cadmium will serve as the anode and lead will serve as the cathode.

E°cell = E°cathode - E°anode

E°cell = -0.13 - (-0.40)

E°cell = 0.27 V