trigonometric identities

Trigonometric Identities

Answers

Answer 1

Without knowing what Juan's exact steps were, it's hard to say what he did wrong. The least you could say is that his solution is simply not correct.

4 sin²(θ) - 1 = 0

==>   sin²(θ) = 1/4

==>   sin(θ) = ±1/√2

==>   θ = π/4, 3π/4, 5π/4, 7π/4


Related Questions

Please help. I’ll mark you as brainliest if correct!

Answers

Answer:

The system is dependent:

x=-3t-7

y=-5t-15

z=t

Step-by-step explanation:

I chose to use a matrix to solve this system of equations. Once put into matrix form, you need to row reduce the system into its simplest form (Row Reduced Echelon form). Doing this, we find that the system is dependent on the z variable. And following usual procedures, we let z equal some other letter; which is t in this case. Then we isolate each variable to get the answer.

Check the attachment for the work.

[The arrows indicate a row swap and the parenthesis indicates addition if a constant multiple of one row to another]

Fertilizing bromeliads. Bromeliads are tropical flowering plants. Many are epiphytes that attach to trees and obtain moisture and nutrients from air and rain. Their leaf bases form cups that collect water and are home to the larvae of many insects. As a preliminary to a study of changes in the nutrient cycle, Jacqueline Ngai and Diane Srivastava examined the effects of adding nitrogen, phosphorus, or both to the cups. They randomly assigned 8 bromeliads growing in Costa Rica to each of 4 treatment groups, including an unfertilized control group. A monkey destroyed one of the plants in the control group, leaving 7 bromeliads in that group. Here are the numbers of new leaves on each plant over the seven months following fertilization:
Nitrogen Phosphorus Both Neither
15 15 14 14
14 17 18 19
18 13 14 11
16 13 15 16
14 14 15 13
11 17 14 15
13 12 15 15
(a) Give the degrees of freedom for the F statistic. numerator degrees of freedom denominator degrees of freedom
(b) Find the F-statistic. (Round your answer to two decimal places.)
(c) Find the associated P-value. (Round your answer to four decimal places.)

Answers

Answer:

Calculated value of F = 0.0535

The critical region is F >F ₀.₀₅ (6,21) = 2.575

Reject H0

Step-by-step explanation:

1. Null hypothesis

H0: µ Nitrogen = µ Phosphorus = µ Both = µ Neither

2. Alternative hypothesis

H1: Not all means are equal.

3. The degrees of freedom for the numerator of the F-ratio = k- 1= 7-1=6

4.The degrees of freedom for the denominator of the F-ratio = n-k= 28-7

= 21

5. The significance level is set at α-0.05

The critical region is F >F ₀.₀₅ (6,21) = 2.575

The test statistic to use is

F = sb²/ sw²

Which if H0 is true has an F distribution with v₁=k-1 and v₂= n-k degrees of freedom

Correction Factor = CF = Tj²/n = (410)²/28= 6003.57

Total SS ∑∑X²- C. F = 6108- 6003.57= 104.43

Between SS ∑T²j/r - C.F = 42036/ 7 - 6003.57 =  1.57286

Within SS = Total SS - Between SS= 104.43- 1.573= 102.86

The Analysis of Variance Table is

Source Of                 Sum of          Mean              Computed

Variation          d.f     Squares       Squares               F

Between

Samples          6         1.57286       0.2621               0.0535

Within

Samples         21       102.86           4.898

Calculated value of F = 0.0535

Pvalue = 2.575

Since it is smaller than 5 % reject H0.

In accounting, a company's gross profit rate measures how well the company controls cost of goods sold to maximize gross profit. The gross profit rate, PPP, is calculated using the formula P = \dfrac{S - C}{S}P= S S−C ​ P, equals, start fraction, S, minus, C, divided by, S, end fraction, where SSS is the net sales and CCC is the cost of goods sold. Rearrange the formula to solve for the cost of goods sold (C)(C)left parenthesis, C, right parenthesis. C=C=C, equals What is the cost of goods sold if the net sales is \$1{,}200{,}000$1,200,000dollar sign, 1, comma, 200, comma, 000 and the gross profit ratio is 0.20.20, point, 2? Round your answer, if necessary, to the nearest dollar. C=C=C, equals dollars

Answers

Answer:

$960,000

Step-by-step explanation:

The gross profit rate of the company is expressed as [tex]P = \dfrac{S - C}{S}[/tex] where C is the cost of goods sold and S is the net sales. If the net sales S = $1,200,000, and gross profit ratio is 0.20, the cost of goods sold will be expressed as shown;

Making C the subject of the formula from the expression given.

[tex]P = \dfrac{S - C}{S}\\\\cross \ multiply\\\\SP = S-C\\\-C = SP-S\\\\C = S -SP\\[/tex]

Substituting P = 0.20 and S = $1,200,000 into the resulting equation, we will have;

[tex]C = $1,2000,000 - 0.2($1,2000,000)\\C = $1,2000,000- 240,000\\ C = 960,000[/tex]

Hence the cost of goods sold is $960,000

Students who score within 14 points of the number 88 will pass a particular test. Write this statement using absolute value notation and use the variable x for the score.

Answers

Answer:

|88-x| ≤ 14

Step-by-step explanation:

their score has to be within 14 points of 88.

if their score is above 88, the number will be negative, but the absolute value makes the number positive. if that number is still within 14 of 88, they pass.

if their score is below 88, the number will be negative, and the absolute value keeps the number positive. if that number is still within 14 of 88, they pass.

PLS HELP:Find all the missing elements:

Answers

Answer:

b = 9.5 , c = 15

Step-by-step explanation:

For b

To find side b we use the sine rule

[tex] \frac{ |a| }{ \sin(A) } = \frac{ |b| }{ \sin(B) } [/tex]

a = 7

A = 23°

B = 32°

b = ?

Substitute the values into the above formula

That's

[tex] \frac{7}{ \sin(23) } = \frac{ |b| }{ \sin(32) } [/tex]

[tex] |b| \sin(23) = 7 \sin(32) [/tex]

Divide both sides by sin 23°

[tex] |b| = \frac{7 \sin(32) }{ \sin(23) } [/tex]

b = 9.493573

b = 9.5 to the nearest tenth

For c

To find side c we use sine rule

[tex] \frac{ |a| }{ \sin(A) } = \frac{ |c| }{ \sin(C) } [/tex]

C = 125°

So we have

[tex] \frac{7}{ \sin(23) } = \frac{ |c| }{ \sin(125) } [/tex]

[tex] |c| \sin(23) = 7 \sin(125) [/tex]

Divide both sides by sin 23°

[tex] |c| = \frac{7 \sin(125) }{ \sin(23) } [/tex]

c = 14.67521

c = 15.0 to the nearest tenth

Hope this helps you

NEED HELP ASAP!!!! PLEASEEE

Answers

The first answer of the missing blank is 4/5.

The second answer of the missing blank is 2.

The third answer of the missing blank is 25.

*For all of these solutions, I will be using the common rules for logarithms.*

Solution for the first question:

Log9^4/5 must equal log9^4-log9^5, or it could also equal the more proper version, which is simplified: 2log9^2-log9^5.

Solution for the second question:

Log3^22 must equal log3^11+log3^2, if you break it down.

Solution for the third question:

Log9^25 must equal 2log9^5 because it will be like this when simplifying it:

log9^25=2log9^5

log9^5²=2log9^5

2log9^5=2log9^5

These are all of the step-by-step procedures for all three of these given questions. Anyways, I hope that this helped you!

can you please help me with this

Answers

Answer:

  [tex]\displaystyle A=\dfrac{1}{2}\int_\pi^{\frac{7\pi}{6}}{(\cos{\theta}+\sin{2\theta})^2}\,d\theta[/tex]

Step-by-step explanation:

The shaded area is the area of the curve bounded by θ = π and θ = 7π/6.* A differential of area in polar coordinates is ...

  dA = (1/2)r^2·dθ

So, the shaded area is ...

   [tex]\displaystyle\boxed{A=\dfrac{1}{2}\int_\pi^{\frac{7\pi}{6}}{(\cos{\theta}+\sin{2\theta})^2}\,d\theta}[/tex]

_____

* We found these bounds by trial and error using a graphing calculator to plot portions of the curve.

What is the maximum value of -4z^2+20z-6?

Answers

Answer:

Hello,

19

Step-by-step explanation:

2 methodes:

1)

[tex]y=-4x^2+20x-6\\\\=-4(x^2-5x)-6\\\\=-4(x^2-2*\dfrac{5}{2}*x+\dfrac{25}{4} ) +25-6\\\\=-4(x-\frac{5}{2} )^2+19\\\\Maximum\ =19 \ if\ x=\dfrac{5}{2} \\[/tex]

2)

y'=-8x+20=0 ==> x=20/8=5/2

and y=-4*(5/2)²+20*5/2-6=-25+50-6=19

finding maximums/minimums in quadratic equations:

The maximum value is 19

We want to find the maximum value of:

y = -4z^2+20z-6

Here, you can see that we have a quadratic equation with a negative leading coefficient.

This means that the arms of the graph will go downwards. From this, we can conclude that the maximum will the at the vertex (the highest point).

Remember that for a general equation like:

y = a*x^2 + b*x + c

The x-value of the vertex is:

x = -b/(2a)

(you can see that the variable is a different letter, that does not matter, is just notation)

Then for our equation:

y = -4z^2+20z-6

The z-value of the vertex is:

z = -20/(2*-4) = -20/-8 = 5/2

Then the maximum of the equation:

y = -4z^2+20z-6

is that equation evaluated in z = 5/2

So we get:

y = -4*(5/2)^2 + 20*(5/2) - 6  = 19

The maximum value is 19

If you want to learn more about this topic, you can read:

https://brainly.com/question/14336752

A tortoise is walking in the desert. It walks 7.5 meters in 3 minutes. What is its speed?
meters per minute

Answers

9514 1404 393

Answer:

  2.5 m/min

Step-by-step explanation:

To find meters per minute, divide meters by minutes:

  (7.5 m)/(3 min) = 2.5 m/min

The speed of the tortoise is 2.5 meters per minute.

Given the following three points, find by the hand the quadratic function they represent (0,6, (2,16, (3,33)

Answers

Answer:

[tex] f(x) = 4x^2 - 3x + 6 [/tex]

Step-by-step explanation:

Quadratic function is given as [tex] f(x) = ax^2 + bx + c [/tex]

Let's find a, b and c:

Substituting (0, 6):

[tex] 6 = a(0)^2 + b(0) + c [/tex]

[tex] 6 = 0 + 0 + c [/tex]

[tex] c = 6 [/tex]

Now that we know the value of c, let's derive 2 system of equations we would use to solve for a and b simultaneously as follows.

Substituting (2, 16), and c = 6

[tex] f(x) = ax^2 + bx + c [/tex]

[tex] 16 = a(2)^2 + b(2) + 6 [/tex]

[tex] 16 = 4a + 2b + 6 [/tex]

[tex] 16 - 6 = 4a + 2b + 6 - 6 [/tex]

[tex] 10 = 4a + 2b [/tex]

[tex] 10 = 2(2a + b) [/tex]

[tex] \frac{10}{2} = \frac{2(2a + b)}{2} [/tex]

[tex] 5 = 2a + b [/tex]

[tex] 2a + b = 5 [/tex] => (Equation 1)

Substituting (3, 33), and c = 6

[tex] f(x) = ax^2 + bx + x [/tex]

[tex] 33 = a(3)^2 + b(3) + 6 [/tex]

[tex] 33 = 9a + 3b + 6 [/tex]

[tex] 33 - 6 = 9a + 3b + 6 - 6 [/tex]

[tex] 27 = 9a + 3b [/tex]

[tex] 27 = 3(3a + b) [/tex]

[tex] \frac{27}{3} = \frac{3(3a + b)}{3} [/tex]

[tex] 9 = 3a + b [/tex]

[tex] 3a + b = 9 [/tex] => (Equation 2)

Subtract equation 1 from equation 2 to solve simultaneously for a and b.

[tex] 3a + b = 9 [/tex]

[tex] 2a + b = 5 [/tex]

[tex] a = 4 [/tex]

Replace a with 4 in equation 2.

[tex] 2a + b = 5 [/tex]

[tex] 2(4) + b = 5 [/tex]

[tex] 8 + b = 5 [/tex]

[tex] 8 + b - 8 = 5 - 8 [/tex]

[tex] b = -3 [/tex]

The quadratic function that represents the given 3 points would be as follows:

[tex] f(x) = ax^2 + bx + c [/tex]

[tex] f(x) = (4)x^2 + (-3)x + 6 [/tex]

[tex] f(x) = 4x^2 - 3x + 6 [/tex]

Which of the following is a solution for 5 - 2x ≤ -3?

Answers

Answer:

x≥4

Step-by-step explanation:

The required solution for the inequality 5 - 2x ≤ -3 is x ≥ 4 or x ∈ [4, ∞).

What is inequality?

Inequality shows relation between two expression which are not equal to each others.

The given inequality is,

5 - 2x ≤ -3.

Solve the inequality,

Add 3 to both the sides,

5 - 2x + 3 ≤ -3 + 3

8 - 2x ≤ 0

-2x  ≤ -8

Multiply -1 both the sides,

2x ≥ 8

x ≥ 4

The solution for the inequality is x ≥ 4 or x ∈ [4, ∞).

To know more about Inequality on:

https://brainly.com/question/20383699

#SPJ2


Question
Five people, each working 8 hours a day, can assemble 400 toys in a 5-day work week. What is the average
number of toys assembled per hour, per person?

Answers

3,200 per hour. This might be wrong sorry if it is !

find the value of X?

Answers

Answer:

x = 58

Step-by-step explanation:

The exterior angle is equal to the sum of the opposite interior angles

90  = 32+x

Subtract 32 from each side

90-32 = x

58 =x

Find the fractal dimension of the object.

Answers

Answer:

maaqqqf aku ngak tau soal jawaban in

Find a 3 digit number with all these properties: all 3 digits are different, the 1st digit is the square of the second digit in the 3rd digit on one more than twice the second digit

Answers

Answer:

425 or 937

Step-by-step explanation:

First, I listed out all the possible numbers for the first digits, namely, the squares under 10.

1*1=1

2*2=4

3*3=9

Since all the digits have to be different, the first digit cannot be 1 because 1 squared is 1. So that leaves us 4 and 9 to work with, which I tried out one at a time.

Starting with 4:

2 squared is 4.

42

2 times 2 plus 1 equals 5.

425

Starting with 9:

3 squared is 9.

93

2 times 3 plus 1 equals 7.

937

So here we have two numbers that both work and meet the requirements (unless I understood the problem wrong at the part where it says "...the second digit in the 3rd digit on one more than twice the second digit")!

I hope this helped! :D

Hunda Corporation’s expected year end dividend amounting to RM1.60, and its required return is 11 percent. The dividend yield is 6 percent and its growth rate is expected to be constant in the future. What is Hunda Corporation’s expected stock price in 7 years?

Answers

Answer:

Hunda expected stock price in 7 years = RM48.12

Step-by-step explanation:

expected year end dividend = RM1.60

required return = 11%

dividend yield = 6%

growth rate = constant

Determine Hunda corporation's expected stock price in 7 years

stock price in 7 years

= expected year end dividend / (required return rate - dividend yield rate )

= 1.6 * (1.06)^7  / ( 0.11 - 0.06 )

= 2.4058 / 0.05 =  48.12%

You roll two fair dice, a green one and a red one. (a) What is the probability of getting a sum of 6? (Enter your answer as a fraction.) (b) What is the probability of getting a sum of 10? (Enter your answer as a fraction.) (c) What is the probability of getting a sum of 6 or 10? (Enter your answer as a fraction.) Are these outcomes mutually exclusive? Yes No

Answers

Answer:

5/36 ; 1/12 ; 2/9 ; yes

Step-by-step explanation:

Given the following :

Roll of two fair dice : green and red

Probability = (number of required outcomes / number of total possible outcomes)

(a) What is the probability of getting a sum of 6?

Number of required outcomes = 5

P(sum of 6) = 5/36

b.) What is the probability of getting a sum of 10?

Number of required outcomes = 3

P(sum of 10) = 3 / 36 = 1/12

c.) What is the probability of getting a sum of 6 or 10?

P(getting a sum of 6) + P(getting a sum of 10)

(5/36) + (1/12) = (5 + 3) / 36

= 8/36 = 2/9

The events are mutually exclusive because each event cannot occur at the same time.

Use mathematical induction to prove the statement is true for all positive integers n. The integer n3 + 2n is divisible by 3 for every positive integer n.

Answers

Answer:

Prove:

Using 1

n³+2n = (1)³+2(1) = 1+2= 3 ---> 3/3= 1 ✔

Using 2

n³+2n = (2)³+2(2)= 8+4=12 --> 12/3=4✔

Using 3

n³+2n= (3)³+2(3)= 27+6= 33 --> 33/3=11✔

So it is proven that n³+2n is divisible by 3 for every positive integer.

I hope this helps

if u have question let me know in comments

A low-noise transistor for use in computing products is being developed. It is claimed that the mean noise level will be below the 2.5-dB level of products currently in use. It is believed that the noise level is approximately normal with a standard deviation of .8. find 95% CI

Answers

Answer:

The 95% CI is   [tex]2.108 < \mu < 2.892[/tex]

Step-by-step explanation:

From the question we are told that

   The  population mean [tex]\mu = 2.5[/tex]

    The standard deviation is  [tex]\sigma = 0.8[/tex]

Given that the confidence level is  95% then the level of confidence is mathematically evaluated as

          [tex]\alpha = 100 - 95[/tex]

   =>  [tex]\alpha = 5\%[/tex]

  =>    [tex]\alpha = 0.05[/tex]

Next we obtain the critical value of  [tex]\frac{\alpha }{2}[/tex] from the normal distribution table, the values is  [tex]Z_{\frac{\alpha }{2} } = 1.96[/tex]

Generally the margin of error is mathematically evaluated as

          [tex]E = Z_{\frac{\alpha }{2} } * \frac{\sigma}{\sqrt{n} }[/tex]

here we would assume that the sample size is  n =  16 since the person that posted the question did not include the sample size

  So    

               [tex]E = 1.96* \frac{0.8}{\sqrt{16} }[/tex]

               [tex]E = 0.392[/tex]

The  95% CI is mathematically represented as

              [tex]\= x -E < \mu < \= x +E[/tex]

substituting values

              [tex]2.5 - 0.392 < \mu < 2.5 + 0.392[/tex]

substituting values

              [tex]2.108 < \mu < 2.892[/tex]

       

Which equation is equivalent to the formula below?

Answers

Answer:

option C is best.

Step-by-step explanation:

y=a(x-h)^2+k

y-k=a(x-h)^2y

y-k/(x-h)^2=a

option c is right………..

A 95% confidence interval indicates that:
A. 95% of the intervals constructed using this process based on samples from this population will
include the population mean
B. 95% of the time the interval will include the sample mean
C. 95% of the possible population means will be included by the interval
D. 95% of the possible sample means will be included by the interval

Answers

95% interval would be 95% of the population mean.

The answer should be:

A. 95% of the intervals constructed using this process based on samples from this population will

include the population mean

Answer:

A

Step-by-step explanation:

A 95% confidence interval indicates that 95% of the intervals constructed using this process based on samples from this population will

include the population mean

x
Find the value
of x. Show
3
10
your work.

Answers

Step-by-step explanation:

Hello, there!!!

Let ABC be a Right angled triangle,

where, AB = 3

BC= 10

and AC= x

now,

As the triangle is a Right angled triangle, taking angle C asrefrence angle. we get,

h= AC = x

p= AB = 3

b= BC= 10

now, by Pythagoras relation we get,

[tex]h = \sqrt{ {p}^{2} + {b}^{2} } [/tex]

[tex]or ,\: h = \sqrt{ {3}^{2} + {10}^{2} } [/tex]

by simplifying it we get,

h = 10.44030

Therefore, the answer is x= 10.

Hope it helps...

I will rate brainly if you answer this The number of weekly social media posts varies directly with the square root of the poster’s age and inversely with the cube root of the poster’s income. If a 16-year-old person who earns $8,000 makes 64 posts in a week, what is the value of k?

Answers

Answer:

[tex]\large \boxed{\sf \bf \ \ k=320 \ \ }[/tex]

Step-by-step explanation:

Hello,

The number of weekly social media posts varies directly with the square root of the poster’s age and inversely with the cube root of the poster’s income.

If a 16-year-old person who earns $8,000 makes 64 posts in a week, what is the value of k?

[tex]64=\dfrac{\sqrt{16}}{\sqrt[3]{8000}}\cdot k=\dfrac{4}{20}\cdot k=\dfrac{1}{5}\cdot k=0.2\cdot k\\\\k=64*5=320[/tex]

Hope this helps.

Do not hesitate if you need further explanation.

Thank you

k=320.

If a=age, m=income, and n=number of weekly posts:
The relationship can be modeled by
n=k * sqrt(a) / cbrt(m). sqrt(a) is in the numerator because it is directly proportional to n and cbrt(m) is in the denominator because it is inversely proportional to n.
Plugging in the given values, n=64, a=16, m=8000, 64=k* sqrt(16) / cbrt(8000). sqrt(16)=4, and cbrt(8000)=20, so 64=4k/20=k/5. So k=64*5= 320.

Answer using the graph

Answers

Answer:

8

Step-by-step explanation:

f(x)=x²+4 ( find quadratic equation: given vertex)

g(x)=x+2  ( find linear equation : given 2 points)

(f-g)(-2)

(x²+4-x-2)of (-2)

x²-x+2  now find (f-g)(-2)

-2²-(-2)+2=4+2+2=8

HELP PRECALC NEED IN PROOF FORM

Answers

Hello, please consider the following.

We know the following, right ?

[tex](\forall a, b \in \mathbb{R}) \left( sin(a+b)=sin(a)sin(b)+cos(a)cos(b) \right)[/tex]

So, here, it gives.

[tex]Asin(\omega t+\phi)=Asin(\phi){\sf \bf sin(\omega t)}+Acos(\phi){\sf \bf cos(\omega t)}\\\\=c_2{\sf \bf sin(\omega t)}+c_1{\sf \bf cos(\omega t)}\\\\\text{ *** where }c_2=Asin(\phi) \text{ and } c_1=Acos(\phi) \text{ ***}[/tex]

Do not hesitate if you need further explanation.

(2)
Study the figure below and use the counting square method to determine
the perimeter and area of the diagram in the grid. The idea for using the
counting squares is to enable you to develop the formulae that can be used
to calculate the area and perimeter of a rectangle.
2
G
7
8 9
12 LIS
o 23 24 25
2427128129130
3132333435
363 ks halu
L22HLLLS 4.12712849 Sos: S-3 54 55
56 57 58 591696162163164165 66 67 68 69174
772 19L4214277879808182838485
66 87 88 89 90 91 92 93 94 95 96 97 98 99 100
5
plu2!3114
Gise 2212 213 24 2a2a134
8
Adapted from Tess-India (Elementary Mathematics)
Explain step by step, how you arrived at your answer to determine the area
and perimeter of the figure in the grid paper.​

Answers

The perimeter of a shape is the summation of the visible lengths of the figure. The area; however, is the product of the length and the width of the figure

The perimeter of the figure is 58 units and the area of the figure is 130 unit square

Your question is not properly formatted and the diagram required to solve the question is missing. I've included the appropriate diagram.

Having said that, the perimeter is:

Perimeter = sum of all sides

[tex]Perimeter = 7 + 8 + 5 + 8 + 3 + 6 + 3 + 5 + 7 + 6[/tex]

[tex]Perimeter = 58[/tex]

To calculate the area, we use a different approach.

First, we split the figure into 3, we then calculate the area of each sub-figure, and then we add up the calculated areas.

From left to right, we have:

Rectangle 1

[tex]Length = 7\\Width = 6[/tex]

Rectangle 2

[tex]Length = 5\\Width = 6+8 = 14[/tex]

Rectangle 3

[tex]Length = 3\\Width = 6[/tex]

The area of a rectangle is:

[tex]Area = Length * Width[/tex]

So, the area of the figure is:

[tex]Area = 7 * 6 + 5 * 14 + 3 * 6[/tex]

[tex]Area = 130[/tex]

Learn more at:

https://brainly.com/question/2649416

The length of the longest side of a triangle is 5 inches more than twice the length of the shortest
side, and the length of the middle side is 2 inches more than the length of the shortest side. The
perimeter of the triangle is 235 inches. So the shortest side is inches long. Type in your
numerical answer only; do not type any words or letters with your answer.

Answers

Answer:

Length of shortest side: 57

Length of medium side:59

Length of long side: 119

Step-by-step explanation:

3. A jogger runs 4 miles on Monday, 5 miles on
Tuesday, 3 miles on Wednesday, and 5 miles on
Thursday. He doesn't run on Friday. How many
miles did he run in all?​

Answers

Answer:

17 miles

Step-by-step explanation:

4+5+5+3=17

As part of a group exercise, four students each randomly selected 3 cards with angle measures written on them. The table shows the results. Which student selected angle measures that could form a triangle? A. Aella B. Aisha C. Ah Lam D.Andrew

Answers

Answer =  A.  Aella

Step-by-step explanation: Add 60, 25, and 95 degrees because that will equal 180 which is what the triangle equals.

What is the formula for the volume of a pyramid?

V = πr2h
V = 3/4πr2h
V = 1/3πr2h
V = 1/3Bh

Answers

Which behavior would best describe someone who has good communication skills with customers ? a) Following up with some customers b) Talking to customers more than listening to them c) Repeating back what the customer says d) Interrupting customers frequently
The formula is V=1/3Bh
Other Questions
The perpendicular bisector of the line segment connecting the points $(-3,8)$ and $(-5,4)$ has an equation of the form $y = mx + b$. Find $m+b$. what are the features of humanism? 5. solve for x please help A sample of 81 observations is taken from a normal population with a standard deviation of 5. The sample mean is 40. Determine the 95% confidence interval for the population mean. what is called the priest of magar? Given two points M & N on the coordinate plane, find the slope of MN , and state the slope of the line perpendicular to MN . (there's two questions) 1) M(9,6), N(1,4) 2) M(-2,2), N(4,-4) PLEASE HELP!!! 10. Write the formula of the function f(x) whose graph is shown.Af(x) = 4 - 4Bf(x)=1= - +4Xf(x) = 24D1f(x) =X +4 2Select the correct answer.which number is the additive Inverse of -10 ?O A 10 1. OD. -41ResetNext A clothing factory makes small, medium, and large sweaters. Last week, the factory made1,612 sweaters. The factory made 3 times as many small sweaters as large sweaters. Theymade 3 times as many medium sweaters as small sweaters.How many small sweaters did the factory make last week? Based on the article, what do you think environmental racism is "A broker-dealer who acted as financial advisor to a municipality in structuring a new issue now wishes to act as underwriter in a negotiated offering. Which statement is TRUE?" An insect 1.1 mm tall is placed 1.0 mm beyond the focal point of the objective lens of a compound microscope. The objective lens has a focal length of 14 mm , the eyepiece a focal length of 21 mm . A) Where is the image formed by the objective lens? Give your answer as the distance from the image to the lens. Express your answer using two significant figures. B) How tall is the image mentioned in part A? Express your answer using two significant figures. C) If you want to place the eyepiece so that the image it produces is at infinity, how far should this lens be from the image produced by the objective lens? Express your answer using two significant figures. D) Under the conditions of part C, find the overall magnification of the microscope. Express your answer using two significant figures. Which of the following parties is permitted to view all entries in the Notary Signing Agent Notary journal?A) Contracting Companies and LendersB) Borrowers and signing PartiesC) Police with a warrant for Journal This neurotransmitter is involved in learning.A: SerotoninB: NorepinephrineC: AcetylcholineD: GABA the height of a soccer ball that is kicked from the ground can be approximated by the function: y = -12x^2 + 60xwhere y is the height of the soccer ball in feet in x seconds after it is kicked. Find the time, in seconds, it takes from the moment soccer is kicked until it returns to the ground The backbone vertebrae, skull, and rib cage make up the _______ skeleton. Among other types of cells, bone marrow produces _______ blood cells, which carry oxygen in the blood. _______ can eventually become osteocytes. If bones rapidly deconstruct faster than new bone tissue grows, this can lead to less dense and more fragile bones. When severe, this condition is called _______. _______ such as the MCL and ACL connect bone to other bone at joints.ANSWERS :1.axial2. red3. Osteoblasts4. osteoporosis5. Ligaments6. Osteoblasts are cells that build bone tissue, and are called osteocytes when they become surrounded by the bone that they have built. Osteoclasts are cells that break down bone tissue. The building and breaking down of bone tissue continues throughout a persons lifetime and makes bones strong. If osteoclasts break down more bone than osteoblasts build, this can lead to osteopenia and osteoporosis, causing bones to be fragile and break more easily. what is the period of the function F(x)=2sec(2x+3) Below are works cited entries for an encyclopedia article about benjamin franklin. select the one that is completely correct. Six times a number is greater than 20 more than that number Hey I need Japanese HIRAGANA help! Ka means is right?