Answer:
Calcium: Alkaline Earth
Sodium: Alkali Metal
Hope it helps!
Answer:
Calcium is in Alkaline Earth
Sodium is in Alkali Metal
Which of the following pairs of compounds have the same empirical formula?
a. acetylene, C2H2, and benzene, C6H6
b. ethane, C2H6, and butane, C4H10
c. nitrogen dioxide, NO2, and dinitrogen tetroxide, N2O4
d. diphenyl ether, C12H10O, and phenol, C6H5OH
Answer:
option a and c both are correct
Explanation:
please mark me as brainliest
The pairs of compounds have the same empirical formula are:
a. acetylene, C₂H₂, and benzene, C₆H₆ and
c .nitrogen dioxide, NO₂, and di nitrogen tetroxide, N₂O₄
What is empirical formula?The empirical formula of a compound is defined as the formula that shows the ratio of elements present in the compound, but not the actual numbers of atoms found in the molecule.
In some cases, the empirical formula is the same as the molecular formula, which gives the actual number of atoms in a compound (e.g., H₂O).Otherwise, the molecular formula is a multiple of the empirical formula (e.g., CH₂O is the empirical formula for glucose, C₆H₁₂O₆).
Examples of empirical formulas:
Glucose has a molecular formula of C₆H₁₂O₆. It contains 2 moles of hydrogen for every mole of carbon and oxygen. The empirical formula for glucose is CH₂O.
The molecular formula of ribose is C₅H₁₀O₅, which can be reduced to the empirical formula CH₂O.
The pair with empirical formula is acetylene, C₂H₂, and benzene, C₆H₆ and
nitrogen dioxide, NO₂, and di nitrogen tetroxide, N₂O₄
Thus, option (A) and (C) are correct.
To learn more about empirical formula, refer to below link:
https://brainly.com/question/14044066
#SPJ2
How can we identify that the absorption of heat has occurred?
Answer:
rise in temperature and the effect it has on our global weather patterns
You are given two aqueous solutions with different ionic solutes (Solution A and Solution B). What if you are told that Solution A has a greater concentration than Solution B by mass percent, but Solution B has a greater concentration than Solution A in terms of molality? Is this possible? If not, explain why not. If it is possible, provide example solutes for A and B and justify your answer with calculations.
Answer:
Yes, it is possible. Let us consider an example of two solutions, that is, solution A having 20 percent mass RbCl (rubidium chloride) and solution B is having 15 percent by mass NaCl or sodium chloride.
It is found that solution A is having more concentration in comparison to solution B in terms of mass percent. The formula for mass percent is,
% by mass = mass of solute/mass of solution * 100
Now the formula for molality is,
Molality = weight of solute/molecular weight of solute * 1000/ weight of solvent in grams
Now molality of solution A is,
m = 20/121 * 1000/80 (molecular weight of RbCl is 121 grams per mole)
m = 2.07
Now the molality of solution B is,
m = 15/58.5 * 1000/85
m = 3.02
Therefore, in terms of molality, the solution B is having greater concentration (3.02) in comparison to solution A (2.07).
Which of the following is an aldehyde?
Answer:
D
Explanation:
I wish it will help you thank you
An aldehyde is a functional group that has the general formula CₓH₂ₓ₊₁CHO. The compound in option C is an aldehyde. Thus, option C is correct.
What is an aldehyde?An aldehyde is a type of functional group that has a carbon atom that shares a double bond with an oxygen atom and another single bond with the R group and H group (R−CH=O).
The aldehyde functional group gives a specific chemical property to the species. The first compound is CH₃CH₂CH₂COOH is a carboxylic acid functional group. The second compound is CH₃CH₂CH₂COOCH₃ is an ester.
The third compound is CH₃CH₂CH₂CHO an aldehyde group as (R−CH=O) functional group is present. The fourth compound is CH₃CH₂CH₂COCH₃, ketone.
Therefore, option C is an aldehyde.
Learn more about aldehyde here:
https://brainly.com/question/17101347
#SPJ2
balance this equation
Si Cl4 + H2O → Si (OH4) + HCl
Please give a detailed explanation
Answer:
4HCl + SiO2 → 4H2O + SiCl4
axit clohidric Silic dioxit nước Silic tetraclorua
Axit
Explanation:
Answer:
SiCl4 + 4H2O--->Si(OH4)+4HCl
Explanation:
if you put a 4 in front of H2O it means you will have 8 hydrogens(you multiply 4 by 2) then the oxygens will be 4..on the other side that hydrogen in the brackets holds it's on 4 so that 4 isn't for both the hydrogen and the oxygen...and if you put a 4 in front of the HCl that simply means it's for both the hydrogen and oxygen.
I hope this helps
A student is worried about determining if a chemical is radioactive. Which
section of the SDS would the student refer to?
Product Information
Fire Fighting Methods
Physical and Chemical Properties
Hazards Identification
Answer:
Hazards Identification
Explanation:
A safety data sheet, SDS, is an informational document provided by the manufacturer or importer of a hazardous chemical detailing the chemical, physical, health, and environmental health hazards associated with the chemical as well as safety precautions in handling the chemical.
Some of the sections in the SDS include:
Product Information: It identifies the chemical as well as its recommended uses. The contact information of the manufacturer is also provided.
Fire fighting methods: It gives measures and guidelines necessary for fighting a fire caused by the chemical.
Physical and chemical properties: states the physical and chemical properties of the chemical substance such as: appearance, odor, pH, melting/freezing point, boiling point and boiling range, flammability, etc.
Hazards identification: states the hazards of the chemical and the necessary warnings regarding the hazards. Some of the information provided include: hazard classification of the chemical (for example flammable liquid, oxidizing gases,explosives, etc), signal word, hazard statement (for example radioactive), pictograms, precautionary statements, etc.
From the above information provided, the student should refer to the hazards identification section.
Chemistry is often called the __________ science because it involves the study of the materials in the universe and the changes these materials undergo
Answer:
Central
Explanation:
Chemistry is often called the central science because of connects the physical sciences, life sciences and applied sciences.
Chemistry is the study of matter and changes undergone by matter. This makes chemistry to occupy a central place in many scientific disciplines including medicine, engineering, pharmacy, geology etc. Basic knowledge of chemistry is usually required by experts in these disciplines.
Determine the grams of sodium chloride produced when 10 g of sodium react with 10 grams chlorine gas according to the equation 2Na + Cl2 = 2 NaCl
Answer:
16 g
Explanation:
Step 1: Write the balanced equation
2 Na + Cl₂ ⇒ 2 NaCl
Step 2: Identify the limiting reactant
The theoretical mass ratio (TMR) of Na to Cl₂ is 46:71 = 0.65:1.
The experimental mass ratio (EMR) of Na to Cl₂ is 10:10 = 1:1.
Since EMR > TMR, Cl₂ is the limiting reactant
Step 3: Calculate the mass of NaCl produced
The theoretical mass ratio of Cl₂ to NaCl is 71:117.
10 g Cl₂ × 117 g NaCl/71 g Cl₂ = 16 g NaCl
what is the light transmission of gallium?
Explanation:
the intensity of a He-Ne laser (633 nm ,5 mW) transmitted by different Gase samples is observed to change in correlation with the Nd-yttrium-aluminium-garnet laser pulse (532 nm, 7.8ns ,3mJ) which excites them
4. (01.05 MC)
Rubbing alcohol evaporates from your arm quickly, leaving a cooling effect on your skin. How do the molecules of gas compare to the molecules as a liquid? (4 points)
The gas particles move faster, have the same molecular composition, and have weaker attractions between them than the liquid particles
The gas particles move faster than the liquid particles, and the bonds of the molecules are broken during evaporation to allow gas atoms to spread apart.
The gas particles move slower but have the same molecular structure and the same attraction between them as the liquid particles.
The gas and liquid particles move at the same speed, but the bonds of the molecules are broken during evaporation to allow the gas atoms to spread apart
Answer:
The correct option is;
The gas particles move faster, have the same molecular composition, and have weaker attractions between them than the liquid particles
Explanation:
The properties of the gas molecules in comparison to liquids are
1) The gas molecules are widely spread out
2) After evaporation and while in conditions favorable to the gaseous state, the kinetic energy of a gas is larger than the inter molecular attractive forces
3) A gas fills the container in which it is placed
For liquids
1) There are strong intermolecular forces holding the molecules together in a liquid
2) Liquid attractive forces in a liquid are strong enough to hold neighboring molecules
3) The volume of a liquid is definite.
The table describes how some substances were formed.
Substance
P.
Q
Description
Formed by boiling pure water
Formed by combining three hydrogen atoms to every nitrogen atom
Formed by adding 5 g of sugar to 1 L of water
Formed by compressing carbon under high pressure
R
S
Based on the given descriptions, which substance is most likely a mixture?
P
Q
R
S
Explanation:
Which is a pure substance?
1. soda
2. gasoline
3. salt water
4. carbon dioxide
carbon dioxide
Bromine, a liquid at room temperature, has a boiling point of 58°C and a melting point of -7.2°C. Bromine can be classified as a
1. compound.
2. impure substance.
3. mixture.
4. pure substance.
pure substance.
Answer:
the answer is
Explanation:
Sugar and water make a homogeneous mixture (the same proportions of its components throughout any given sample).
which property is a physical property
Answer:
a
Explanation:
because it is matter . It has change in molèculaŕ level
3. How did ethanol use affect the shortage of corn available to consumers during and
after the drought of 2012? Do you think that commodities in one sector should be used
in another economic sector? How might the concept of needs and wants affect your
analysis of this issue?
Due to drought, the production of corn decreases and shortage of it occurs.
Effects of droughtYes, commodities in one sector should be used in another sector because scientist invented methods in which one commodity is used in several sectors for the production of new products.
Corn was used for the production of ethanol which causes the shortage of corn that was available to consumers during and after the drought condition of 2012 so we can conclude that due to drought, the production of corn decreases and shortage of it occurs.
Learn more about drought here: https://brainly.com/question/12686086
Learn more: https://brainly.com/question/17177683
why there are two chloride ions for every calcium ion
Answer:
The valency of calcium is +2
Explanation:
Calcium is in group two. The members of group two are divalent metals that loose two electrons to form M^2+.
Since they form M^2+, they form ionic bonds with two uninegative ions. Chlorine is in group 17. This implies that its valency is -1 and it accepts one electron when it participates in an ionic bond.
Hence it will take two chlorine atoms to receive two electrons from one calcium atom in an ionic bond making the ratio of calcium to chlorine in the compound 2:1.
What is the product of the reaction of pentanoic acid with ethanol in the presence of a strong acid?
Answer:
ethylpentanoate
Explanation:
Alkanoic acids react with alkanols in the presence of mineral acids to yield an ester and water. This is the organic analogue of the inorganic neutralization reaction. The reaction his commonly called esterification. It is an acid catalysed reaction.
The reaction of pentanoic acid and ethanol in the presence of a string acid is shown below;
CH3CH2CH2CH2COOH(aq) + CH3CH2OH(aq) ----> CH3CH2CH2CH2COOCH2CH3(aq) + H2O(l)
The name of the compound formed is ethylpentanoate.
in h-atom if x is radius of first bohrs orbit de broglie wavelength of an atom in 3rd orbit is a.3πx b.6πx c.9x/2 d.x/2
please I need complete explanation fast
Answer:
can you type question properly.
calculate the volume of hydrogen produced at s.t.p when 25g and zinc are added to excess dilute hydrochloric acid at 31 degrees and 778 mm Hg pressure ( H= 1 , Zn = 65 , cl = 35.5 , volume of gas at stop = 22.4 dm cube
Answer:
The volume of hydrogen gas produced at s.t.p. is 9.419 dm³
Explanation:
The balanced chemical equation for the reaction is given as follows;
Zn + 2HCl → ZnCl₂ + H₂
Therefore, we have;
One mole of Zn reacts with 2 moles of HCl to produce one mole of ZnCl₂ and one mole of H₂
Number of moles of Zn present = 25/65 = 5/13 = 0.385 moles
Therefore, number of moles of H₂ produced = 0.385 moles
The volume of hydrogen gas produced is given by the relation
PV = nRT, we have;
R = 8.3145 J/(mol·K)
V = nRT/P = 0.385 ×8.3145 ×298.15/(101325)= 0.009419 m³ = 9.419 dm³
The volume of hydrogen gas produced at s.t.p. = 9.419 dm³.
In an electrochemical cell, equilibrium is the point at which:
A. None of these
B. both electrodes have an equal number of electrons.
C. ion concentrations are no longer changing and the voltage is 0.
D. Equilibrium cannot be reached in a voltaic cell because electrons only flow in one direction.
Answer:
C. ion concentrations are no longer changing and the voltage is 0.
Explanation:
Electrochemical cells are a device that generates current from redox reactions. In the cell, the equilibrium is reached when the voltage drops to 0. Thus, option C is correct.
What is an electrochemical cell?An electrochemical cell is a voltaic device that uses chemical energy to generate electrical energy and vice versa. It is of two types electrolytic and galvanic cells depending on the energy it produces.
The electrochemical cell comprises two electrodes namely an anode and cathode, a salt bridge or the porous barrier, and an external connection.
The connection shows the voltage that indicates the equilibrium. When the current flow stops and the voltage reaches zero, the electrochemical cell is said to be in equilibrium.
Therefore, no change in the ionic concentrations and zero voltage indicates equilibrium.
Learn more about electrochemical cells here:
https://brainly.com/question/16790905
#SPJ5
. Fire can be extinguished by: - a. Lowering temperature below ignition temperature b. Cutting the supply of oxygen c. Removing non-combustible substances from surroundings d. Both a & b
Answer:
B. Cutting the supplies of oxygen
PLS HELP ASAP 15 POINTS TYSM which of the following is a consequence of urban heat islands? a) increased precipitation downwind of the city b) increased winds within the city c) increased precipitation upwind of the city d) decreased winds within the city
Answer:
Hey!
Your answer is definitely A!
Explanation:
Hope this helps!
:>
In an ecosystem, the following is a consequence of urban heat islands which is increased precipitation downwind of the city.
What is an ecosystem?Ecosystem is defined as a system which consists of all living organisms and the physical components with which the living beings interact. The abiotic and biotic components are linked to each other through nutrient cycles and flow of energy.
Energy enters the system through the process of photosynthesis .Animals play an important role in transfer of energy as they feed on each other.As a result of this transfer of matter and energy takes place through the system .Living organisms also influence the quantity of biomass present.By decomposition of dead plants and animals by microbes nutrients are released back in to the soil.
Learn more about ecosystem,here:
https://brainly.com/question/1673533
#SPJ2
What evidence demonstrates that chlorine in the stratosphere is primarily from man-made chemicals rather than from natural sources such as volcanoes?
Answer:
The evidence that demonstrated that the Chlorine in the stratosphere is believed to come primarily from CFCs ( Chlorofluorocarbons) rather than from natural sources such as volcanoes was due to the study conducted in which the amount of chlorine in the stratosphere over the past 20 years was measured and it was discovered that there was an increase over the years. This also corresponded with a rise in CFCs over the same period which shows that the chlorine in the stratosphere was from man made chemicals such as chlorofluorocarbons.
Chlorine in the stratosphere is primarily from man-made chemicals rather than from natural sources such as volcanoes is evident as follows;
Discussion;
Most of the chlorine in the stratosphere is there as a result of human activities, as the figure below illustrates.
Many compounds containing chlorine are released at the ground.
Volcanoes can emit large quantities of hydrogen chloride, but this gas is rapidly converted to hydrochloric acid, which dissolves in rain water, ice, and snow and does not reach the stratosphere.
Read more:
https://brainly.com/question/22776037
What type of reaction is shown below:
Ethanoic acid + propanol -> propyl ethanoate + water
A. Polymerization
B. Addition (water)
C. Elimination
D. Esterification
Answer:
c
Explanation:
because mix with propanol
A sample of gas has a volume of 20 cm³.The pressure is changed to 90 kPa at constant temperature,while the volume increases to 75 cm³.What was the original pressure of the gas?
Answer:
337.5kPa ~ 338kPa
Explanation:
Using the ideal gas law PV=nRT we have the following definitions from the problem:
V(initial) = 20cm³
P(initial) = ?kPa
V(final) = 75cm³
P(final) = 90kPa
Since we know that the number of moles of the sample did not change, nor did the temperature, nor does the ideal gas constant (R) we can rewrite this equation to state:
P(initial)V(initial) = nRT =P(final)V(final) ~ P(initial)V(initial) = P(final)V(final)
Rearranging this equation as we are solving for the initial pressure we find that:
P(initial) = (P(final)V(final))/V(initial)
P(initial) = ((90kPa)(75cm³))/20cm³
P(initial) = 337.5kPa ~ 338kPA
Es la representación escrita de un cambio químico, se construye con simbología, la cual fue establecida para una mejor interpretación universal de las reacciones.
Ribbon diagrams shows secondary structures and appear less detailed than other model types. In one to two sentences, give a reason the chemists would use ribbon diagrams. What type of information do they provide?
Answer:
They show helixes and proteins
Explanation:
Ribbon diagrams are the Richardson diagrams that represent the protein structures. Chemist prefers using Ribbon diagrams to show the various structure of the proteins.
What are ribbon diagrams?The Ribbon diagram is used to represent the structural organization of the protein in the polypeptide chains or individually. It shows the three-dimensional structure and organization of the protein framework.
The ribbon diagram for the secondary structure of the protein shows the intramolecular and intermolecular structure along with helixes and bonding. It shows the detailed structure of the protein organization including the helix and sheets.
Therefore, the ribbon diagram is used by chemists to determine the structure of the protein as they give the details about the helix and sheet.
Learn more about ribbon diagrams, here:
https://brainly.com/question/2794632
#SPJ2
describe an activity to separate the mixture of sand and water
Answer:
Sedimentation and decantation
Explanation:
Sedimentation and decantation: Mixture is kept undisturbed for some time. After some time, sand being heavier and insoluble in water, settles down at the bottom of container. Now, water is poured into another container to separate it from sand.
Answer:
evaporation or destillation
Explanation:
When sand is added to water it either hangs in the water or forms a layer at the bottom of the container. Sand therefore does not dissolve in water and is insoluble. It is easy to separate sand and water by filtering the mixture. Salt can be separated from a solution through evaporation.
differences between properties of convalent and ionic bond.
Ionic bonds will be a metal + a nonmetal, and electrons
are transferred from the metal to the nonmetal.
A covalent bond will be a nonmetal only. Nonmetals will not give up their electrons so electrons are shared.
I have also written this on the whiteboard in the image provided.
Can someone plz help me :<
Answer: cats r alliens because they r kind of like ufos they would usually wonder around rather u know it or not when they spy on us it could b with us sleep cooking anything so they r like aliens
Explanation:
Answer in the correct significant figures: 35.6 + 56.27 *
Answer:
101.87
Explanation:
that's the answer
PLEASE HELP!! What direction do you predict the addition of a base to the solution containing bromophenol blue will drive the equilibrium? Explain your prediction in terms of Le Châtelier's principle.
Answer:
Below is the clarification of that same particular question.
Explanation:
Le Chatlier's theory states that whenever an equilibrium mechanism is disrupted by environmental influences, the program responds by changing the supplies information of its constituents in a somewhat way that the disturbance is invalidated and reaches a stable equilibrium during that disrupted stage, with concentrations of stability differently than ever before.Bromothymol blue seems to be a phenolic subs lone which always allows it to act throughout aqueous solutions as an acidic solution. Being such an acid (weak), it should not add to rapid, as well as introduces a balance with its accompanying but mostly disconnected form.For that kind of weak diprotic predictor, the standard economic statement can indeed be published as:
⇒ [tex]H_2In_(aq)\rightleftharpoons In^{2-} +2H^+[/tex]
It could be conclusively proven from either the theory of Le Charlier whereby, that whenever a strong acid becomes applied, the full disorientation of one or the other, through equilibrium formation, induces an increase throughout the medium's proton concentrations.Likewise, it absorbs the protons throughout the media to split water that whenever a solution is added. So, particle concentration throughout the medium is decreasing. To accommodate for this transition, the equilibrium reacts by moving to the correct i.e. causing further dissociation of the optimistic predictor into their dianion through protons, thereby attempting to nullify that perturbation.