what is Collatz conjecture?
Is Collatz conjecture always true?
What so special about 3x+1 ? ​

Answers

Answer 1

Answer:

Step-by-step explanation:

The Collatz Conjecture is one of the most intreging of all the possible simple statements in mathematics.

Simply put it says

if a number is even, divide by 2If a number is odd, multiply by 3 and add1. or 3x + 1The result will always wind up in a loop. Neat huh!!! Where you wind up going over the same numbers over and over. You can't escape the loop.

Try 5

It's odd so triple it and add 1. You get 1616 is even. Divide by 2. You get 88 is even. Divide by 2. You get 44 is even. Divide by 2. You get 22 is even. Divide by 2. You get 11 is odd. Triple it and add 1. You get 4. You can see you wind up doing 4 2 1 forever. The Collatz conjecture has not been proved, but every number up to 2^68 has been shown to go to this loop eventually.

Try another one -- 15. On the 16th move it goes from 4 to 2 to 1 and then keeps on repeating those 3 digits.

Take 15It's odd. Triple it and add 1. That gives 46.46 is even. Divide by 223 which is odd. Triple it and add 1  = 7070 is even. Divide by 2. 3535 is odd. Triple and add 1.  106  which is even53 which is odd.  Triple it and add 1. You get 160160 is even. Divide by 2. You get 8080 is even Divide by 2. You get 4040 is even. Divide by 2. You get 2020 is even. Divide by 2. You get 1010 is even. Divide by 2. You get 55 is odd. Triple it and add 1. You get 1616 is even. Divide by 2. You get 88 is even. Divide by 2. You get 44 is even. Divide by 2.. You get 2.2 is even. Divide by 2. You get 11 is odd and you are in the loop because you get 4 which you have already done.


Related Questions

A box is 1 m high, 2.5 m long, and 1.5 m wide, what is its volume?

Answers

Answer:

3.75

Step-by-step explanation:

[tex]v = lbh \\ 2.5 \times 1.5 \times 1 \\ = 3.75[/tex]

The volume of the rectangular prism will be 3.75 cubic meters.

What is the volume of the rectangular prism?

Let the prism with a length of L, a width of W, and a height of H. Then the volume of the prism is given as

V = L x W x H

A box is 1 m high, 2.5 m long, and 1.5 m wide.

Then the volume of the rectangular prism will be

V = L x W x H

V = 1 x 2.5 x 1.5

V = 3.75 cubic meters

Thus, the volume of the rectangular prism will be 3.75 cubic meters.

More about the volume of the rectangular prism link is given below.

https://brainly.com/question/21334693

#SPJ2

In Littletown, the probability that a baseball team goes to the city playoffs is 0.30. the probability that the team goes to the state playoffs given that the team goes to the city playoffs is 0.20.

Answers

THIS IS THE COMPLETE QUESTION BELOW;

In Littletown, the probability that a baseball team goes to the city playoffs is 0.30. the probability that the team goes to the state playoffs given that the team goes to the city playoffs is 0.20.

What is the probability that a randomly selected team from Littletown goes to the city and state playoffs?

A. 0.10

B.0.50

C. 0.66

D. 0.06

Answer:

OPTION D is correct

d)0.06

the probability that a randomly selected team from Littletown goes to the city and state playoffs is [tex]0.06[/tex]

Step-by-step explanation:

The probability that a baseball team goes to city playoffs is 0.30.

P(baseball team goes to city playoffs)=0.30

The probability that the team goes to state playoffs given that the team goes to the city playoffs is 0.20.

P(team goes to state playoffs given that the team goes to the city playoffs)=0.20

From our knowledge of set, we know that

P(A | B)= P(A ∩ C)/P(C)

where A= city playoffs

B= state playoffs

P(State play off | city play off)=0.20

P(State play off ∩ city play off)/P(city play off,)=0.20

P(State play off ∩ city play off)/0.30 =0.20

P(State play off ∩ city play off)= 0.30 × 0.20

= 0.06

Hence,the probability that a randomly selected team from Littletown goes to the city and state playoffs is 0.06

Cesium-137 has a half-life of about 30 years. A) Find the annual decay rate and round final result to 4 decimal places. B) Find the continuous decay rate and round final result to 4 decimal places. C) How long will it take for a 10 gram sample to decay to 1 gram? Round to nearest year and interpret your result with a complete sentence. D) Complete this statement: as x goes to infinity, y goes to ___.

Answers

Answer:

0.02280.0231100 years0

Step-by-step explanation:

The exponential equation for the fraction remaining after x years can be written as ...

  y = (1/2)^(x/30)

A) For x=1, the fraction remaining is ...

  y = (1/2)^(1/30) ≈ 0.97716 = 1 - 0.0228

Of the original amount, 0.0228 decays each year.

__

B) The continuous decay rate is the natural log of the growth factor, so is ...

  ln(0.97716) = -0.0231

The continuous decay rate is 0.0231 of the present amount (per year).

__

C) For y=.10 (1/10 of the original amount) we find x to be ...

  .1 = .5^(x/30)

  ln(.1) = (x/30)ln(.5) . . . . . take the natural log

  30ln(0.1)/ln(0.5) = x ≈ 100 . . . years

It will take 100 years for a 10-gram sample to decay to 1 gram.

__

D) As x goes to infinity, y goes to zero.

_____

The relationship between growth rate and growth factor is ...

  growth factor = 1 + growth rate

When the growth rate is negative, it is called a decay rate.

PLEASE HELP

Solve the equation for y. Identify the slope and y-intercept then graph the equation.

Y=-3x+1

Y=
M=
B=

Please Include a picture of the graph and show your work if you can

Answers

The equation is already solved for y

It's in y = mx+b form where

m = -3 = slope

b = 1 = y intercept

The graph is shown below. It's a straight line through the two points (0,1) and (1,-2).

Note that (0,1) is the y intercept. We use the slope = -3 = -3/1 to move 3 units down and 1 unit to the right to arrive at (1,-2).

What did this person do wrong? Honestly really stuck and do not remember geometry!

Answers

Answer:

See below.

Step-by-step explanation:

Using the right triangle altitude theorem, the correct proportions are:

[tex] \dfrac{AB}{AC} = \dfrac{AC}{AD} [/tex]

[tex] \dfrac{AB}{x} = \dfrac{x}{AD} [/tex]

[tex] \dfrac{25}{x} = \dfrac{x}{16} [/tex]

[tex] x^2 = 25 \times 16 [/tex]

[tex] x = 20 [/tex]

AC = 20 cm

[tex] \dfrac{AB}{CB} = \dfrac{CB}{DB} [/tex]

[tex] \dfrac{AB}{y} = \dfrac{y}{DB} [/tex]

[tex] \dfrac{25}{y} = \dfrac{y}{9} [/tex]

[tex]y^2 = 25 \times 9[/tex]

[tex]y = 15[/tex]

CB = 15 cm

what is the graph of −36≤2x+4(x−3)

Answers

The answer is x ≥ -4


[tex]4x - 2x = [/tex]

Answers

Answer:

2x

Step-by-step explanation:

These are like terms so we can combine them

4x-2x

2x

Answer:

2x

Explanation:

Since both terms in this equation are common, we can simply subtract them.

4x - 2x = ?

4x - 2x = 2x

Therefore, the correct answer should be 2x.

Find the 14th term in the sequence 1, 1/3, 1/9, … Find the sum of the first 10 terms of the sequence above.

Answers

Answer:

This is a geometric progresion that begins with 1 and each term is 1/3 the preceeding term

   Let Pn represent the nth term in the sequence

 

   Then Pn = (1/3)^n-1

 

   From this P14 = (1/3)^13 = 1/1594323

 

5. The sum of the first n terms of a GP beginning a with ratio r is given by

   Sn = a* (r^n+1 - 1)/(r - 1)

 

   With n = 10, a = 1 and r = 1/3, S10 = ((1/3)^11 - 1)/(1/3 - 1) = 1.500

A.Yes, since the slopes are the same and the y-intercepts are the same.
B.No, since the y-intercepts are different.
C.Yes, since the slopes are the same and the y-intercepts are different.
D.No, since the slopes are different.

Answers

Answer:

C

Step-by-step explanation:

one line is

y = 3x/7 + 11

its slope is 3/7

the y-intercept is, of course, when x=0. there y=11

the other is

-3x + 7y = 13

7y = 3x + 13

y = 3x/7 + 13/7

its slope is 3/7 (the same as the other line)

the y-intercept (x=0) is y = 13/7 (different to the other line)

Answer:

C. Yes, since the slopes are the same and the y-intercepts are different.

Step-by-step explanation:

[tex]y=\frac{3}{7} x+11[/tex]  and [tex]-3x+7y=13[/tex]

→ Rearrange the second equation to make y the subject

7y = 3x + 13

→ Divide everything by 7

[tex]y=\frac{3}{7} x+\frac{13}{7}[/tex]

Molly’s house is located at point X. Molly wants Sophia and Cole to meet at her house because she thinks it is the same distance from Sophia’s house and Cole’s house. Which could prove that Molly’s house is the samedistance from Sophia’s and Cole’s houses?

Answers

Answer:

Cole's House

Step-by-step explanation:

Cole house is closer because molly and Sophia can go there together because there both girls

Can someone help with this please

Answers

Answer:

x2  1-

Step-by-step explanation:

Answer:

x ≥ 0

Step-by-step explanation:

Domain of a function is the x values of a function

The graph extends from 0 to positive infinity.

Since the point at x=0 is closed, the graph includes 0

please solve quick ​

Answers

Answer:

x = 5

AC = 6

DC = 8

Step-by-step explanation:

∆ABC ~ ∆CDE

Therefore, [tex] \frac{AB}{ED} = \frac{AC}{DC} [/tex]

AB = 3

ED = 4

AC = x + 1

DC = x + 3

Plug in the values and solve for x:

[tex] \frac{3}{4} = \frac{x + 1}{x + 3} [/tex]

Cross multiply

[tex] 3(x + 3) = 4(x + 1) [/tex]

[tex] 3x + 9 = 4x + 4 [/tex]

[tex] 3x - 4x = -9 + 4 [/tex]

[tex] -x = -5 [/tex]

[tex] x = 5 [/tex]

Plug in the value of x and find AC and DC

AC = x + 1 = 5 + 1 = 6

DC = x + 3 = 5 + 3 = 8

I need help with this balance mobile please:)​

Answers

Answer:

blue 1

orange 5

green 3

I hope it is helpful and mark me as brainlest and follow me plz

F(x)=x^2 what is g(x)

Answers

Answer:

stop spamming

Step-by-step explanation:

will rate you brainliest

Answers

Answer:

[tex] \frac{11x}{3y} [/tex]

Step-by-step explanation:

[tex] \frac{7x}{3y} + \frac{12x}{9y} [/tex]

Make both a single fraction by adding together.

[tex] \frac{3(7x) + 1(12x)}{9y} [/tex]

[tex] \frac{21x + 12x}{9y} [/tex]

[tex] \frac{33x}{9y} [/tex]

Simplify

[tex] \frac{3(11)x}{3(3y)} [/tex]

[tex] \frac{11x}{3y} [/tex]

find the derivative of e power ax divide by log bx​

Answers

Answer:

Step-by-step explanation:

The first step in a mathematical induction proof is to divide by n. (True or False).

Answers

Answer:

Step-by-step explanation:

Hello, this is false.

The first step of a mathematical induction proof is to prove the statement for the initial value, which is most of the time for n = 0 or n = 1.

Hope this helps.

Do not hesitate if you need further explanation.

Thank you

7. 20x + 10 = 110
a. X= 1
b. X= 5
c. x= 12

Answers

Answer:

b x=5

Step-by-step explanation:

20x+10=110

20x+10-10=110-10

20x/20=100/20

x=5

Answer:

x=5

Step-by-step explanation:

20x + 10 = 110

Subtract 10 from each side

20x +10-10 = 110-10

20x = 100

divide by 20

20x/20 =100/20

x= 5

Which of the following equations has the same solution as 5 x + 8 = x − 9?
A) 4 x = −1
B) 4 x = 17
C) 6 x = −17
D) 6 x = 17
E) 4 x = −17

Please give me a explanation! Willing to give a Brainliest.

Answers

So, let’s start with solving the first equation. Merge x’s, 4x+8=-9, then subtract the 8 for 4x=-17. Now, with that short and simple equation solving process, we’ve already solved the question to get an answer of E! Comment if you have any further questions.

[tex]4x=-17[/tex] has the same solution as  [tex]5x+8=x-9[/tex]

Option (E) is correct

What is Equation?

"An equation is a formula that expresses the equality of two expressions, by connecting them with the equals sign =."

We have,

[tex]5x+8=x-9[/tex]

By solving the given equation

⇒[tex]5x-x=-9-8[/tex]

⇒[tex]4x=-17[/tex]

Clearly, Option (E) is correct

⇒[tex]x=\frac{-17}{4}[/tex]

Explanation for other options:

(A) [tex]4x=-1[/tex]

⇒[tex]x=\frac{-1}{4}[/tex]

(B) [tex]4x=17[/tex]

⇒[tex]x=\frac{17}{4}[/tex]

(C) [tex]6x=-17[/tex]

⇒[tex]x=\frac{-17}{6}[/tex]

(D) [tex]6x=17[/tex]

⇒[tex]x=\frac{17}{6}[/tex]

∴ [tex]4x=-17[/tex] has the same solution as [tex]5x+8=x-9[/tex]

Learn more about equation here

https://brainly.com/question/19549156

#SPJ2

Musah stands at the centre of a rectangular field. He first takes 50 steps north, then 25 steps
west and finally 50 steps on a bearing of 3150
.
i. Sketch Musah’s movement [Mark 4]
ii. How far west is Musah’s final point from the centre?

Answers

Answer:

Inokkohgy8uokokj76899

Which property is not used to simplify the following expression 2* (x+5)+7x=(2x+10)+7x

Answers

Distributive property

Hence, the commutative property of addition is not used.

What is an expression?

A mathematical expression is in form of variables and constants separated by their arithmetic operation.

As we know that, there are three types of properties they are associative property which is [tex](a+b) + c = a + (b+c)[/tex],

Distributive property which is [tex]a(b+c) = ab + ac[/tex],

Commutative property which is [tex]a + b = b + a[/tex].

Here given that,

[tex]2 (x+5)+7x=(2x+10)+7x[/tex]      

[tex](2x+10)+7x=(2x+10)+7x[/tex]         ( distributive property of multiplication)

[tex](2x+7x)+10=(2x+7x)+10[/tex]        ( it is associative property of addition)

[tex](8x)+10=(8x)+10[/tex]        ( it is a commutative property)

Hence, the commutative property of addition is not used.

To know more about the distributive property

https://brainly.com/question/24242989

#SPJ5

What is the solution of the linear equation? LaTeX: 5k\:+\:3.8\:=\:3k\:+\:95 k + 3.8 = 3 k + 9 Group of answer choices 26 6.4 .065 2.6

Answers

Answer:

[tex]k = 2.6[/tex]

Step-by-step explanation:

Given

[tex]5k + 3.8 = 3k + 9[/tex]

Required

Solve

[tex]5k + 3.8 = 3k + 9[/tex]

Collect like terms

[tex]5k -3k+ 3.8 = 3k -3k + 9[/tex]

[tex]2k+ 3.8 = 9[/tex]

Subtract 3.8 from both sides

[tex]2k+ 3.8 - 3.8= 9 - 3.8[/tex]

[tex]2k= 9 - 3.8[/tex]

[tex]2k = 5.2[/tex]

Divide through by 2

[tex]k = 5.2/2[/tex]

[tex]k = 2.6[/tex]

Factorize the following:
cosB + 5cosB - 6​

Answers

[tex]\\ \rm\Rrightarrow cosB+5cosB-6[/tex]

Add cos

[tex]\\ \rm\Rrightarrow (1+5)cosB-6[/tex]

[tex]\\ \rm\Rrightarrow 6cosB-6[/tex]

Take 6 common

[tex]\\ \rm\Rrightarrow 6(cosB-1)[/tex]

Answer:

6(cosB - 1)

BRAINLIEST, PLEASE!

Step-by-step explanation:

cosB + 5cosB - 6

6cosB - 6

6(cosB - 1)

An experimental probability is ______ likely to approach the theoretical probability if the number of trials simulated is larger. A. as B. more C. less D. not

Answers

Answer:

B. More

Step-by-step explanation:

This is according to the law of large numbers

An experimental probability is more likely to approach the theoretical probability if the number of trials simulated is larger.

What is an experimental probability and theoretical probability?

Experimental probability is an experimental outcome whereas theoretical probability is a possible or expected outcome.

An experimental probability is more likely to approach the theoretical probability if the number of trials increased because of the law of large numbers which states that the average of the results obtained from a large number of trials should be close to the expected value and tends to become closer to the expected value as more trials are performed

Thus using the concept of the law of large numbers we can say that an experimental probability is more likely to approach the theoretical probability.

Learn more about probability here:

https://brainly.com/question/9627169

#SPJ5

Find the greatest number than divides 45, 60 and 75 without leaving remainder​

Answers

Answer:

15

Step-by-step explanation:

15×3=45

15×4=60

15×5=75

Answer:

15

Step-by-step explanation:

45 = 1 × 3^2 × 5

60 =  2^2 × 3 × 5

75 = 3 × 5^2

greatest number than divides 45, 60 and 75 without leaving remainder​ = GCF of 45,60,75 = 3 × 5 = 15

Find an equation of the tangent to the curve at the given point by both eliminating the parameter and without eliminating the parameter. x = 5 + ln(t), y = t2 + 2, (5, 3)

Answers

Answer:

Step-by-step explanation:

Given that:

[tex]x = 5 + In (t)[/tex]

[tex]y = t^2+2[/tex]

At point (5,3)

To find an equation of the tangent to the curve at the given point,

By without eliminating the parameter

[tex]\dfrac{dx}{dt}= \dfrac{1}{t}[/tex]

[tex]\dfrac{dy}{dt}= 2t[/tex]

[tex]\dfrac{dy}{dx}= \dfrac{ \dfrac{dy}{dt} }{\dfrac{dx}{dt} }[/tex]

[tex]\dfrac{dy}{dx}= \dfrac{ 2t }{\dfrac{1}{t} }[/tex]

[tex]\dfrac{dy}{dx}= 2t^2[/tex]

[tex]\dfrac{dy}{dx}_{ (5,3)}= 2t^2_{ (5,3)}[/tex]

t²  + 5 = 4

t² = 4 - 5

t² = - 1

Then;

[tex]\dfrac{dy}{dx}_{ (5,3)}= -2[/tex]

The equation of the tangent  is:

[tex]y -y_1 = m(x-x_1)[/tex]

[tex](y-3 )= -2(x - 5)[/tex]

y - 3 = -2x +10

y = -2x + 7

y = 2x - 7

By eliminating the parameter

x = 5 + In(t)

In(t)  = 5 - x

[tex]t =e^{x-5}[/tex]

[tex]y = (e^{x-5})^2+5[/tex][tex]y = (e^{2x-10})+5[/tex]

[tex]\dfrac{dy}{dx} = 2e^{2x-10}[/tex]

[tex]\dfrac{dy}{dx}_{(5,3)} = 2e^{10-10}[/tex]

[tex]\dfrac{dy}{dx}_{(5,3)} = 2[/tex]

The equation of the tangent  is:

[tex]y -y_1 = m(x-x_1)[/tex]

[tex](y-3 )= -2(x - 5)[/tex]

y - 3 = -2x +10

y = -2x + 7

y = 2x - 7

A polling company reported that 53​% of 1018 surveyed adults said that secondhand smoke issecondhand smoke is "very harmful.""very harmful." Complete parts​ (a) through​ (d) below.
a. What is the exact value that is 53​% of 1018​?
b. Could the result from part​ (a) be the actual number of adults who said that secondhand smoke issecondhand smoke is "very harmful" question mark "very harmful"? Why or why​ not?
c. What could be the actual number of adults who said that secondhand smoke issecondhand smoke is "very harmful" question mark "very harmful"?
d. Among the 10181018 ​respondents, 260260 said that secondhand smoke issecondhand smoke is "not at all harmful.""not at all harmful." What percentage of respondents said that secondhand smoke issecondhand smoke is "not at all harmful" question mark "not at all harmful"?

Answers

Answer:

a. 539.54

b. No, the result from part (a) could not be the actual number of adult who said that secondhand smoke are very harmful because a count of people must result into a whole number.

c. 540

d. 25.54%

Step-by-step explanation:

Given that:

A polling company reported that 53​% of 1018 surveyed adults said that secondhand smoke is "very harmful."

Complete parts​ (a) through​ (d) below.

a. What is the exact value that is 53​% of 1018​?

The 53% of 1018 is :

=[tex]\dfrac{53}{100} \times 1018[/tex]

= 0.53 × 1018

= 539.54

b. Could the result from part​ (a) be the actual number of adults who said that secondhand smoke is ''very harmful"? Why or why​ not?

No, the result from part (a) could not be the actual number of adult who said that secondhand smoke are very harmful because a count of people must result into a whole number.

c. What could be the actual number of adults who said that secondhand smoke is secondhand smoke "very harmful"?

Since, a count of people must result into a whole number, the actual number of adults who said that secondhand smoke is secondhand smoke "very harmful" can be determined from the approximation of the exact value into whole number which is 539.54 [tex]\approx[/tex] 540.

d. Among the 1018 ​respondents, 260 said that secondhand smoke is  is "not at all harmful.''  What percentage of respondents said that secondhand smoke is  "not at all harmful"?

Since 260 respondents out of 1018 respondents said that the second hand smoke is not harmful, then the percentage of the 260 respondents is :

= [tex]\dfrac{260}{1018} \times 100 \%[/tex]

= 25.54%

0.3,1/5,1/2,0.706,7/8,57.1%
Place following in ascending order

Answers

Answer:

the answer is 0.31/ 5.1/8.57.1% /207067

Step-by-step explanation:

ascending order from the smallest to the largest

Greg is 10 years older than his brother gabe. He is also 3 times as old as gabe. How old is Greg?

Answers

Answer: 30 i think 10x3=30

Step-by-step explanation:

In order to study the mean blood pressure of people in his town, Richard samples the population by dividing the residents by age and randomly selecting a proportionate number of residents from each age group. Which type of sampling is used?
a. Convenience sampling
b. Cluster sampling
c. Stratified sampling
d. Systematic sampling

Answers

Answer:

C Stratified sampling

Step-by-step explanation:

Stratified sampling : Stratified sampling is a type of sampling technique in which the total population is divided into smaller groups or strata to complete the sampling process. The strata is formed based on some common characteristics in the data of the population.

One of the advantage of stratified random sampling is that it covers important population characteristics in the sample.

Other Questions
Assuming a 360 -day year the maturity value of a 15000, 9%,60-day note receivable dated February 10th is: Choose the inequality that represents the following graph. In your own words what does pre-written mean?... y varies directly as z, y=180, z=10 , find ywhen z=14 Mr. and Mrs. Haley are purchasing beachfront property in an upscale development. The home comes equipped with all furnishings. The Haleys want to get a mortgage that will cover the purchase price plus all the furnishings. What kind of mortgage are they looking for? How do the parenthetical remarks in John Jeremiah Sullivan's article 'HowWilliam Faulkner Tackled Race - and Freed the South From Itself" contributeto its tone?O A. They add a conversational tone to the article.O B. They add an academic tone to the article.O C. They enhance the level of discourse by providing unnecessaryinformation.O D. They reflect Sullivan's disparaging tone toward Faulkner. Suppose you exert a force of 185 N tangential to the outer edge of a 1.73-m radius 76-kg grindstone (which is a solid disk).Required:a. What torque is exerted?b. What is the angular acceleration assuming negligible opposing friction?c. What is the angular acceleration if there is an opposing frictional force of 20.0 N exerted 1.50 cm from the axis? URGENT/EDGE: An individuals health is affected by their environment and personal genetic makeup.True or False==============I feel like common sense says it's true but another person answered the same question with false - edge2021 vit topic sentence v nc Large capacitors can hold a potentially dangerous charge long after a circuit has been turned off, so it is important to make sure they are discharged before you touch them. Suppose a 120 F capacitor from a camera flash unit retains a voltage of 140 V when an unwary student removes it from the camera. If the student accidentally touches the two terminals with his hands, and if the resistance of his body between his hands is 1.8 k, for how long will the current across his chest exceed the danger level of 50 mA? What does Kuno say to Vashti look at the image below The values of 9s in 9905482 Please Help me!! An 8 foot high camel is loping away from a streetlight. The camel is loping at 12 feet/second. The streetlight is 20 feet high. How fast is the camels shadow growing? Why was the Pequot War 1637 important? ActivityWrite sentences using the verbs saber and conocer to express that you know the people listed below or know something about them.People you Might Know or Know AboutPart AAntonio Banderas It takes 250 \text{ g}250 g250, start text, space, g, end text of pasta and 240 \text{ ml}240 ml 240, start text, space, m, l, end text of sauce to make one batch of spaghetti, and it takes 600 \text{ g}600 g600, start text, space, g, end text of pasta and 700 \text{ ml}700 ml 700, start text, space, m, l, end text of sauce to make one batch of lasagna. Pens cost 15 pence each. Rulers cost 20 pence each. Write down an expression for the cost of x pens and x rulers. Work out the mean for the data set below: 3, 5, 4, 3, 5, 6 Give your answer as a fraction. answer Name the following compound from the concise formula:______. CH3CH(CH3)CHCHCH(CH3)CH2CH3 A. 2,4-dimethyl-3-heptene B. 2,5-dimethyl-3-heptene C. 3,5-dimethyl-3-heptene D. 2,5-dimethyl-4-heptene