What is the final volume V2 in milliliters when 0.551 L of a 50.0 % (m/v) solution is diluted to 23.5 % (m/v)?

Answers

Answer 1

Answer:

[tex]V_2=1.17L[/tex]

Explanation:

Hello,

In this case, for dilution processes, we must remember that the amount of solute remains the same, therefore, we can write:

[tex]V_1C_1=V_2C_2[/tex]

Whereas V accounts for volume and C for concentration that in this case is %(m/v). In such a way, the final volume V2 turns out:

[tex]V_2=\frac{V_1C_1}{C_2}= \frac{0.551L*50.0\%}{23.5\%}\\ \\V_2=1.17L[/tex]

Best regards.


Related Questions

The valves in the heart open and close to move blood in between heart chambers. O a) three directions O b) two directions O c) four directions d) one direction

Answers

Answer:

im not sure but i think its four directions

Hi,

The valves in the heart open and close to move blood in between heart chambers.

Answer:

d) one direction

What are the correct half reactions for the following reaction: Cu2+ + Mg -> Cu + Mg2+

Answers

Answer:

Cu2 + 2Mg-> 2Cu+ Mg2

Explanation:

Balance the equation and make sure both the reactant and the products are the same

Hope it will be helpful

[tex]Cu^{+2} + 2Mg[/tex]  -> [tex]2Cu + Mg^+2[/tex]  is the correct half-reactions.

What is a balanced equation?

A balanced equation is an equation for a chemical reaction in which the number of atoms for each element in the reaction and the total oxidation numbers is the same for both the reactants and the products.

[tex]Cu^{+2} + 2Mg[/tex]  -> [tex]2Cu + Mg^+2[/tex] is the correct half-reactions.

Magnesium is oxidized because its oxidation state increased from 0 to +2 while Cu is reduced because its oxidation state decreased from +2 to 0.

Learn more about balanced equations here:

brainly.com/question/15052184

#SPJ5

A skydiver slows down from 65 m/s to 5 m/s by opening the parachute. If this
takes 0.75 seconds, what is the skydiver's acceleration?
A. 45 m/s2 up
B. 80 m/s2 up
C. 45 m/s2 down
D. 80 m/s2 down

Answers

Answer:

D. -80m/s^2

Explanation:

V = u + at

5 = 65 + a (0.75)

0.75a = -60

a = -60/0.75

a = -80m/s^2

Therefore, is decelerating at 80m/s^2

Answer:

[tex]\boxed {\boxed {\sf D. \ 80 \ m/s^2 \ down}}[/tex]

Explanation:

We are asked to find the acceleration of a skydiver. Acceleration is the change in velocity over the change in time, so the formula for calculating acceleration is:

[tex]a= \frac{v_f-v_i}{t}[/tex]

The skydiver was initially traveling 65 meters per second, then he slowed down to a final velocity of 5 meters per second. He slowed down in 0.75 seconds.

[tex]\bullet \ v_f = 5 \ m/s \\\bullet \ v_i= 65 \ m/s \\\bullet \ t= 0.75 \ s[/tex]

Substitute the values into the formula.

[tex]a= \frac{ 5 \ m/s - 65 \ m/s}{0.75 \ s}[/tex]

Solve the numerator.

[tex]a= \frac{-60 \ m/s}{0.75 \ s}[/tex]

Divide.

[tex]a= -80 \ m/s^2[/tex]

The acceleration of the skydiver is -80 meters per second squared or 80 meters per second squared down. The skydiver is slowing down or decelerating, so the acceleration is negative or down.

When 1604 J of heat energy is added to 48.9 g of hexane, C6H14, the temperature increases by 14.5 ∘C. Calculate the molar heat capacity of C6H14.

Answers

Answer:

THE MOLAR HEAT CAPACITY OF HEXANE IS 290.027 J/ C

Explanation:

1604 J of heat is added to 48.9 g of hexane

To calculate the molar heat capacity of hexane, it is important to note that the molar heat capacity of a substance is the measure of the amount of heat needed to raise 1 mole of a substance by 1 K.

Since 1604 J of heat = 48.9 g of hexane

Molar mass of hexane = 86 g/mol = 1 mole

then;

1604 J = 48.9 g

x = 86 g

x = 1604 * 86 / 48.9

x = 4205.4 J

Hence, 4205.4 J of heat will be added to 1 mole or 86 g of hexane to raise the temperature by 14.5 C.

In other words,

heat = molar heat capacity * temperature change

molar heat capacity = heat/ temperature change

Molar heat capacity = 4205.4 J / 14.5 C

Molar heat capacity = 290.027 J/C

The molar heat capacity of hexane is 290.027 J/ C

A critical reaction in the production of energy to do work or drive chemical reactions in biological systems is the hydrolysis of adenosine triphosphate, ATP, to adenosine diphosphate, ADP, as described by the reaction

ATP(aq)+H2O(l)→ADP(aq)+HPO2−4(aq) for which ΔGrxn=30.5 kJ/mol at 37.0∘C and pH 7.0.

Required:
Calculate the value of ΔGrxn in a biological cell in which [ATP]=5.0 mM, [ADP]=0.60 mM, and [HPO2−4]=5.0 mM

Answers

Answer:

ΔG  = -49.64 KJ/mol

Explanation:

The actual free energy change of the reaction under the given conditions,  ΔG is given by the formula below;

ΔG = ΔG'° + RT ln([ADP][HPO₂⁴⁻] / [ATP])

where ΔG'° = -30.5 KJ/mol; R = 8.315 J/mol.K; T = 37°C = 310 K; [ADP] = 5.0 mM = 0.005 M; [HPO₂⁴⁻] = 0.60 mM = 0.0006 M; [ATP] = 5.0 mM = 0.005 M

ΔG = -30.5 KJ/mol + (8.315 J/mol.K)(310 K) ln {(0.005)(0.0006)/(0.005)}

ΔG = -30.5 KJ/mol + (2.58 KJ/mol * -7.4186)

ΔG = -30.5 KJ/mol - 19.14 KJ/mol

ΔG  = -49.64 KJ/mol

Identify a homogeneous catalyst. Identify a homogeneous catalyst. Pd in H2 gas N2 and H2 catalyzed by Fe SO2 over vanadium (V) oxide Pt with methane H2SO4 with concentrated HCl

Answers

Answer:

H2SO4 with concentrated HCl

clacium hydroxide is slightly soluable in water about 1 gram will dissolve in 1 liter what are the spectator ions in the reaction ions in the reaction of such a dilute solution of calcium hydroxide with hydrochloric acid

Answers

Answer:

Ca²⁺ and Cl⁻

Explanation:

In a chemical reaction, spectator ions are ions that are not involved in the reaction, that means are the same before and after the reaction.

In water, calcium hydroxide, Ca(OH)₂ is dissociated in Ca²⁺ and OH⁻. Also, hydrochloric acid, HCl, dissociates in H⁺ and Cl⁻. The reaction is:

Ca²⁺ + 2OH⁻ + 2H⁺ + 2Cl⁻ → 2H₂O + Ca²⁺ + 2Cl⁻

The ions that react are H⁺ and OH⁻ (Acid and base producing water)

And the ions that are not reacting, spectator ions, are:

Ca²⁺ and Cl⁻

A 2.87g sample of carbon reacts with hydrogen to form 3.41g of car fuel. What is the empirical formula of the car fuel?

Answers

Answer:

The empirical formulae for the car fuel is C4H9

Which of the following elements is in the same group as Sulfur (S)?

Answers

Answer:

PLEASE SHOW ME THE ELEMENTS OR I WOULD ENLIST ALL THE ELEMENTS.

Explanation:

Group 6A (or VIA) of the periodic table are the chalcogens: the nonmetals oxygen (O), sulfur (S), and selenium (Se), the metalloid tellurium (Te), and the metal polonium (Po)

Name the following compound from the concise formula:______.
CH3CH(CH3)CHCHCH(CH3)CH2CH3
A. 2,4-dimethyl-3-heptene
B. 2,5-dimethyl-3-heptene
C. 3,5-dimethyl-3-heptene
D. 2,5-dimethyl-4-heptene

Answers

Answer:

B. 2,5-dimethyl-3-heptene

Explanation:

Answer:

B. 2,5-dimethyl-3-heptene

Explanation:

Describe the factors influencing chemical bonds and the
characteristics of an ionic and a covalent bond.

Answers

Explanation:

factors affecting chemical bonds

a. electronegativity difference

b. size

c. charges

characteristics of Ionic bond

a. high melting point

b. they are soluble in polar solvents

c. they don't conduct electricity in solid state

characteristics of covalent bonds

a. they are insoluble in polar solvents

b. they don't conduct electricity

c. low melting point

What is the concentration of A after 50.7 minutes for the second order reaction A → Products when the initial concentration of A is 0.250 M? (k = 0.117 M⁻¹min⁻¹)

Answers

Answer:

0.101 M

Explanation:

Step 1: Given data

Initial concentration of A ([A]₀): 0.250 MFinal concentration of A ([A]): ?Time (t): 50.7 minRate constant (k): 0.117 M⁻¹.min⁻¹

Step 2: Calculate [A]

For a second-order reaction, we can calculate [A] using the following expression.

1/[A] = 1/[A]₀ + k × t

1/[A] = 1/0.250 M + 0.117 M⁻¹.min⁻¹ × 50.7 min

[A] = 0.101 M

oxide. b) Silicon dio
43. What is the nature of an enzyme?
a) Vitamin. b) Lipid. c) Carbohydrate. d) Protein
44. Name the enzyme which catalyzes the oxidation-reduction reaction?
a) Transaminase. b) Glutamine synthetase. c) Phosphofructokinase. d) Oxidoreductase
nontido

Answers

Answer:

43) protein

44) oxidoreductase

A compound is found to contain 11.21 % hydrogen and 88.79 % oxygen by mass. What is the empirical formula for this compound?

Answers

Answer:

H₂O

Explanation:

The empirical formular of the compound is obtained using the following steps;

Step 1: Divide the percentage composition by the atomic mass

Hydrogen = 11.21 / 1 = 11.21

Oxygen = 88.79  / 16 = 5.55

Step 2: Divide by the lowest number

Hydrogen  = 11.21 / 5.55 = 2.02 ≈ 2

Oxygen = 5.55 / 5.55 = 1

This means the ratio of the elements is 2 : 1

The empirical formular (simplest formular of a compound) of the compound is;

H₂O

Answer:Empirical formula ======== H₂O    

Explanation:The empirical formula of a compound shows the whole number ratio for  each atom in a compound.

To find empirical formula. we follow the below steps

The total mass of the compound here  is 100 grams, that is (11.21% of hydrogen + 88.79% of oxygen) we can then  assume 11.21 grams  of hydrogen and 88.79grams of oxygen

                                          Hydrogen                   Oxygen

1.composition by mass    11.21                              88.79

molecular weight              1.007g/mol               15.990g/mol

2.Divide composition by mass  11.21/1.007            88.79/15.99    

by each molecular weight to get 11.13                            5.553

no of moles

3 Divide by the least number of moles

to get atomic ratio                       11.13/5.553          5.553/5.553

                                                         2.004                           1.00

4.Convert  to whole numbers             2                                 1

Empirical formula ======== H₂O    

Calculate the [H+] and pH of a 0.0010 M acetic acid solution. The Ka of acetic acid is 1.76×10−5. Use the method of successive approximations in your calculations.

Answers

Answer:

[tex][H^+]=0.000123M[/tex]

[tex]pH=3.91[/tex]

Explanation:

Hello,

In this case, dissociation reaction for acetic acid is:

[tex]CH_3COOH\rightleftharpoons CH_3COO^-+H^+[/tex]

For which the equilibrium expression is:

[tex]Ka=\frac{[CH_3COO^-][H^+]}{[CH_3COOH]}[/tex]

Which in terms of the reaction extent [tex]x[/tex] could be written as:

[tex]1.74x10^{-5}=\frac{x*x}{[CH_3COOH]_0-x}=\frac{x*x}{0.0010M-x}[/tex]

Thus, solving by using a solver or quadratic equation we obtain:

[tex]x_1=0.000123M\\\\x_2=-0.000141M[/tex]

And clearly the result is 0.000123M, which also equals the concentration of hydronium ion in solution:

[tex][H^+]=0.000123M[/tex]

Now, the pH is computed as follows:

[tex]pH=-log([H^+])=-log(0.000123)\\\\pH=3.91[/tex]

Best regards.

Given that π = n M R T, rearrange the equation to solve for V

Answers

Answer:

V= n/M

Explanation:

From;

π = nRT/V = MRT

Where;

n= number of moles

R= gas constant

T= absolute temperature

M= molar mass

V= volume of the solution

π= osmotic pressure

Thus;

nRT/V = MRT

nRT = VMRT

V= nRT/MRT

V= n/M

What is the molarity of 4 g of NaCl dissolved in 100mL of water?

Answers

Answer:

[tex]M=0.684M[/tex]

Explanation:

Hello,

In this case, considering that the solution is formed by NaCl as the solute and water as the solvent, we can compute the molarity as shown below:

[tex]M=\frac{mol_{solute}}{V_{solution}}[/tex]

Whereas the volume of the solution must be in liters. In such a way, since the addition of sodium chloride does not significantly changes the volume of the solution we can say it remains in 100 mL (0.100 L) and the moles of sodium chloride are computed by using its molar mass (58.45 g/mol):

[tex]mol_{solute}=4g*\frac{1mol}{58.45g} =0.0684mol[/tex]

Therefore, the molarity is:

[tex]M=\frac{0.0684mol}{0.100L} \\\\M=0.684\frac{mol}{L}=0.684M[/tex]

Regards.

What is the initial temperature (°C) of a system that has the pressure decreased by 10 times while the volume increased by 5 times with a final temperature of -123°C?

Answers

Answer:

27°C or 300K

Explanation

We were told that the pressureof the system decreased by 10 times implies that P2= P1/10

Where P2=final pressure

P1= initial pressure

Wew were also told that the volume of the system increased by 5 times this implies that V2= 5×V1

Where T2= final temperature =-123C= 273+(-123C)=150K

T1= initial temperature

But from gas law

PV=nRT

As n and R are constant

P1V1/T1 = P2V2/T2

T1= P1V1T2/P2V2

T1=2×T2

T1=2×150

T1=300K

=300-273

=27°C

the initial temperature (°C) of a system is 27°C

What do you predict the chemical formula for the compound formed between calcium and sulfur?

Answers

Answer:

calcium donates two vanence electrons to sulfur atom to form Ca2+ ion and an S2+ - ion

3. Write the following isotope in hyphenated form (e.g., "carbon-14”): Kr
a. Krypton-109
b. Krypton -37
c. Krypton -36
d. Krypton -73​

Answers

Answer:

Krypton -73

Explanation:

There are 33 known isotopes of krypton (36Kr) with atomic mass numbers from 69 through 101.

Good luck!

Answer:

D. Krypton-73

Explanation:

An isotope of an element has the same atomic number and the same number of protons but a different number of neutrons and a different atomic weight. Krypton is the 36th element on the periodic table. It has 36 protons and 48 neutrons. Krypton-73 is one of 33 known isotopes of Krypton and is the only one that actually exists from the list of choices.

Hope that helps.

An unknown gas diffuses 5 times slower than that of H2.The moleculer mass of unknown gas is??

Answers

Answer:

50.

Explanation:

We can write Graham's Law of Diffusion as:

(Rate 1)^2 = Molecular Mass 2

--------------    -------------------------

(Rate 2)^2    Molecular Mass 1

So using the Given Information:

1^2  / (1/5)^2 = Molecular Mass of unknown gas / 2, so:

25 = M/2

M = 50.

Given the balanced chemical equation for the decomposition for INO, and the rate of disappearance of INO, write the expressions for the rates of appearance of I2 and NO.

2INO(g) → I2(g) + 2NO(g)

Reactant: Product(I2): Product(NO):

-∆[INO]/2∆t = ??/??

Answers

Answer:

rate of disappearance of -0.5d[INO]/dt

rate of appearance of I2 = d[I2]/dt

rate of appearance of No = 0.5*d[NO]/dt

Explanation:

According to chemical equilibrium,  d[I₂]/dt and d[NO]/dt is  the expressions for the rates of appearance of I₂ and NO respectively.

What is chemical equilibrium?

Chemical equilibrium is defined as the condition which arises during the course of a reversible chemical reaction with no net change in amount of reactants and products.A reversible chemical reaction is the one wherein the products as soon as they are formed react together to produce back the reactants.

At equilibrium, the two opposing reactions which take place take place at equal rates and there is no net change in amount of the substances which are involved in the chemical reaction.At equilibrium, the reaction is considered to be complete . Conditions which are required for equilibrium are given by quantitative formulation.

Factors which affect chemical equilibrium are change in concentration , change in pressure and temperature and presence of catalyst.

Learn more about chemical equilibrium,here:

https://brainly.com/question/4289021

#SPJ6

If 75.4 J of energy is absorbed by 0.25 mol of CCl4 at constant pressure, what is the change in temperature? The specific heat of CCl4 is 0.861 J/g·°C.

Answers

Answer:

ΔT = 2.28°C

Explanation:

Heat, H = 75.4J

Number of moles = 0.25 mol

Specific heat capacity, c = 0.861 J/g·°C

Change in temperature, ΔT = ?

These quantities are related by the following equation;

H = mc ΔT

Mass, m = Number of moles * Molar mass

m = 0.25mol * 153.82 g/mol

m = 38.455g

S back to the equation;

H = mc ΔT

Substituting the values;

75.4 = 38.455 * 0.861 * ΔT

ΔT = 75.4 /  33.11

ΔT = 2.28°C

The change in temperature is 2.28 °C

First, we will determine the mass of CCl₄ absorbed

From the given information,

Number of moles of CCl₄ absorbed = 0.25 mol

Using the formula

Mass = Number of moles × Molar mass

Molar mass of CCl₄ = 153.82 g/mol

∴ Mass of CCl₄ absorbed = 0.25 × 153.82

Mass of CCl₄ absorbed = 38.455 g

Now, using the formula

Q = mcΔT

Where Q is the quantity of heat

m is the mass

c is the specific heat of substance

and ΔT is the change in temperature

From the given information

Q = 75.4 J

c = 0.861 J/g.°C

Putting the parameters into the formula, we get  

75.4 = 38.455 × 0.861 ×ΔT

75.4 = 33.109755 × ΔT

∴ ΔT = 75.4 ÷ 33.109755

ΔT = 2.28 °C

Hence, the change in temperature is 2.28 °C

Learn more here: https://brainly.com/question/13439286

What is the rate constant of a reaction if rate = 1 x 10-2 (mol/L)/s, [A] is 2 M,
[B] is 3 M, m = 2, and n = 1?

Answers

Answer:

[tex]0.10 \text{ L$^2$mol$^{-2}$s$^{-1}$}[/tex]

Explanation:

The general formula for a rate law is

[tex]\text{rate} = k\text{[A]}^m \text{[B]}^{n}[/tex]

With your numbers, the rate law becomes

1.2 mol·L⁻¹s⁻¹ = k(2 mol·L⁻¹)²(3 mol·L⁻¹)¹ = k × 4 mol²L⁻² × 3 mol·L⁻¹

= 12k mol³L⁻³

[tex]\\ k = \dfrac{\text{1.2 mol $\cdot$ L$^{-1}$s$^{-1}$} }{12\text{ mol$^{3}$L}^{-3}} = \mathbf{0.10} \textbf{ L$\mathbf{^2}$mol$^{\mathbf{-2}}$s$^{\mathbf{-1}}$}[/tex]

For the reaction CO2(g) + H2(g)CO(g) + H20(g)
∆H°=41.2 kJ and ∆S°=42.1 J/K
The standard free energy change for the reaction of 1.96 moles of Co2(g) at 289 K, 1 atm would be_________KJ.
This reaction is (reactant, product)___________ favored under standard conditions at 289 K.
Assume that ∆H° and ∆S° are independent of temperature.

Answers

Answer:

The ΔG° is 29 kJ and the reaction is favored towards reactant.

Explanation:

Based on the given information, the ΔH°rxn or enthalpy change is 41.2 kJ, the ΔS°rxn or change in entropy is 42.1 J/K or 42.1 * 10⁻³ kJ/K. The temperature given is 289 K. Now the Gibbs Free energy change can be calculated by using the formula,  

ΔG° = ΔH°rxn - TΔS°rxn

= 41.2 kJ - 289 K × 42.1 × 10⁻³ kJ/K

= 41.2 kJ - 12.2 kJ

= 29 kJ

As ΔG° of the reaction is positive, therefore, the reaction is favored towards reactant.  

An SN2 reaction is a type of _____________ in which the nucleophile attacks the electrophile.

Answers

Answer:

A bimolecular nucleophilic substitution (SN2) reaction is a type of nucleophilic substitution whereby a lone pair of electrons on a nucleophile attacks an electron deficient electrophilic center and bonds to it, resulting in the expulsion of a leaving group.

The two common properties of all solids are fixed _____ and _____.

Answers

Answer:

shape

volume

Hope this helps! (づ ̄3 ̄)づ╭❤~

Explanation:

Shape and volume is the correct answer

An unknown compound has the following chemical formula:
Co(OH),
where x stands for a whole number.
Measurements also show that a certain sample of the unknown compound contains 5.1 mol of oxygen and 2.59 mol of cobalt.
Write the complete chemical formula for the unknown compound.

Answers

since we are given the moles for Co and O, we'll divide both of those moles by the lowest mole quantity, which is, in this case, 2.59. After dividing, we see that the ratio of O to Co is 2:1. So, for every 1 Co atom, there has to be 2 O atoms. we can then insert the 2 in for OH to satisfy this ratio.

Complete the following reactions
need answers?

i) P + [H]

ii) O2 + [H]

iii) LiH + H2O

iv) CaC2 +H2O

v) NaH + H2O

vi) CaH2 H2O

Answers

Answer:

this reaction will produce phosphine

P+H---->PH

this reaction will produce water

O2+H---->H2O

this reaction will produce lithium hydroxide and hydrogen gas

LiH+H2O---->LiOH+H2

this reaction will produce calcium hydroxide and acetylene gas

CaC2+H2O---->Ca(OH)2+C2H2

this reaction will produce sodium hydroxide and hydrogen gas

NaH+H2O---->NaOH+H2

this type of reaction will produce calcium hydroxide and hydrogen gas

CaH2+H2O---->CaOH+H2

I hope this helps

The ceramic glaze on a red-orange Fiestaware plate is U2O3 and contains 50.1 grams of 238U, but very little 235U. (a) What is the activity of the plate (in Ci)

Answers

Answer:

The correct answer is 1.68 × 10⁻⁵ Ci

Explanation:

The activity of the uranium is determined by using the formula,  

R = 0.693 N/t1/2 -------------- (i)

The number of atoms is, N = nNA

Here, NA is the Avogadro number and n is the number of moles. The value of n is m/M, that is, mass/molecular mass. Now the value of N becomes,  

N = (m/M) NA

The m or mass of uranium given is 50.1 grams, and the molecular mass is 238 g/mol, now putting the values we get,  

N = (50 g/238 g) (6.023 × 10²³) = 1.26 × 10²³

The half-life of 238U from year to second is,  

t1/2 = (4.468 × 10⁸ year) (3.16 × 10⁷ s/ 1 year) = 1.412 × 10¹⁶ s

Substituting the values of t1/2 as 1.412 × 10¹⁶, and 1.26 × 10²³ for N in equation (i) we get,  

R = 0.639 (1.26 × 10²³) / 1.412 × 10¹⁶ s  

= 6.18 × 10⁶ Bq (2.7027 × 10⁻¹¹ Ci/1 Bq)

= 1.68 × 10⁻⁵ Ci

Hence, the activity of the plate is 1.68 × 10⁻⁵ Ci

Other Questions
Find the solution of the exponential equation, as in Example 1. (Enter your answers as a comma-separated list.)e1 3x = e4x 3x=_______ The three-dimensional figure shown consists of a cylinder and a right circular cone. The radius of the base is 10 centimeters. The height of the cylinder is 16 centimeters, and the total height of the figure is 28 centimeters. The slant height of the cone is 13 centimeters. Which choice is the best approximation of the surface area of the figure? Use 3.14 to approximate pi. what do the edaphosaurus use their back sail for? 1A. A strontium hydroxide solution is prepared by dissolving 10.45 g of Sr(OH)2 in water to make 41.00 mL of solution. What is the molarity of this solution? 1B. Next the strontium hydroxide solution prepared in part (a) is used to titrate a nitric acid solution of unknown concentration. Write a balanced chemical equation to represent the reaction between strontium hydroxide and nitric acid solutions. 1C. If 23.9 mL of the strontium hydroxide solution was needed to neutralize a 31.5 mL aliquot of the nitric acid solution, what is the concentration (molarity) of the acid? find all the solutions of the equation in the interval [0, 2pi) sin2x-1=0show work pls sum and product of zeros of a quadratic polynomial are 0 and root 15 respectively find the quadratic polynomial Why are primary sources important when studying historical events When sketching a normal curve, whatvalue represents one standard deviationto the right of the mean for the data set?56, 54, 45, 52, and 48. What is the molar mas of zinc (Zn)? 6.02 g/mol 30.0 g/mol 48.7 g/mol 65.38 g/mol A(n) _______is a special type of scientific investigationthat is performed under controlled conditions typicallyincluding a dependent and independent variable. 22. An astronaut on the space station tests whether gravity affects the productivity of tomato plants. Whatis the independent variable in this experiment? In Shakespeare's Hamlet, the character Hamlet reveals in a monologue that he is pretending to be mad. Concerned, the King and the Queen try to find out the reason behind Hamlet's unusual mood. The court adviser, Polonius, tries to help them by promising the King that he will find out the reason for Hamlet's behavior. Meanwhile, the other characters Gertrude, Claudius, and Ophelia try to cheer up Hamlet in their own way. Which description is an example of dramatic irony? simpily 2^33^2=6^5 Why did the ostrich run away as fast as it could? Select the correct answer.What does a production possibilities curve represent?.a combination of price and demand of goods and servicesB.a combination of the goods produced before and after a change in a factor of production.a combination of two factors of production used to produce a single good or serviceODa combination of two goods that can be produced using limited resources The ratio of boys to girls in the ninth grade is 7 to 9. there are 218 girls set up a proportion to model this information Sales tax is calculated as a percentage of the sales price.If sales tax is 5%, what is the salestax on clothing that costs $170? Please help . Ill mark you as brainliest if correct! Armando is baking 36 batches of brownies for the bake sale. Each batch of brownies takes cups of flour. What is a reasonable estimate of the amount of flour that he will need to bake all thirty-six batches of brownies? prove that..please help