Which inequality is graphed on the coordinate plane shown?


A
y≥2x−6

B
y<2x−6

C
y>2x−6

D
y≤2x−6

Which Inequality Is Graphed On The Coordinate Plane Shown?A Y2x6B Y&lt;2x6C Y&gt;2x6D Y2x6

Answers

Answer 1

Answer:

y ≤ 2x-6

Step-by-step explanation:

First find the equation of the line

The y intercept is -6

The slope is 2

y = 2x-6

The line graphed is solid so we know that there is an equal sign

We are graphing below the line

y ≤ 2x-6


Related Questions

The solutions to \[2x^2 - 10x + 13 = 0\]are $a+bi$ and $a-bi,$ where $a$ and $b$ are positive. What is $a\cdot b?$[tex]The solutions to\[2x^2 - 10x + 13 = 0\]are $a+bi$ and $a-bi,$ where $a$ and $b$ are positive. What is $a\cdot b?$[/tex]

Answers

Answer:

5/8

Step-by-step explanation:

(10 +/- √100-104)/4

(10 +/- 2i)/4

5/4 +/- 1/2i

5/4 * 1/2 = 5/8

is {3,…} a defined set

Answers

Answer:

is infinite set... because dots meaning non stop


[tex]integrate \: ln(x) [/tex]

Answers

Answer:

ln(x) = 1/x... It's a basic rule of Calculus.

Someone plzzzz help I don’t get this at all

Answers

Answer:

Option B

Step-by-step explanation:

The slope of the line BC is,

[tex] \frac{ - 2 - 8}{7 - 3} [/tex]

[tex] = \frac{ - 10}{4} = - \frac{5}{2} [/tex]

Since AD is altitude to BC, we can say AD is perpendicular to BC, so the slope of the line AD which is perpendicular line to BC will be,

[tex] \frac{2}{5} [/tex]

in the circle below, ...

Answers

Answer:

angle FEG = 66⁰

angle GFH = 90⁰

13. A map has a scale of 2 cm to 3 km.
(iii) If the actual area of a lake is 81 km?, calculate
its area on the map.

Answers

Scale = 1cm:3km

Therefore area of lake = 81Km

1:3 = x:81

= 27:81

Therefore the area on map is 27cm

Must click thanks and mark brainliest

Answer:

121.5 is answer.

Step-by-step explanation:

81 / 2 = 40.540.5 *3 = 121.5

Find the inverse. (SHOW WORK)

Answers

Let f(x) = y

y = log3(x+1) - 1

Plug x in y and y in x

x = log3(y+1) - 1

x + 1 = log3(y+1)

3^(x+1) - 1 = y

[tex]y = 3^{x+1}[/tex] - 1

This is the inverse function.

Hope it helps! xxxx

Answer:

y = [tex]3^{(x+1)}[/tex] -1

Step-by-step explanation:

x = [tex]log_{3}[/tex](y + 1) - 1

x + 1 = log₃(y + 1)

[tex]3^{(x+1)}[/tex] = y + 1

[tex]3^{(x+1)}[/tex] -1 = y

SOMEONE PLZ HELP ASAP !!!!!!

Answers

Answer:

a = 53.13

b = 42.76

c= 0

Step-by-step explanation:

as the question said i was supposed to use a calculator which i did

You work for a roofing company and must order the correct number of tiles to complete the final side of the roof. It is in the shape of a trapezoid. The numbers of tiles in each row form a sequence. We know we will have 20 rows to complete the job. The first row has ten tiles. Each row has two more tiles than the previous row. Is this sequence arithmetic or geometric?

Answers

Answer:

ljj

Step-by-step explanation:

llk

Yes , the series is an arithmetic sequence of common difference 2

What is Arithmetic Progression?

An arithmetic progression is a sequence of numbers in which each term is derived from the preceding term by adding or subtracting a fixed number called the common difference "d"

The general form of an Arithmetic Progression is a, a + d, a + 2d, a + 3d and so on. Thus nth term of an AP series is Tn = a + (n - 1) d, where Tₙ = nth term and a = first term. Here d = common difference = Tₙ - Tₙ₋₁

Sum of first n terms of an AP: Sₙ = ( n/2 ) [ 2a + ( n- 1 ) d ]

Given data ,

Let the number of terms n = 20

The number of tiles in the first row = 10 tiles

The number of tiles in the second row = 2 more than first row

The number of tiles in the second row = 12 tiles

The number of tiles in the third row = 14 tiles

So , the sequence will be , 10 , 12 , 14 , 16 ...

The number of terms n = 20

The first term a = 10

The common difference d = second term - first term

The common difference d = 12 - 10 = 2

The series is an arithmetic sequence and the 20th term of the sequence will be

a₂₀ = a + ( n - 1 )d

a₂₀ = 10 + ( 19 ) 2

a₂₀ = 10 + 38

a₂₀ = 48 tiles

Hence , the series is an arithmetic sequence

To learn more about arithmetic progression click :

https://brainly.com/question/1522572

#SPJ5

Which decimal is equivalent to 48 over 100

a. 0.048
b. 0.48
c. 4.08
d. 4.8​

Answers

Answer:

0.48

Step-by-step explanation:

hope it can work for you mark me as a brain liest

Enter the values for the variables that give the correct simplified expressions, x=>=0; sqrt(50x ^ 2) = sqrt(25 - 2x ^ 2) = 5x * sqrt(b); b =; sqrt(32x) = sqrt(16.2x) = e * sqrt(2x); c =; sqrt(38n) = sqrt(8 * 2 * pi) = e * sqrt(2n); e =; sqrt(72x ^ 2) = sqrt(36 * 2 * x ^ 2) = gx * sqrt(2); g =

Answers

Answer:

b=2

c=4

e=3

g=6

Step-by-step explanation:

sam leases a car for 24 months. the car will cost him $7,000 if he decides to buy it at the end of the lease. What term describes the $7,000

Answers

Answer:

Residual value

another question what's the formula for an open end of a cylinder??​

Answers

Answer:

Formula for an opened end of a cylinder =

[tex]\pi r^2 +2\pi rh\\[/tex]

Closed at both end =

[tex]2\pi r^2 +2\pi r h[/tex]

Opened at both end =

[tex]2\pi rh[/tex]

Step-by-step explanation:

PLS HELP ME ON THIS QUESTION I WILL MARK YOU AS BRAINLIEST IF YOU KNOW THE ANSWER PLS GIVE ME A STEP BY STEP EXPLANATION!!

Answers

The answer would be D.) 904.78 cm cubes because the formula for a cylinder is V=πr2h meaning you have to do the radius which is 6 squared which comes out to 36 times pi to get 113.04 which you multiply by the height of 8 to get Answer D.) 904.78cm cubed

-14 = x - 12 pls answer this if I can and check answer

Answers

Answer:

x = -2

Step-by-step explanation:

-14 = x - 12

-14 + 12 = x

-2 = x

check:

-14 = -2 - 12

The citizens of a certain community were asked to choose their favorite pet. The pie chart below shows the distribution of the citizens' answers. If there are 140,000 citizens in the community, how many chose Fish or Cats?

Answers

Incomplete Question:

The content of the pie chart is as follows:

Hamsters  = 9% ; Snakes  = 10% ; Cats  = 23%

Birds  = 21% ;  Dogs  = 26% ;  Fish  = 11%

Answer:

The number of citizens who chose cat or fish is 47,600

Step-by-step explanation:

Given

Number of citizens = 140,000

Required

Determine the number of those that chose fish or cats

First, we need to calculate the percentage of those whose pets are either cats or fish

[tex]Percentage = Cat + Fish[/tex]

Substitute 23% for cat and 11% for fish

[tex]Percentage = 23\% + 11\%[/tex]

[tex]Percentage = 34\%[/tex]

Next, is to multiply the calculated percentage by the number of citizens

[tex]Cat\ or\ Fish = Percentage * Number\ of\ Citizens[/tex]

[tex]Cat\ or\ Fish = 34\% * 140000[/tex]

[tex]Cat\ or\ fish = 47600[/tex]

Hence, the number of citizens who chose cat or fish is 47,600

the number of citizens who chose cat or fish is 47,600

The calculation is as follows;

= Number of citizens × total percentage

[tex]= 140,000 \times (23\% + 11\%)\\\\= 140,000 \times 34\%[/tex]

= 47,600

Learn more: https://brainly.com/question/17429689?referrer=searchResults

Expand the following using the Binomial Theorem and Pascal’s triangle. Show your work. (x + 2)6 (x − 4)4 (2x + 3)5 (2x − 3y)4 In the expansion of (3a + 4b)8, which of the following are possible variable terms? Explain your reasoning. a2b3; a5b3; ab8; b8; a4b4; a8; ab7; a6b5

Answers

Answer:

The answer is below

Step-by-step explanation:

Expansion using pascal triangle:

a)  (x + 2)⁶ = x⁶2⁰ + 6(x⁵)(2)¹ + 15(x⁴)(2²) + 20(x³)(2³) + 15(x²)(2⁴) + 6(x)(2⁵) + 1(2⁶)

                 = x⁶ + 12x⁵ + 60x⁴ + 160x³ + 240x² + 192x + 64

b) (x-4)⁴ = x⁴ + 4(x³)(-4) + 6(x²)(-4)² + 4(x)(-4)³ + 1(x⁰)(-4)⁴

              =x⁴-16x³+96x²-256x+256

c) (2x + 3)⁵ = (2x)⁵ + 5(2x)⁴(3) + 10(2x)³(3)² + 10(2x)²(3)³ + 5(2x)(3)⁴ + 1(2x)⁰(3)⁵ =

                  = 32x⁵ + 240x⁴ + 720x³ + 1080x² + 810x + 243

d) (2x-3y)⁴ = 1(2x)⁴(-3y)⁰ + 4(2x)³(-3y) + 6(2x)²(-3y)² + 4(2x)(-3y)³ + 1(2x)⁰(-3y)⁴

                  = 16x⁴- 96x³ + 216x² - 216x + 81

Expansion using binomial where [tex]C(n,r)=\frac{n!}{(n-r)!r!}[/tex]

a)  (x + 2)⁶ = C(6,0)[x⁶2⁰] + C(6,1)[(x⁵)(2)¹] + C(6,2)[(x⁴)(2²)] + C(6,3)[(x³)(2³)] + C(6,4)[(x²)(2⁴)] + C(6,5)[(x)(2⁵)] + C(6,6)[(2⁶)]

                = x⁶2⁰ + 6(x⁵)(2)¹ + 15(x⁴)(2²) + 20(x³)(2³) + 15(x²)(2⁴) + 6(x)(2⁵) + 1(2⁶)

                 = x⁶ + 12x⁵ + 60x⁴ + 160x³ + 240x² + 192x + 64

b) (x-4)⁴ = C(4,0)[x⁴] + C(4,1)[(x³)(-4)] + C(4,2)[(x²)(-4)²] + C(4,3)[(x)(-4)³] + C(4,4)[(x⁰)(-4)⁴]

              = x⁴ + 4(x³)(-4) + 6(x²)(-4)² + 4(x)(-4)³ + 1(x⁰)(-4)⁴

              =x⁴-16x³+96x²-256x+256

c) (2x + 3)⁵   = C(5,0)[(2x)⁵] + C(5,1)[(2x)⁴(3)] + C(5,2)[(2x)³(3)²] + C(5,3)[(2x)²(3)³] + C(5,4)[(2x)(3)⁴] + C(5,5)[(2x)⁰(3)⁵]

                   = (2x)⁵ + 5(2x)⁴(3) + 10(2x)³(3)² + 10(2x)²(3)³ + 5(2x)(3)⁴ + 1(2x)⁰(3)⁵

                  = 32x⁵ + 240x⁴ + 720x³ + 1080x² + 810x + 243

d) (2x-3y)⁴ = C(4,0){(2x)⁴(-3y)⁰} + C(4,1)[(2x)³(-3y)] + C(4,2)[(2x)²(-3y)²] + C(4,3)[(2x)(-3y)³] + C(4,4)[(2x)⁰(-3y)⁴]

                  = 1(2x)⁴(-3y)⁰ + 4(2x)³(-3y) + 6(2x)²(-3y)² + 4(2x)(-3y)³ + 1(2x)⁰(-3y)⁴

                  = 16x⁴- 96x³ + 216x² - 216x + 81

In the expansion of (3a + 4b)⁸, the only possible variable terms are a⁵b³, b⁸, a⁴b⁴, a⁸, ab⁷ because for each of them, the sum of there powers is eight. If the sum of the powers is not 8 then it is not correct.

For a²b³, the sum of the power is 5, for ab⁸ the sum of power is 9 and for a⁶b⁵ the sum of the power is 11 therefore thy are not correct.

As per the question expand the bimonoidal theorem and the pascal triangle. Showing the (x+2)6 (x-4)4 (2x+3)5 (2x-3y)4.

Expansion using pascal triangle:a)  (x + 2)⁶ = x⁶2⁰ + 6(x⁵)(2)¹ + 15(x⁴)(2²) + 20(x³)(2³) + 15(x²)(2⁴) + 6(x)(2⁵) + 1(2⁶)      = x⁶ + 12x⁵ + 60x⁴ + 160x³ + 240x² + 192x + 64b) (x-4)⁴ = x⁴ + 4(x³)(-4) + 6(x²)(-4)² + 4(x)(-4)³ + 1(x⁰)(-4)  =x⁴-16x³+96x²-256x+256c) (2x + 3)⁵ = (2x)⁵ + 5(2x)⁴(3) + 10(2x)³(3)² + 10(2x)²(3)³ + 5(2x)(3)⁴ + 1(2x)⁰(3)⁵ = 32x⁵ + 240x⁴ + 720x³ + 1080x² + 810x + 243d) (2x-3y)⁴ = 1(2x)⁴(-3y)⁰ + 4(2x)³(-3y) + 6(2x)²(-3y)² + 4(2x)(-3y)³ + 1(2x)⁰(-3y)⁴ = 16x⁴- 96x³ + 216x² - 216x + 81.

Learn more about the use the binomial theorem.

brainly.com/question/11995132.

I don’t really understand this…
Steps:
Calculate MU/P
Compare MUx with MUy
Choose highest MU
Continue until you spend all of your money


Answers

Answer:

In the real world, a consumer may purchase more then one commodity. Let us assume that a consumer purchases two goods X and Y. How does a consumer spend his fixed money income in purchasing two goods so as to maximize his total utility? The law of equi­-marginal utility tells us the way how a consumer maximizes his total utilit

Factor X squared minus 2X -80

Answers

Answer:

(x - 10)(x + 8)

Step-by-step explanation:

x² - 2x - 80

Consider the factors of the constant term (- 80) which sum to give the coefficient of the x- term (- 2)

The factors are - 10 and + 8 , since

- 10 × 8 = - 80 and - 10 + 8 = - 2 , then

x² - 2x - 80 = (x - 10)(x + 8)

Write this expression as a complex number in standard form

Answers

Answer:

[tex]81+144i[/tex]

Step-by-step explanation:

We want to simplify:
[tex]\displaystyle (-3\sqrt{-81})(-5+\sqrt{-9}) + 9i[/tex]

Recall that:

[tex]\displaystyle \sqrt{-a} = i\sqrt{a}[/tex]

Therefore:
[tex]\displaystyle \begin{aligned} (-3\sqrt{-81})(-5+\sqrt{-9}) + 9i & = (-3i\sqrt{81})(-5+i\sqrt{9})+9i \\ \\ &= -(3i(9))(-5+i(3))+9i \\ \\ & = -27i(-5+3i)+9i \\ \\ & = 135i -81i^2 + 9i \\ \\ & = 144i - 81i^2 \\ \\ & = 81+144i\end{aligned}[/tex]

Note that i² = -1.

In conclusion:

[tex]\displaystyle (-3\sqrt{-81})(-5+\sqrt{-9})+9i = 81 + 144i[/tex]

The answer is 81+144i

(x-y)²-(x+y)² a)0 b)2y² c)-2y² d)-4xy e)-2(x+y)²

Answers

Answer:

D

Step-by-step explanation:

-4xy

will be your answer after factoring

Answer:

d

Step-by-step explanation:

Given

(x - y)² - (x + y)² ← expand both factors using FOIL

= x² - 2xy + y² - (x² + 2xy + y²) ← distribute by - 1

= x² - 2xy + y² - x² - 2xy - y² ← collect like terms

= - 4xy → d

You need to prepare 30mL solution of a 1:8 syrup solution. You have on hand 50% syrup solution and a 1:20 soda solution. How many mL of each solution do you need to create the final solution?

Answers

Answer:

5 ml of 50% syrup solution will be used to create the final solution

Step by step Explanation:

Let the amount of 50% solution that was used = b

Which means ( 30 - b ) is the amount of 1/200 solution used then we can derive an equation as follows,

set up will then be,

0.5b +0.05(30 -b) = 1/8 (30)

We can simplifiy this as

0.5b+ 1.5 -0.05b = 3.75

Then make b the subject of the formula we have

0.45b = 2.25

b= 2.25/0.45

b = 5 ml

Therefore, 5ml of 50% syrup solution will be used to create the final solution

classify what type of number is 8/2

Answers

Answer:

unsimplified improper fraction

Step-by-step explanation:

8/2 could be simplified into 4 and its an improper fraction bc proper fraction form is 4/1 or just 4

Helpppppppppppppppppppppppp im not smart pls don't just say some bull i need help ill just get it deleted

Answers

Answer:

a. 6m

b. m-2

c. 5(m-2)

d. 6m +5m -10= 56

E. 11m=66

divide by 6: m=6

Maple Granola= 6$

Apple Granola= 4$

what is 1680 mm in feet

Answers

5.51181102 feet (5 feet 6 9⁄64 inches)

find the third term of the geometric sequence when a1 = 1/4 and r=-2

Answers

Answer:

1

Step-by-step explanation:

(-2)(1/4)=-1/2

(-2)(-1/2)

=1

the third term of the geometric sequence with first term = 1/4 and common ratio r = -2 is 1

We have a geometric sequence in which the first term is [tex]\frac{1}{4}[/tex] and the common ratio is -2.

We have to find the third term of this geometric sequence.

What is the formula to find the [tex]n^{th}[/tex] term of a geometric sequence?

The formula to find the [tex]n^{th}[/tex] term of a geometric sequence with first term [tex]a_{1}[/tex] and common ratio r is -

[tex]a_{n} =a_{1} r^{n-1}[/tex]

In our question, [tex]a_{1}[/tex] = [tex]\frac{1}{4}[/tex]  and r = -2 and n =3.

Substituting the values, we get -

[tex]a_{3} =\frac{1}{4}(-2)^{3-1} = \frac{1}{4} (-2)^{2} =\frac{1}{4}\times4=1[/tex]

Hence, the third term of the geometric sequence with first term = 1/4 and common ratio r = -2 is 1.

To solve questions on geometric sequences, visit the link below -

https://brainly.com/question/4069689

#SPJ5

Simplify: (-2)(-3)+(4)(-8)

Simplify: (3)(-6)-18​

Answers

Answer:

4

Step-by-step explanation:

Answer:

-26, and -36

Step-by-step explanation:

(-2) (-3) + (4) (-8)

        6 + -32 = -26

(3) (-6) - 18

       -18 + -18 = -36

IT IS FOR NOW IM GIVING BRAINLIEST HRRY UP AND 10 POINTS Simplify the expression. What classification describes the resulting polynomial? (8x2 + 3x) − (12x2 − 1) A. linear binomial B. quadratic binomial C. quadratic trinomial D. linear monomial

Answers

Answer:

The equation would be a quadratic trinomial

Step-by-step explanation:

Step 1: Expand the equation to remove the brackets

0 = 8x² + 3x - 12x² + 1

Step 2: Collect like terms

0 = -4x² + 3x + 1

Step 3: Count number of terms

0 = -4x² + 3x + 1

1 2 3

Therefore there are 3 terms and this is a quadratic equation making the answer B, a quadratic trinomial

PLEASE HELP!!! What is factoring? Why is it useful to try to factor out the GCF first when factoring? Explain the relationship between factoring and multiplying polynomials. Give an example to help explain. Factor x^2-25, 3x^2-12x-15, and x^3+2x^2+3x+6 . What are the key features needed to graph a polynomial function? Explain how to find these key features to sketch a rough graph of a polynomial function. Why would someone want to factor a polynomial? Provide real world examples of different questions we can answer or facts we can determine from factoring a polynomial.

Answers

Answer:

What is factoring?

Factoring is finding what to multiply to find an expression. It is like splitting expression into a multiplication of simplified expression.

Why is it useful to try to factor out the GCF first when factoring?

Greatest common factor or GCF of two numbers is the largest number that divides evenly in both numbers, GCF works the same in polynomials, which divide the expression evenly .

Explain the relationship between factoring and multiplying polynomials. Give an example to help explain

Factoring take away the multiplication, to factorize a polynomial it means take apart what  is multiplied. the best example is a²+b²+2ab ( multiplied)

factorize :(a+b)(a+b)   take apart what is multiplied

Factor x^2-25, 3x^2-12x-15, and x^3+2x^2+3x+6

x²-25  =(x+5)(x-5)

3x²-12x-15 = 3(x²-4x-5)  GCF=3

3(x-5)(x+1)

x³+2x²+3x+6  (x+2) common factor

(x+2)(x²+3)

What are the key features needed to graph a polynomial function?

the key features are the vertex, axis of symmetry, x and y intercept

Explain how to find these key features to sketch a rough graph of a polynomial function

parabola : y=ax²+bx+c

ex: 3x²-12x-15

find vertex (h,k)

h=-b/2a =-(-12)/2(3)=2

k=f(h)=f(2)=3(2)²-12(2)-15

k=12-24-15=-27

vertex=(2,-27)

x intercept is when the graph =0 (y=0)

y intercept when x=0 then y= the constant c and where the graph cross the y axis

axis of symmetry is the x of the vertex: is a line about which a parabola is symmetrical and vertical when the axis of symmetric is vertical.

Why would someone want to factor a polynomial? Provide real world examples of different questions we can answer or facts we can determine from factoring a polynomial.

factor a polynomial helps us understand more about equations,factoring helps us rewrite the polynomial into simpler expression.

example from real life:

A homeowner has a back yard and wants to turn it to garden beds so he can plant his vegetables, he wants to fill it with dirt he needs 240 cubic feet to fill it  the length is 4 feet than the width , and the height is 4

solve:

length=W+4

height=1/3 w

V=length* width* height

240=(w+4)(w)(4)

351= 4w²+16w

4w²+16w-240=0

take 4 as common factor

4(w²+4w-60)

now factorize:

4(w-6)(w+10)=0

The parentheses are around 270-54, the value is _______. When the parentheses are around 54÷9, the value is _______.

What is the answer? I'm having trouble with GoMath! I can't seem to figure it out.​

Answers

Answer:

Im pretty sure they stay the same. But that might just be me

They are the same!! Im not sure thi
Other Questions
Pens cost 15 pence each. Rulers cost 20 pence each. Write down an expression for the cost of x pens and x rulers. Work out the mean for the data set below: 3, 5, 4, 3, 5, 6 Give your answer as a fraction. answer Name the following compound from the concise formula:______. CH3CH(CH3)CHCHCH(CH3)CH2CH3 A. 2,4-dimethyl-3-heptene B. 2,5-dimethyl-3-heptene C. 3,5-dimethyl-3-heptene D. 2,5-dimethyl-4-heptene You are planning to use a tile design in your new room. The tiles are equilateral triangles. You decide to arrange the tiles in a hexagonal shape as shown. If the side of each tile measures 11 cm, what will be the exact area of each hexagonal shape? A. 3,993 cm^2 B. 181.5 root 3 cm^2 C. 132 root 3 cm^2 D. 33 cm^2 Midpoint City operates its own municipal public drinking water system for which the Environmental Protection Agency has set maximum levels of pollutants. The city does not use any equipment to meet these standards. With regard to any contamination of the water, under the Safe Drinking Water Act, this is most likely What name did the pro slavery rebel states take on when they broke from the United States? A. Dixie B. The Mason-Dixie line C. The Confederate States of America D. The Rebel States of America Which of the following best describes Chinas status during the 1980s? The core belief in this movement promotes an ideal spiritual state that 'transcends' the physical and empirical and is only realized through the individual's intuition, rather than through the doctrines of established religions. It placed individualism at a high level. a. Abolitionist movement.b. Domesticity movement.c. Transcendentalist movement.d. Temperance movement. Create a class called Date that includes three pieces of information as data members -- a month (type int), a day (type int) and a year (type int). Your class should have a constructor with three parameters that uses the parameters to initialize the three data members. For the purpose of this exercise, assume that the values provided for the year and day are correct, but ensure that the month value is in the range 1-12; if it isn't, set the month to 1. Provide a set and a get function for each data member. Provide a member function displayDate that displays the month, day and year separated by forward slashes (/). plz plzzz helpp meelook photoplz help asapi will give brainliest a shopkeeper sells a pant at 10% profit, if he would have sold it at rs.150 more than profit would have been 15% find the purchased price of the pant prove sin^2 /6 + cos^2 /3 - tan^2 /4 = -1/2 PLEASE HELP 4/9w = -8Show your work in details if you can, I have a hard time understanding this. How to define a medium of an artifact? i love old cottages/ the old cottagevillages/ the villages are usually quieter than towns/ the town In your own words tell how you can use the number line to add and subtract integers. Given the balanced chemical equation for the decomposition for INO, and the rate of disappearance of INO, write the expressions for the rates of appearance of I2 and NO.2INO(g) I2(g) + 2NO(g)Reactant: Product(I2): Product(NO): -[INO]/2t = ??/?? how many are 4 raised to 2 ??? 56. Name three supranational organizations where the Russian Federation is a member. Which is most challenging for developing countries?